/*!********************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./src/styles.css ***!
  \********************************************************************************************************************************************************************************************************/
:root {
  --iq-primary: #DBF6F0;
  --iq-secondary: #AAB0E4;
  --iq-success: #b6e2c8;
  --iq-info: #AEDBF4;
  --iq-warning: #ECDDB6;
  --iq-danger: #edb5ab;
  --iq-light: #F6F8FB;
  --iq-dark: rgba(199, 203, 211, 0.1);
  --iq-orange: #AAB0E4;
  --iq-purple: #cbc0ff;
  --iq-skyblue: #aad7ff;
  --iq-white: #fff;
  --iq-primary: rgba(71, 136, 255, 0.1);
  --iq-secondary: rgba(108, 117, 125, 0.1);
  --iq-success: rgba(55, 230, 178, 0.1);
  --iq-info: rgba(135, 108, 254, 0.1);
  --iq-warning: rgba(254, 114, 28, 0.1);
  --iq-danger: rgba(255, 75, 75, 0.1);
  --iq-light: rgba(199, 203, 211, 0.1);
  --iq-dark: rgba(1, 4, 27, 0.1);
  --iq-orange: rgba(253, 126, 20, 0.1);
  --iq-purple: rgba(71, 49, 182, 0.1); }

:root {
  --blue: #47B4AC;
  --indigo: #6610f2;
  --purple: #4731b6;
  --pink: #e83e8c;
  --red: #D75842;
  --orange: #323C9C;
  --yellow: #CCA43B;
  --green: #47B473;
  --teal: #20c997;
  --cyan: #1B98E0;
  --white: #fff;
  --gray: #6c757d;
  --gray-dark: #01041b;
  --skyblue: #158df7;
  --primary: #47B4AC;
  --secondary: #323C9C;
  --success: #47B473;
  --info: #1B98E0;
  --warning: #CCA43B;
  --danger: #D75842;
  --light: #F6F8FB;
  --dark: #01041b;
  --orange: #323C9C;
  --purple: #4731b6;
  --skyblue: #158df7;
  --light-gray: #f4f5fa;
  --white: #fff;
  --breakpoint-xs: 0;
  --breakpoint-sm: 576px;
  --breakpoint-md: 768px;
  --breakpoint-lg: 992px;
  --breakpoint-xl: 1200px;
  --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; }

*,
*::before,
*::after {
  box-sizing: border-box; }

html {
  font-family: sans-serif;
  line-height: 1.15;
  -webkit-text-size-adjust: 100%;
  -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }

article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
  display: block; }

body {
  margin: 0;
  font-family: "Open Sans", sans-serif;
  font-size: 0.875rem;
  font-weight: 400;
  line-height: 1.5;
  color: #737B8E;
  text-align: left;
  background-color: #ffffff; }

[tabindex="-1"]:focus:not(:focus-visible) {
  outline: 0 !important; }

hr {
  box-sizing: content-box;
  height: 0;
  overflow: visible; }

h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: 0.625rem; }

p {
  margin-top: 0;
  margin-bottom: 1rem; }

abbr[title],
abbr[data-original-title] {
  text-decoration: underline;
  -webkit-text-decoration: underline dotted;
          text-decoration: underline dotted;
  cursor: help;
  border-bottom: 0;
  -webkit-text-decoration-skip-ink: none;
          text-decoration-skip-ink: none; }

#swal2-validation-message {
  width: 100% !important;
  margin: 5px auto !important;
}

.swal2-input {
	margin:10px 0px 40px !important;
}

.swal2-actions {
  width: 100%;
  background-color: #47B4AC;
  padding: 0px;
  margin: 0px;
  display: block;
  position: absolute;
  bottom: -20px;
}

address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit; }

ol,
ul,
dl {
  margin-top: 0;
  margin-bottom: 1rem; }

ol ol,
ul ul,
ol ul,
ul ol {
  margin-bottom: 0; }

dt {
  font-weight: 700; }

dd {
  margin-bottom: .5rem;
  margin-left: 0; }

blockquote {
  margin: 0 0 1rem; }

b,
strong {
  font-weight: bolder; }

small {
  font-size: 80%; }

sub,
sup {
  position: relative;
  font-size: 75%;
  line-height: 0;
  vertical-align: baseline; }

sub {
  bottom: -.25em; }

sup {
  top: -.5em; }

pre,
code,
kbd,
samp {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
  font-size: 1em; }

pre {
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  -ms-overflow-style: scrollbar; }

figure {
  margin: 0 0 1rem; }

img {
  vertical-align: middle;
  border-style: none; }

svg {
  overflow: hidden;
  vertical-align: middle; }

table {
  border-collapse: collapse; }

caption {
  padding-top: 0.75rem;
  padding-bottom: 0.75rem;
  color: #6c757d;
  text-align: left;
  caption-side: bottom; }

th {
  text-align: inherit; }

label {
  display: inline-block;
  margin-bottom: 0.5rem; }

button {
  border-radius: 0; }

button:focus {
  outline: 1px dotted;
  outline: 5px auto -webkit-focus-ring-color; }

input,
button,
select,
optgroup,
textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit; }

button,
input {
  overflow: visible; }

button,
select {
  text-transform: none; }

[role="button"] {
  cursor: pointer; }

select {
  word-wrap: normal; }

button,
[type="button"],
[type="reset"],
[type="submit"] {
  -webkit-appearance: button; }

button:not(:disabled),
[type="button"]:not(:disabled),
[type="reset"]:not(:disabled),
[type="submit"]:not(:disabled) {
  cursor: pointer; }

button::-moz-focus-inner,
[type="button"]::-moz-focus-inner,
[type="reset"]::-moz-focus-inner,
[type="submit"]::-moz-focus-inner {
  padding: 0;
  border-style: none; }

input[type="radio"],
input[type="checkbox"] {
  box-sizing: border-box;
  padding: 0; }

textarea {
  overflow: auto;
  resize: vertical; }

fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0; }

legend {
  display: block;
  width: 100%;
  max-width: 100%;
  padding: 0;
  margin-bottom: .5rem;
  font-size: 1.5rem;
  line-height: inherit;
  color: inherit;
  white-space: normal; }

@media (max-width: 1200px) {
    legend {
      font-size: calc(1.275rem + 0.3vw) ; } }

progress {
  vertical-align: baseline; }

[type="number"]::-webkit-inner-spin-button,
[type="number"]::-webkit-outer-spin-button {
  height: auto; }

[type="search"] {
  outline-offset: -2px;
  -webkit-appearance: none; }

[type="search"]::-webkit-search-decoration {
  -webkit-appearance: none; }

::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button; }

output {
  display: inline-block; }

summary {
  display: list-item;
  cursor: pointer; }

template {
  display: none; }

[hidden] {
  display: none !important; }

h1, h2, h3, h4, h5, h6,
.h1, .h2, .h3, .h4, .h5, .h6 {
  margin-bottom: 0.625rem;
  font-weight: 500;
  line-height: 1.2; }

h1, .h1 {
  font-size: 3.052rem; }

@media (max-width: 1200px) {
    h1, .h1 {
      font-size: calc(1.4302rem + 2.1624vw) ; } }

h2, .h2 {
  font-size: 2.441rem; }

@media (max-width: 1200px) {
    h2, .h2 {
      font-size: calc(1.3691rem + 1.4292vw) ; } }

h3, .h3 {
  font-size: 1.953rem; }

@media (max-width: 1200px) {
    h3, .h3 {
      font-size: calc(1.3203rem + 0.8436vw) ; } }

h4, .h4 {
  font-size: 1.563rem; }

@media (max-width: 1200px) {
    h4, .h4 {
      font-size: calc(1.2813rem + 0.3756vw) ; } }

h5, .h5 {
  font-size: 1.25rem; }

h6, .h6 {
  font-size: 1rem; }

.lead {
  font-size: 1.09375rem;
  font-weight: 300; }

.display-1 {
  font-size: 6rem;
  font-weight: 300;
  line-height: 1.2; }

@media (max-width: 1200px) {
    .display-1 {
      font-size: calc(1.725rem + 5.7vw) ; } }

.display-2 {
  font-size: 5.5rem;
  font-weight: 300;
  line-height: 1.2; }

@media (max-width: 1200px) {
    .display-2 {
      font-size: calc(1.675rem + 5.1vw) ; } }

.display-3 {
  font-size: 4.5rem;
  font-weight: 300;
  line-height: 1.2; }

@media (max-width: 1200px) {
    .display-3 {
      font-size: calc(1.575rem + 3.9vw) ; } }

.display-4 {
  font-size: 3.5rem;
  font-weight: 300;
  line-height: 1.2; }

@media (max-width: 1200px) {
    .display-4 {
      font-size: calc(1.475rem + 2.7vw) ; } }

hr {
  margin-top: 1.25rem;
  margin-bottom: 1.25rem;
  border: 0;
  border-top: 1px solid rgba(0, 0, 0, 0.1); }

small,
.small {
  font-size: 80%;
  font-weight: 400; }

mark,
.mark {
  padding: 0.2em;
  background-color: #fcf8e3; }

.list-unstyled {
  padding-left: 0;
  list-style: none; }

.with-margin {
  display: contents;
  word-break: break-all;
}

textarea::placeholder {
	line-height:20px;
}

.er_ashish {
  color: red;
}

.ashish_my_note { 
background-color: #FFF8C4;
border-left: 4px solid #ffa503;
margin: 10px 0px;
padding: 10px 12px;
width: fit-content;
font-weight: 600;
}

.ashish_my_note p{
	margin:0px;
	padding:0px;
	color: #000;
font-size: 15px;

}

.Forgot_Password {
	text-align:left;}

pre .ashish_ore {
  color: #F75D14;
}

.ashish_my_note1 { 
background-color: #FFF8C4;
border-left: 4px solid #ffa503;
margin: 10px 0px;
padding: 10px 12px;
width: fit-content;
font-weight: 600;
}

.ashish_my_note1 p{
	margin:0px;
	padding:0px;
	color: #000;
font-size: 15px;

}

.list-inline {
  padding-left: 0;
  list-style: none; }

.dropdown-item i {
    font-size: 18px;
}

.floating-label select option {
  background-color: #fff !important;
  color: #000 !important;
  padding: 10px 10px;
  line-height: 1.5;
}

.NgxEditor__Wrapper svg {
  color: #333 !important;
}

.NgxEditor__Dropdown .NgxEditor__Dropdown--Text {
  background-color: #333 !important;
  color:#fff !important;
}

.NgxEditor__Dropdown .NgxEditor__Dropdown--Item {
  background-color: #333 !important;
  color:#fff !important;
}

.NgxEditor__Wrapper {
background-color: #fff !important;
}

.list-inline-item {
  display: inline-block; }

.list-inline-item:not(:last-child) {
    margin-right: 0.5rem; }

.initialism {
  font-size: 90%;
  text-transform: uppercase; }

.blockquote {
  margin-bottom: 1.25rem;
  font-size: 1.09375rem; }

.blockquote-footer {
  display: block;
  font-size: 80%;
  color: #6c757d; }

.blockquote-footer::before {
    content: "\2014\00A0"; }

.img-fluid {
  max-width: 100%;
  height: auto; }

.img-thumbnail {
  padding: 0.25rem;
  background-color: #ffffff;
  border: 1px solid #ccced2;
  border-radius: 10px 10px 0 10px;
  box-shadow: 0 1px 2px rgba(0, 0, 0, 0.075);
  max-width: 100%;
  height: auto; }

.figure {
  display: inline-block; }

.figure-img {
  margin-bottom: 0.625rem;
  line-height: 1; }

.figure-caption {
  font-size: 90%;
  color: #6c757d; }

code {
  font-size: 87.5%;
  color: #e83e8c;
  word-wrap: break-word; }

a > code {
    color: inherit; }

kbd {
  padding: 0.2rem 0.4rem;
  font-size: 87.5%;
  color: #fff;
  background-color: #212529;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 -0.1rem 0 rgba(0, 0, 0, 0.25); }

kbd kbd {
    padding: 0;
    font-size: 100%;
    font-weight: 700;
    box-shadow: none; }

pre {
  display: block;
  font-size: 87.5%;
  color: #212529; }

pre code {
    font-size: inherit;
    color: inherit;
    word-break: normal; }

.pre-scrollable {
  max-height: 340px;
  overflow-y: scroll; }

/*.err_my{
  position: absolute;
  bottom: 43px;
}
.er_ashish{
  position: relative;
  top: 0px;
  font-size: 14px;
  margin: 0px;
  padding: 0px;
  color: red;
}
*/

.container {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto; }

@media (min-width: 576px) {
    .container {
      max-width: 540px; } }

@media (min-width: 768px) {
    .container {
      max-width: 720px; } }

@media (min-width: 992px) {
    .container {
      max-width: 960px; } }

@media (min-width: 1200px) {
    .container {
      max-width: 1140px; } }

.container-fluid, .container-sm, .container-md, .container-lg, .container-xl {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto; }

@media (min-width: 576px) {
  .container, .container-sm {
    max-width: 540px; } }

@media (min-width: 768px) {
  .container, .container-sm, .container-md {
    max-width: 720px; } }

@media (min-width: 992px) {
  .container, .container-sm, .container-md, .container-lg {
    max-width: 960px; } }

@media (min-width: 1200px) {
  .container, .container-sm, .container-md, .container-lg, .container-xl {
    max-width: 1140px; } }

.row {
  display: flex;
  flex-wrap: wrap;
  margin-right: -15px;
  margin-left: -15px; }

.no-gutters {
  margin-right: 0;
  margin-left: 0; }

.no-gutters > .col,
  .no-gutters > [class*="col-"] {
    padding-right: 0;
    padding-left: 0; }

.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
.col-xl-auto {
  position: relative;
  width: 100%;
  padding-right: 15px;
  padding-left: 15px; }

.col {
  flex-basis: 0;
  flex-grow: 1;
  min-width: 0;
  max-width: 100%; }

.row-cols-1 > * {
  flex: 0 0 100%;
  max-width: 100%; }

.row-cols-2 > * {
  flex: 0 0 50%;
  max-width: 50%; }

.row-cols-3 > * {
  flex: 0 0 33.33333%;
  max-width: 33.33333%; }

.row-cols-4 > * {
  flex: 0 0 25%;
  max-width: 25%; }

.row-cols-5 > * {
  flex: 0 0 20%;
  max-width: 20%; }

.row-cols-6 > * {
  flex: 0 0 16.66667%;
  max-width: 16.66667%; }

.col-auto {
  flex: 0 0 auto;
  width: auto;
  max-width: 100%; }

.col-1 {
  flex: 0 0 8.33333%;
  max-width: 8.33333%; }

.col-2 {
  flex: 0 0 16.66667%;
  max-width: 16.66667%; }

.col-3 {
  flex: 0 0 25%;
  max-width: 25%; }

.col-4 {
  flex: 0 0 33.33333%;
  max-width: 33.33333%; }

.col-5 {
  flex: 0 0 41.66667%;
  max-width: 41.66667%; }

.col-6 {
  flex: 0 0 50%;
  max-width: 50%; }

.col-7 {
  flex: 0 0 58.33333%;
  max-width: 58.33333%; }

.col-8 {
  flex: 0 0 66.66667%;
  max-width: 66.66667%; }

.col-9 {
  flex: 0 0 75%;
  max-width: 75%; }

.col-10 {
  flex: 0 0 83.33333%;
  max-width: 83.33333%; }

.col-11 {
  flex: 0 0 91.66667%;
  max-width: 91.66667%; }

.col-12 {
  flex: 0 0 100%;
  max-width: 100%; }

.order-first {
  order: -1; }

.order-last {
  order: 13; }

.order-0 {
  order: 0; }

.order-1 {
  order: 1; }

.order-2 {
  order: 2; }

.order-3 {
  order: 3; }

.order-4 {
  order: 4; }

.order-5 {
  order: 5; }

.order-6 {
  order: 6; }

.order-7 {
  order: 7; }

.order-8 {
  order: 8; }

.order-9 {
  order: 9; }

.order-10 {
  order: 10; }

.order-11 {
  order: 11; }

.order-12 {
  order: 12; }

.offset-1 {
  margin-left: 8.33333%; }

.offset-2 {
  margin-left: 16.66667%; }

.offset-3 {
  margin-left: 25%; }

.offset-4 {
  margin-left: 33.33333%; }

.offset-5 {
  margin-left: 41.66667%; }

.offset-6 {
  margin-left: 50%; }

.offset-7 {
  margin-left: 58.33333%; }

.offset-8 {
  margin-left: 66.66667%; }

.offset-9 {
  margin-left: 75%; }

.offset-10 {
  margin-left: 83.33333%; }

.offset-11 {
  margin-left: 91.66667%; }

@media (min-width: 576px) {
  .col-sm {
    flex-basis: 0;
    flex-grow: 1;
    min-width: 0;
    max-width: 100%; }
  .row-cols-sm-1 > * {
    flex: 0 0 100%;
    max-width: 100%; }
  .row-cols-sm-2 > * {
    flex: 0 0 50%;
    max-width: 50%; }
  .row-cols-sm-3 > * {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .row-cols-sm-4 > * {
    flex: 0 0 25%;
    max-width: 25%; }
  .row-cols-sm-5 > * {
    flex: 0 0 20%;
    max-width: 20%; }
  .row-cols-sm-6 > * {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-sm-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%; }
  .col-sm-1 {
    flex: 0 0 8.33333%;
    max-width: 8.33333%; }
  .col-sm-2 {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-sm-3 {
    flex: 0 0 25%;
    max-width: 25%; }
  .col-sm-4 {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .col-sm-5 {
    flex: 0 0 41.66667%;
    max-width: 41.66667%; }
  .col-sm-6 {
    flex: 0 0 50%;
    max-width: 50%; }
  .col-sm-7 {
    flex: 0 0 58.33333%;
    max-width: 58.33333%; }
  .col-sm-8 {
    flex: 0 0 66.66667%;
    max-width: 66.66667%; }
  .col-sm-9 {
    flex: 0 0 75%;
    max-width: 75%; }
  .col-sm-10 {
    flex: 0 0 83.33333%;
    max-width: 83.33333%; }
  .col-sm-11 {
    flex: 0 0 91.66667%;
    max-width: 91.66667%; }
  .col-sm-12 {
    flex: 0 0 100%;
    max-width: 100%; }
  .order-sm-first {
    order: -1; }
  .order-sm-last {
    order: 13; }
  .order-sm-0 {
    order: 0; }
  .order-sm-1 {
    order: 1; }
  .order-sm-2 {
    order: 2; }
  .order-sm-3 {
    order: 3; }
  .order-sm-4 {
    order: 4; }
  .order-sm-5 {
    order: 5; }
  .order-sm-6 {
    order: 6; }
  .order-sm-7 {
    order: 7; }
  .order-sm-8 {
    order: 8; }
  .order-sm-9 {
    order: 9; }
  .order-sm-10 {
    order: 10; }
  .order-sm-11 {
    order: 11; }
  .order-sm-12 {
    order: 12; }
  .offset-sm-0 {
    margin-left: 0; }
  .offset-sm-1 {
    margin-left: 8.33333%; }
  .offset-sm-2 {
    margin-left: 16.66667%; }
  .offset-sm-3 {
    margin-left: 25%; }
  .offset-sm-4 {
    margin-left: 33.33333%; }
  .offset-sm-5 {
    margin-left: 41.66667%; }
  .offset-sm-6 {
    margin-left: 50%; }
  .offset-sm-7 {
    margin-left: 58.33333%; }
  .offset-sm-8 {
    margin-left: 66.66667%; }
  .offset-sm-9 {
    margin-left: 75%; }
  .offset-sm-10 {
    margin-left: 83.33333%; }
  .offset-sm-11 {
    margin-left: 91.66667%; } }

@media (min-width: 768px) {
  .col-md {
    flex-basis: 0;
    flex-grow: 1;
    min-width: 0;
    max-width: 100%; }
  .row-cols-md-1 > * {
    flex: 0 0 100%;
    max-width: 100%; }
  .row-cols-md-2 > * {
    flex: 0 0 50%;
    max-width: 50%; }
  .row-cols-md-3 > * {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .row-cols-md-4 > * {
    flex: 0 0 25%;
    max-width: 25%; }
  .row-cols-md-5 > * {
    flex: 0 0 20%;
    max-width: 20%; }
  .row-cols-md-6 > * {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-md-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%; }
  .col-md-1 {
    flex: 0 0 8.33333%;
    max-width: 8.33333%; }
  .col-md-2 {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-md-3 {
    flex: 0 0 25%;
    max-width: 25%; }
  .col-md-4 {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .col-md-5 {
    flex: 0 0 41.66667%;
    max-width: 41.66667%; }
  .col-md-6 {
    flex: 0 0 50%;
    max-width: 50%; }
  .col-md-7 {
    flex: 0 0 58.33333%;
    max-width: 58.33333%; }
  .col-md-8 {
    flex: 0 0 66.66667%;
    max-width: 66.66667%; }
  .col-md-9 {
    flex: 0 0 75%;
    max-width: 75%; }
  .col-md-10 {
    flex: 0 0 83.33333%;
    max-width: 83.33333%; }
  .col-md-11 {
    flex: 0 0 91.66667%;
    max-width: 91.66667%; }
  .col-md-12 {
    flex: 0 0 100%;
    max-width: 100%; }
  .order-md-first {
    order: -1; }
  .order-md-last {
    order: 13; }
  .order-md-0 {
    order: 0; }
  .order-md-1 {
    order: 1; }
  .order-md-2 {
    order: 2; }
  .order-md-3 {
    order: 3; }
  .order-md-4 {
    order: 4; }
  .order-md-5 {
    order: 5; }
  .order-md-6 {
    order: 6; }
  .order-md-7 {
    order: 7; }
  .order-md-8 {
    order: 8; }
  .order-md-9 {
    order: 9; }
  .order-md-10 {
    order: 10; }
  .order-md-11 {
    order: 11; }
  .order-md-12 {
    order: 12; }
  .offset-md-0 {
    margin-left: 0; }
  .offset-md-1 {
    margin-left: 8.33333%; }
  .offset-md-2 {
    margin-left: 16.66667%; }
  .offset-md-3 {
    margin-left: 25%; }
  .offset-md-4 {
    margin-left: 33.33333%; }
  .offset-md-5 {
    margin-left: 41.66667%; }
  .offset-md-6 {
    margin-left: 50%; }
  .offset-md-7 {
    margin-left: 58.33333%; }
  .offset-md-8 {
    margin-left: 66.66667%; }
  .offset-md-9 {
    margin-left: 75%; }
  .offset-md-10 {
    margin-left: 83.33333%; }
  .offset-md-11 {
    margin-left: 91.66667%; } }

@media (min-width: 992px) {
  .col-lg {
    flex-basis: 0;
    flex-grow: 1;
    min-width: 0;
    max-width: 100%; }
  .row-cols-lg-1 > * {
    flex: 0 0 100%;
    max-width: 100%; }
  .row-cols-lg-2 > * {
    flex: 0 0 50%;
    max-width: 50%; }
  .row-cols-lg-3 > * {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .row-cols-lg-4 > * {
    flex: 0 0 25%;
    max-width: 25%; }
  .row-cols-lg-5 > * {
    flex: 0 0 20%;
    max-width: 20%; }
  .row-cols-lg-6 > * {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-lg-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%; }
  .col-lg-1 {
    flex: 0 0 8.33333%;
    max-width: 8.33333%; }
  .col-lg-2 {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-lg-3 {
    flex: 0 0 25%;
    max-width: 25%; }
  .col-lg-4 {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .col-lg-5 {
    flex: 0 0 41.66667%;
    max-width: 41.66667%; }
  .col-lg-6 {
    flex: 0 0 50%;
    max-width: 50%; }
  .col-lg-7 {
    flex: 0 0 58.33333%;
    max-width: 58.33333%; }
  .col-lg-8 {
    flex: 0 0 66.66667%;
    max-width: 66.66667%; }
  .col-lg-9 {
    flex: 0 0 75%;
    max-width: 75%; }
  .col-lg-10 {
    flex: 0 0 83.33333%;
    max-width: 83.33333%; }
  .col-lg-11 {
    flex: 0 0 91.66667%;
    max-width: 91.66667%; }
  .col-lg-12 {
    flex: 0 0 100%;
    max-width: 100%; }
  .order-lg-first {
    order: -1; }
  .order-lg-last {
    order: 13; }
  .order-lg-0 {
    order: 0; }
  .order-lg-1 {
    order: 1; }
  .order-lg-2 {
    order: 2; }
  .order-lg-3 {
    order: 3; }
  .order-lg-4 {
    order: 4; }
  .order-lg-5 {
    order: 5; }
  .order-lg-6 {
    order: 6; }
  .order-lg-7 {
    order: 7; }
  .order-lg-8 {
    order: 8; }
  .order-lg-9 {
    order: 9; }
  .order-lg-10 {
    order: 10; }
  .order-lg-11 {
    order: 11; }
  .order-lg-12 {
    order: 12; }
  .offset-lg-0 {
    margin-left: 0; }
  .offset-lg-1 {
    margin-left: 8.33333%; }
  .offset-lg-2 {
    margin-left: 16.66667%; }
  .offset-lg-3 {
    margin-left: 25%; }
  .offset-lg-4 {
    margin-left: 33.33333%; }
  .offset-lg-5 {
    margin-left: 41.66667%; }
  .offset-lg-6 {
    margin-left: 50%; }
  .offset-lg-7 {
    margin-left: 58.33333%; }
  .offset-lg-8 {
    margin-left: 66.66667%; }
  .offset-lg-9 {
    margin-left: 75%; }
  .offset-lg-10 {
    margin-left: 83.33333%; }
  .offset-lg-11 {
    margin-left: 91.66667%; } }

@media (min-width: 1200px) {
  .col-xl {
    flex-basis: 0;
    flex-grow: 1;
    min-width: 0;
    max-width: 100%; }
  .row-cols-xl-1 > * {
    flex: 0 0 100%;
    max-width: 100%; }
  .row-cols-xl-2 > * {
    flex: 0 0 50%;
    max-width: 50%; }
  .row-cols-xl-3 > * {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .row-cols-xl-4 > * {
    flex: 0 0 25%;
    max-width: 25%; }
  .row-cols-xl-5 > * {
    flex: 0 0 20%;
    max-width: 20%; }
  .row-cols-xl-6 > * {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-xl-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%; }
  .col-xl-1 {
    flex: 0 0 8.33333%;
    max-width: 8.33333%; }
  .col-xl-2 {
    flex: 0 0 16.66667%;
    max-width: 16.66667%; }
  .col-xl-3 {
    flex: 0 0 25%;
    max-width: 25%; }
  .col-xl-4 {
    flex: 0 0 33.33333%;
    max-width: 33.33333%; }
  .col-xl-5 {
    flex: 0 0 41.66667%;
    max-width: 41.66667%; }
  .col-xl-6 {
    flex: 0 0 50%;
    max-width: 50%; }
  .col-xl-7 {
    flex: 0 0 58.33333%;
    max-width: 58.33333%; }
  .col-xl-8 {
    flex: 0 0 66.66667%;
    max-width: 66.66667%; }
  .col-xl-9 {
    flex: 0 0 75%;
    max-width: 75%; }
  .col-xl-10 {
    flex: 0 0 83.33333%;
    max-width: 83.33333%; }
  .col-xl-11 {
    flex: 0 0 91.66667%;
    max-width: 91.66667%; }
  .col-xl-12 {
    flex: 0 0 100%;
    max-width: 100%; }
  .order-xl-first {
    order: -1; }
  .order-xl-last {
    order: 13; }
  .order-xl-0 {
    order: 0; }
  .order-xl-1 {
    order: 1; }
  .order-xl-2 {
    order: 2; }
  .order-xl-3 {
    order: 3; }
  .order-xl-4 {
    order: 4; }
  .order-xl-5 {
    order: 5; }
  .order-xl-6 {
    order: 6; }
  .order-xl-7 {
    order: 7; }
  .order-xl-8 {
    order: 8; }
  .order-xl-9 {
    order: 9; }
  .order-xl-10 {
    order: 10; }
  .order-xl-11 {
    order: 11; }
  .order-xl-12 {
    order: 12; }
  .offset-xl-0 {
    margin-left: 0; }
  .offset-xl-1 {
    margin-left: 8.33333%; }
  .offset-xl-2 {
    margin-left: 16.66667%; }
  .offset-xl-3 {
    margin-left: 25%; }
  .offset-xl-4 {
    margin-left: 33.33333%; }
  .offset-xl-5 {
    margin-left: 41.66667%; }
  .offset-xl-6 {
    margin-left: 50%; }
  .offset-xl-7 {
    margin-left: 58.33333%; }
  .offset-xl-8 {
    margin-left: 66.66667%; }
  .offset-xl-9 {
    margin-left: 75%; }
  .offset-xl-10 {
    margin-left: 83.33333%; }
  .offset-xl-11 {
    margin-left: 91.66667%; } }

.table {
  width: 100% !important;
  margin-bottom: 1.25rem !important;
  color: #737B8E !important; }

.table td {
    padding: 0.75rem !important;
    border-top: 1px solid #C2C6CF !important; }

.table thead th {
    vertical-align: bottom !important;
    border-bottom: 2px solid #C2C6CF !important; }

.table tbody + tbody {
    border-top: 2px solid #C2C6CF !important; }

.table-sm th,
.table-sm td {
  padding: 0.3rem; }

.table-bordered {
  border: 1px solid #C2C6CF; }

.table-bordered th,
  .table-bordered td {
    border: 1px solid #C2C6CF; }

.table-bordered thead th,
  .table-bordered thead td {
    border-bottom-width: 2px; }

.table-borderless th,
.table-borderless td,
.table-borderless thead th,
.table-borderless tbody + tbody {
  border: 0; }

.table-striped tbody tr:nth-of-type(odd) {
  background-color: rgba(0, 0, 0, 0.05); }

.table-hover tbody tr:hover {
  color: #737B8E;
  background-color: rgba(0, 0, 0, 0.075); }

.table-primary,
.table-primary > th,
.table-primary > td {
  background-color: #cbeae8; }

.table-primary th,
.table-primary td,
.table-primary thead th,
.table-primary tbody + tbody {
  border-color: #9fd8d4; }

.table-hover .table-primary:hover {
  background-color: #b9e3e0; }

.table-hover .table-primary:hover > td,
  .table-hover .table-primary:hover > th {
    background-color: #b9e3e0; }

.table-secondary,
.table-secondary > th,
.table-secondary > td {
  background-color: #c6c8e3; }

.table-secondary th,
.table-secondary td,
.table-secondary thead th,
.table-secondary tbody + tbody {
  border-color: #949acc; }

.table-hover .table-secondary:hover {
  background-color: #b5b8db; }

.table-hover .table-secondary:hover > td,
  .table-hover .table-secondary:hover > th {
    background-color: #b5b8db; }

.table-success,
.table-success > th,
.table-success > td {
  background-color: #cbead8; }

.table-success th,
.table-success td,
.table-success thead th,
.table-success tbody + tbody {
  border-color: #9fd8b6; }

.table-hover .table-success:hover {
  background-color: #b9e3ca; }

.table-hover .table-success:hover > td,
  .table-hover .table-success:hover > th {
    background-color: #b9e3ca; }

.table-info,
.table-info > th,
.table-info > td {
  background-color: #bfe2f6; }

.table-info th,
.table-info td,
.table-info thead th,
.table-info tbody + tbody {
  border-color: #88c9ef; }

.table-hover .table-info:hover {
  background-color: #a9d8f3; }

.table-hover .table-info:hover > td,
  .table-hover .table-info:hover > th {
    background-color: #a9d8f3; }

.table-warning,
.table-warning > th,
.table-warning > td {
  background-color: #f1e6c8; }

.table-warning th,
.table-warning td,
.table-warning thead th,
.table-warning tbody + tbody {
  border-color: #e4d099; }

.table-hover .table-warning:hover {
  background-color: #ecddb4; }

.table-hover .table-warning:hover > td,
  .table-hover .table-warning:hover > th {
    background-color: #ecddb4; }

.table-danger,
.table-danger > th,
.table-danger > td {
  background-color: #f4d0ca; }

.table-danger th,
.table-danger td,
.table-danger thead th,
.table-danger tbody + tbody {
  border-color: #eaa89d; }

.table-hover .table-danger:hover {
  background-color: #f0bdb5; }

.table-hover .table-danger:hover > td,
  .table-hover .table-danger:hover > th {
    background-color: #f0bdb5; }

.table-light,
.table-light > th,
.table-light > td {
  background-color: #fcfdfe; }

.table-light th,
.table-light td,
.table-light thead th,
.table-light tbody + tbody {
  border-color: #fafbfd; }

.table-hover .table-light:hover {
  background-color: #e9f0f8; }

.table-hover .table-light:hover > td,
  .table-hover .table-light:hover > th {
    background-color: #e9f0f8; }

.table-dark,
.table-dark > th,
.table-dark > td {
  background-color: #b8b9bf; }

.table-dark th,
.table-dark td,
.table-dark thead th,
.table-dark tbody + tbody {
  border-color: #7b7c88; }

.table-hover .table-dark:hover {
  background-color: #abacb3; }

.table-hover .table-dark:hover > td,
  .table-hover .table-dark:hover > th {
    background-color: #abacb3; }

.table-orange,
.table-orange > th,
.table-orange > td {
  background-color: #c6c8e3; }

.table-orange th,
.table-orange td,
.table-orange thead th,
.table-orange tbody + tbody {
  border-color: #949acc; }

.table-hover .table-orange:hover {
  background-color: #b5b8db; }

.table-hover .table-orange:hover > td,
  .table-hover .table-orange:hover > th {
    background-color: #b5b8db; }

.table-purple,
.table-purple > th,
.table-purple > td {
  background-color: #cbc5eb; }

.table-purple th,
.table-purple td,
.table-purple thead th,
.table-purple tbody + tbody {
  border-color: #9f94d9; }

.table-hover .table-purple:hover {
  background-color: #bab2e4; }

.table-hover .table-purple:hover > td,
  .table-hover .table-purple:hover > th {
    background-color: #bab2e4; }

.table-skyblue,
.table-skyblue > th,
.table-skyblue > td {
  background-color: #bddffd; }

.table-skyblue th,
.table-skyblue td,
.table-skyblue thead th,
.table-skyblue tbody + tbody {
  border-color: #85c4fb; }

.table-hover .table-skyblue:hover {
  background-color: #a4d3fc; }

.table-hover .table-skyblue:hover > td,
  .table-hover .table-skyblue:hover > th {
    background-color: #a4d3fc; }

.table-light-gray,
.table-light-gray > th,
.table-light-gray > td {
  background-color: #fcfcfe; }

.table-light-gray th,
.table-light-gray td,
.table-light-gray thead th,
.table-light-gray tbody + tbody {
  border-color: #f9fafc; }

.table-hover .table-light-gray:hover {
  background-color: #e9e9f8; }

.table-hover .table-light-gray:hover > td,
  .table-hover .table-light-gray:hover > th {
    background-color: #e9e9f8; }

.table-white,
.table-white > th,
.table-white > td {
  background-color: white; }

.table-white th,
.table-white td,
.table-white thead th,
.table-white tbody + tbody {
  border-color: white; }

.table-hover .table-white:hover {
  background-color: #f2f2f2; }

.table-hover .table-white:hover > td,
  .table-hover .table-white:hover > th {
    background-color: #f2f2f2; }

.table-active,
.table-active > th,
.table-active > td {
  background-color: rgba(0, 0, 0, 0.075); }

.table-hover .table-active:hover {
  background-color: rgba(0, 0, 0, 0.075); }

.table-hover .table-active:hover > td,
  .table-hover .table-active:hover > th {
    background-color: rgba(0, 0, 0, 0.075); }

.table .thead-dark th {
  color: #fff;
  background-color: #01041b;
  border-color: #020940; }

.table .thead-light th {
  color: #495057;
  background-color: #e9ecef;
  border-color: #C2C6CF; }

.table-dark {
  color: #fff;
  background-color: #01041b; }

.table-dark th,
  .table-dark td,
  .table-dark thead th {
    border-color: #020940; }

.table-dark.table-bordered {
    border: 0; }

.table-dark.table-striped tbody tr:nth-of-type(odd) {
    background-color: rgba(255, 255, 255, 0.05); }

.table-dark.table-hover tbody tr:hover {
    color: #fff;
    background-color: rgba(255, 255, 255, 0.075); }

@media (max-width: 575.98px) {
  .table-responsive-sm {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch; }
    .table-responsive-sm > .table-bordered {
      border: 0; } }

@media (max-width: 767.98px) {
  .table-responsive-md {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch; }
    .table-responsive-md > .table-bordered {
      border: 0; } }

@media (max-width: 991.98px) {
  .table-responsive-lg {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch; }
    .table-responsive-lg > .table-bordered {
      border: 0; } }

@media (max-width: 1199.98px) {
  .table-responsive-xl {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch; }
    .table-responsive-xl > .table-bordered {
      border: 0; } }

.table-responsive {
  display: block;
  width: 100%;
  -webkit-overflow-scrolling: touch; }

.table-responsive > .table-bordered {
    border: 0; }

.form-control {
  display: block;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  padding: 0.625rem 0.938rem;
  font-size: 0.875rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid #ced4da;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }

@media (prefers-reduced-motion: reduce) {
    .form-control {
      transition: none; } }

.form-control::-ms-expand {
    background-color: transparent;
    border: 0; }

.form-control:-moz-focusring {
    color: transparent;
    text-shadow: 0 0 0 #495057; }

.form-control:focus {
    color: #495057;
    background-color: #fff;
    border-color: #a1dad6;
    outline: 0;
    box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.form-control::placeholder {
    color: #6c757d;
    opacity: 1; }

.form-control:disabled, .form-control[readonly] {
    background-color: #e9ecef;
    opacity: 1; }

input[type="date"].form-control,
input[type="time"].form-control,
input[type="datetime-local"].form-control,
input[type="month"].form-control {
  appearance: none; }

select.form-control:focus::-ms-value {
  color: #495057;
  background-color: #fff; }

.form-control-file,
.form-control-range {
  display: block;
  width: 100%; }

.col-form-label {
  padding-top: calc(0.625rem + 1px);
  padding-bottom: calc(0.625rem + 1px);
  margin-bottom: 0;
  font-size: inherit;
  line-height: 1.5; }

.col-form-label-lg {
  padding-top: calc(0.938rem + 1px);
  padding-bottom: calc(0.938rem + 1px);
  font-size: 1.25rem;
  line-height: 1.5; }

.col-form-label-sm {
  padding-top: calc(0.313rem + 1px);
  padding-bottom: calc(0.313rem + 1px);
  font-size: 0.75rem;
  line-height: 1.5; }

.form-control-plaintext {
  display: block;
  width: 100%;
  padding: 0.625rem 0;
  margin-bottom: 0;
  font-size: 0.875rem;
  line-height: 1.5;
  color: #737B8E;
  background-color: transparent;
  border: solid transparent;
  border-width: 1px 0; }

.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
    padding-right: 0;
    padding-left: 0; }

.form-control-sm {
  height: calc(1.5em + 0.626rem + 2px);
  padding: 0.313rem 0.625rem;
  font-size: 0.75rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px; }

.form-control-lg {
  height: calc(1.5em + 1.876rem + 2px);
  padding: 0.938rem 1.25rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px; }

select.form-control[size], select.form-control[multiple] {
  height: auto; }

textarea.form-control {
  height: auto; }

.form-group {
  margin-bottom: 1rem; }

.form-text {
  display: block;
  margin-top: 0.25rem; }

.form-row {
  display: flex;
  flex-wrap: wrap;
  margin-right: -5px;
  margin-left: -5px; }

.form-row > .col,
  .form-row > [class*="col-"] {
    padding-right: 5px;
    padding-left: 5px; }

.form-check {
  position: relative;
  display: block;
  padding-left: 1.25rem; }

.form-check-input {
  position: absolute;
  margin-top: 0.3rem;
  margin-left: -1.25rem; }

.form-check-input[disabled] ~ .form-check-label,
  .form-check-input:disabled ~ .form-check-label {
    color: #6c757d; }

.form-check-label {
  margin-bottom: 0; }

.form-check-inline {
  display: inline-flex;
  align-items: center;
  padding-left: 0;
  margin-right: 0.75rem; }

.form-check-inline .form-check-input {
    position: static;
    margin-top: 0;
    margin-right: 0.3125rem;
    margin-left: 0; }

.valid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 80%;
  color: #47B473; }

.valid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: .1rem;
  font-size: 0.75rem;
  line-height: 1.5;
  color: #fff;
  background-color: rgba(71, 180, 115, 0.9);
  border-radius: 10px 10px 0 10px; }

.was-validated :valid ~ .valid-feedback,
.was-validated :valid ~ .valid-tooltip,
.is-valid ~ .valid-feedback,
.is-valid ~ .valid-tooltip {
  display: block; }

.was-validated .form-control:valid, .form-control.is-valid {
  border-color: #47B473;
  padding-right: calc(1.5em + 1.25rem);
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%2347B473' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(0.375em + 0.3125rem) center;
  background-size: calc(0.75em + 0.625rem) calc(0.75em + 0.625rem); }

.was-validated .form-control:valid:focus, .form-control.is-valid:focus {
    border-color: #47B473;
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 115, 0.25); }

.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
  padding-right: calc(1.5em + 1.25rem);
  background-position: top calc(0.375em + 0.3125rem) right calc(0.375em + 0.3125rem); }

.was-validated .custom-select:valid, .custom-select.is-valid {
  border-color: #47B473;
  padding-right: calc(0.75em + 2.8755rem);
  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2301041b' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.938rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%2347B473' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") #fff no-repeat center right 1.938rem/calc(0.75em + 0.625rem) calc(0.75em + 0.625rem); }

.was-validated .custom-select:valid:focus, .custom-select.is-valid:focus {
    border-color: #47B473;
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 115, 0.25); }

.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
  color: #47B473; }

.was-validated .form-check-input:valid ~ .valid-feedback,
.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback,
.form-check-input.is-valid ~ .valid-tooltip {
  display: block; }

.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label {
  color: #47B473; }

.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before {
    border-color: #47B473; }

.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before {
  border-color: #6ac48e;
  background-color: #6ac48e; }

.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 0.2rem rgba(71, 180, 115, 0.25); }

.was-validated .custom-control-input:valid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before {
  border-color: #47B473; }

.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label {
  border-color: #47B473; }

.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label {
  border-color: #47B473;
  box-shadow: 0 0 0 0.2rem rgba(71, 180, 115, 0.25); }

.invalid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 80%;
  color: #D75842; }

.invalid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: .1rem;
  font-size: 0.75rem;
  line-height: 1.5;
  color: #fff;
  background-color: rgba(215, 88, 66, 0.9);
  border-radius: 10px 10px 0 10px; }

.was-validated :invalid ~ .invalid-feedback,
.was-validated :invalid ~ .invalid-tooltip,
.is-invalid ~ .invalid-feedback,
.is-invalid ~ .invalid-tooltip {
  display: block; }

.was-validated .form-control:invalid, .form-control.is-invalid {
  border-color: #D75842;
  padding-right: calc(1.5em + 1.25rem);
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23D75842' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23D75842' stroke='none'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(0.375em + 0.3125rem) center;
  background-size: calc(0.75em + 0.625rem) calc(0.75em + 0.625rem); }

.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus {
    border-color: #D75842;
    box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.25); }

.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
  padding-right: calc(1.5em + 1.25rem);
  background-position: top calc(0.375em + 0.3125rem) right calc(0.375em + 0.3125rem); }

.was-validated .custom-select:invalid, .custom-select.is-invalid {
  border-color: #D75842;
  padding-right: calc(0.75em + 2.8755rem);
  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2301041b' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.938rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23D75842' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23D75842' stroke='none'/%3e%3c/svg%3e") #fff no-repeat center right 1.938rem/calc(0.75em + 0.625rem) calc(0.75em + 0.625rem); }

.was-validated .custom-select:invalid:focus, .custom-select.is-invalid:focus {
    border-color: #D75842;
    box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.25); }

.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
  color: #D75842; }

.was-validated .form-check-input:invalid ~ .invalid-feedback,
.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback,
.form-check-input.is-invalid ~ .invalid-tooltip {
  display: block; }

.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label {
  color: #D75842; }

.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before {
    border-color: #D75842; }

.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before {
  border-color: #e07d6c;
  background-color: #e07d6c; }

.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.25); }

.was-validated .custom-control-input:invalid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before {
  border-color: #D75842; }

.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label {
  border-color: #D75842; }

.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label {
  border-color: #D75842;
  box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.25); }

.form-inline {
  display: flex;
  flex-flow: row wrap;
  align-items: center; }

.form-inline .form-check {
    width: 100%; }

@media (min-width: 576px) {
    .form-inline label {
      display: flex;
      align-items: center;
      justify-content: center;
      margin-bottom: 0; }
    .form-inline .form-group {
      display: flex;
      flex: 0 0 auto;
      flex-flow: row wrap;
      align-items: center;
      margin-bottom: 0; }
    .form-inline .form-control {
      display: inline-block;
      width: auto;
      vertical-align: middle; }
    .form-inline .form-control-plaintext {
      display: inline-block; }
    .form-inline .input-group,
    .form-inline .custom-select {
      width: auto; }
    .form-inline .form-check {
      display: flex;
      align-items: center;
      justify-content: center;
      width: auto;
      padding-left: 0; }
    .form-inline .form-check-input {
      position: relative;
      flex-shrink: 0;
      margin-top: 0;
      margin-right: 0.25rem;
      margin-left: 0; }
    .form-inline .custom-control {
      align-items: center;
      justify-content: center; }
    .form-inline .custom-control-label {
      margin-bottom: 0; } }

.fade {
  transition: opacity 0.15s linear; }

@media (prefers-reduced-motion: reduce) {
    .fade {
      transition: none; } }

.fade:not(.show) {
    opacity: 0; }

.collapse:not(.show) {
  display: none; }

.collapsing {
  position: relative;
  height: 0;
  overflow: hidden;
  transition: height 0.35s ease; }

@media (prefers-reduced-motion: reduce) {
    .collapsing {
      transition: none; } }

.dropup,
.dropright,
.dropdown,
.dropleft {
  position: relative; }

.dropdown-toggle {
  white-space: nowrap; }

.dropdown-toggle::after {
    display: inline-block;
    margin-left: 0.255em;
    vertical-align: 0.255em;
    content: "";
    border-top: 0.3em solid;
    border-right: 0.3em solid transparent;
    border-bottom: 0;
    border-left: 0.3em solid transparent; }

.dropdown-toggle:empty::after {
    margin-left: 0; }

.dropdown-menu {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 1000;
  display: none;
  float: left;
  min-width: 10rem;
  padding: 0.5rem 0;
  margin: 0.125rem 0 0;
  font-size: 0.875rem;
  color: #737B8E;
  text-align: left;
  list-style: none;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.15);
  border-radius: 10px 10px 0 10px;
  box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.175); }

.dropdown-menu-left {
  right: auto;
  left: 0; }

.dropdown-menu-right {
  right: 0;
  left: auto; }

@media (min-width: 576px) {
  .dropdown-menu-sm-left {
    right: auto;
    left: 0; }
  .dropdown-menu-sm-right {
    right: 0;
    left: auto; } }

@media (min-width: 768px) {
  .dropdown-menu-md-left {
    right: auto;
    left: 0; }
  .dropdown-menu-md-right {
    right: 0;
    left: auto; } }

@media (min-width: 992px) {
  .dropdown-menu-lg-left {
    right: auto;
    left: 0; }
  .dropdown-menu-lg-right {
    right: 0;
    left: auto; } }

@media (min-width: 1200px) {
  .dropdown-menu-xl-left {
    right: auto;
    left: 0; }
  .dropdown-menu-xl-right {
    right: 0;
    left: auto; } }

.dropup .dropdown-menu {
  top: auto;
  bottom: 100%;
  margin-top: 0;
  margin-bottom: 0.125rem; }

.dropup .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0;
  border-right: 0.3em solid transparent;
  border-bottom: 0.3em solid;
  border-left: 0.3em solid transparent; }

.dropup .dropdown-toggle:empty::after {
  margin-left: 0; }

.dropright .dropdown-menu {
  top: 0;
  right: auto;
  left: 100%;
  margin-top: 0;
  margin-left: 0.125rem; }

.dropright .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0;
  border-bottom: 0.3em solid transparent;
  border-left: 0.3em solid; }

.dropright .dropdown-toggle:empty::after {
  margin-left: 0; }

.dropright .dropdown-toggle::after {
  vertical-align: 0; }

.dropleft .dropdown-menu {
  top: 0;
  right: 100%;
  left: auto;
  margin-top: 0;
  margin-right: 0.125rem; }

.dropleft .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: ""; }

.dropleft .dropdown-toggle::after {
  display: none; }

.dropleft .dropdown-toggle::before {
  display: inline-block;
  margin-right: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0.3em solid;
  border-bottom: 0.3em solid transparent; }

.dropleft .dropdown-toggle:empty::after {
  margin-left: 0; }

.dropleft .dropdown-toggle::before {
  vertical-align: 0; }

.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] {
  right: auto;
  bottom: auto; }

.dropdown-divider {
  height: 0;
  margin: 0.625rem 0;
  overflow: hidden;
  border-top: 1px solid #e9ecef; }

.dropdown-item {
  display: block;
  width: 100%;
  padding: 0.25rem 1.5rem;
  clear: both;
  font-weight: 400;
  color: #212529;
  text-align: inherit;
  white-space: nowrap;
  background-color: transparent;
  border: 0; }

.dropdown-item:hover, .dropdown-item:focus {
    color: #16181b;
    text-decoration: none;
    background-color: #f8f9fa; }

.dropdown-item.active, .dropdown-item:active {
    color: #fff;
    text-decoration: none;
    background-color: #47B4AC; }

.dropdown-item.disabled, .dropdown-item:disabled {
    color: #6c757d;
    pointer-events: none;
    background-color: transparent; }

.dropdown-menu.show {
  display: block; }

.dropdown-header {
  display: block;
  padding: 0.5rem 1.5rem;
  margin-bottom: 0;
  font-size: 0.75rem;
  color: #6c757d;
  white-space: nowrap; }

.dropdown-item-text {
  display: block;
  padding: 0.25rem 1.5rem;
  color: #212529; }

.btn-group,
.btn-group-vertical {
  position: relative;
  display: inline-flex;
  vertical-align: middle; }

.btn-group > .btn,
  .btn-group-vertical > .btn {
    position: relative;
    flex: 1 1 auto; }

.btn-group > .btn:hover,
    .btn-group-vertical > .btn:hover {
      z-index: 1; }

.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active,
    .btn-group-vertical > .btn:focus,
    .btn-group-vertical > .btn:active,
    .btn-group-vertical > .btn.active {
      z-index: 1; }

.btn-toolbar {
  display: flex !important; 
  flex-wrap: wrap !important; 
  justify-content: flex-start; }

.btn-toolbar .input-group {
    width: auto !important;  }

.btn-group > .btn:not(:first-child),
.btn-group > .btn-group:not(:first-child) {
  margin-left: -1px !important;  }

.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
.btn-group > .btn-group:not(:last-child) > .btn {
  border-top-right-radius: 0 !important;
  border-bottom-right-radius: 0 !important; }

.btn-group > .btn:not(:first-child),
.btn-group > .btn-group:not(:first-child) > .btn {
  border-top-left-radius: 0 !important; 
  border-bottom-left-radius: 0 !important;  }

.dropdown-toggle-split {
  padding-right: 0.7035rem !important; 
  padding-left: 0.7035rem !important;  }

.dropdown-toggle-split::after,
  .dropup .dropdown-toggle-split::after,
  .dropright .dropdown-toggle-split::after {
    margin-left: 0 !important;  }

.dropleft .dropdown-toggle-split::before {
    margin-right: 0 !important;  }

.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
  padding-right: 0.46875rem!important; 
  padding-left: 0.46875rem!important;  }

.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
  padding-right: 0.9375rem;
  padding-left: 0.9375rem; }

.btn-group.show .dropdown-toggle {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); }

.btn-group.show .dropdown-toggle.btn-link {
    box-shadow: none; }

.btn-group-vertical {
  flex-direction: column;
  align-items: flex-start;
  justify-content: center; }

.btn-group-vertical > .btn,
  .btn-group-vertical > .btn-group {
    width: 100%; }

.btn-group-vertical > .btn:not(:first-child),
  .btn-group-vertical > .btn-group:not(:first-child) {
    margin-top: -1px; }

.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
  .btn-group-vertical > .btn-group:not(:last-child) > .btn {
    border-bottom-right-radius: 0;
    border-bottom-left-radius: 0; }

.btn-group-vertical > .btn:not(:first-child),
  .btn-group-vertical > .btn-group:not(:first-child) > .btn {
    border-top-left-radius: 0;
    border-top-right-radius: 0; }

.btn-group-toggle > .btn,
.btn-group-toggle > .btn-group > .btn {
  margin-bottom: 0; }

.btn-group-toggle > .btn input[type="radio"],
  .btn-group-toggle > .btn input[type="checkbox"],
  .btn-group-toggle > .btn-group > .btn input[type="radio"],
  .btn-group-toggle > .btn-group > .btn input[type="checkbox"] {
    position: absolute;
    clip: rect(0, 0, 0, 0);
    pointer-events: none; }

.input-group {
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: stretch;
  width: 100%; }

.input-group > .form-control,
  .input-group > .form-control-plaintext,
  .input-group > .custom-select,
  .input-group > .custom-file {
    position: relative;
    flex: 1 1 auto;
    width: 1%;
    min-width: 0;
    margin-bottom: 0; }

.input-group > .form-control + .form-control,
    .input-group > .form-control + .custom-select,
    .input-group > .form-control + .custom-file,
    .input-group > .form-control-plaintext + .form-control,
    .input-group > .form-control-plaintext + .custom-select,
    .input-group > .form-control-plaintext + .custom-file,
    .input-group > .custom-select + .form-control,
    .input-group > .custom-select + .custom-select,
    .input-group > .custom-select + .custom-file,
    .input-group > .custom-file + .form-control,
    .input-group > .custom-file + .custom-select,
    .input-group > .custom-file + .custom-file {
      margin-left: -1px; }

.input-group > .form-control:focus,
  .input-group > .custom-select:focus,
  .input-group > .custom-file .custom-file-input:focus ~ .custom-file-label {
    z-index: 3; }

.input-group > .custom-file .custom-file-input:focus {
    z-index: 4; }

.input-group > .form-control:not(:last-child),
  .input-group > .custom-select:not(:last-child) {
    border-top-right-radius: 0;
    border-bottom-right-radius: 0; }

.input-group > .form-control:not(:first-child),
  .input-group > .custom-select:not(:first-child) {
    border-top-left-radius: 0;
    border-bottom-left-radius: 0; }

.input-group > .custom-file {
    display: flex;
    align-items: center; }

.input-group > .custom-file:not(:last-child) .custom-file-label,
    .input-group > .custom-file:not(:last-child) .custom-file-label::after {
      border-top-right-radius: 0;
      border-bottom-right-radius: 0; }

.input-group > .custom-file:not(:first-child) .custom-file-label {
      border-top-left-radius: 0;
      border-bottom-left-radius: 0; }

.input-group-prepend,
.input-group-append {
  display: flex; }

.input-group-prepend .btn,
  .input-group-append .btn {
    position: relative;
    z-index: 2; }

.input-group-prepend .btn:focus,
    .input-group-append .btn:focus {
      z-index: 3; }

.input-group-prepend .btn + .btn,
  .input-group-prepend .btn + .input-group-text,
  .input-group-prepend .input-group-text + .input-group-text,
  .input-group-prepend .input-group-text + .btn,
  .input-group-append .btn + .btn,
  .input-group-append .btn + .input-group-text,
  .input-group-append .input-group-text + .input-group-text,
  .input-group-append .input-group-text + .btn {
    margin-left: -1px; }

.input-group-prepend {
  margin-right: -1px; }

.input-group-append {
  margin-left: -1px; }

.input-group-text {
  display: flex;
  align-items: center;
  padding: 0.625rem 0.938rem;
  margin-bottom: 0;
  font-size: 0.875rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  text-align: center;
  white-space: nowrap;
  background-color: #e9ecef;
  border: 1px solid #ced4da;
  border-radius: 10px 10px 0 10px; }

.input-group-text input[type="radio"],
  .input-group-text input[type="checkbox"] {
    margin-top: 0; }

.input-group-lg > .form-control:not(textarea),
.input-group-lg > .custom-select {
  height: calc(1.5em + 1.876rem + 2px); }

.input-group-lg > .form-control,
.input-group-lg > .custom-select,
.input-group-lg > .input-group-prepend > .input-group-text,
.input-group-lg > .input-group-append > .input-group-text,
.input-group-lg > .input-group-prepend > .btn,
.input-group-lg > .input-group-append > .btn {
  padding: 0.938rem 1.25rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px; }

.input-group-sm > .form-control:not(textarea),
.input-group-sm > .custom-select {
  height: calc(1.5em + 0.626rem + 2px); }

.input-group-sm > .form-control,
.input-group-sm > .custom-select,
.input-group-sm > .input-group-prepend > .input-group-text,
.input-group-sm > .input-group-append > .input-group-text,
.input-group-sm > .input-group-prepend > .btn,
.input-group-sm > .input-group-append > .btn {
  padding: 0.313rem 0.625rem;
  font-size: 0.75rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px; }

.input-group-lg > .custom-select,
.input-group-sm > .custom-select {
  padding-right: 1.938rem; }

.input-group > .input-group-prepend > .btn,
.input-group > .input-group-prepend > .input-group-text,
.input-group > .input-group-append:not(:last-child) > .btn,
.input-group > .input-group-append:not(:last-child) > .input-group-text,
.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle),
.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0; }

.input-group > .input-group-append > .btn,
.input-group > .input-group-append > .input-group-text,
.input-group > .input-group-prepend:not(:first-child) > .btn,
.input-group > .input-group-prepend:not(:first-child) > .input-group-text,
.input-group > .input-group-prepend:first-child > .btn:not(:first-child),
.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0; }

.custom-control {
  position: relative;
  display: block;
  min-height: 21;
  padding-left: 1.5rem; }

.custom-control-inline {
  display: inline-flex;
  margin-right: 10px;
   }

.custom-control-input {
  position: absolute;
  left: 0;
  z-index: -1;
  width: 1rem;
  height: 11rem;
  opacity: 0; }

.custom-control-input:checked ~ .custom-control-label::before {
    color: #fff;
    border-color: #47B4AC;
    background-color: #47B4AC;
    box-shadow: none; }

.custom-control-input:focus ~ .custom-control-label::before {
    box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.custom-control-input:focus:not(:checked) ~ .custom-control-label::before {
    border-color: #a1dad6; }

.custom-control-input:not(:disabled):active ~ .custom-control-label::before {
    color: #fff;
    background-color: #c5e8e6;
    border-color: #c5e8e6;
    box-shadow: none; }

.custom-control-input[disabled] ~ .custom-control-label, .custom-control-input:disabled ~ .custom-control-label {
    color: #6c757d; }

.custom-control-input[disabled] ~ .custom-control-label::before, .custom-control-input:disabled ~ .custom-control-label::before {
      background-color: #e9ecef; }

.custom-control-label {
  position: relative;
  margin-bottom: 0;
  vertical-align: top; }

.custom-control-label::before {
    position: absolute;
    top: 10rem;
    left: -1.5rem;
    display: block;
    width: 1rem;
    height: 1rem;
    pointer-events: none;
    content: "";
    background-color: #fff;
    border: #adb5bd solid 1px;
    box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); }

.custom-control-label::after {
    position: absolute;
    top: 10rem;
    left: -1.5rem;
    display: block;
    width: 1rem;
    height: 1rem;
    content: "";
    background: no-repeat 50% / 50% 50%; }

.custom-checkbox .custom-control-label::before {
  border-radius: 10px 10px 0 10px; }

.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3e%3c/svg%3e"); }

/*  .non_right .custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
background-image:none !important;
  }
*/

.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
  border-color: #47B4AC;
  background-color: #47B4AC;
  box-shadow: none; }

.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
/*  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='4' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e");*/

   }

.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5); }

.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5); }

.custom-radio .custom-control-label::before {
  border-radius: 50%; }

.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e"); }

.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5); }

.custom-switch {
  padding-left: 2.25rem; }

.custom-switch .custom-control-label::before {
    left: -2.25rem;
    width: 1.75rem;
    pointer-events: all;
    border-radius: 0.5rem; }

.custom-switch .custom-control-label::after {
    top: calc(10rem + 2px);
    left: calc(-2.25rem + 2px);
    width: calc(1rem - 4px);
    height: calc(1rem - 4px);
    background-color: #adb5bd;
    border-radius: 0.5rem;
    transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }

@media (prefers-reduced-motion: reduce) {
      .custom-switch .custom-control-label::after {
        transition: none; } }

.custom-switch .custom-control-input:checked ~ .custom-control-label::after {
    background-color: #fff;
    transform: translateX(0.75rem); }

.custom-switch .custom-control-input:disabled:checked ~ .custom-control-label::before {
    background-color: rgba(71, 180, 172, 0.5); }

.custom-select {
  display: inline-block;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  padding: 0.625rem 1.938rem 0.625rem 0.938rem;
  font-size: 0.875rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  vertical-align: middle;
  background: #fff url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2301041b' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.938rem center/8px 10px;
  border: 1px solid #ced4da;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075);
  appearance: none; }

.custom-select:focus {
    border-color: #a1dad6;
    outline: 0;
    box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.custom-select:focus::-ms-value {
      color: #495057;
      background-color: #fff; }

.custom-select[multiple], .custom-select[size]:not([size="1"]) {
    height: auto;
    padding-right: 0.938rem;
    background-image: none; }

.custom-select:disabled {
    color: #6c757d;
    background-color: #e9ecef; }

.custom-select::-ms-expand {
    display: none; }

.custom-select:-moz-focusring {
    color: transparent;
    text-shadow: 0 0 0 #495057; }

.custom-select-sm {
  height: calc(1.5em + 0.626rem + 2px);
  padding-top: 0.313rem;
  padding-bottom: 0.313rem;
  padding-left: 0.625rem;
  font-size: 0.75rem; }

.custom-select-lg {
  height: calc(1.5em + 1.876rem + 2px);
  padding-top: 0.938rem;
  padding-bottom: 0.938rem;
  padding-left: 1.25rem;
  font-size: 1.25rem; }

.custom-file {
  position: relative;
  display: inline-block;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  margin-bottom: 0; }

.custom-file-input {
  position: relative;
  z-index: 2;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  margin: 0;
  opacity: 0; }

.custom-file-input:focus ~ .custom-file-label {
    border-color: #a1dad6;
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.custom-file-input[disabled] ~ .custom-file-label,
  .custom-file-input:disabled ~ .custom-file-label {
    background-color: #e9ecef; }

.custom-file-input:lang(en) ~ .custom-file-label::after {
    content: "Browse"; }

.custom-file-input ~ .custom-file-label[data-browse]::after {
    content: attr(data-browse); }

.custom-file-label {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1;
  height: calc(1.5em + 1.25rem + 2px);
  padding: 0.625rem 0.938rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  background-color: #fff;
  border: 1px solid #ced4da;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); }

.custom-file-label::after {
    position: absolute;
    top: 0;
    right: 0;
    bottom: 0;
    z-index: 3;
    display: block;
    height: calc(1.5em + 1.25rem);
    padding: 0.625rem 0.938rem;
    line-height: 1.5;
    color: #495057;
    content: "Browse";
    background-color: #e9ecef;
    border-left: inherit;
    border-radius: 0 10px 10px 0 10px 10px 10px 0 10px 0; }

.custom-range {
  width: 100%;
  height: 1.4rem;
  padding: 0;
  background-color: transparent;
  appearance: none; }

.custom-range:focus {
    outline: none; }

.custom-range:focus::-webkit-slider-thumb {
      box-shadow: 0 0 0 1px #ffffff, 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.custom-range:focus::-moz-range-thumb {
      box-shadow: 0 0 0 1px #ffffff, 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.custom-range:focus::-ms-thumb {
      box-shadow: 0 0 0 1px #ffffff, 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.custom-range::-moz-focus-outer {
    border: 0; }

.custom-range::-webkit-slider-thumb {
    width: 1rem;
    height: 1rem;
    margin-top: -0.25rem;
    background-color: #47B4AC;
    border: 0;
    border-radius: 1rem;
    box-shadow: 0 0.1rem 0.25rem rgba(0, 0, 0, 0.1);
    -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
    transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
    appearance: none; }

@media (prefers-reduced-motion: reduce) {
      .custom-range::-webkit-slider-thumb {
        -webkit-transition: none;
        transition: none; } }

.custom-range::-webkit-slider-thumb:active {
      background-color: #c5e8e6; }

.custom-range::-webkit-slider-runnable-track {
    width: 100%;
    height: 0.5rem;
    color: transparent;
    cursor: pointer;
    background-color: #ccced2;
    border-color: transparent;
    border-radius: 1rem;
    box-shadow: inset 0 0.25rem 0.25rem rgba(0, 0, 0, 0.1); }

.custom-range::-moz-range-thumb {
    width: 1rem;
    height: 1rem;
    background-color: #47B4AC;
    border: 0;
    border-radius: 1rem;
    box-shadow: 0 0.1rem 0.25rem rgba(0, 0, 0, 0.1);
    -moz-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
    transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
    appearance: none; }

@media (prefers-reduced-motion: reduce) {
      .custom-range::-moz-range-thumb {
        -moz-transition: none;
        transition: none; } }

.custom-range::-moz-range-thumb:active {
      background-color: #c5e8e6; }

.custom-range::-moz-range-track {
    width: 100%;
    height: 0.5rem;
    color: transparent;
    cursor: pointer;
    background-color: #ccced2;
    border-color: transparent;
    border-radius: 1rem;
    box-shadow: inset 0 0.25rem 0.25rem rgba(0, 0, 0, 0.1); }

.custom-range::-ms-thumb {
    width: 1rem;
    height: 1rem;
    margin-top: 0;
    margin-right: 0.2rem;
    margin-left: 0.2rem;
    background-color: #47B4AC;
    border: 0;
    border-radius: 1rem;
    box-shadow: 0 0.1rem 0.25rem rgba(0, 0, 0, 0.1);
    -ms-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
    transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
    appearance: none; }

@media (prefers-reduced-motion: reduce) {
      .custom-range::-ms-thumb {
        -ms-transition: none;
        transition: none; } }

.custom-range::-ms-thumb:active {
      background-color: #c5e8e6; }

.custom-range::-ms-track {
    width: 100%;
    height: 0.5rem;
    color: transparent;
    cursor: pointer;
    background-color: transparent;
    border-color: transparent;
    border-width: 0.5rem;
    box-shadow: inset 0 0.25rem 0.25rem rgba(0, 0, 0, 0.1); }

.custom-range::-ms-fill-lower {
    background-color: #ccced2;
    border-radius: 1rem; }

.custom-range::-ms-fill-upper {
    margin-right: 15px;
    background-color: #ccced2;
    border-radius: 1rem; }

.custom-range:disabled::-webkit-slider-thumb {
    background-color: #adb5bd; }

.custom-range:disabled::-webkit-slider-runnable-track {
    cursor: default; }

.custom-range:disabled::-moz-range-thumb {
    background-color: #adb5bd; }

.custom-range:disabled::-moz-range-track {
    cursor: default; }

.custom-range:disabled::-ms-thumb {
    background-color: #adb5bd; }

.custom-control-label::before,
.custom-file-label,
.custom-select {
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }

@media (prefers-reduced-motion: reduce) {
    .custom-control-label::before,
    .custom-file-label,
    .custom-select {
      transition: none; } }

.nav {
  display: flex;
  flex-wrap: wrap;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none; }

.nav-link {
  display: block;
  padding: 0.5rem 1rem; }

.nav-link:hover, .nav-link:focus {
    text-decoration: none; }

.nav-link.disabled {
    color: #6c757d;
    pointer-events: none;
    cursor: default; }

.nav-tabs {
  border-bottom: 1px solid #ccced2; }

.nav-tabs .nav-item {
    margin-bottom: -1px; }

.nav-tabs .nav-link {
    border: 1px solid transparent;
    border-top-left-radius: 10px 10px 0 10px;
    border-top-right-radius: 10px 10px 0 10px; }

.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
      border-color: #e9ecef #e9ecef #ccced2; }

.nav-tabs .nav-link.disabled {
      color: #6c757d;
      background-color: transparent;
      border-color: transparent; }

.nav-tabs .nav-link.active,
  .nav-tabs .nav-item.show .nav-link {
    color: #495057;
    background-color: #ffffff;
    border-color: #ccced2 #ccced2 #ffffff; }

.nav-tabs .dropdown-menu {
    margin-top: -1px;
    border-top-left-radius: 0;
    border-top-right-radius: 0; }

.nav-pills .nav-link {
  border-radius: 10px 10px 0 10px; }

.nav-pills .nav-link.active,
.nav-pills .show > .nav-link {
  color: #fff;
  background-color: #47B4AC; }

.nav-fill .nav-item {
  flex: 1 1 auto;
  text-align: center; }

.nav-justified .nav-item {
  flex-basis: 0;
  flex-grow: 1;
  text-align: center; }

.tab-content > .tab-pane {
  display: none; }

.tab-content > .active {
  display: block; }

.navbar {
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: space-between;
  padding: 0.625rem 1.25rem; }

.navbar .container,
  .navbar .container-fluid, .navbar .container-sm, .navbar .container-md, .navbar .container-lg, .navbar .container-xl {
    display: flex;
    flex-wrap: wrap;
    align-items: center;
    justify-content: space-between; }

.navbar-brand {
  display: inline-block;
  padding-top: -4rem;
  padding-bottom: -4rem;
  margin-right: 1.25rem;
  font-size: 1.25rem;
  line-height: inherit;
  white-space: nowrap; }

.navbar-brand:hover, .navbar-brand:focus {
    text-decoration: none; }

.navbar-nav {
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none; }

.navbar-nav .nav-link {
    padding-right: 0;
    padding-left: 0; }

.navbar-nav .dropdown-menu {
    position: static;
    float: none; }

.navbar-text {
  display: inline-block;
  padding-top: 0.5rem;
  padding-bottom: 0.5rem; }

.navbar-collapse {
  flex-basis: 100%;
  flex-grow: 1;
  align-items: center; }

.navbar-toggler {
  padding: 0.25rem 0.75rem;
  font-size: 1.25rem;
  line-height: 1;
  background-color: transparent;
  border: 1px solid transparent;
  border-radius: 10px 10px 0 10px; }

.navbar-toggler:hover, .navbar-toggler:focus {
    text-decoration: none; }

.navbar-toggler-icon {
  display: inline-block;
  width: 1.5em;
  height: 1.5em;
  vertical-align: middle;
  content: "";
  background: no-repeat center center;
  background-size: 100% 100%; }

@media (max-width: 575.98px) {
  .navbar-expand-sm > .container,
  .navbar-expand-sm > .container-fluid, .navbar-expand-sm > .container-sm, .navbar-expand-sm > .container-md, .navbar-expand-sm > .container-lg, .navbar-expand-sm > .container-xl {
    padding-right: 0;
    padding-left: 0; } }

@media (min-width: 576px) {
  .navbar-expand-sm {
    flex-flow: row nowrap;
    justify-content: flex-start; }
    .navbar-expand-sm .navbar-nav {
      flex-direction: row; }
      .navbar-expand-sm .navbar-nav .dropdown-menu {
        position: absolute; }
      .navbar-expand-sm .navbar-nav .nav-link {
        padding-right: 0.5rem;
        padding-left: 0.5rem; }
    .navbar-expand-sm > .container,
    .navbar-expand-sm > .container-fluid, .navbar-expand-sm > .container-sm, .navbar-expand-sm > .container-md, .navbar-expand-sm > .container-lg, .navbar-expand-sm > .container-xl {
      flex-wrap: nowrap; }
    .navbar-expand-sm .navbar-collapse {
      display: flex !important;
      flex-basis: auto; }
    .navbar-expand-sm .navbar-toggler {
      display: none; } }

@media (max-width: 767.98px) {
  .navbar-expand-md > .container,
  .navbar-expand-md > .container-fluid, .navbar-expand-md > .container-sm, .navbar-expand-md > .container-md, .navbar-expand-md > .container-lg, .navbar-expand-md > .container-xl {
    padding-right: 0;
    padding-left: 0; } }

@media (min-width: 768px) {
  .navbar-expand-md {
    flex-flow: row nowrap;
    justify-content: flex-start; }
    .navbar-expand-md .navbar-nav {
      flex-direction: row; }
      .navbar-expand-md .navbar-nav .dropdown-menu {
        position: absolute; }
      .navbar-expand-md .navbar-nav .nav-link {
        padding-right: 0.5rem;
        padding-left: 0.5rem; }
    .navbar-expand-md > .container,
    .navbar-expand-md > .container-fluid, .navbar-expand-md > .container-sm, .navbar-expand-md > .container-md, .navbar-expand-md > .container-lg, .navbar-expand-md > .container-xl {
      flex-wrap: nowrap; }
    .navbar-expand-md .navbar-collapse {
      display: flex !important;
      flex-basis: auto; }
    .navbar-expand-md .navbar-toggler {
      display: none; } }

@media (max-width: 991.98px) {
  .navbar-expand-lg > .container,
  .navbar-expand-lg > .container-fluid, .navbar-expand-lg > .container-sm, .navbar-expand-lg > .container-md, .navbar-expand-lg > .container-lg, .navbar-expand-lg > .container-xl {
    padding-right: 0;
    padding-left: 0; } }

@media (min-width: 992px) {
  .navbar-expand-lg {
    flex-flow: row nowrap;
    justify-content: flex-start; }
    .navbar-expand-lg .navbar-nav {
      flex-direction: row; }
      .navbar-expand-lg .navbar-nav .dropdown-menu {
        position: absolute; }
      .navbar-expand-lg .navbar-nav .nav-link {
        padding-right: 0.5rem;
        padding-left: 0.5rem; }
    .navbar-expand-lg > .container,
    .navbar-expand-lg > .container-fluid, .navbar-expand-lg > .container-sm, .navbar-expand-lg > .container-md, .navbar-expand-lg > .container-lg, .navbar-expand-lg > .container-xl {
      flex-wrap: nowrap; }
    .navbar-expand-lg .navbar-collapse {
      display: flex !important;
      flex-basis: auto; }
    .navbar-expand-lg .navbar-toggler {
      display: none; } }

@media (max-width: 1199.98px) {
  .navbar-expand-xl > .container,
  .navbar-expand-xl > .container-fluid, .navbar-expand-xl > .container-sm, .navbar-expand-xl > .container-md, .navbar-expand-xl > .container-lg, .navbar-expand-xl > .container-xl {
    padding-right: 0;
    padding-left: 0; } }

@media (min-width: 1200px) {
  .navbar-expand-xl {
    flex-flow: row nowrap;
    justify-content: flex-start; }
    .navbar-expand-xl .navbar-nav {
      flex-direction: row; }
      .navbar-expand-xl .navbar-nav .dropdown-menu {
        position: absolute; }
      .navbar-expand-xl .navbar-nav .nav-link {
        padding-right: 0.5rem;
        padding-left: 0.5rem; }
    .navbar-expand-xl > .container,
    .navbar-expand-xl > .container-fluid, .navbar-expand-xl > .container-sm, .navbar-expand-xl > .container-md, .navbar-expand-xl > .container-lg, .navbar-expand-xl > .container-xl {
      flex-wrap: nowrap; }
    .navbar-expand-xl .navbar-collapse {
      display: flex !important;
      flex-basis: auto; }
    .navbar-expand-xl .navbar-toggler {
      display: none; } }

.navbar-expand {
  flex-flow: row nowrap;
  justify-content: flex-start; }

.navbar-expand > .container,
  .navbar-expand > .container-fluid, .navbar-expand > .container-sm, .navbar-expand > .container-md, .navbar-expand > .container-lg, .navbar-expand > .container-xl {
    padding-right: 0;
    padding-left: 0; }

.navbar-expand .navbar-nav {
    flex-direction: row; }

.navbar-expand .navbar-nav .dropdown-menu {
      position: absolute; }

.navbar-expand .navbar-nav .nav-link {
      padding-right: 0.5rem;
      padding-left: 0.5rem; }

.navbar-expand > .container,
  .navbar-expand > .container-fluid, .navbar-expand > .container-sm, .navbar-expand > .container-md, .navbar-expand > .container-lg, .navbar-expand > .container-xl {
    flex-wrap: nowrap; }

.navbar-expand .navbar-collapse {
    display: flex !important;
    flex-basis: auto; }

.navbar-expand .navbar-toggler {
    display: none; }

.navbar-light .navbar-brand {
  color: rgba(0, 0, 0, 0.9); }

.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus {
    color: rgba(0, 0, 0, 0.9); }

.navbar-light .navbar-nav .nav-link {
  color: rgba(0, 0, 0, 0.5); }

.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus {
    color: rgba(0, 0, 0, 0.7); }

.navbar-light .navbar-nav .nav-link.disabled {
    color: rgba(0, 0, 0, 0.3); }

.navbar-light .navbar-nav .show > .nav-link,
.navbar-light .navbar-nav .active > .nav-link,
.navbar-light .navbar-nav .nav-link.show,
.navbar-light .navbar-nav .nav-link.active {
  color: rgba(0, 0, 0, 0.9); }

.navbar-light .navbar-toggler {
  color: rgba(0, 0, 0, 0.5);
  border-color: rgba(0, 0, 0, 0.1); }

.navbar-light .navbar-toggler-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.5%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); }

.navbar-light .navbar-text {
  color: rgba(0, 0, 0, 0.5); }

.navbar-light .navbar-text a {
    color: rgba(0, 0, 0, 0.9); }

.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus {
      color: rgba(0, 0, 0, 0.9); }

.navbar-dark .navbar-brand {
  color: #fff; }

.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus {
    color: #fff; }

.navbar-dark .navbar-nav .nav-link {
  color: rgba(255, 255, 255, 0.5); }

.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus {
    color: rgba(255, 255, 255, 0.75); }

.navbar-dark .navbar-nav .nav-link.disabled {
    color: rgba(255, 255, 255, 0.25); }

.navbar-dark .navbar-nav .show > .nav-link,
.navbar-dark .navbar-nav .active > .nav-link,
.navbar-dark .navbar-nav .nav-link.show,
.navbar-dark .navbar-nav .nav-link.active {
  color: #fff; }

.navbar-dark .navbar-toggler {
  color: rgba(255, 255, 255, 0.5);
  border-color: rgba(255, 255, 255, 0.1); }

.navbar-dark .navbar-toggler-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.5%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); }

.navbar-dark .navbar-text {
  color: rgba(255, 255, 255, 0.5); }

.navbar-dark .navbar-text a {
    color: #fff; }

.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus {
      color: #fff; }

.card {
  position: relative;
  display: flex;
  flex-direction: column;
  min-width: 0;
  word-wrap: break-word;
  background-color: #F6F8FB;
  background-clip: border-box;
/*  border: 1px solid rgba(0, 0, 0, 0.125);*/
/*  border-radius: 10px 10px 0 10px;*/ }

.card > hr {
    margin-right: 0;
    margin-left: 0; }

.card > .list-group {
    border-top: inherit;
    border-bottom: inherit; }

.card > .list-group:first-child {
      border-top-width: 0;
      border-top-left-radius: calc(10px 10px 0 10px - 1px);
      border-top-right-radius: calc(10px 10px 0 10px - 1px); }

.card > .list-group:last-child {
      border-bottom-width: 0;
      border-bottom-right-radius: calc(10px 10px 0 10px - 1px);
      border-bottom-left-radius: calc(10px 10px 0 10px - 1px); }

.card-body {
  flex: 1 1 auto;
  min-height: 1px;
  padding: 1.25rem; }

.card-title {
  margin-bottom: 0.75rem; }

.card-subtitle {
  margin-top: -0.375rem;
  margin-bottom: 0; }

.card-text:last-child {
  margin-bottom: 0; }

.card-link:hover {
  text-decoration: none; }

.card-link + .card-link {
  margin-left: 1.25rem; }

.card-header {
  padding: 0.75rem 1.25rem;
  margin-bottom: 0;
  background-color: rgba(0, 0, 0, 0.03);
  border-bottom: 1px solid rgba(0, 0, 0, 0.125); }

.card-header:first-child {
    border-radius: calc(10px 10px 0 10px - 1px) calc(10px 10px 0 10px - 1px) 0 0; }

.card-header + .list-group .list-group-item:first-child {
    border-top: 0; }

.card-footer {
  padding: 0.75rem 1.25rem;
  background-color: rgba(0, 0, 0, 0.03);
  border-top: 1px solid rgba(0, 0, 0, 0.125); }

.card-footer:last-child {
    border-radius: 0 0 calc(10px 10px 0 10px - 1px) calc(10px 10px 0 10px - 1px); }

.card-header-tabs {
  margin-right: -0.625rem;
  margin-bottom: -0.75rem;
  margin-left: -0.625rem;
  border-bottom: 0; }

.card-header-pills {
  margin-right: -0.625rem;
  margin-left: -0.625rem; }

.card-img-overlay {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  padding: 1.25rem; }

.card-img,
.card-img-top,
.card-img-bottom {
  flex-shrink: 0;
  width: 100%; }

.card-img,
.card-img-top {
  border-top-left-radius: calc(10px 10px 0 10px - 1px);
  border-top-right-radius: calc(10px 10px 0 10px - 1px); }

.card-img,
.card-img-bottom {
  border-bottom-right-radius: calc(10px 10px 0 10px - 1px);
  border-bottom-left-radius: calc(10px 10px 0 10px - 1px); }

.card-deck .card {
  margin-bottom: 15px; }

@media (min-width: 576px) {
  .card-deck {
    display: flex;
    flex-flow: row wrap;
    margin-right: -15px;
    margin-left: -15px; }
    .card-deck .card {
      flex: 1 0 0%;
      margin-right: 15px;
      margin-bottom: 0;
      margin-left: 15px; } }

.card-group > .card {
  margin-bottom: 15px; }

@media (min-width: 576px) {
  .card-group {
    display: flex;
    flex-flow: row wrap; }
    .card-group > .card {
      flex: 1 0 0%;
      margin-bottom: 0; }
      .card-group > .card + .card {
        margin-left: 0;
        border-left: 0; }
      .card-group > .card:not(:last-child) {
        border-top-right-radius: 0;
        border-bottom-right-radius: 0; }
        .card-group > .card:not(:last-child) .card-img-top,
        .card-group > .card:not(:last-child) .card-header {
          border-top-right-radius: 0; }
        .card-group > .card:not(:last-child) .card-img-bottom,
        .card-group > .card:not(:last-child) .card-footer {
          border-bottom-right-radius: 0; }
      .card-group > .card:not(:first-child) {
        border-top-left-radius: 0;
        border-bottom-left-radius: 0; }
        .card-group > .card:not(:first-child) .card-img-top,
        .card-group > .card:not(:first-child) .card-header {
          border-top-left-radius: 0; }
        .card-group > .card:not(:first-child) .card-img-bottom,
        .card-group > .card:not(:first-child) .card-footer {
          border-bottom-left-radius: 0; } }

.card-columns .card {
  margin-bottom: 0.75rem; }

@media (min-width: 576px) {
  .card-columns {
    column-count: 3;
    column-gap: 1.25rem;
    orphans: 1;
    widows: 1; }
    .card-columns .card {
      display: inline-block;
      width: 100%; } }

.accordion > .card {
  overflow: hidden; }

.accordion > .card:not(:last-of-type) {
    border-bottom: 0;
    border-bottom-right-radius: 0;
    border-bottom-left-radius: 0; }

.accordion > .card:not(:first-of-type) {
    border-top-left-radius: 0;
    border-top-right-radius: 0; }

.accordion > .card > .card-header {
    border-radius: 0;
    margin-bottom: -1px; }

.breadcrumb {
  display: flex;
  flex-wrap: wrap;
  padding: 0.75rem 1rem;
  margin-bottom: 1rem;
  list-style: none;
  background-color: #e9ecef;
  border-radius: 10px 10px 0 10px; }

.breadcrumb-item {
  display: flex; }

.breadcrumb-item + .breadcrumb-item {
    padding-left: 0.5rem; }

.breadcrumb-item + .breadcrumb-item::before {
      display: inline-block;
      padding-right: 0.5rem;
      color: #6c757d;
      content: "/"; }

.breadcrumb-item + .breadcrumb-item:hover::before {
    text-decoration: underline; }

.breadcrumb-item + .breadcrumb-item:hover::before {
    text-decoration: none; }

.breadcrumb-item.active {
    color: #6c757d; }

.pagination {
  display: flex;
  padding-left: 0;
  list-style: none;
  border-radius: 10px 10px 0 10px; }

.page-link {
  position: relative;
  display: block;
  padding: 0.5rem 0.75rem;
  margin-left: -1px;
  line-height: 1.25;
  color: #47B4AC;
  background-color: #fff;
  border: 1px solid #ccced2; }

.page-link:hover {
    z-index: 2;
    color: #317d78;
    text-decoration: none;
    background-color: #e9ecef;
    border-color: #ccced2; }

.page-link:focus {
    z-index: 3;
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 172, 0.25); }

.page-item:first-child .page-link {
  margin-left: 0;
  border-top-left-radius: 10px 10px 0 10px;
  border-bottom-left-radius: 10px 10px 0 10px; }

.page-item:last-child .page-link {
  border-top-right-radius: 10px 10px 0 10px;
  border-bottom-right-radius: 10px 10px 0 10px; }

.page-item.active .page-link {
  z-index: 3;
  color: #fff;
  background-color: #47B4AC;
  border-color: #47B4AC; }

.page-item.disabled .page-link {
  color: #6c757d;
  pointer-events: none;
  cursor: auto;
  background-color: #fff;
  border-color: #ccced2; }

.pagination-lg .page-link {
  padding: 0.75rem 1.5rem;
  font-size: 1.25rem;
  line-height: 1.5; }

.pagination-lg .page-item:first-child .page-link {
  border-top-left-radius: 10px 10px 0 10px;
  border-bottom-left-radius: 10px 10px 0 10px; }

.pagination-lg .page-item:last-child .page-link {
  border-top-right-radius: 10px 10px 0 10px;
  border-bottom-right-radius: 10px 10px 0 10px; }

.pagination-sm .page-link {
  padding: 0.25rem 0.5rem;
  font-size: 0.75rem;
  line-height: 1.5; }

.pagination-sm .page-item:first-child .page-link {
  border-top-left-radius: 10px 10px 0 10px;
  border-bottom-left-radius: 10px 10px 0 10px; }

.pagination-sm .page-item:last-child .page-link {
  border-top-right-radius: 10px 10px 0 10px;
  border-bottom-right-radius: 10px 10px 0 10px; }

.badge {
  display: inline-block;
  padding: 0.25em 0.4em;
  font-size: 75%;
  font-weight: 700;
  line-height: 1;
  text-align: center;
  white-space: nowrap;
  vertical-align: baseline;
  border-radius: 10px 10px 0 10px;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }

@media (prefers-reduced-motion: reduce) {
    .badge {
      transition: none; } }

a.badge:hover, a.badge:focus {
    text-decoration: none; }

.badge:empty {
    display: none; }

.btn .badge {
  position: relative;
  top: -1px; }

.badge-pill {
  padding-right: 0.6em;
  padding-left: 0.6em;
  border-radius: 10rem; }

.badge-primary {
  color: #fff;
  background-color: #47B4AC; }

a.badge-primary:hover, a.badge-primary:focus {
    color: #fff;
    background-color: #398f89; }

a.badge-primary:focus, a.badge-primary.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 172, 0.5); }

.badge-secondary {
  color: #fff;
  background-color: #323C9C; }

a.badge-secondary:hover, a.badge-secondary:focus {
    color: #fff;
    background-color: #262d75; }

a.badge-secondary:focus, a.badge-secondary.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(50, 60, 156, 0.5); }

.badge-success {
  color: #fff;
  background-color: #47B473; }

a.badge-success:hover, a.badge-success:focus {
    color: #fff;
    background-color: #398f5c; }

a.badge-success:focus, a.badge-success.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 115, 0.5); }

.badge-info {
  color: #fff;
  background-color: #1B98E0; }

a.badge-info:hover, a.badge-info:focus {
    color: #fff;
    background-color: #1679b2; }

a.badge-info:focus, a.badge-info.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(27, 152, 224, 0.5); }

.badge-warning {
  color: #fff;
  background-color: #CCA43B; }

a.badge-warning:hover, a.badge-warning:focus {
    color: #fff;
    background-color: #a8862c; }

a.badge-warning:focus, a.badge-warning.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(204, 164, 59, 0.5); }

.badge-danger {
  color: #fff;
  background-color: #D75842; }

a.badge-danger:hover, a.badge-danger:focus {
    color: #fff;
    background-color: #be3e28; }

a.badge-danger:focus, a.badge-danger.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.5); }

.badge-light {
  color: #212529;
  background-color: #F6F8FB; }

a.badge-light:hover, a.badge-light:focus {
    color: #212529;
    background-color: #d3ddeb; }

a.badge-light:focus, a.badge-light.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(246, 248, 251, 0.5); }

.badge-dark {
  color: #fff;
  background-color: #01041b; }

a.badge-dark:hover, a.badge-dark:focus {
    color: #fff;
    background-color: black; }

a.badge-dark:focus, a.badge-dark.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(1, 4, 27, 0.5); }

.badge-orange {
  color: #fff;
  background-color: #323C9C; }

a.badge-orange:hover, a.badge-orange:focus {
    color: #fff;
    background-color: #262d75; }

a.badge-orange:focus, a.badge-orange.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(50, 60, 156, 0.5); }

.badge-purple {
  color: #fff;
  background-color: #4731b6; }

a.badge-purple:hover, a.badge-purple:focus {
    color: #fff;
    background-color: #37268e; }

a.badge-purple:focus, a.badge-purple.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(71, 49, 182, 0.5); }

.badge-skyblue {
  color: #fff;
  background-color: #158df7; }

a.badge-skyblue:hover, a.badge-skyblue:focus {
    color: #fff;
    background-color: #0773d2; }

a.badge-skyblue:focus, a.badge-skyblue.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(21, 141, 247, 0.5); }

.badge-light-gray {
  color: #212529;
  background-color: #f4f5fa; }

a.badge-light-gray:hover, a.badge-light-gray:focus {
    color: #212529;
    background-color: #d1d5ea; }

a.badge-light-gray:focus, a.badge-light-gray.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(244, 245, 250, 0.5); }

.badge-white {
  color: #212529;
  background-color: #fff; }

a.badge-white:hover, a.badge-white:focus {
    color: #212529;
    background-color: #e6e6e6; }

a.badge-white:focus, a.badge-white.focus {
    outline: 0;
    box-shadow: 0 0 0 0.2rem rgba(255, 255, 255, 0.5); }

.alert {
  position: relative;
  padding: 0.75rem 1.25rem;
  margin-bottom: 1rem;
  border: 1px solid transparent;
  border-radius: 10px 10px 0 10px; }

.alert-heading {
  color: inherit; }

.alert-link {
  font-weight: 700; }

.alert-dismissible {
  padding-right: 23.5rem; }

.alert-dismissible .close {
    position: absolute;
    top: 0;
    right: 0;
    padding: 0.75rem 1.25rem;
    color: inherit; }

.alert-primary {
  color: #255e59;
  background-color: #daf0ee;
  border-color: #cbeae8; }

.alert-primary hr {
    border-top-color: #b9e3e0; }

.alert-primary .alert-link {
    color: #173936; }

.alert-secondary {
  color: #1a1f51;
  background-color: #d6d8eb;
  border-color: #c6c8e3; }

.alert-secondary hr {
    border-top-color: #b5b8db; }

.alert-secondary .alert-link {
    color: #0e102a; }

.alert-success {
  color: #255e3c;
  background-color: #daf0e3;
  border-color: #cbead8; }

.alert-success hr {
    border-top-color: #b9e3ca; }

.alert-success .alert-link {
    color: #173925; }

.alert-info {
  color: #0e4f74;
  background-color: #d1eaf9;
  border-color: #bfe2f6; }

.alert-info hr {
    border-top-color: #a9d8f3; }

.alert-info .alert-link {
    color: #093046; }

.alert-warning {
  color: #6a551f;
  background-color: #f5edd8;
  border-color: #f1e6c8; }

.alert-warning hr {
    border-top-color: #ecddb4; }

.alert-warning .alert-link {
    color: #433513; }

.alert-danger {
  color: #702e22;
  background-color: #f7ded9;
  border-color: #f4d0ca; }

.alert-danger hr {
    border-top-color: #f0bdb5; }

.alert-danger .alert-link {
    color: #491e16; }

.alert-light {
  color: #808183;
  background-color: #fdfefe;
  border-color: #fcfdfe; }

.alert-light hr {
    border-top-color: #e9f0f8; }

.alert-light .alert-link {
    color: #676869; }

.alert-dark {
  color: #01020e;
  background-color: #cccdd1;
  border-color: #b8b9bf; }

.alert-dark hr {
    border-top-color: #abacb3; }

.alert-dark .alert-link {
    color: black; }

.alert-orange {
  color: #1a1f51;
  background-color: #d6d8eb;
  border-color: #c6c8e3; }

.alert-orange hr {
    border-top-color: #b5b8db; }

.alert-orange .alert-link {
    color: #0e102a; }

.alert-purple {
  color: #25195f;
  background-color: #dad6f0;
  border-color: #cbc5eb; }

.alert-purple hr {
    border-top-color: #bab2e4; }

.alert-purple .alert-link {
    color: #150e37; }

.alert-skyblue {
  color: #0b4980;
  background-color: #d0e8fd;
  border-color: #bddffd; }

.alert-skyblue hr {
    border-top-color: #a4d3fc; }

.alert-skyblue .alert-link {
    color: #072e51; }

.alert-light-gray {
  color: #7f7f82;
  background-color: #fdfdfe;
  border-color: #fcfcfe; }

.alert-light-gray hr {
    border-top-color: #e9e9f8; }

.alert-light-gray .alert-link {
    color: #666668; }

.alert-white {
  color: #858585;
  background-color: white;
  border-color: white; }

.alert-white hr {
    border-top-color: #f2f2f2; }

.alert-white .alert-link {
    color: #6c6c6c; }

@keyframes progress-bar-stripes {
  from {
    background-position: 1rem 0; }
  to {
    background-position: 0 0; } }

.progress {
  display: flex;
  height: 1rem;
  overflow: hidden;
  line-height: 0;
  font-size: 0.65625rem;
  background-color: #e9ecef;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 0.1rem 0.1rem rgba(0, 0, 0, 0.1); }

.progress-bar {
  display: flex !important;
  flex-direction: column !important;
  justify-content: center !important;
  overflow: hidden !important;
  color: #fff !important;
  text-align: center !important;
  white-space: nowrap !important;
  background-color: #47B4AC !important;
  transition: width 0.6s ease !important; }

@media (prefers-reduced-motion: reduce) {
    .progress-bar {
      transition: none !important; } }

.progress-bar-striped {
  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent) !important;
  background-size: 1rem 1rem !important; }

.progress-bar-animated {
  animation: progress-bar-stripes 1s linear infinite; }

@media (prefers-reduced-motion: reduce) {
    .progress-bar-animated {
      animation: none; } }

.media {
  display: flex;
  align-items: flex-start; }

.media-body {
  flex: 1; }

.list-group {
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  border-radius: 10px 10px 0 10px; }

.list-group-item-action {
  width: 100%;
  color: #495057;
  text-align: inherit; }

.list-group-item-action:hover, .list-group-item-action:focus {
    z-index: 1;
    color: #495057;
    text-decoration: none;
    background-color: #f8f9fa; }

.list-group-item-action:active {
    color: #737B8E;
    background-color: #e9ecef; }

.list-group-item {
  position: relative;
  display: block;
  padding: 0.75rem 1.25rem;
  background-color: #fff;
  border: 1px solid rgba(0, 0, 0, 0.125); }

.list-group-item:first-child {
    border-top-left-radius: inherit;
    border-top-right-radius: inherit; }

.list-group-item:last-child {
    border-bottom-right-radius: inherit;
    border-bottom-left-radius: inherit; }

.list-group-item.disabled, .list-group-item:disabled {
    color: #6c757d;
    pointer-events: none;
    background-color: #fff; }

.list-group-item.active {
    z-index: 2;
    color: #fff;
    background-color: #47B4AC;
    border-color: #47B4AC; }

.list-group-item + .list-group-item {
    border-top-width: 0; }

.list-group-item + .list-group-item.active {
      margin-top: -1px;
      border-top-width: 1px; }

.list-group-horizontal {
  flex-direction: row; }

.list-group-horizontal > .list-group-item:first-child {
    border-bottom-left-radius: 10px 10px 0 10px;
    border-top-right-radius: 0; }

.list-group-horizontal > .list-group-item:last-child {
    border-top-right-radius: 10px 10px 0 10px;
    border-bottom-left-radius: 0; }

.list-group-horizontal > .list-group-item.active {
    margin-top: 0; }

.list-group-horizontal > .list-group-item + .list-group-item {
    border-top-width: 1px;
    border-left-width: 0; }

.list-group-horizontal > .list-group-item + .list-group-item.active {
      margin-left: -1px;
      border-left-width: 1px; }

@media (min-width: 576px) {
  .list-group-horizontal-sm {
    flex-direction: row; }
    .list-group-horizontal-sm > .list-group-item:first-child {
      border-bottom-left-radius: 10px 10px 0 10px;
      border-top-right-radius: 0; }
    .list-group-horizontal-sm > .list-group-item:last-child {
      border-top-right-radius: 10px 10px 0 10px;
      border-bottom-left-radius: 0; }
    .list-group-horizontal-sm > .list-group-item.active {
      margin-top: 0; }
    .list-group-horizontal-sm > .list-group-item + .list-group-item {
      border-top-width: 1px;
      border-left-width: 0; }
      .list-group-horizontal-sm > .list-group-item + .list-group-item.active {
        margin-left: -1px;
        border-left-width: 1px; } }

@media (min-width: 768px) {
  .list-group-horizontal-md {
    flex-direction: row; }
    .list-group-horizontal-md > .list-group-item:first-child {
      border-bottom-left-radius: 10px 10px 0 10px;
      border-top-right-radius: 0; }
    .list-group-horizontal-md > .list-group-item:last-child {
      border-top-right-radius: 10px 10px 0 10px;
      border-bottom-left-radius: 0; }
    .list-group-horizontal-md > .list-group-item.active {
      margin-top: 0; }
    .list-group-horizontal-md > .list-group-item + .list-group-item {
      border-top-width: 1px;
      border-left-width: 0; }
      .list-group-horizontal-md > .list-group-item + .list-group-item.active {
        margin-left: -1px;
        border-left-width: 1px; } }

@media (min-width: 992px) {
  .list-group-horizontal-lg {
    flex-direction: row; }
    .list-group-horizontal-lg > .list-group-item:first-child {
      border-bottom-left-radius: 10px 10px 0 10px;
      border-top-right-radius: 0; }
    .list-group-horizontal-lg > .list-group-item:last-child {
      border-top-right-radius: 10px 10px 0 10px;
      border-bottom-left-radius: 0; }
    .list-group-horizontal-lg > .list-group-item.active {
      margin-top: 0; }
    .list-group-horizontal-lg > .list-group-item + .list-group-item {
      border-top-width: 1px;
      border-left-width: 0; }
      .list-group-horizontal-lg > .list-group-item + .list-group-item.active {
        margin-left: -1px;
        border-left-width: 1px; } }

@media (min-width: 1200px) {
  .list-group-horizontal-xl {
    flex-direction: row; }
    .list-group-horizontal-xl > .list-group-item:first-child {
      border-bottom-left-radius: 10px 10px 0 10px;
      border-top-right-radius: 0; }
    .list-group-horizontal-xl > .list-group-item:last-child {
      border-top-right-radius: 10px 10px 0 10px;
      border-bottom-left-radius: 0; }
    .list-group-horizontal-xl > .list-group-item.active {
      margin-top: 0; }
    .list-group-horizontal-xl > .list-group-item + .list-group-item {
      border-top-width: 1px;
      border-left-width: 0; }
      .list-group-horizontal-xl > .list-group-item + .list-group-item.active {
        margin-left: -1px;
        border-left-width: 1px; } }

.list-group-flush {
  border-radius: 0; }

.list-group-flush > .list-group-item {
    border-width: 0 0 1px; }

.list-group-flush > .list-group-item:last-child {
      border-bottom-width: 0; }

.list-group-item-primary {
  color: #255e59;
  background-color: #cbeae8; }

.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus {
    color: #255e59;
    background-color: #b9e3e0; }

.list-group-item-primary.list-group-item-action.active {
    color: #fff;
    background-color: #255e59;
    border-color: #255e59; }

.list-group-item-secondary {
  color: #1a1f51;
  background-color: #c6c8e3; }

.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus {
    color: #1a1f51;
    background-color: #b5b8db; }

.list-group-item-secondary.list-group-item-action.active {
    color: #fff;
    background-color: #1a1f51;
    border-color: #1a1f51; }

.list-group-item-success {
  color: #255e3c;
  background-color: #cbead8; }

.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus {
    color: #255e3c;
    background-color: #b9e3ca; }

.list-group-item-success.list-group-item-action.active {
    color: #fff;
    background-color: #255e3c;
    border-color: #255e3c; }

.list-group-item-info {
  color: #0e4f74;
  background-color: #bfe2f6; }

.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus {
    color: #0e4f74;
    background-color: #a9d8f3; }

.list-group-item-info.list-group-item-action.active {
    color: #fff;
    background-color: #0e4f74;
    border-color: #0e4f74; }

.list-group-item-warning {
  color: #6a551f;
  background-color: #f1e6c8; }

.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus {
    color: #6a551f;
    background-color: #ecddb4; }

.list-group-item-warning.list-group-item-action.active {
    color: #fff;
    background-color: #6a551f;
    border-color: #6a551f; }

.list-group-item-danger {
  color: #702e22;
  background-color: #f4d0ca; }

.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus {
    color: #702e22;
    background-color: #f0bdb5; }

.list-group-item-danger.list-group-item-action.active {
    color: #fff;
    background-color: #702e22;
    border-color: #702e22; }

.list-group-item-light {
  color: #808183;
  background-color: #fcfdfe; }

.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus {
    color: #808183;
    background-color: #e9f0f8; }

.list-group-item-light.list-group-item-action.active {
    color: #fff;
    background-color: #808183;
    border-color: #808183; }

.list-group-item-dark {
  color: #01020e;
  background-color: #b8b9bf; }

.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus {
    color: #01020e;
    background-color: #abacb3; }

.list-group-item-dark.list-group-item-action.active {
    color: #fff;
    background-color: #01020e;
    border-color: #01020e; }

.list-group-item-orange {
  color: #1a1f51;
  background-color: #c6c8e3; }

.list-group-item-orange.list-group-item-action:hover, .list-group-item-orange.list-group-item-action:focus {
    color: #1a1f51;
    background-color: #b5b8db; }

.list-group-item-orange.list-group-item-action.active {
    color: #fff;
    background-color: #1a1f51;
    border-color: #1a1f51; }

.list-group-item-purple {
  color: #25195f;
  background-color: #cbc5eb; }

.list-group-item-purple.list-group-item-action:hover, .list-group-item-purple.list-group-item-action:focus {
    color: #25195f;
    background-color: #bab2e4; }

.list-group-item-purple.list-group-item-action.active {
    color: #fff;
    background-color: #25195f;
    border-color: #25195f; }

.list-group-item-skyblue {
  color: #0b4980;
  background-color: #bddffd; }

.list-group-item-skyblue.list-group-item-action:hover, .list-group-item-skyblue.list-group-item-action:focus {
    color: #0b4980;
    background-color: #a4d3fc; }

.list-group-item-skyblue.list-group-item-action.active {
    color: #fff;
    background-color: #0b4980;
    border-color: #0b4980; }

.list-group-item-light-gray {
  color: #7f7f82;
  background-color: #fcfcfe; }

.list-group-item-light-gray.list-group-item-action:hover, .list-group-item-light-gray.list-group-item-action:focus {
    color: #7f7f82;
    background-color: #e9e9f8; }

.list-group-item-light-gray.list-group-item-action.active {
    color: #fff;
    background-color: #7f7f82;
    border-color: #7f7f82; }

.list-group-item-white {
  color: #858585;
  background-color: white; }

.list-group-item-white.list-group-item-action:hover, .list-group-item-white.list-group-item-action:focus {
    color: #858585;
    background-color: #f2f2f2; }

.list-group-item-white.list-group-item-action.active {
    color: #fff;
    background-color: #858585;
    border-color: #858585; }

.close {
  float: right;
  font-size: 1.3125rem;
  font-weight: 700;
  line-height: 1;
  color: #000;
  text-shadow: 0 1px 0 #fff;
  opacity: .5; }

@media (max-width: 1200px) {
    .close {
      font-size: calc(1.25625rem + 0.075vw) ; } }

.close:hover {
    color: #000;
    text-decoration: none; }

.close:not(:disabled):not(.disabled):hover, .close:not(:disabled):not(.disabled):focus {
    opacity: .75; }

button.close {
  padding: 0;
  background-color: transparent;
  border: 0; }

a.close.disabled {
  pointer-events: none; }

.modal-open {
  overflow: hidden; }

.modal-open .modal {
    overflow-x: hidden;
    overflow-y: auto; }

.modal {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1050;
  display: none;
  width: 100%;
  height: 100%;
  overflow: hidden;
  outline: 0; }

.modal-dialog {
  position: relative;
  width: auto;
  margin: 0.5rem;
  pointer-events: none; }

.modal.fade .modal-dialog {
    transition: transform 0.3s ease-out;
    transform: translate(0, -50px); }

@media (prefers-reduced-motion: reduce) {
      .modal.fade .modal-dialog {
        transition: none; } }

.modal.show .modal-dialog {
    transform: none; }

.modal.modal-static .modal-dialog {
    transform: scale(1.02); }

.modal-dialog-scrollable {
  display: flex;
  max-height: calc(100% - 1rem); }

.modal-dialog-scrollable .modal-content {
    max-height: calc(100vh - 1rem);
    overflow: hidden; }

.modal-dialog-scrollable .modal-header,
  .modal-dialog-scrollable .modal-footer {
    flex-shrink: 0; }

.modal-dialog-scrollable .modal-body {
    overflow-y: auto; }

.modal-dialog-centered {
  display: flex;
  align-items: center;
  min-height: calc(100% - 1rem); }

.modal-dialog-centered::before {
    display: block;
    height: calc(100vh - 1rem);
    height: min-content;
    content: ""; }

.modal-dialog-centered.modal-dialog-scrollable {
    flex-direction: column;
    justify-content: center;
    height: 100%; }

.modal-dialog-centered.modal-dialog-scrollable .modal-content {
      max-height: none; }

.modal-dialog-centered.modal-dialog-scrollable::before {
      content: none; }

.modal-content {
  position: relative;
  display: flex;
  flex-direction: column;
  width: 100%;
  pointer-events: auto;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 10px 10px 0 10px;
  box-shadow: 0 0.25rem 0.5rem rgba(0, 0, 0, 0.5);
  outline: 0; }

.modal-backdrop {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1040;
  width: 100vw;
  height: 100vh;
  background-color: #000; }

.modal-backdrop.fade {
    opacity: 0; }

.modal-backdrop.show {
    opacity: 0.5; }

.modal-header {
  display: flex;
  align-items: flex-start;
  justify-content: space-between;
  padding: 1rem 1rem;
  border-bottom: 1px solid #C2C6CF;
  border-top-left-radius: calc(10px 10px 0 10px - 1px);
  border-top-right-radius: calc(10px 10px 0 10px - 1px); }

.modal-header .close {
    padding: 1rem 1rem;
    margin: -1rem -1rem -1rem auto; }

.modal-title {
  margin-bottom: 0;
  line-height: 1.5; }

.modal-body {
  position: relative;
  flex: 1 1 auto;
  padding: 1rem; }

.modal-footer {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: flex-end;
  padding: 0.75rem;
  border-top: 1px solid #C2C6CF;
  border-bottom-right-radius: calc(10px 10px 0 10px - 1px);
  border-bottom-left-radius: calc(10px 10px 0 10px - 1px); }

.modal-footer > * {
    margin: 0.25rem; }

.modal-scrollbar-measure {
  position: absolute;
  top: -9999px;
  width: 50px;
  height: 50px;
  overflow: scroll; }

@media (min-width: 576px) {
  .modal-dialog {
    max-width: 500px;
    margin: 1.75rem auto; }
  .modal-dialog-scrollable {
    max-height: calc(100% - 3.5rem); }
    .modal-dialog-scrollable .modal-content {
      max-height: calc(100vh - 3.5rem); }
  .modal-dialog-centered {
    min-height: calc(100% - 3.5rem); }
    .modal-dialog-centered::before {
      height: calc(100vh - 3.5rem);
      height: min-content; }
  .modal-content {
    box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.5); }
  .modal-sm {
    max-width: 300px; } }

@media (min-width: 992px) {
  .modal-lg,
  .modal-xl {
    max-width: 800px; } }

@media (min-width: 1200px) {
  .modal-xl {
    max-width: 1140px; } }

.tooltip {
  position: absolute;
  z-index: 1070;
  display: block;
  margin: 0;
  font-family: "Open Sans", sans-serif;
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  word-spacing: normal;
  white-space: normal;
  line-break: auto;
  font-size: 0.75rem;
  word-wrap: break-word;
  opacity: 0; }

.tooltip.show {
    opacity: 0.9; }

.tooltip .arrow {
    position: absolute;
    display: block;
    width: 0.8rem;
    height: 0.4rem; }

.tooltip .arrow::before {
      position: absolute;
      content: "";
      border-color: transparent;
      border-style: solid; }

.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] {
  padding: 0.4rem 0; }

.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow {
    bottom: 0; }

.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before {
      top: 0;
      border-width: 0.4rem 0.4rem 0;
      border-top-color: #000; }

.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] {
  padding: 0 0.4rem; }

.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow {
    left: 0;
    width: 0.4rem;
    height: 0.8rem; }

.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before {
      right: 0;
      border-width: 0.4rem 0.4rem 0.4rem 0;
      border-right-color: #000; }

.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] {
  padding: 0.4rem 0; }

.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow {
    top: 0; }

.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before {
      bottom: 0;
      border-width: 0 0.4rem 0.4rem;
      border-bottom-color: #000; }

.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] {
  padding: 0 0.4rem; }

.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow {
    right: 0;
    width: 0.4rem;
    height: 0.8rem; }

.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before {
      left: 0;
      border-width: 0.4rem 0 0.4rem 0.4rem;
      border-left-color: #000; }

.tooltip-inner {
  max-width: 200px;
  padding: 0.25rem 0.5rem;
  color: #fff;
  text-align: center;
  background-color: #000;
  border-radius: 10px 10px 0 10px; }

.popover {
  position: absolute;
  top: 0;
  left: 0;
  z-index: 1060;
  display: block;
  max-width: 276px;
  font-family: "Open Sans", sans-serif;
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  word-spacing: normal;
  white-space: normal;
  line-break: auto;
  font-size: 0.75rem;
  word-wrap: break-word;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 10px 10px 0 10px;
  box-shadow: 0 0.25rem 0.5rem rgba(0, 0, 0, 0.2); }

.popover .arrow {
    position: absolute;
    display: block;
    width: 1rem;
    height: 0.5rem;
    margin: 0 10px 10px 0 10px; }

.popover .arrow::before, .popover .arrow::after {
      position: absolute;
      display: block;
      content: "";
      border-color: transparent;
      border-style: solid; }

.bs-popover-top, .bs-popover-auto[x-placement^="top"] {
  margin-bottom: 0.5rem; }

.bs-popover-top > .arrow, .bs-popover-auto[x-placement^="top"] > .arrow {
    bottom: calc(-0.5rem - 1px); }

.bs-popover-top > .arrow::before, .bs-popover-auto[x-placement^="top"] > .arrow::before {
      bottom: 0;
      border-width: 0.5rem 0.5rem 0;
      border-top-color: rgba(0, 0, 0, 0.25); }

.bs-popover-top > .arrow::after, .bs-popover-auto[x-placement^="top"] > .arrow::after {
      bottom: 1px;
      border-width: 0.5rem 0.5rem 0;
      border-top-color: #fff; }

.bs-popover-right, .bs-popover-auto[x-placement^="right"] {
  margin-left: 0.5rem; }

.bs-popover-right > .arrow, .bs-popover-auto[x-placement^="right"] > .arrow {
    left: calc(-0.5rem - 1px);
    width: 0.5rem;
    height: 1rem;
    margin: 10px 10px 0 10px 0; }

.bs-popover-right > .arrow::before, .bs-popover-auto[x-placement^="right"] > .arrow::before {
      left: 0;
      border-width: 0.5rem 0.5rem 0.5rem 0;
      border-right-color: rgba(0, 0, 0, 0.25); }

.bs-popover-right > .arrow::after, .bs-popover-auto[x-placement^="right"] > .arrow::after {
      left: 1px;
      border-width: 0.5rem 0.5rem 0.5rem 0;
      border-right-color: #fff; }

.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] {
  margin-top: 0.5rem; }

.bs-popover-bottom > .arrow, .bs-popover-auto[x-placement^="bottom"] > .arrow {
    top: calc(-0.5rem - 1px); }

.bs-popover-bottom > .arrow::before, .bs-popover-auto[x-placement^="bottom"] > .arrow::before {
      top: 0;
      border-width: 0 0.5rem 0.5rem 0.5rem;
      border-bottom-color: rgba(0, 0, 0, 0.25); }

.bs-popover-bottom > .arrow::after, .bs-popover-auto[x-placement^="bottom"] > .arrow::after {
      top: 1px;
      border-width: 0 0.5rem 0.5rem 0.5rem;
      border-bottom-color: #fff; }

.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before {
    position: absolute;
    top: 0;
    left: 50%;
    display: block;
    width: 1rem;
    margin-left: -0.5rem;
    content: "";
    border-bottom: 1px solid #f7f7f7; }

.bs-popover-left, .bs-popover-auto[x-placement^="left"] {
  margin-right: 0.5rem; }

.bs-popover-left > .arrow, .bs-popover-auto[x-placement^="left"] > .arrow {
    right: calc(-0.5rem - 1px);
    width: 0.5rem;
    height: 1rem;
    margin: 10px 10px 0 10px 0; }

.bs-popover-left > .arrow::before, .bs-popover-auto[x-placement^="left"] > .arrow::before {
      right: 0;
      border-width: 0.5rem 0 0.5rem 0.5rem;
      border-left-color: rgba(0, 0, 0, 0.25); }

.bs-popover-left > .arrow::after, .bs-popover-auto[x-placement^="left"] > .arrow::after {
      right: 1px;
      border-width: 0.5rem 0 0.5rem 0.5rem;
      border-left-color: #fff; }

.popover-header {
  padding: 0.5rem 0.75rem;
  margin-bottom: 0;
  font-size: 0.875rem;
  background-color: #f7f7f7;
  border-bottom: 1px solid #ebebeb;
  border-top-left-radius: calc(10px 10px 0 10px - 1px);
  border-top-right-radius: calc(10px 10px 0 10px - 1px); }

.popover-header:empty {
    display: none; }

.popover-body {
  padding: 0.5rem 0.75rem;
  color: #737B8E; }

.carousel {
  position: relative; }

.carousel.pointer-event {
  touch-action: pan-y; }

.carousel-inner {
  position: relative;
  width: 100%;
  overflow: hidden; }

.carousel-inner::after {
    display: block;
    clear: both;
    content: ""; }

.carousel-item {
  position: relative;
  display: none;
  float: left;
  width: 100%;
  margin-right: -100%;
  backface-visibility: hidden;
  transition: transform 0.6s ease-in-out; }

@media (prefers-reduced-motion: reduce) {
    .carousel-item {
      transition: none; } }

.carousel-item.active,
.carousel-item-next,
.carousel-item-prev {
  display: block; }

.carousel-item-next:not(.carousel-item-left),
.active.carousel-item-right {
  transform: translateX(100%); }

.carousel-item-prev:not(.carousel-item-right),
.active.carousel-item-left {
  transform: translateX(-100%); }

.carousel-fade .carousel-item {
  opacity: 0;
  transition-property: opacity;
  transform: none; }

.carousel-fade .carousel-item.active,
.carousel-fade .carousel-item-next.carousel-item-left,
.carousel-fade .carousel-item-prev.carousel-item-right {
  z-index: 1;
  opacity: 1; }

.carousel-fade .active.carousel-item-left,
.carousel-fade .active.carousel-item-right {
  z-index: 0;
  opacity: 0;
  transition: opacity 0s 0.6s; }

@media (prefers-reduced-motion: reduce) {
    .carousel-fade .active.carousel-item-left,
    .carousel-fade .active.carousel-item-right {
      transition: none; } }

.carousel-control-prev,
.carousel-control-next {
  position: absolute;
  top: 0;
  bottom: 0;
  z-index: 1;
  display: flex;
  align-items: center;
  justify-content: center;
  width: 15%;
  color: #fff;
  text-align: center;
  opacity: 0.5;
  transition: opacity 0.15s ease; }

@media (prefers-reduced-motion: reduce) {
    .carousel-control-prev,
    .carousel-control-next {
      transition: none; } }

.carousel-control-prev:hover, .carousel-control-prev:focus,
  .carousel-control-next:hover,
  .carousel-control-next:focus {
    color: #fff;
    text-decoration: none;
    outline: 0;
    opacity: 0.9; }

.carousel-control-prev {
  left: 0; }

.carousel-control-next {
  right: 0; }

.carousel-control-prev-icon,
.carousel-control-next-icon {
  display: inline-block;
  width: 20px;
  height: 20px;
  background: no-repeat 50% / 100% 100%; }

.carousel-control-prev-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5L4.25 4l2.5-2.5L5.25 0z'/%3e%3c/svg%3e"); }

.carousel-control-next-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5L3.75 4l-2.5 2.5L2.75 8l4-4-4-4z'/%3e%3c/svg%3e"); }

.carousel-indicators {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 15;
  display: flex;
  justify-content: center;
  padding-left: 0;
  margin-right: 15%;
  margin-left: 15%;
  list-style: none; }

.carousel-indicators li {
    box-sizing: content-box;
    flex: 0 1 auto;
    width: 30px;
    height: 3px;
    margin-right: 3px;
    margin-left: 3px;
    text-indent: -999px;
    cursor: pointer;
    background-color: #fff;
    background-clip: padding-box;
    border-top: 10px solid transparent;
    border-bottom: 10px solid transparent;
    opacity: .5;
    transition: opacity 0.6s ease; }

@media (prefers-reduced-motion: reduce) {
      .carousel-indicators li {
        transition: none; } }

.carousel-indicators .active {
    opacity: 1; }

.carousel-caption {
  position: absolute;
  right: 15%;
  bottom: 20px;
  left: 15%;
  z-index: 10;
  padding-top: 20px;
  padding-bottom: 20px;
  color: #fff;
  text-align: center; }

.align-baseline {
  vertical-align: baseline !important; }

.align-top {
  vertical-align: top !important; }

.align-middle {
  vertical-align: middle !important; }

.align-bottom {
  vertical-align: bottom !important; }

.align-text-bottom {
  vertical-align: text-bottom !important; }

.align-text-top {
  vertical-align: text-top !important; }

.bg-primary {
  color: black !important;
  background-color: #47B4AC !important; }

a.bg-primary:hover, a.bg-primary:focus,
button.bg-primary:hover,
button.bg-primary:focus {
  color: black !important;
  background-color: #398f89 !important; }

.bg-secondary {
  color: black !important;
  background-color: #323C9C !important; }

a.bg-secondary:hover, a.bg-secondary:focus,
button.bg-secondary:hover,
button.bg-secondary:focus {
  color: black !important;
  background-color: #262d75 !important; }

.bg-success {
  color: black !important;
  background-color: #47B473 !important; }

a.bg-success:hover, a.bg-success:focus,
button.bg-success:hover,
button.bg-success:focus {
  color: black !important;
  background-color: #398f5c !important; }

.bg-info {
  color: black !important;
  background-color: #1B98E0 !important; }

a.bg-info:hover, a.bg-info:focus,
button.bg-info:hover,
button.bg-info:focus {
  color: black !important;
  background-color: #1679b2 !important; }

.bg-warning {
  color: #060502 !important;
  background-color: #CCA43B !important; }

a.bg-warning:hover, a.bg-warning:focus,
button.bg-warning:hover,
button.bg-warning:focus {
  color: #060502 !important;
  background-color: #a8862c !important; }

.bg-danger {
  color: #150705 !important;
  background-color: #D75842 !important; }

a.bg-danger:hover, a.bg-danger:focus,
button.bg-danger:hover,
button.bg-danger:focus {
  color: #150705 !important;
  background-color: #be3e28 !important; }

.bg-light {
  color: #4a70a8 !important;
  background-color: #F6F8FB !important; }

a.bg-light:hover, a.bg-light:focus,
button.bg-light:hover,
button.bg-light:focus {
  color: #4a70a8 !important;
  background-color: #d3ddeb !important; }

.bg-dark {
  color: black !important;
  background-color: #01041b !important; }

a.bg-dark:hover, a.bg-dark:focus,
button.bg-dark:hover,
button.bg-dark:focus {
  color: black !important;
  background-color: black !important; }

.bg-orange {
  color: black !important;
  background-color: #323C9C !important; }

a.bg-orange:hover, a.bg-orange:focus,
button.bg-orange:hover,
button.bg-orange:focus {
  color: black !important;
  background-color: #262d75 !important; }

.bg-purple {
  color: black !important;
  background-color: #4731b6 !important; }

a.bg-purple:hover, a.bg-purple:focus,
button.bg-purple:hover,
button.bg-purple:focus {
  color: black !important;
  background-color: #37268e !important; }

.bg-skyblue {
  color: #00070d !important;
  background-color: #158df7 !important; }

a.bg-skyblue:hover, a.bg-skyblue:focus,
button.bg-skyblue:hover,
button.bg-skyblue:focus {
  color: #00070d !important;
  background-color: #0773d2 !important; }

.bg-light-gray {
  color: #4b5aa4 !important;
  background-color: #f4f5fa !important; }

a.bg-light-gray:hover, a.bg-light-gray:focus,
button.bg-light-gray:hover,
button.bg-light-gray:focus {
  color: #4b5aa4 !important;
  background-color: #d1d5ea !important; }

.bg-white {
  color: gray !important;
  background-color: #fff !important; }

a.bg-white:hover, a.bg-white:focus,
button.bg-white:hover,
button.bg-white:focus {
  color: gray !important;
  background-color: #e6e6e6 !important; }

.bg-white {
  background-color: #fff !important; }

.bg-transparent {
  background-color: transparent !important; }

.border {
  border: 1px solid #C2C6CF !important; }

.border-top {
  border-top: 1px solid #C2C6CF !important; }

.border-right {
  border-right: 1px solid #C2C6CF !important; }

.border-bottom {
  border-bottom: 1px solid #C2C6CF !important; }

.border-left {
  border-left: 1px solid #C2C6CF !important; }

.border-0 {
  border: 0 !important; }

.border-top-0 {
  border-top: 0 !important; }

.border-right-0 {
  border-right: 0 !important; }

.border-bottom-0 {
  border-bottom: 0 !important; }

.border-left-0 {
  border-left: 0 !important; }

.border-primary {
  border-color: #47B4AC !important; }

.border-secondary {
  border-color: #323C9C !important; }

.border-success {
  border-color: #47B473 !important; }

.border-info {
  border-color: #1B98E0 !important; }

.border-warning {
  border-color: #CCA43B !important; }

.border-danger {
  border-color: #D75842 !important; }

.border-light {
  border-color: #F6F8FB !important; }

.border-dark {
  border-color: #01041b !important; }

.border-orange {
  border-color: #323C9C !important; }

.border-purple {
  border-color: #4731b6 !important; }

.border-skyblue {
  border-color: #158df7 !important; }

.border-light-gray {
  border-color: #f4f5fa !important; }

.border-white {
  border-color: #fff !important; }

.border-white {
  border-color: #fff !important; }

.rounded-sm {
  border-radius: 10px 10px 0 10px !important; }

.rounded {
  border-radius: 10px 10px 0 10px !important; }

.rounded-top {
  border-top-left-radius: 10px 10px 0 10px !important;
  border-top-right-radius: 10px 10px 0 10px !important; }

.rounded-right {
  border-top-right-radius: 10px 10px 0 10px !important;
  border-bottom-right-radius: 10px 10px 0 10px !important; }

.rounded-bottom {
  border-bottom-right-radius: 10px 10px 0 10px !important;
  border-bottom-left-radius: 10px 10px 0 10px !important; }

.rounded-left {
  border-top-left-radius: 10px 10px 0 10px !important;
  border-bottom-left-radius: 10px 10px 0 10px !important; }

.rounded-lg {
  border-radius: 10px 10px 0 10px !important; }

.rounded-circle {
  border-radius: 50% !important; }

.rounded-pill {
  border-radius: 50px !important; }

.rounded-0 {
  border-radius: 0 !important; }

.clearfix::after {
  display: block;
  clear: both;
  content: ""; }

.d-none {
  display: none !important; }

.d-inline {
  display: inline !important; }

.d-inline-block {
  display: inline-block !important; }

.d-block {
  display: block !important; }

.d-table {
  display: table !important; }

.d-table-row {
  display: table-row !important; }

.d-table-cell {
  display: table-cell !important; }

.d-flex {
  display: flex !important; }

.d-inline-flex {
  display: inline-flex !important; }

@media (min-width: 576px) {
  .d-sm-none {
    display: none !important; }
  .d-sm-inline {
    display: inline !important; }
  .d-sm-inline-block {
    display: inline-block !important; }
  .d-sm-block {
    display: block !important; }
  .d-sm-table {
    display: table !important; }
  .d-sm-table-row {
    display: table-row !important; }
  .d-sm-table-cell {
    display: table-cell !important; }
  .d-sm-flex {
    display: flex !important; }
  .d-sm-inline-flex {
    display: inline-flex !important; } }

@media (min-width: 768px) {
  .d-md-none {
    display: none !important; }
  .d-md-inline {
    display: inline !important; }
  .d-md-inline-block {
    display: inline-block !important; }
  .d-md-block {
    display: block !important; }
  .d-md-table {
    display: table !important; }
  .d-md-table-row {
    display: table-row !important; }
  .d-md-table-cell {
    display: table-cell !important; }
  .d-md-flex {
    display: flex !important; }
  .d-md-inline-flex {
    display: inline-flex !important; } }

@media (min-width: 992px) {
  .d-lg-none {
    display: none !important; }
  .d-lg-inline {
    display: inline !important; }
  .d-lg-inline-block {
    display: inline-block !important; }
  .d-lg-block {
    display: block !important; }
  .d-lg-table {
    display: table !important; }
  .d-lg-table-row {
    display: table-row !important; }
  .d-lg-table-cell {
    display: table-cell !important; }
  .d-lg-flex {
    display: flex !important; }
  .d-lg-inline-flex {
    display: inline-flex !important; } }

@media (min-width: 1200px) {
  .d-xl-none {
    display: none !important; }
  .d-xl-inline {
    display: inline !important; }
  .d-xl-inline-block {
    display: inline-block !important; }
  .d-xl-block {
    display: block !important; }
  .d-xl-table {
    display: table !important; }
  .d-xl-table-row {
    display: table-row !important; }
  .d-xl-table-cell {
    display: table-cell !important; }
  .d-xl-flex {
    display: flex !important; }
  .d-xl-inline-flex {
    display: inline-flex !important; } }

@media print {
  .d-print-none {
    display: none !important; }
  .d-print-inline {
    display: inline !important; }
  .d-print-inline-block {
    display: inline-block !important; }
  .d-print-block {
    display: block !important; }
  .d-print-table {
    display: table !important; }
  .d-print-table-row {
    display: table-row !important; }
  .d-print-table-cell {
    display: table-cell !important; }
  .d-print-flex {
    display: flex !important; }
  .d-print-inline-flex {
    display: inline-flex !important; } }

.embed-responsive {
  position: relative;
  display: block;
  width: 100%;
  padding: 0;
  overflow: hidden; }

.embed-responsive::before {
    display: block;
    content: ""; }

.embed-responsive .embed-responsive-item,
  .embed-responsive iframe,
  .embed-responsive embed,
  .embed-responsive object,
  .embed-responsive video {
    position: absolute;
    top: 0;
    bottom: 0;
    left: 0;
    width: 100%;
    height: 100%;
    border: 0; }

.embed-responsive-21by9::before {
  padding-top: 42.85714%; }

.embed-responsive-16by9::before {
  padding-top: 56.25%; }

.embed-responsive-4by3::before {
  padding-top: 75%; }

.embed-responsive-1by1::before {
  padding-top: 100%; }

.flex-row {
  flex-direction: row !important; }

.flex-column {
  flex-direction: column !important; }

.flex-row-reverse {
  flex-direction: row-reverse !important; }

.flex-column-reverse {
  flex-direction: column-reverse !important; }

.flex-wrap {
  flex-wrap: wrap !important; }

.flex-nowrap {
  flex-wrap: nowrap !important; }

.flex-wrap-reverse {
  flex-wrap: wrap-reverse !important; }

.flex-fill {
  flex: 1 1 auto !important; }

.flex-grow-0 {
  flex-grow: 0 !important; }

.flex-grow-1 {
  flex-grow: 1 !important; }

.flex-shrink-0 {
  flex-shrink: 0 !important; }

.flex-shrink-1 {
  flex-shrink: 1 !important; }

.justify-content-start {
  justify-content: flex-start !important; }

.justify-content-end {
  justify-content: flex-end !important; }

.justify-content-center {
  justify-content: center !important; }

.justify-content-between {
  justify-content: space-between !important; }

.justify-content-around {
  justify-content: space-around !important; }

.align-items-start {
  align-items: flex-start !important; }

.align-items-end {
  align-items: flex-end !important; }

.align-items-center {
  align-items: center !important; }

.align-items-baseline {
  align-items: baseline !important; }

.align-items-stretch {
  align-items: stretch !important; }

.align-content-start {
  align-content: flex-start !important; }

.align-content-end {
  align-content: flex-end !important; }

.align-content-center {
  align-content: center !important; }

.align-content-between {
  align-content: space-between !important; }

.align-content-around {
  align-content: space-around !important; }

.align-content-stretch {
  align-content: stretch !important; }

.align-self-auto {
  align-self: auto !important; }

.align-self-start {
  align-self: flex-start !important; }

.align-self-end {
  align-self: flex-end !important; }

.align-self-center {
  align-self: center !important; }

.align-self-baseline {
  align-self: baseline !important; }

.align-self-stretch {
  align-self: stretch !important; }

@media (min-width: 576px) {
  .flex-sm-row {
    flex-direction: row !important; }
  .flex-sm-column {
    flex-direction: column !important; }
  .flex-sm-row-reverse {
    flex-direction: row-reverse !important; }
  .flex-sm-column-reverse {
    flex-direction: column-reverse !important; }
  .flex-sm-wrap {
    flex-wrap: wrap !important; }
  .flex-sm-nowrap {
    flex-wrap: nowrap !important; }
  .flex-sm-wrap-reverse {
    flex-wrap: wrap-reverse !important; }
  .flex-sm-fill {
    flex: 1 1 auto !important; }
  .flex-sm-grow-0 {
    flex-grow: 0 !important; }
  .flex-sm-grow-1 {
    flex-grow: 1 !important; }
  .flex-sm-shrink-0 {
    flex-shrink: 0 !important; }
  .flex-sm-shrink-1 {
    flex-shrink: 1 !important; }
  .justify-content-sm-start {
    justify-content: flex-start !important; }
  .justify-content-sm-end {
    justify-content: flex-end !important; }
  .justify-content-sm-center {
    justify-content: center !important; }
  .justify-content-sm-between {
    justify-content: space-between !important; }
  .justify-content-sm-around {
    justify-content: space-around !important; }
  .align-items-sm-start {
    align-items: flex-start !important; }
  .align-items-sm-end {
    align-items: flex-end !important; }
  .align-items-sm-center {
    align-items: center !important; }
  .align-items-sm-baseline {
    align-items: baseline !important; }
  .align-items-sm-stretch {
    align-items: stretch !important; }
  .align-content-sm-start {
    align-content: flex-start !important; }
  .align-content-sm-end {
    align-content: flex-end !important; }
  .align-content-sm-center {
    align-content: center !important; }
  .align-content-sm-between {
    align-content: space-between !important; }
  .align-content-sm-around {
    align-content: space-around !important; }
  .align-content-sm-stretch {
    align-content: stretch !important; }
  .align-self-sm-auto {
    align-self: auto !important; }
  .align-self-sm-start {
    align-self: flex-start !important; }
  .align-self-sm-end {
    align-self: flex-end !important; }
  .align-self-sm-center {
    align-self: center !important; }
  .align-self-sm-baseline {
    align-self: baseline !important; }
  .align-self-sm-stretch {
    align-self: stretch !important; } }

@media (min-width: 768px) {
  .flex-md-row {
    flex-direction: row !important; }
  .flex-md-column {
    flex-direction: column !important; }
  .flex-md-row-reverse {
    flex-direction: row-reverse !important; }
  .flex-md-column-reverse {
    flex-direction: column-reverse !important; }
  .flex-md-wrap {
    flex-wrap: wrap !important; }
  .flex-md-nowrap {
    flex-wrap: nowrap !important; }
  .flex-md-wrap-reverse {
    flex-wrap: wrap-reverse !important; }
  .flex-md-fill {
    flex: 1 1 auto !important; }
  .flex-md-grow-0 {
    flex-grow: 0 !important; }
  .flex-md-grow-1 {
    flex-grow: 1 !important; }
  .flex-md-shrink-0 {
    flex-shrink: 0 !important; }
  .flex-md-shrink-1 {
    flex-shrink: 1 !important; }
  .justify-content-md-start {
    justify-content: flex-start !important; }
  .justify-content-md-end {
    justify-content: flex-end !important; }
  .justify-content-md-center {
    justify-content: center !important; }
  .justify-content-md-between {
    justify-content: space-between !important; }
  .justify-content-md-around {
    justify-content: space-around !important; }
  .align-items-md-start {
    align-items: flex-start !important; }
  .align-items-md-end {
    align-items: flex-end !important; }
  .align-items-md-center {
    align-items: center !important; }
  .align-items-md-baseline {
    align-items: baseline !important; }
  .align-items-md-stretch {
    align-items: stretch !important; }
  .align-content-md-start {
    align-content: flex-start !important; }
  .align-content-md-end {
    align-content: flex-end !important; }
  .align-content-md-center {
    align-content: center !important; }
  .align-content-md-between {
    align-content: space-between !important; }
  .align-content-md-around {
    align-content: space-around !important; }
  .align-content-md-stretch {
    align-content: stretch !important; }
  .align-self-md-auto {
    align-self: auto !important; }
  .align-self-md-start {
    align-self: flex-start !important; }
  .align-self-md-end {
    align-self: flex-end !important; }
  .align-self-md-center {
    align-self: center !important; }
  .align-self-md-baseline {
    align-self: baseline !important; }
  .align-self-md-stretch {
    align-self: stretch !important; } }

@media (min-width: 992px) {
  .flex-lg-row {
    flex-direction: row !important; }
  .flex-lg-column {
    flex-direction: column !important; }
  .flex-lg-row-reverse {
    flex-direction: row-reverse !important; }
  .flex-lg-column-reverse {
    flex-direction: column-reverse !important; }
  .flex-lg-wrap {
    flex-wrap: wrap !important; }
  .flex-lg-nowrap {
    flex-wrap: nowrap !important; }
  .flex-lg-wrap-reverse {
    flex-wrap: wrap-reverse !important; }
  .flex-lg-fill {
    flex: 1 1 auto !important; }
  .flex-lg-grow-0 {
    flex-grow: 0 !important; }
  .flex-lg-grow-1 {
    flex-grow: 1 !important; }
  .flex-lg-shrink-0 {
    flex-shrink: 0 !important; }
  .flex-lg-shrink-1 {
    flex-shrink: 1 !important; }
  .justify-content-lg-start {
    justify-content: flex-start !important; }
  .justify-content-lg-end {
    justify-content: flex-end !important; }
  .justify-content-lg-center {
    justify-content: center !important; }
  .justify-content-lg-between {
    justify-content: space-between !important; }
  .justify-content-lg-around {
    justify-content: space-around !important; }
  .align-items-lg-start {
    align-items: flex-start !important; }
  .align-items-lg-end {
    align-items: flex-end !important; }
  .align-items-lg-center {
    align-items: center !important; }
  .align-items-lg-baseline {
    align-items: baseline !important; }
  .align-items-lg-stretch {
    align-items: stretch !important; }
  .align-content-lg-start {
    align-content: flex-start !important; }
  .align-content-lg-end {
    align-content: flex-end !important; }
  .align-content-lg-center {
    align-content: center !important; }
  .align-content-lg-between {
    align-content: space-between !important; }
  .align-content-lg-around {
    align-content: space-around !important; }
  .align-content-lg-stretch {
    align-content: stretch !important; }
  .align-self-lg-auto {
    align-self: auto !important; }
  .align-self-lg-start {
    align-self: flex-start !important; }
  .align-self-lg-end {
    align-self: flex-end !important; }
  .align-self-lg-center {
    align-self: center !important; }
  .align-self-lg-baseline {
    align-self: baseline !important; }
  .align-self-lg-stretch {
    align-self: stretch !important; } }

@media (min-width: 1200px) {
  .flex-xl-row {
    flex-direction: row !important; }
  .flex-xl-column {
    flex-direction: column !important; }
  .flex-xl-row-reverse {
    flex-direction: row-reverse !important; }
  .flex-xl-column-reverse {
    flex-direction: column-reverse !important; }
  .flex-xl-wrap {
    flex-wrap: wrap !important; }
  .flex-xl-nowrap {
    flex-wrap: nowrap !important; }
  .flex-xl-wrap-reverse {
    flex-wrap: wrap-reverse !important; }
  .flex-xl-fill {
    flex: 1 1 auto !important; }
  .flex-xl-grow-0 {
    flex-grow: 0 !important; }
  .flex-xl-grow-1 {
    flex-grow: 1 !important; }
  .flex-xl-shrink-0 {
    flex-shrink: 0 !important; }
  .flex-xl-shrink-1 {
    flex-shrink: 1 !important; }
  .justify-content-xl-start {
    justify-content: flex-start !important; }
  .justify-content-xl-end {
    justify-content: flex-end !important; }
  .justify-content-xl-center {
    justify-content: center !important; }
  .justify-content-xl-between {
    justify-content: space-between !important; }
  .justify-content-xl-around {
    justify-content: space-around !important; }
  .align-items-xl-start {
    align-items: flex-start !important; }
  .align-items-xl-end {
    align-items: flex-end !important; }
  .align-items-xl-center {
    align-items: center !important; }
  .align-items-xl-baseline {
    align-items: baseline !important; }
  .align-items-xl-stretch {
    align-items: stretch !important; }
  .align-content-xl-start {
    align-content: flex-start !important; }
  .align-content-xl-end {
    align-content: flex-end !important; }
  .align-content-xl-center {
    align-content: center !important; }
  .align-content-xl-between {
    align-content: space-between !important; }
  .align-content-xl-around {
    align-content: space-around !important; }
  .align-content-xl-stretch {
    align-content: stretch !important; }
  .align-self-xl-auto {
    align-self: auto !important; }
  .align-self-xl-start {
    align-self: flex-start !important; }
  .align-self-xl-end {
    align-self: flex-end !important; }
  .align-self-xl-center {
    align-self: center !important; }
  .align-self-xl-baseline {
    align-self: baseline !important; }
  .align-self-xl-stretch {
    align-self: stretch !important; } }

.float-left {
  float: left !important; }

.float-right {
  float: right !important; }

.float-none {
  float: none !important; }

@media (min-width: 576px) {
  .float-sm-left {
    float: left !important; }
  .float-sm-right {
    float: right !important; }
  .float-sm-none {
    float: none !important; } }

@media (min-width: 768px) {
  .float-md-left {
    float: left !important; }
  .float-md-right {
    float: right !important; }
  .float-md-none {
    float: none !important; } }

@media (min-width: 992px) {
  .float-lg-left {
    float: left !important; }
  .float-lg-right {
    float: right !important; }
  .float-lg-none {
    float: none !important; } }

@media (min-width: 1200px) {
  .float-xl-left {
    float: left !important; }
  .float-xl-right {
    float: right !important; }
  .float-xl-none {
    float: none !important; } }

.user-select-all {
  -webkit-user-select: all !important;
          user-select: all !important; }

.user-select-auto {
  -webkit-user-select: auto !important;
          user-select: auto !important; }

.user-select-none {
  -webkit-user-select: none !important;
          user-select: none !important; }

.overflow-auto {
  overflow: auto !important; }

.overflow-hidden {
  overflow: hidden !important; }

.position-static {
  position: static !important; }

.position-relative {
  position: relative !important; }

.position-absolute {
  position: absolute !important; }

.position-fixed {
  position: fixed !important; }

.position-sticky {
  position: sticky !important; }

.fixed-top {
  position: fixed;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1030; }

.fixed-bottom {
  position: fixed;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1030; }

@supports (position: sticky) {
  .sticky-top {
    position: sticky;
    top: 0;
    z-index: 1020; } }

.sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  margin: -1px;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  white-space: nowrap;
  border: 0; }

.sr-only-focusable:active, .sr-only-focusable:focus {
  position: static;
  width: auto;
  height: auto;
  overflow: visible;
  clip: auto;
  white-space: normal; }

.shadow-sm {
  box-shadow: 0px 16px 40px 0px #0000000A !important; }

.shadow {
  box-shadow: 0px 16px 40px 0px #0000000A !important; }

.shadow-lg {
  box-shadow: 0px 16px 40px 0px #0000000A !important; }

.shadow-none {
  box-shadow: none !important; }

.w-25 {
  width: 25% !important; }

.w-50 {
  width: 50% !important; }

.w-75 {
  width: 75% !important; }

.w-100 {
  width: 100% !important; }

.w-auto {
  width: auto !important; }

.h-25 {
  height: 25% !important; }

.h-50 {
  height: 50% !important; }

.h-75 {
  height: 75% !important; }

.h-100 {
  height: 100% !important; }

.h-auto {
  height: auto !important; }

.mw-100 {
  max-width: 100% !important; }

.mh-100 {
  max-height: 100% !important; }

.min-vw-100 {
  min-width: 100vw !important; }

.min-vh-100 {
  min-height: 100vh !important; }

.vw-100 {
  width: 100vw !important; }

.vh-100 {
  height: 100vh !important; }

.m-0 {
  margin: 0 !important; }

.mt-0,
.my-0 {
  margin-top: 0 !important; }

.mr-0,
.mx-0 {
  margin-right: 0 !important; }

.mb-0,
.my-0 {
  margin-bottom: 0 !important; }

.ml-0,
.mx-0 {
  margin-left: 0 !important; }

.m-1 {
  margin: 0.3125rem !important; }

.mt-1,
.my-1 {
  margin-top: 0.3125rem !important; }

.mr-1,
.mx-1 {
  margin-right: 0.3125rem !important; }

.mb-1,
.my-1 {
  margin-bottom: 0.3125rem !important; }

.ml-1,
.mx-1 {
  margin-left: 0.3125rem !important; }

.m-2 {
  margin: 0.625rem !important; }

.mt-2,
.my-2 {
  margin-top: 0.625rem !important; }

.mr-2,
.mx-2 {
  margin-right: 0.625rem !important; }

.mb-2,
.my-2 {
  margin-bottom: 0.625rem !important; }

.ml-2,
.mx-2 {
  margin-left: 0.625rem !important; }

.m-3 {
  margin: 1.25rem !important; }

.mt-3,
.my-3 {
  margin-top: 1.25rem !important; }

.mr-3,
.mx-3 {
  margin-right: 1.25rem !important; }

.mb-3,
.my-3 {
  margin-bottom: 1.25rem !important; }

.ml-3,
.mx-3 {
  margin-left: 1.25rem !important; }

.m-4 {
  margin: 1.875rem !important; }

.mt-4,
.my-4 {
  margin-top: 1.875rem !important; }

.mr-4,
.mx-4 {
  margin-right: 1.875rem !important; }

.mb-4,
.my-4 {
  margin-bottom: 1.875rem !important; }

.ml-4,
.mx-4 {
  margin-left: 1.875rem !important; }

.m-5 {
  margin: 2.5rem !important; }

.mt-5,
.my-5 {
  margin-top: 2.5rem !important; }

.mr-5,
.mx-5 {
  margin-right: 2.5rem !important; }

.mb-5,
.my-5 {
  margin-bottom: 2.5rem !important; }

.ml-5,
.mx-5 {
  margin-left: 2.5rem !important; }

.p-0 {
  padding: 0 !important; }

.pt-0,
.py-0 {
  padding-top: 0 !important; }

.pr-0,
.px-0 {
  padding-right: 0 !important; }

.pb-0,
.py-0 {
  padding-bottom: 0 !important; }

.pl-0,
.px-0 {
  padding-left: 0 !important; }

.p-1 {
  padding: 0.3125rem !important; }

.pt-1,
.py-1 {
  padding-top: 0.3125rem !important; }

.pr-1,
.px-1 {
  padding-right: 0.3125rem !important; }

.pb-1,
.py-1 {
  padding-bottom: 0.3125rem !important; }

.pl-1,
.px-1 {
  padding-left: 0.3125rem !important; }

.p-2 {
  padding: 0.625rem !important; }

.pt-2,
.py-2 {
  padding-top: 0.625rem !important; }

.pr-2,
.px-2 {
  padding-right: 0.625rem !important; }

.pb-2,
.py-2 {
  padding-bottom: 0.625rem !important; }

.pl-2,
.px-2 {
  padding-left: 0.625rem !important; }

.p-3 {
  padding: 1.25rem !important; }

.pt-3,
.py-3 {
  padding-top: 1.25rem !important; }

.pr-3,
.px-3 {
  padding-right: 1.25rem !important; }

.pb-3,
.py-3 {
  padding-bottom: 1.25rem !important; }

.pl-3,
.px-3 {
  padding-left: 1.25rem !important; }

.p-4 {
  padding: 1.875rem !important; }

.pt-4,
.py-4 {
  padding-top: 1.875rem !important; }

.pr-4,
.px-4 {
  padding-right: 1.875rem !important; }

.pb-4,
.py-4 {
  padding-bottom: 1.875rem !important; }

.pl-4,
.px-4 {
  padding-left: 1.875rem !important; }

.p-5 {
  padding: 2.5rem !important; }

.pt-5,
.py-5 {
  padding-top: 2.5rem !important; }

.pr-5,
.px-5 {
  padding-right: 2.5rem !important; }

.pb-5,
.py-5 {
  padding-bottom: 2.5rem !important; }

.pl-5,
.px-5 {
  padding-left: 2.5rem !important; }

.m-n1 {
  margin: -0.3125rem !important; }

.mt-n1,
.my-n1 {
  margin-top: -0.3125rem !important; }

.mr-n1,
.mx-n1 {
  margin-right: -0.3125rem !important; }

.mb-n1,
.my-n1 {
  margin-bottom: -0.3125rem !important; }

.ml-n1,
.mx-n1 {
  margin-left: -0.3125rem !important; }

.m-n2 {
  margin: -0.625rem !important; }

.mt-n2,
.my-n2 {
  margin-top: -0.625rem !important; }

.mr-n2,
.mx-n2 {
  margin-right: -0.625rem !important; }

.mb-n2,
.my-n2 {
  margin-bottom: -0.625rem !important; }

.ml-n2,
.mx-n2 {
  margin-left: -0.625rem !important; }

.m-n3 {
  margin: -1.25rem !important; }

.mt-n3,
.my-n3 {
  margin-top: -1.25rem !important; }

.mr-n3,
.mx-n3 {
  margin-right: -1.25rem !important; }

.mb-n3,
.my-n3 {
  margin-bottom: -1.25rem !important; }

.ml-n3,
.mx-n3 {
  margin-left: -1.25rem !important; }

.m-n4 {
  margin: -1.875rem !important; }

.mt-n4,
.my-n4 {
  margin-top: -1.875rem !important; }

.mr-n4,
.mx-n4 {
  margin-right: -1.875rem !important; }

.mb-n4,
.my-n4 {
  margin-bottom: -1.875rem !important; }

.ml-n4,
.mx-n4 {
  margin-left: -1.875rem !important; }

.m-n5 {
  margin: -2.5rem !important; }

.mt-n5,
.my-n5 {
  margin-top: -2.5rem !important; }

.mr-n5,
.mx-n5 {
  margin-right: -2.5rem !important; }

.mb-n5,
.my-n5 {
  margin-bottom: -2.5rem !important; }

.ml-n5,
.mx-n5 {
  margin-left: -2.5rem !important; }

.m-auto {
  margin: auto !important; }

.mt-auto,
.my-auto {
  margin-top: auto !important; }

.mr-auto,
.mx-auto {
  margin-right: auto !important; }

.mb-auto,
.my-auto {
  margin-bottom: auto !important; }

.ml-auto,
.mx-auto {
  margin-left: auto !important; }

@media (min-width: 576px) {
  .m-sm-0 {
    margin: 0 !important; }
  .mt-sm-0,
  .my-sm-0 {
    margin-top: 0 !important; }
  .mr-sm-0,
  .mx-sm-0 {
    margin-right: 0 !important; }
  .mb-sm-0,
  .my-sm-0 {
    margin-bottom: 0 !important; }
  .ml-sm-0,
  .mx-sm-0 {
    margin-left: 0 !important; }
  .m-sm-1 {
    margin: 0.3125rem !important; }
  .mt-sm-1,
  .my-sm-1 {
    margin-top: 0.3125rem !important; }
  .mr-sm-1,
  .mx-sm-1 {
    margin-right: 0.3125rem !important; }
  .mb-sm-1,
  .my-sm-1 {
    margin-bottom: 0.3125rem !important; }
  .ml-sm-1,
  .mx-sm-1 {
    margin-left: 0.3125rem !important; }
  .m-sm-2 {
    margin: 0.625rem !important; }
  .mt-sm-2,
  .my-sm-2 {
    margin-top: 0.625rem !important; }
  .mr-sm-2,
  .mx-sm-2 {
    margin-right: 0.625rem !important; }
  .mb-sm-2,
  .my-sm-2 {
    margin-bottom: 0.625rem !important; }
  .ml-sm-2,
  .mx-sm-2 {
    margin-left: 0.625rem !important; }
  .m-sm-3 {
    margin: 1.25rem !important; }
  .mt-sm-3,
  .my-sm-3 {
    margin-top: 1.25rem !important; }
  .mr-sm-3,
  .mx-sm-3 {
    margin-right: 1.25rem !important; }
  .mb-sm-3,
  .my-sm-3 {
    margin-bottom: 1.25rem !important; }
  .ml-sm-3,
  .mx-sm-3 {
    margin-left: 1.25rem !important; }
  .m-sm-4 {
    margin: 1.875rem !important; }
  .mt-sm-4,
  .my-sm-4 {
    margin-top: 1.875rem !important; }
  .mr-sm-4,
  .mx-sm-4 {
    margin-right: 1.875rem !important; }
  .mb-sm-4,
  .my-sm-4 {
    margin-bottom: 1.875rem !important; }
  .ml-sm-4,
  .mx-sm-4 {
    margin-left: 1.875rem !important; }
  .m-sm-5 {
    margin: 2.5rem !important; }
  .mt-sm-5,
  .my-sm-5 {
    margin-top: 2.5rem !important; }
  .mr-sm-5,
  .mx-sm-5 {
    margin-right: 2.5rem !important; }
  .mb-sm-5,
  .my-sm-5 {
    margin-bottom: 2.5rem !important; }
  .ml-sm-5,
  .mx-sm-5 {
    margin-left: 2.5rem !important; }
  .p-sm-0 {
    padding: 0 !important; }
  .pt-sm-0,
  .py-sm-0 {
    padding-top: 0 !important; }
  .pr-sm-0,
  .px-sm-0 {
    padding-right: 0 !important; }
  .pb-sm-0,
  .py-sm-0 {
    padding-bottom: 0 !important; }
  .pl-sm-0,
  .px-sm-0 {
    padding-left: 0 !important; }
  .p-sm-1 {
    padding: 0.3125rem !important; }
  .pt-sm-1,
  .py-sm-1 {
    padding-top: 0.3125rem !important; }
  .pr-sm-1,
  .px-sm-1 {
    padding-right: 0.3125rem !important; }
  .pb-sm-1,
  .py-sm-1 {
    padding-bottom: 0.3125rem !important; }
  .pl-sm-1,
  .px-sm-1 {
    padding-left: 0.3125rem !important; }
  .p-sm-2 {
    padding: 0.625rem !important; }
  .pt-sm-2,
  .py-sm-2 {
    padding-top: 0.625rem !important; }
  .pr-sm-2,
  .px-sm-2 {
    padding-right: 0.625rem !important; }
  .pb-sm-2,
  .py-sm-2 {
    padding-bottom: 0.625rem !important; }
  .pl-sm-2,
  .px-sm-2 {
    padding-left: 0.625rem !important; }
  .p-sm-3 {
    padding: 1.25rem !important; }
  .pt-sm-3,
  .py-sm-3 {
    padding-top: 1.25rem !important; }
  .pr-sm-3,
  .px-sm-3 {
    padding-right: 1.25rem !important; }
  .pb-sm-3,
  .py-sm-3 {
    padding-bottom: 1.25rem !important; }
  .pl-sm-3,
  .px-sm-3 {
    padding-left: 1.25rem !important; }
  .p-sm-4 {
    padding: 1.875rem !important; }
  .pt-sm-4,
  .py-sm-4 {
    padding-top: 1.875rem !important; }
  .pr-sm-4,
  .px-sm-4 {
    padding-right: 1.875rem !important; }
  .pb-sm-4,
  .py-sm-4 {
    padding-bottom: 1.875rem !important; }
  .pl-sm-4,
  .px-sm-4 {
    padding-left: 1.875rem !important; }
  .p-sm-5 {
    padding: 2.5rem !important; }
  .pt-sm-5,
  .py-sm-5 {
    padding-top: 2.5rem !important; }
  .pr-sm-5,
  .px-sm-5 {
    padding-right: 2.5rem !important; }
  .pb-sm-5,
  .py-sm-5 {
    padding-bottom: 2.5rem !important; }
  .pl-sm-5,
  .px-sm-5 {
    padding-left: 2.5rem !important; }
  .m-sm-n1 {
    margin: -0.3125rem !important; }
  .mt-sm-n1,
  .my-sm-n1 {
    margin-top: -0.3125rem !important; }
  .mr-sm-n1,
  .mx-sm-n1 {
    margin-right: -0.3125rem !important; }
  .mb-sm-n1,
  .my-sm-n1 {
    margin-bottom: -0.3125rem !important; }
  .ml-sm-n1,
  .mx-sm-n1 {
    margin-left: -0.3125rem !important; }
  .m-sm-n2 {
    margin: -0.625rem !important; }
  .mt-sm-n2,
  .my-sm-n2 {
    margin-top: -0.625rem !important; }
  .mr-sm-n2,
  .mx-sm-n2 {
    margin-right: -0.625rem !important; }
  .mb-sm-n2,
  .my-sm-n2 {
    margin-bottom: -0.625rem !important; }
  .ml-sm-n2,
  .mx-sm-n2 {
    margin-left: -0.625rem !important; }
  .m-sm-n3 {
    margin: -1.25rem !important; }
  .mt-sm-n3,
  .my-sm-n3 {
    margin-top: -1.25rem !important; }
  .mr-sm-n3,
  .mx-sm-n3 {
    margin-right: -1.25rem !important; }
  .mb-sm-n3,
  .my-sm-n3 {
    margin-bottom: -1.25rem !important; }
  .ml-sm-n3,
  .mx-sm-n3 {
    margin-left: -1.25rem !important; }
  .m-sm-n4 {
    margin: -1.875rem !important; }
  .mt-sm-n4,
  .my-sm-n4 {
    margin-top: -1.875rem !important; }
  .mr-sm-n4,
  .mx-sm-n4 {
    margin-right: -1.875rem !important; }
  .mb-sm-n4,
  .my-sm-n4 {
    margin-bottom: -1.875rem !important; }
  .ml-sm-n4,
  .mx-sm-n4 {
    margin-left: -1.875rem !important; }
  .m-sm-n5 {
    margin: -2.5rem !important; }
  .mt-sm-n5,
  .my-sm-n5 {
    margin-top: -2.5rem !important; }
  .mr-sm-n5,
  .mx-sm-n5 {
    margin-right: -2.5rem !important; }
  .mb-sm-n5,
  .my-sm-n5 {
    margin-bottom: -2.5rem !important; }
  .ml-sm-n5,
  .mx-sm-n5 {
    margin-left: -2.5rem !important; }
  .m-sm-auto {
    margin: auto !important; }
  .mt-sm-auto,
  .my-sm-auto {
    margin-top: auto !important; }
  .mr-sm-auto,
  .mx-sm-auto {
    margin-right: auto !important; }
  .mb-sm-auto,
  .my-sm-auto {
    margin-bottom: auto !important; }
  .ml-sm-auto,
  .mx-sm-auto {
    margin-left: auto !important; } }

@media (min-width: 768px) {
  .m-md-0 {
    margin: 0 !important; }
  .mt-md-0,
  .my-md-0 {
    margin-top: 0 !important; }
  .mr-md-0,
  .mx-md-0 {
    margin-right: 0 !important; }
  .mb-md-0,
  .my-md-0 {
    margin-bottom: 0 !important; }
  .ml-md-0,
  .mx-md-0 {
    margin-left: 0 !important; }
  .m-md-1 {
    margin: 0.3125rem !important; }
  .mt-md-1,
  .my-md-1 {
    margin-top: 0.3125rem !important; }
  .mr-md-1,
  .mx-md-1 {
    margin-right: 0.3125rem !important; }
  .mb-md-1,
  .my-md-1 {
    margin-bottom: 0.3125rem !important; }
  .ml-md-1,
  .mx-md-1 {
    margin-left: 0.3125rem !important; }
  .m-md-2 {
    margin: 0.625rem !important; }
  .mt-md-2,
  .my-md-2 {
    margin-top: 0.625rem !important; }
  .mr-md-2,
  .mx-md-2 {
    margin-right: 0.625rem !important; }
  .mb-md-2,
  .my-md-2 {
    margin-bottom: 0.625rem !important; }
  .ml-md-2,
  .mx-md-2 {
    margin-left: 0.625rem !important; }
  .m-md-3 {
    margin: 1.25rem !important; }
  .mt-md-3,
  .my-md-3 {
    margin-top: 1.25rem !important; }
  .mr-md-3,
  .mx-md-3 {
    margin-right: 1.25rem !important; }
  .mb-md-3,
  .my-md-3 {
    margin-bottom: 1.25rem !important; }
  .ml-md-3,
  .mx-md-3 {
    margin-left: 1.25rem !important; }
  .m-md-4 {
    margin: 1.875rem !important; }
  .mt-md-4,
  .my-md-4 {
    margin-top: 1.875rem !important; }
  .mr-md-4,
  .mx-md-4 {
    margin-right: 1.875rem !important; }
  .mb-md-4,
  .my-md-4 {
    margin-bottom: 1.875rem !important; }
  .ml-md-4,
  .mx-md-4 {
    margin-left: 1.875rem !important; }
  .m-md-5 {
    margin: 2.5rem !important; }
  .mt-md-5,
  .my-md-5 {
    margin-top: 2.5rem !important; }
  .mr-md-5,
  .mx-md-5 {
    margin-right: 2.5rem !important; }
  .mb-md-5,
  .my-md-5 {
    margin-bottom: 2.5rem !important; }
  .ml-md-5,
  .mx-md-5 {
    margin-left: 2.5rem !important; }
  .p-md-0 {
    padding: 0 !important; }
  .pt-md-0,
  .py-md-0 {
    padding-top: 0 !important; }
  .pr-md-0,
  .px-md-0 {
    padding-right: 0 !important; }
  .pb-md-0,
  .py-md-0 {
    padding-bottom: 0 !important; }
  .pl-md-0,
  .px-md-0 {
    padding-left: 0 !important; }
  .p-md-1 {
    padding: 0.3125rem !important; }
  .pt-md-1,
  .py-md-1 {
    padding-top: 0.3125rem !important; }
  .pr-md-1,
  .px-md-1 {
    padding-right: 0.3125rem !important; }
  .pb-md-1,
  .py-md-1 {
    padding-bottom: 0.3125rem !important; }
  .pl-md-1,
  .px-md-1 {
    padding-left: 0.3125rem !important; }
  .p-md-2 {
    padding: 0.625rem !important; }
  .pt-md-2,
  .py-md-2 {
    padding-top: 0.625rem !important; }
  .pr-md-2,
  .px-md-2 {
    padding-right: 0.625rem !important; }
  .pb-md-2,
  .py-md-2 {
    padding-bottom: 0.625rem !important; }
  .pl-md-2,
  .px-md-2 {
    padding-left: 0.625rem !important; }
  .p-md-3 {
    padding: 1.25rem !important; }
  .pt-md-3,
  .py-md-3 {
    padding-top: 1.25rem !important; }
  .pr-md-3,
  .px-md-3 {
    padding-right: 1.25rem !important; }
  .pb-md-3,
  .py-md-3 {
    padding-bottom: 1.25rem !important; }
  .pl-md-3,
  .px-md-3 {
    padding-left: 1.25rem !important; }
  .p-md-4 {
    padding: 1.875rem !important; }
  .pt-md-4,
  .py-md-4 {
    padding-top: 1.875rem !important; }
  .pr-md-4,
  .px-md-4 {
    padding-right: 1.875rem !important; }
  .pb-md-4,
  .py-md-4 {
    padding-bottom: 1.875rem !important; }
  .pl-md-4,
  .px-md-4 {
    padding-left: 1.875rem !important; }
  .p-md-5 {
    padding: 2.5rem !important; }
  .pt-md-5,
  .py-md-5 {
    padding-top: 2.5rem !important; }
  .pr-md-5,
  .px-md-5 {
    padding-right: 2.5rem !important; }
  .pb-md-5,
  .py-md-5 {
    padding-bottom: 2.5rem !important; }
  .pl-md-5,
  .px-md-5 {
    padding-left: 2.5rem !important; }
  .m-md-n1 {
    margin: -0.3125rem !important; }
  .mt-md-n1,
  .my-md-n1 {
    margin-top: -0.3125rem !important; }
  .mr-md-n1,
  .mx-md-n1 {
    margin-right: -0.3125rem !important; }
  .mb-md-n1,
  .my-md-n1 {
    margin-bottom: -0.3125rem !important; }
  .ml-md-n1,
  .mx-md-n1 {
    margin-left: -0.3125rem !important; }
  .m-md-n2 {
    margin: -0.625rem !important; }
  .mt-md-n2,
  .my-md-n2 {
    margin-top: -0.625rem !important; }
  .mr-md-n2,
  .mx-md-n2 {
    margin-right: -0.625rem !important; }
  .mb-md-n2,
  .my-md-n2 {
    margin-bottom: -0.625rem !important; }
  .ml-md-n2,
  .mx-md-n2 {
    margin-left: -0.625rem !important; }
  .m-md-n3 {
    margin: -1.25rem !important; }
  .mt-md-n3,
  .my-md-n3 {
    margin-top: -1.25rem !important; }
  .mr-md-n3,
  .mx-md-n3 {
    margin-right: -1.25rem !important; }
  .mb-md-n3,
  .my-md-n3 {
    margin-bottom: -1.25rem !important; }
  .ml-md-n3,
  .mx-md-n3 {
    margin-left: -1.25rem !important; }
  .m-md-n4 {
    margin: -1.875rem !important; }
  .mt-md-n4,
  .my-md-n4 {
    margin-top: -1.875rem !important; }
  .mr-md-n4,
  .mx-md-n4 {
    margin-right: -1.875rem !important; }
  .mb-md-n4,
  .my-md-n4 {
    margin-bottom: -1.875rem !important; }
  .ml-md-n4,
  .mx-md-n4 {
    margin-left: -1.875rem !important; }
  .m-md-n5 {
    margin: -2.5rem !important; }
  .mt-md-n5,
  .my-md-n5 {
    margin-top: -2.5rem !important; }
  .mr-md-n5,
  .mx-md-n5 {
    margin-right: -2.5rem !important; }
  .mb-md-n5,
  .my-md-n5 {
    margin-bottom: -2.5rem !important; }
  .ml-md-n5,
  .mx-md-n5 {
    margin-left: -2.5rem !important; }
  .m-md-auto {
    margin: auto !important; }
  .mt-md-auto,
  .my-md-auto {
    margin-top: auto !important; }
  .mr-md-auto,
  .mx-md-auto {
    margin-right: auto !important; }
  .mb-md-auto,
  .my-md-auto {
    margin-bottom: auto !important; }
  .ml-md-auto,
  .mx-md-auto {
    margin-left: auto !important; } }

@media (min-width: 992px) {
  .m-lg-0 {
    margin: 0 !important; }
  .mt-lg-0,
  .my-lg-0 {
    margin-top: 0 !important; }
  .mr-lg-0,
  .mx-lg-0 {
    margin-right: 0 !important; }
  .mb-lg-0,
  .my-lg-0 {
    margin-bottom: 0 !important; }
  .ml-lg-0,
  .mx-lg-0 {
    margin-left: 0 !important; }
  .m-lg-1 {
    margin: 0.3125rem !important; }
  .mt-lg-1,
  .my-lg-1 {
    margin-top: 0.3125rem !important; }
  .mr-lg-1,
  .mx-lg-1 {
    margin-right: 0.3125rem !important; }
  .mb-lg-1,
  .my-lg-1 {
    margin-bottom: 0.3125rem !important; }
  .ml-lg-1,
  .mx-lg-1 {
    margin-left: 0.3125rem !important; }
  .m-lg-2 {
    margin: 0.625rem !important; }
  .mt-lg-2,
  .my-lg-2 {
    margin-top: 0.625rem !important; }
  .mr-lg-2,
  .mx-lg-2 {
    margin-right: 0.625rem !important; }
  .mb-lg-2,
  .my-lg-2 {
    margin-bottom: 0.625rem !important; }
  .ml-lg-2,
  .mx-lg-2 {
    margin-left: 0.625rem !important; }
  .m-lg-3 {
    margin: 1.25rem !important; }
  .mt-lg-3,
  .my-lg-3 {
    margin-top: 1.25rem !important; }
  .mr-lg-3,
  .mx-lg-3 {
    margin-right: 1.25rem !important; }
  .mb-lg-3,
  .my-lg-3 {
    margin-bottom: 1.25rem !important; }
  .ml-lg-3,
  .mx-lg-3 {
    margin-left: 1.25rem !important; }
  .m-lg-4 {
    margin: 1.875rem !important; }
  .mt-lg-4,
  .my-lg-4 {
    margin-top: 1.875rem !important; }
  .mr-lg-4,
  .mx-lg-4 {
    margin-right: 1.875rem !important; }
  .mb-lg-4,
  .my-lg-4 {
    margin-bottom: 1.875rem !important; }
  .ml-lg-4,
  .mx-lg-4 {
    margin-left: 1.875rem !important; }
  .m-lg-5 {
    margin: 2.5rem !important; }
  .mt-lg-5,
  .my-lg-5 {
    margin-top: 2.5rem !important; }
  .mr-lg-5,
  .mx-lg-5 {
    margin-right: 2.5rem !important; }
  .mb-lg-5,
  .my-lg-5 {
    margin-bottom: 2.5rem !important; }
  .ml-lg-5,
  .mx-lg-5 {
    margin-left: 2.5rem !important; }
  .p-lg-0 {
    padding: 0 !important; }
  .pt-lg-0,
  .py-lg-0 {
    padding-top: 0 !important; }
  .pr-lg-0,
  .px-lg-0 {
    padding-right: 0 !important; }
  .pb-lg-0,
  .py-lg-0 {
    padding-bottom: 0 !important; }
  .pl-lg-0,
  .px-lg-0 {
    padding-left: 0 !important; }
  .p-lg-1 {
    padding: 0.3125rem !important; }
  .pt-lg-1,
  .py-lg-1 {
    padding-top: 0.3125rem !important; }
  .pr-lg-1,
  .px-lg-1 {
    padding-right: 0.3125rem !important; }
  .pb-lg-1,
  .py-lg-1 {
    padding-bottom: 0.3125rem !important; }
  .pl-lg-1,
  .px-lg-1 {
    padding-left: 0.3125rem !important; }
  .p-lg-2 {
    padding: 0.625rem !important; }
  .pt-lg-2,
  .py-lg-2 {
    padding-top: 0.625rem !important; }
  .pr-lg-2,
  .px-lg-2 {
    padding-right: 0.625rem !important; }
  .pb-lg-2,
  .py-lg-2 {
    padding-bottom: 0.625rem !important; }
  .pl-lg-2,
  .px-lg-2 {
    padding-left: 0.625rem !important; }
  .p-lg-3 {
    padding: 1.25rem !important; }
  .pt-lg-3,
  .py-lg-3 {
    padding-top: 1.25rem !important; }
  .pr-lg-3,
  .px-lg-3 {
    padding-right: 1.25rem !important; }
  .pb-lg-3,
  .py-lg-3 {
    padding-bottom: 1.25rem !important; }
  .pl-lg-3,
  .px-lg-3 {
    padding-left: 1.25rem !important; }
  .p-lg-4 {
    padding: 1.875rem !important; }
  .pt-lg-4,
  .py-lg-4 {
    padding-top: 1.875rem !important; }
  .pr-lg-4,
  .px-lg-4 {
    padding-right: 1.875rem !important; }
  .pb-lg-4,
  .py-lg-4 {
    padding-bottom: 1.875rem !important; }
  .pl-lg-4,
  .px-lg-4 {
    padding-left: 1.875rem !important; }
  .p-lg-5 {
    padding: 2.5rem !important; }
  .pt-lg-5,
  .py-lg-5 {
    padding-top: 2.5rem !important; }
  .pr-lg-5,
  .px-lg-5 {
    padding-right: 2.5rem !important; }
  .pb-lg-5,
  .py-lg-5 {
    padding-bottom: 2.5rem !important; }
  .pl-lg-5,
  .px-lg-5 {
    padding-left: 2.5rem !important; }
  .m-lg-n1 {
    margin: -0.3125rem !important; }
  .mt-lg-n1,
  .my-lg-n1 {
    margin-top: -0.3125rem !important; }
  .mr-lg-n1,
  .mx-lg-n1 {
    margin-right: -0.3125rem !important; }
  .mb-lg-n1,
  .my-lg-n1 {
    margin-bottom: -0.3125rem !important; }
  .ml-lg-n1,
  .mx-lg-n1 {
    margin-left: -0.3125rem !important; }
  .m-lg-n2 {
    margin: -0.625rem !important; }
  .mt-lg-n2,
  .my-lg-n2 {
    margin-top: -0.625rem !important; }
  .mr-lg-n2,
  .mx-lg-n2 {
    margin-right: -0.625rem !important; }
  .mb-lg-n2,
  .my-lg-n2 {
    margin-bottom: -0.625rem !important; }
  .ml-lg-n2,
  .mx-lg-n2 {
    margin-left: -0.625rem !important; }
  .m-lg-n3 {
    margin: -1.25rem !important; }
  .mt-lg-n3,
  .my-lg-n3 {
    margin-top: -1.25rem !important; }
  .mr-lg-n3,
  .mx-lg-n3 {
    margin-right: -1.25rem !important; }
  .mb-lg-n3,
  .my-lg-n3 {
    margin-bottom: -1.25rem !important; }
  .ml-lg-n3,
  .mx-lg-n3 {
    margin-left: -1.25rem !important; }
  .m-lg-n4 {
    margin: -1.875rem !important; }
  .mt-lg-n4,
  .my-lg-n4 {
    margin-top: -1.875rem !important; }
  .mr-lg-n4,
  .mx-lg-n4 {
    margin-right: -1.875rem !important; }
  .mb-lg-n4,
  .my-lg-n4 {
    margin-bottom: -1.875rem !important; }
  .ml-lg-n4,
  .mx-lg-n4 {
    margin-left: -1.875rem !important; }
  .m-lg-n5 {
    margin: -2.5rem !important; }
  .mt-lg-n5,
  .my-lg-n5 {
    margin-top: -2.5rem !important; }
  .mr-lg-n5,
  .mx-lg-n5 {
    margin-right: -2.5rem !important; }
  .mb-lg-n5,
  .my-lg-n5 {
    margin-bottom: -2.5rem !important; }
  .ml-lg-n5,
  .mx-lg-n5 {
    margin-left: -2.5rem !important; }
  .m-lg-auto {
    margin: auto !important; }
  .mt-lg-auto,
  .my-lg-auto {
    margin-top: auto !important; }
  .mr-lg-auto,
  .mx-lg-auto {
    margin-right: auto !important; }
  .mb-lg-auto,
  .my-lg-auto {
    margin-bottom: auto !important; }
  .ml-lg-auto,
  .mx-lg-auto {
    margin-left: auto !important; } }

@media (min-width: 1200px) {
  .m-xl-0 {
    margin: 0 !important; }
  .mt-xl-0,
  .my-xl-0 {
    margin-top: 0 !important; }
  .mr-xl-0,
  .mx-xl-0 {
    margin-right: 0 !important; }
  .mb-xl-0,
  .my-xl-0 {
    margin-bottom: 0 !important; }
  .ml-xl-0,
  .mx-xl-0 {
    margin-left: 0 !important; }
  .m-xl-1 {
    margin: 0.3125rem !important; }
  .mt-xl-1,
  .my-xl-1 {
    margin-top: 0.3125rem !important; }
  .mr-xl-1,
  .mx-xl-1 {
    margin-right: 0.3125rem !important; }
  .mb-xl-1,
  .my-xl-1 {
    margin-bottom: 0.3125rem !important; }
  .ml-xl-1,
  .mx-xl-1 {
    margin-left: 0.3125rem !important; }
  .m-xl-2 {
    margin: 0.625rem !important; }
  .mt-xl-2,
  .my-xl-2 {
    margin-top: 0.625rem !important; }
  .mr-xl-2,
  .mx-xl-2 {
    margin-right: 0.625rem !important; }
  .mb-xl-2,
  .my-xl-2 {
    margin-bottom: 0.625rem !important; }
  .ml-xl-2,
  .mx-xl-2 {
    margin-left: 0.625rem !important; }
  .m-xl-3 {
    margin: 1.25rem !important; }
  .mt-xl-3,
  .my-xl-3 {
    margin-top: 1.25rem !important; }
  .mr-xl-3,
  .mx-xl-3 {
    margin-right: 1.25rem !important; }
  .mb-xl-3,
  .my-xl-3 {
    margin-bottom: 1.25rem !important; }
  .ml-xl-3,
  .mx-xl-3 {
    margin-left: 1.25rem !important; }
  .m-xl-4 {
    margin: 1.875rem !important; }
  .mt-xl-4,
  .my-xl-4 {
    margin-top: 1.875rem !important; }
  .mr-xl-4,
  .mx-xl-4 {
    margin-right: 1.875rem !important; }
  .mb-xl-4,
  .my-xl-4 {
    margin-bottom: 1.875rem !important; }
  .ml-xl-4,
  .mx-xl-4 {
    margin-left: 1.875rem !important; }
  .m-xl-5 {
    margin: 2.5rem !important; }
  .mt-xl-5,
  .my-xl-5 {
    margin-top: 2.5rem !important; }
  .mr-xl-5,
  .mx-xl-5 {
    margin-right: 2.5rem !important; }
  .mb-xl-5,
  .my-xl-5 {
    margin-bottom: 2.5rem !important; }
  .ml-xl-5,
  .mx-xl-5 {
    margin-left: 2.5rem !important; }
  .p-xl-0 {
    padding: 0 !important; }
  .pt-xl-0,
  .py-xl-0 {
    padding-top: 0 !important; }
  .pr-xl-0,
  .px-xl-0 {
    padding-right: 0 !important; }
  .pb-xl-0,
  .py-xl-0 {
    padding-bottom: 0 !important; }
  .pl-xl-0,
  .px-xl-0 {
    padding-left: 0 !important; }
  .p-xl-1 {
    padding: 0.3125rem !important; }
  .pt-xl-1,
  .py-xl-1 {
    padding-top: 0.3125rem !important; }
  .pr-xl-1,
  .px-xl-1 {
    padding-right: 0.3125rem !important; }
  .pb-xl-1,
  .py-xl-1 {
    padding-bottom: 0.3125rem !important; }
  .pl-xl-1,
  .px-xl-1 {
    padding-left: 0.3125rem !important; }
  .p-xl-2 {
    padding: 0.625rem !important; }
  .pt-xl-2,
  .py-xl-2 {
    padding-top: 0.625rem !important; }
  .pr-xl-2,
  .px-xl-2 {
    padding-right: 0.625rem !important; }
  .pb-xl-2,
  .py-xl-2 {
    padding-bottom: 0.625rem !important; }
  .pl-xl-2,
  .px-xl-2 {
    padding-left: 0.625rem !important; }
  .p-xl-3 {
    padding: 1.25rem !important; }
  .pt-xl-3,
  .py-xl-3 {
    padding-top: 1.25rem !important; }
  .pr-xl-3,
  .px-xl-3 {
    padding-right: 1.25rem !important; }
  .pb-xl-3,
  .py-xl-3 {
    padding-bottom: 1.25rem !important; }
  .pl-xl-3,
  .px-xl-3 {
    padding-left: 1.25rem !important; }
  .p-xl-4 {
    padding: 1.875rem !important; }
  .pt-xl-4,
  .py-xl-4 {
    padding-top: 1.875rem !important; }
  .pr-xl-4,
  .px-xl-4 {
    padding-right: 1.875rem !important; }
  .pb-xl-4,
  .py-xl-4 {
    padding-bottom: 1.875rem !important; }
  .pl-xl-4,
  .px-xl-4 {
    padding-left: 1.875rem !important; }
  .p-xl-5 {
    padding: 2.5rem !important; }
  .pt-xl-5,
  .py-xl-5 {
    padding-top: 2.5rem !important; }
  .pr-xl-5,
  .px-xl-5 {
    padding-right: 2.5rem !important; }
  .pb-xl-5,
  .py-xl-5 {
    padding-bottom: 2.5rem !important; }
  .pl-xl-5,
  .px-xl-5 {
    padding-left: 2.5rem !important; }
  .m-xl-n1 {
    margin: -0.3125rem !important; }
  .mt-xl-n1,
  .my-xl-n1 {
    margin-top: -0.3125rem !important; }
  .mr-xl-n1,
  .mx-xl-n1 {
    margin-right: -0.3125rem !important; }
  .mb-xl-n1,
  .my-xl-n1 {
    margin-bottom: -0.3125rem !important; }
  .ml-xl-n1,
  .mx-xl-n1 {
    margin-left: -0.3125rem !important; }
  .m-xl-n2 {
    margin: -0.625rem !important; }
  .mt-xl-n2,
  .my-xl-n2 {
    margin-top: -0.625rem !important; }
  .mr-xl-n2,
  .mx-xl-n2 {
    margin-right: -0.625rem !important; }
  .mb-xl-n2,
  .my-xl-n2 {
    margin-bottom: -0.625rem !important; }
  .ml-xl-n2,
  .mx-xl-n2 {
    margin-left: -0.625rem !important; }
  .m-xl-n3 {
    margin: -1.25rem !important; }
  .mt-xl-n3,
  .my-xl-n3 {
    margin-top: -1.25rem !important; }
  .mr-xl-n3,
  .mx-xl-n3 {
    margin-right: -1.25rem !important; }
  .mb-xl-n3,
  .my-xl-n3 {
    margin-bottom: -1.25rem !important; }
  .ml-xl-n3,
  .mx-xl-n3 {
    margin-left: -1.25rem !important; }
  .m-xl-n4 {
    margin: -1.875rem !important; }
  .mt-xl-n4,
  .my-xl-n4 {
    margin-top: -1.875rem !important; }
  .mr-xl-n4,
  .mx-xl-n4 {
    margin-right: -1.875rem !important; }
  .mb-xl-n4,
  .my-xl-n4 {
    margin-bottom: -1.875rem !important; }
  .ml-xl-n4,
  .mx-xl-n4 {
    margin-left: -1.875rem !important; }
  .m-xl-n5 {
    margin: -2.5rem !important; }
  .mt-xl-n5,
  .my-xl-n5 {
    margin-top: -2.5rem !important; }
  .mr-xl-n5,
  .mx-xl-n5 {
    margin-right: -2.5rem !important; }
  .mb-xl-n5,
  .my-xl-n5 {
    margin-bottom: -2.5rem !important; }
  .ml-xl-n5,
  .mx-xl-n5 {
    margin-left: -2.5rem !important; }
  .m-xl-auto {
    margin: auto !important; }
  .mt-xl-auto,
  .my-xl-auto {
    margin-top: auto !important; }
  .mr-xl-auto,
  .mx-xl-auto {
    margin-right: auto !important; }
  .mb-xl-auto,
  .my-xl-auto {
    margin-bottom: auto !important; }
  .ml-xl-auto,
  .mx-xl-auto {
    margin-left: auto !important; } }

.stretched-link::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1;
  pointer-events: auto;
  content: "";
  background-color: rgba(0, 0, 0, 0); }

.text-monospace {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace !important; }

.text-justify {
  text-align: justify !important; }

.text-wrap {
  white-space: normal !important; }

.text-nowrap {
  white-space: nowrap !important; }

.text-truncate {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap; }

.text-left {
  text-align: left !important; }

.text-right {
  text-align: right !important; }

.text-center {
  text-align: center !important; }

@media (min-width: 576px) {
  .text-sm-left {
    text-align: left !important; }
  .text-sm-right {
    text-align: right !important; }
  .text-sm-center {
    text-align: center !important; } }

@media (min-width: 768px) {
  .text-md-left {
    text-align: left !important; }
  .text-md-right {
    text-align: right !important; }
  .text-md-center {
    text-align: center !important; } }

@media (min-width: 992px) {
  .text-lg-left {
    text-align: left !important; }
  .text-lg-right {
    text-align: right !important; }
  .text-lg-center {
    text-align: center !important; } }

@media (min-width: 1200px) {
  .text-xl-left {
    text-align: left !important; }
  .text-xl-right {
    text-align: right !important; }
  .text-xl-center {
    text-align: center !important; } }

.text-lowercase {
  text-transform: lowercase !important; }

.text-uppercase {
  text-transform: uppercase !important; }

.text-capitalize {
  text-transform: capitalize !important; }

.font-weight-light {
  font-weight: 300 !important; }

.font-weight-lighter {
  font-weight: lighter !important; }

.font-weight-normal {
  font-weight: 400 !important; }

.font-weight-bold {
  font-weight: 700 !important; }

.font-weight-bolder {
  font-weight: bolder !important; }

.font-italic {
  font-style: italic !important; }

.text-white {
  color: #fff !important; }

.text-primary {
  color: #47B4AC !important; }

a.text-primary:hover, a.text-primary:focus {
  color: #317d78 !important; }

.text-secondary {
  color: #323C9C !important; }

a.text-secondary:hover, a.text-secondary:focus {
  color: #1f2662 !important; }

.text-success {
  color: #47B473 !important; }

a.text-success:hover, a.text-success:focus {
  color: #317d50 !important; }

.text-info {
  color: #1B98E0 !important; }

a.text-info:hover, a.text-info:focus {
  color: #136a9c !important; }

.text-warning {
  color: #CCA43B !important; }

a.text-warning:hover, a.text-warning:focus {
  color: #947627 !important; }

.text-danger {
  color: #D75842 !important; }

a.text-danger:hover, a.text-danger:focus {
  color: #a93724 !important; }

.text-light {
  color: #F6F8FB !important; }

a.text-light:hover, a.text-light:focus {
  color: #c1cfe3 !important; }

.text-dark {
  color: #01041b !important; }

a.text-dark:hover, a.text-dark:focus {
  color: black !important; }

.text-orange {
  color: #323C9C !important; }

a.text-orange:hover, a.text-orange:focus {
  color: #1f2662 !important; }

.text-purple {
  color: #4731b6 !important; }

a.text-purple:hover, a.text-purple:focus {
  color: #2f217a !important; }

.text-skyblue {
  color: #158df7 !important; }

a.text-skyblue:hover, a.text-skyblue:focus {
  color: #0665b9 !important; }

.text-light-gray {
  color: #f4f5fa !important; }

a.text-light-gray:hover, a.text-light-gray:focus {
  color: #bfc5e2 !important; }

.text-white {
  color: #fff !important; }

a.text-white:hover, a.text-white:focus {
  color: #d9d9d9 !important; }

.text-body {
  color: #737B8E !important; }

.text-muted {
  color: #6c757d !important; }

.text-black-50 {
  color: rgba(0, 0, 0, 0.5) !important; }

.text-white-50 {
  color: rgba(255, 255, 255, 0.5) !important; }

.text-hide {
  font: 0/0 a;
  color: transparent;
  text-shadow: none;
  background-color: transparent;
  border: 0; }

.text-decoration-none {
  text-decoration: none !important; }

.text-break {
  word-wrap: break-word !important; }

.text-reset {
  color: inherit !important; }

.visible {
  visibility: visible !important; }

.invisible {
  visibility: hidden !important; }

@media print {
  *,
  *::before,
  *::after {
    text-shadow: none !important;
    box-shadow: none !important; }
  a:not(.btn) {
    text-decoration: underline; }
  abbr[title]::after {
    content: " (" attr(title) ")"; }
  pre {
    white-space: pre-wrap !important; }
  pre,
  blockquote {
    border: 1px solid #adb5bd;
    page-break-inside: avoid; }
  thead {
    display: table-header-group; }
  tr,
  img {
    page-break-inside: avoid; }
  p,
  h2,
  h3 {
    orphans: 3;
    widows: 3; }
  h2,
  h3 {
    page-break-after: avoid; }
  @page {
    size: a3; }
  body {
    min-width: 992px !important; }
  .container {
    min-width: 992px !important; }
  .navbar {
    display: none; }
  .badge {
    border: 1px solid #000; }
  .table {
    border-collapse: collapse !important; }
    .table td,
    .table th {
      background-color: #fff !important; }
  .table-bordered th,
  .table-bordered td {
    border: 1px solid #ccced2 !important; }
  .table-dark {
    color: inherit; }
    .table-dark th,
    .table-dark td,
    .table-dark thead th,
    .table-dark tbody + tbody {
      border-color: #C2C6CF; }
  .table .thead-dark th {
    color: inherit;
    border-color: #C2C6CF; } }

/*----------------- Grid Boxes -----------------*/

.card {
  background: #fff;
/*  -webkit-border-radius: 10px 10px 0 10px;
  -moz-border-radius: 10px 10px 0 10px;
  -ms-border-radius: 10px 10px 0 10px;
  -o-border-radius: 10px 10px 0 10px;
  border-radius: 10px 10px 0 10px;
*/  margin-bottom: 30px;
/*  border: 1px solid #C2C6CF;*/
  box-shadow: none; }

.card .card-header {
    background: transparent;
    border-radius: 0;
    padding: 20px 20px;
    margin-bottom: 0;
    align-items: center !important;
    border: 0;
    border-bottom: 1px solid #C2C6CF; }

.card .card-header .header-title .card-title {
      margin-bottom: 0; }

.card-transparent {
  background: transparent;
  border-radius: 10px 10px 0 10px;
  margin-bottom: 30px;
  border: none;
  box-shadow: none; }

.card-transparent .card-header {
    background: transparent;
    border-radius: 0;
    padding: 20px;
    margin-bottom: 0;
    align-items: center !important;
    border: none; }

.card-transparent .card-header .header-title .card-title {
      margin-bottom: 0; }

.card-body {
  padding: 20px; }

.card-header-toolbar .nav-item a {
  color: #737B8E;
  padding: 4px 12px;
  font-size: 14px; }

.card-header-toolbar .dropdown-toggle i {
  font-size: 20px;
  line-height: normal;
  vertical-align: text-bottom; }

.card-header-toolbar .dropdown-toggle::after {
  display: none; }

.card-header .dropdown-bg {
  border-radius: 10px 10px 0 10px; }

.card-block.card-stretch {
  align-items: stretch; }

.card-block.card-height-third {
  height: calc(33.33% - 30px); }

.card-block.card-height-half {
  height: calc(50% - 30px); }

.card-block.card-height {
  height: calc(100% - 30px); }

.card-block {
  display: flex;
  flex-grow: 1;
  flex-direction: column; }

.sidebar-logo {
  padding: 15px;
  width: auto;
  position: relative;
  transition: all .6s ease-in-out; }

.iq-top-navbar .wrapper-menu {
  cursor: pointer;
  margin: 0 15px 0 0; }

.iq-sidebar-logo a {
  display: flex;
  align-items: flex-start; }

.iq-sidebar-logo img {
  height: 40px; }

.navbar-list li > a.toggle-icon-effect {
  height: 40px;
  width: 40px;
  line-height: 40px;
  padding: 0 12px;
  margin: 15px 10px; }

.small-saidbar {
  position: fixed;
  width: 260px;
  z-index: 999;
  left: -300px;
  top: 0;
  height: 100vh;
  background: #fff;
  transition: all 0.7s ease-in-out;
  -ms-box-shadow: 0px 16px 40px 0px #0000000A;
  -o-box-shadow: 0px 16px 40px 0px #0000000A;
  box-shadow: 0px 16px 40px 0px #0000000A; }

.small-saidbar .iq-menu-bt-sidebar {
    display: none; }

body.sidebar-main .small-saidbar {
  left: 0; }

body.sidebar-main .small-saidbar .iq-menu-bt-sidebar {
    display: block;
    position: relative;
    z-index: 999; }

.wrapper-menu {
  font-size: 30px;
  text-align: center;
  color: #47B4AC;
  position: relative;
  transition: all .6s ease-in-out; }

.iq-sidebar-menu {
  position: relative; }

.small-saidbar .iq-sidebar-menu {
  height: 100vh; }

.small-saidbar .iq-sidebar-menu .iq-menu > li > a {
    color: #737B8E;
    padding: 10px 10px;
    margin: 0 15px 8px;
    text-align: center;
    background: rgba(255, 255, 255, 0.1);
    border-radius: 10px 10px 0 10px; }

.small-saidbar .iq-sidebar-menu .iq-menu > li i {
    font-size: 20px;
    margin-right: 10px;
    vertical-align: middle;
    display: inline-block; }

.small-saidbar .iq-sidebar-menu .iq-menu > li:hover > a {
    background-color: #47B4AC;
    color: #fff;
    box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5); }

.small-saidbar .iq-sidebar-menu .iq-menu > li:hover > a > i.iq-arrow-left {
      color: #fff; }

.small-saidbar .iq-sidebar-menu .iq-menu > li.active > a {
    background-color: #47B4AC;
    color: #fff;
    box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5); }

.small-saidbar .iq-sidebar-menu .iq-menu > li.active > a > i.iq-arrow-left {
      color: #fff; }

.small-saidbar .iq-sidebar-logo {
  padding: 15px;
  background-color:#47B4AC;
  
   }

.small-saidbar .iq-sidebar {
  position: fixed;
  top: 0;
  width: 285px;
  padding: 20px;
  margin-left: 80px;
  height: 100%;
  background: #F6F8FB;
  overflow-y: scroll;
  overflow-x: hidden;
  transition: all 0.6s ease-in-out; }

.small-saidbar .nav-pills li {
  position: relative;
  margin-bottom: 15px; }

.small-saidbar .nav-pills li a.active {
    color: #fff;
    background-color: #47B4AC;
    box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5); }

.small-saidbar .nav-pills li a.active .svg-icon {
      color: #fff; }

.small-saidbar .nav-pills li a.active:before {
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1;
      transition: all 0.6s ease-in-out; }

.small-saidbar .nav-pills .nav-item a {
  font-size: 26px;
  padding: 5px 15px;
  color: #737B8E; }

.iq-sidebar-menu .iq-menu {
  margin: 0;
  padding: 0;
  list-style-type: none; }

.iq-sidebar-menu .iq-menu li {
    list-style-type: none;
    position: relative;
    white-space: nowrap; }

.iq-sidebar-menu .iq-menu li a {
      font-size: 16px;
      white-space: nowrap;
      display: block;
      color: #535f6b;
      position: relative;
      padding: 15px 20px;
      line-height: 18px;
      display: flex;
      align-items: center;
      overflow: hidden;
      border-radius: 0;
      text-transform: capitalize; }

.iq-sidebar-menu .iq-menu li ul {
      padding-left: 0;
      position: relative;
	  	scrollbar-width: thin;
scrollbar-color: #47B4AC #ccc;
      overflow-y: scroll;
      overflow-x: hidden; }

.sidebar-toggle {
  display: none; }

.NgxEditor__Content {
  min-height: 200px;
}

.iq-saidbar-ecoo {
  padding: 10px; }

.wrapper-menu-click {
  font-size: 24px;
  text-align: center;
  line-height: 15px;
  color: #47B4AC; }

.iq-sidebar-menu .iq-menu li.active .iq-submenu li.active > a {
  color: #47B4AC; }

body.sidebar-main .small-saidbar {
  left: 0; }

@media (min-width: 992px) and (max-width: 1024px) {
  .iq-navbar-logo img {
    height: 40px; } }

@media (min-width: 1300px) {
  .sidebar-toggle {
    display: block;
    background: #DBF6F0;
    padding: 12px 10px;
    margin-right: 15px;
    border-radius: 5px;
    height: 40px;
    width: 40px;
    line-height: 17px;
    text-align: center;
    color: #47B4AC; }
  .iq-sidebar-logo a {
    display: block; }
  .small-saidbar {
    z-index: 1030;
    width: 80px;
    top: 0px;
    left: 0px;
/*    padding: 15px 0;
*/    display: flex;
    flex-direction: column; }
    .small-saidbar .iq-sidebar-menu .iq-menu li ul {
      background: #fff;
      position: absolute;
      display: block;
      top: 0;
      left: 100%;
      padding: 0;
      min-width: 200px;
      list-style: none;
      max-height: 300px;
      -webkit-opacity: 0;
      -moz-opacity: 0;
      -ms-opacity: 0;
      -o-opacity: 0;
      opacity: 0;
      visibility: hidden;
      border-radius: 0px 10px 10px 10px;
      transition: all 0.3s ease-in-out;
      box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.175); }
    .small-saidbar .iq-sidebar-menu .iq-menu li:hover ul {
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1;
      visibility: visible;
      transition: all 0.3s ease-in-out; }
    .small-saidbar .iq-sidebar-menu .iq-menu li ul#layouts {
      max-height: 300px;
      overflow: auto; }
    .small-saidbar .iq-sidebar-menu .iq-menu li ul#ui {
      max-height: 300px;
      overflow: auto;
      z-index: 10; }
    .small-saidbar .sub-scrll {
      height: 315px;
      overflow-y: scroll; }
    .small-saidbar .iq-sidebar-logo {
/*      padding: 0 15px 15px;*/ }
  .iq-footer {
    margin-left: 80px;
    width: calc(100vw - 85px); }
  .iq-top-navbar {
    width: calc(100% - 80px); }
  .small-saidbar .iq-sidebar-menu .iq-menu > li > a > span {
    font-size: 0; }
  .small-saidbar .iq-sidebar-menu .iq-menu > li > a > i {
    font-size: 26px;
    margin: 0;
    color: #737B8E;
    margin-left: -1px; }
  .iq-sidebar-menu .iq-menu li a {
    font-size: 16px;
    white-space: nowrap;
    display: block;
    color: #737B8E;
    position: relative;
    padding: 15px 20px;
    line-height: 18px;
    display: flex;
    align-items: center;
    overflow: hidden;
    border-radius: 0;
    text-transform: capitalize; }
    .iq-sidebar-menu .iq-menu li a span {
      white-space: nowrap;
      padding: 0;
      display: inline-block;
      transition: none; }
  .iq-navbar-logo {
    display: none !important; }
  .iq-sidebar-logo a {
    display: block; }
  
	
	
  body.sidebar-main .content-page {
    margin-left: 80px; }
  body.sidebar-main .iq-menu-bt-sidebar {
    display: block;
    margin-left: auto;
    margin-right: auto;
    padding-left: 0; }
  body.sidebar-main .iq-sidebar-logo a {
    display: none; }
  body.sidebar-main .iq-sidebar .iq-sidebar-menu .iq-menu li a .iq-arrow-right {
    display: none; } }

@media (max-width: 1200px) {
  .iq-menu-horizontal .iq-sidebar-h-menu {
    display: none !important; }
  .iq-menu-horizontal .iq-navbar-logo a {
    display: flex; } }

@media (max-width: 1299px) {
  body.sidebar-main .small-saidbar .small-profl {
    display: none; }
  body.sidebar-main .small-saidbar .set-text {
    display: none; }
  .iq-menu-horizontal .iq-sidebar-h-menu .iq-menu li a:first-child {
    padding-left: 20px; }
  body.sidebar-main .small-saidbar .wrapper-menu i {
    color: #47B4AC;
    cursor: pointer; }
  body.sidebar-main .small-saidbar .iq-sidebar-menu {
    overflow-y: scroll; }
  .set-text {
    display: flex;
    align-items: center; }
  .iq-sidebar-logo img {
    height: 25px; }
  .iq-sidebar-menu .iq-menu li ul {
    padding-left: 20px; } }

@media (max-width: 991px) {
  .navbar {
    position: static; }
  .iq-navbar-custom .navbar-nav.navbar-list {
    display: flex;
    flex-direction: row; }
  .search-content .iq-search-bar {
    margin: 0; }
  .chat-head .chat-profile img {
    display: none; }
  .chat-content .media .chating {
    margin: 0; }
  .chat-content .media .chat-profile img {
    display: none; } }

@media (max-width: 479px) {
  .iq-top-navbar {
    width: 100%; } }

@keyframes shadowDots {
  0% {
    box-shadow: 0 0 0 0px rgba(0, 177, 255, 0.2); }
  100% {
    box-shadow: 0 0 0 15px rgba(0, 177, 255, 0); } }

@keyframes shadow-pulse {
  0% {
    box-shadow: 0 0 0 0px rgba(0, 177, 255, 0.2); }
  100% {
    box-shadow: 0 0 0 15px rgba(0, 177, 255, 0); } }

@keyframes shadow-pulse-dots-danger {
  0% {
    box-shadow: 0 0 0 0px rgba(255, 155, 138, 0.2); }
  100% {
    box-shadow: 0 0 0 15px rgba(255, 155, 138, 0); } }

@keyframes shadow-pulse-danger {
  0% {
    box-shadow: 0 0 0 0px rgba(255, 155, 138, 0.2); }
  100% {
    box-shadow: 0 0 0 15px rgba(255, 155, 138, 0); } }

@keyframes fade-in-bottom {
  0% {
    transform: translateY(50px);
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0; }
  100% {
    transform: translateY(0);
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1; } }

.iq-top-navbar {
/*  background: #fff;*/
  padding: 0 0px 0 0px;
  min-height: 65px;
  position: fixed;
  top: 0;
  left: auto;
  right: 0;
  width: calc(20% - 80px);
  display: inline-block;
  z-index: 99;
  margin: 0;
  transition: all 0.3s ease-in-out;
/*  -webkit-box-shadow: 1px 6px 15px 0px rgba(0, 0, 0, 0.02);
  -moz-box-shadow: 1px 6px 15px 0px rgba(0, 0, 0, 0.02);
  -ms-box-shadow: 1px 6px 15px 0px rgba(0, 0, 0, 0.02);
  -o-box-shadow: 1px 6px 15px 0px rgba(0, 0, 0, 0.02);
  box-shadow: 1px 6px 15px 0px rgba(0, 0, 0, 0.02);*/
  
   }

.iq-top-navbar .iq-navbar-custom .navbar-breadcrumb {
    display: block;
    margin-left: 0px;
    padding: 20px 0; }

.iq-top-navbar .breadcrumb {
    background: transparent;
    padding: 0;
    margin: 0; }

.iq-top-navbar .breadcrumb .breadcrumb-item.active {
      color: #737B8E; }

.iq-top-navbar .breadcrumb li {
      list-style-type: none;
      font-size: 14px; }

.iq-top-navbar .breadcrumb li a {
        text-decoration: none; }

.iq-top-navbar .breadcrumb li a:hover {
          text-decoration: none; }

.iq-top-navbar .navbar-expand-lg {
    justify-content: space-between !important; }

.iq-top-navbar .iq-sub-dropdown {
    width: 300px;
    position: absolute;
    top: 100%;
    right: 0;
    left: auto;
    border: none;
    animation: fade-in-bottom 0.6s cubic-bezier(0.39, 0.575, 0.565, 1) both;
    transform: translateY(100%);
    background-color: #fff;
    transition: all 0.3s ease-in-out;
    padding: 0;
    border-radius: 10px 10px 0 10px;
    -ms-box-shadow: 0px 16px 40px 0px #0000000A;
    -o-box-shadow: 0px 16px 40px 0px #0000000A;
    box-shadow: 0px 16px 40px 0px #0000000A;
    transition: all 0.3s ease-in-out; }

.iq-top-navbar .iq-sub-dropdown .iq-card-body div {
      border-radius: 10px 10px 0 10px 10px 10px 0 10px 0 0; }

.iq-top-navbar .lang .iq-sub-dropdown {
    width: auto; }

.iq-top-navbar .iq-user-dropdown {
    position: fixed;
    left: auto;
    right: 0;
    width: 350px;
    top: 0;
    bottom: 0;
    height: 100vh;
    background: #fff;
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0;
    visibility: hidden;
    transform: translateX(100%);
    transition: all 0.3s ease-in-out; }

.iq-top-navbar .navbar-brand {
    padding: 0; }

body.sidebar-main .iq-top-navbar {
  width: calc(100% - 70px); }

.iq-top-navbar.fixed-header {
  margin: 0;
  right: 0;
  width: calc(100% - 330px);
  border-radius: 0;
  transition: all 0.3s ease-in-out; }

.navbar-breadcrumb .breadcrumb {
  padding: 0;
  background: none;
  margin-top: 5px; }

.breadcrumb-item + .breadcrumb-item::before {
  content: "\ea5f";
  font-family: 'remixicon';
  font-size: 14px;
  vertical-align: sub;
  color: #737B8E; }

.navbar-list {
  margin: 0;
  padding: 0;
  float: right; }

.navbar-list li {
    float: left;
    list-style-type: none;
    position: relative; }

.navbar-list li > .dropdown {
      line-height: 73px;
      cursor: pointer; }

.navbar-list li > .dropdown .dropdown-menu {
        animation: fade-in-bottom 0.6s cubic-bezier(0.39, 0.575, 0.565, 1) both;
        transform: translateY(100%); }

.navbar-list li .dropdown-toggle::after {
      display: none; }

.navbar-list li > a.language-title {
      font-size: 16px; }

.navbar-list li > a {
      color: #737B8E;
      font-size: 18px;
      padding: 0 10px;
      display: block;
      line-height: 65px; }

.navbar-list li > a > img {
        width: 40px;
        height: 40px;
        min-width: 40px; }

.navbar-list li a:hover {
      text-decoration: none; }

.navbar-list li .caption {
      line-height: 16px; }

.navbar-list li .caption p {
        color: #737B8E;
        font-size: 12px; }

.navbar-list li .iq-sub-dropdown .sub-card .iq-sub-card {
      padding-bottom: 0; }

.navbar-list li .iq-sub-dropdown .iq-sub-card {
      font-size: inherit;
      padding-bottom: 18px;
      line-height: normal;
      color: inherit;
      display: inline-block;
      width: 100%; }

.navbar-list li .iq-sub-dropdown .iq-sub-card:last-child {
        padding-bottom: 0; }

.navbar-list li .iq-sub-dropdown .iq-sub-card.iq-sub-card-big {
      width: auto; }

.navbar-list li .add-btn {
      line-height: 36px;
      font-size: 16px;
      margin-top: 5px; }

.navbar-list li .image-flag {
      min-width: auto;
      height: auto;
      width: auto; }

.navbar-list li .profile-detail {
      border-radius: 10px 10px 0 10px 10px 10px 0 10px 0 0; }

.navbar-list li.iq-nav-user {
    display: flex;
    align-items: flex-start; }

.navbar-list li.iq-nav-user span {
      flex: 1;
      font-size: 14px; }

.navbar-list .caption-content {
    line-height: normal; }

.badge-card {
  border-radius: 5px !important; }

.menu-tag {
  position: absolute;
  background: #737B8E;
  color: #fff;
  display: inline-block;
  top: 18px;
  left: 18px;
  font-size: 12px;
  border-radius: 90px;
  line-height: normal;
  height: 18px;
  width: 18px;
  line-height: 18px;
  text-align: center;
  display: inline-block; }

.iq-breadcrumb {
  display: none; }

.toggle-cart-info img {
  width: 50px; }

.nav-item span.dots {
  height: 6px;
  width: 6px;
  font-size: 0;
  text-align: center;
  padding: 0;
  position: absolute;
  top: 18px;
  right: 3px;
  border: 0;
  animation: shadowDots 1s infinite;
  border-radius: 50%; }

.nav-item span.count-mail {
  height: 6px;
  width: 5px;
  font-size: 10px;
  text-align: center;
  line-height: 15px;
  padding: 0;
  position: absolute;
  top: 18px;
  right: 3px;
  border: 0;
  animation: shadow-pulse 1s infinite;
  border-radius: 50%; }

.nav-item .badge.count-cart {
  height: 15px;
  width: 15px;
  font-size: 10px;
  text-align: center;
  line-height: 15px;
  padding: 0;
  position: absolute;
  top: 13px;
  right: 0px; }

.top-nav-bottom {
  margin-left: 260px;
  border-top: 1px solid #DBF6F0; }

.topnav-toolbar li a {
  display: block;
  padding: 10px 15px;
  text-transform: capitalize;
  color: #323C9C;
  border-radius: 10px 10px 0 10px; }

.topnav-toolbar li.date-today {
  background: #F6F8FB; }

.topnav-toolbar li.active a {
  background: #DBF6F0;
  color: #47B4AC; }

.topnav-toolbar ul li {
  list-style: none;
  padding: 13px 0; }

.iq-search-bar {
  width: 100%; }

.iq-search-bar .searchbox {
    width: 100%;
    position: relative; }

.iq-search-bar .search-input {
    width: 100%;
    height: 40px;
    padding: 10px 40px 10px 20px;
    border-radius: 10px 10px 0 10px;
    border: 1px solid transparent;
    background-color: #ffffff; }

.iq-search-bar .search-link {
    position: absolute;
    right: 24px !important;
    top: 6px;
    color: #737B8E; }

.iq-navbar-logo {
  padding: 0;
  width: auto;
  position: relative;
  background: #fff;
  transition: all 0.3s ease-in-out;
  background: transparent; }

.iq-navbar-logo a {
    display: flex;
    align-items: center; }

.iq-navbar-logo a span {
      margin-left: 10px;
      font-size: 28px;
      line-height: 26px;
      font-weight: 500;
      color: #01041b;
      text-transform: capitalize;
      flex: 1;
      transition: all 0.3s ease-in-out; }

.iq-navbar-logo a:hover {
      text-decoration: none; }

.iq-navbar-logo a:focus {
      text-decoration: none; }

.iq-navbar-logo img {
    height: 25px; }

.iq-sub-dropdown.iq-sub-dropdown-large {
  width: 500px; }

.cust-title {
  border-bottom: 1px solid #C2C6CF; }

.crt-img {
  background: #ffffff;
  padding: 10px;
  border-radius: 10px 10px 0 10px; }

.cust-dd .btn {
  border-radius: 0 0 10px 10px 0 10px 10px 10px 0 10px; }

.dd-icon {
  position: absolute;
  right: 0;
  bottom: 0;
  width: 40px;
  height: 40px;
  background: #235854;
  color: #fff;
  border-radius: 0 0 0 10px;
  text-align: center;
  line-height: 40px;
  transition: all 0.3s ease-in-out;
  display: flex;
  align-items: center;
  justify-content: center; }

.right-ic {
  border-radius: 0 0 10px 10px 0 10px 10px 10px 0 10px;
  overflow: hidden;
  border: none !important; }

.right-ic:hover .dd-icon {
    background: #47B4AC; }

.iq-show .iq-sub-dropdown {
  display: inline-block; }

.iq-sub-dropdown .iq-card-icon {
  width: 45px;
  height: 45px;
  line-height: 40px;
  font-size: 22px; }

.show-data .iq-user-dropdown {
  -webkit-opacity: 1;
  -moz-opacity: 1;
  -ms-opacity: 1;
  -o-opacity: 1;
  opacity: 1;
  visibility: visible;
  transform: translateX(0);
  transition: all 0.3s ease-in-out; }

.iq-card-icon-small {
  height: 40px;
  width: 40px;
  min-width: 40px;
  line-height: 40px;
  display: inline-block;
  line-height: 40px;
  text-align: center;
  font-size: 20px;
  color: #737B8E;
  border-radius: 10px 10px 0 10px; }

i.las.iq-card-icon-small {
  line-height: 40px; }

.profile-details > a {
  margin-bottom: 15px;
  display: block;
  border-radius: 10px 10px 0 10px; }

.data-scrollbar {
  height: 100vh; }

.navbar-toggler {
  outline: none; }

.d-flex ul {
  list-style-type: none; }

.profile-detail {
  position: relative; }

.profile-detail .profile-img {
    position: absolute;
    left: 0;
    right: 0;
    bottom: -6px;
    margin: 0 auto;
    border: 0;
    background: #fff; }

.search-box {
  top: 50%;
  left: 50%;
  height: 40px;
  transform: translate(-100%, -55%);
  position: absolute;
  display: flex;
  background-color: #F6F8FB;
  border-radius: 10px 10px 0 10px; }

.search-box .iq-card-icon-small {
    border: none;
    background: #F6F8FB;
    border-radius: 10px 10px 0 10px; }

.search-box .iq-card-icon-small:hover {
      cursor: pointer; }

.search-box input {
    border: none;
    outline: 0px;
    padding: 0px 0px;
    background-color: #F6F8FB;
    border-radius: 10px 10px 0 10px;
    color: #35405A;
    font-size: 16px;
    width: 0px;
    box-sizing: border-box;
    transition: .3s;
    margin: 0px -20px; }

.search-box:hover .text {
    width: 240px;
    padding: 10px 20px; }

.iq-search-bar-header .searchbox {
  width: 400px;
  position: relative; }

.iq-search-bar-header .search-input {
  width: 100%;
  height: 35px;
  padding: 5px 15px 5px 40px;
  border-radius: 10px 10px 0 10px;
  border: 1px solid #C2C6CF;
  background-color: #ffffff; }

.iq-search-bar-header .search-link {
  position: absolute;
  left: 10px;
  top: 3px;
  color: #737B8E; }

@media (min-width: 1300px) {
  .iq-navbar-logo {
    display: none !important; }
    .iq-navbar-logo > a {
      display: none; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li a.collapsed {
    pointer-events: none; } }

@media (max-width: 1199px) {
  .iq-search-bar .searchbox {
    width: 100%; } }

@media (max-width: 1299px) {
  .iq-top-navbar {
    width: 100%;
    padding: 0px 30px 0px 30px; }
    .iq-top-navbar .iq-search-bar.device-search {
      margin-left: 20px; }
  body.sidebar-main .iq-top-navbar {
    width: 100%; } }

.search-toggle.add-btn {
  margin: 0 10px 0 12px; }

@media (min-width: 992px) {
  .navbar-list li:last-child > a {
    padding: 0 0 0 10px;
    margin-top: -6px; }
  .search-content {
    display: none; } }

@media (max-width: 991px) {
  .device-search {
    display: none; }
  .navbar-collapse {
    position: absolute;
    top: 100%;
    left: 0;
    width: 100%;
    background: #fff;
    border-radius: 10px 10px 0 10px;
    -ms-box-shadow: 0px 16px 40px 0px #0000000A;
    -o-box-shadow: 0px 16px 40px 0px #0000000A;
    box-shadow: 0px 16px 40px 0px #0000000A; }
  .navbar-nav.navbar-list {
    display: inline-block; }
  .iq-top-navbar {
    padding: 0px 15px;
    line-height: normal;
    min-height: unset; }
    .iq-top-navbar .navbar-toggler {
      color: #47B4AC;
      background: transparent;
      border: none;
      padding: 0;
      border-radius: 5px;
      font-size: 24px;
      margin-top: 0px; }
    .iq-top-navbar .iq-search-bar {
      line-height: normal; }
    .iq-top-navbar .navbar-list li .add-btn {
      margin-top: 18px; }
  .iq-search-bar .searchbox.device {
    width: 100%; }
    .iq-search-bar .searchbox.device .search-link {
      top: 12px; } }

@media (max-width: 767px) {
  .iq-top-navbar .lang .iq-sub-dropdown {
    width: 150px; } }

@media (max-width: 575px) {
  .search-toggle {
    position: relative; }
  .iq-top-navbar .iq-sub-dropdown {
    left: 0;
    right: 0;
    margin: 0 auto; }
  .iq-top-navbar .iq-search-bar {
    width: 100%; }
  .iq-top-navbar .iq-user-dropdown {
    width: 300px; }
  .navbar-list li {
    position: static; }
    .navbar-list li > a.language-title {
      font-size: 0; }
  .navbar-list li:last-child > a {
    margin-top: -6px; } }

@media (max-width: 479px) {
  .navbar-list li > a {
    padding: 0 7px; }
    .navbar-list li > a > img {
      width: 40px;
      height: 40px;
      min-width: 40px; } }

@media (max-width: 345px) {
  .navbar-list li > a {
    padding: 0 7px; }
  .iq-navbar-logo img {
    height: 20px; }
  .group-chat .chat-profile img {
    width: 40px !important;
    min-width: 40px !important;
    height: 40px !important; } }

.iq-right-fixed {
  margin: 0 15px; }

.right-sidebar-mini {
  top: 75px;
  z-index: 100;
  position: fixed;
  width: 260px;
  right: 0;
  transform: translateX(calc(111% + -2em));
  transition: all 0.3s ease-in-out; }

.right-sidebar-mini .side-left-icon {
    display: none; }

.right-sidebar-toggle {
  position: absolute;
  margin-left: -44px;
  background: #fff;
  padding: 15px;
  display: inline;
  top: 0;
  z-index: 99;
  border-radius: 50px 0 0 50px;
  -ms-box-shadow: 0px 16px 40px 0px #0000000A;
  -o-box-shadow: 0px 16px 40px 0px #0000000A;
  box-shadow: 0px 16px 40px 0px #0000000A;
  cursor: pointer; }

.right-sidebar-toggle span {
    display: none !important; }

.right-sidebar-panel {
  background-color: #fff;
  -ms-box-shadow: 0px 16px 40px 0px #0000000A;
  -o-box-shadow: 0px 16px 40px 0px #0000000A;
  box-shadow: 0px 16px 40px 0px #0000000A;
  height: 91vh;
  padding: 15px;
  overflow-y: scroll; }

.right-sidebar {
  transform: translateX(calc(10% + -1em)); }

.right-sidebar .side-right-icon {
    display: none; }

.right-sidebar .side-left-icon {
    display: block; }

@media (min-width: 1500px) {
  .right-sidebar-mini {
    transform: translateX(calc(10% + -1em)); }
    .right-sidebar-mini:hover .right-sidebar-toggle {
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1;
      margin-left: -44px;
      transition: all 0.3s ease-in-out; }
  .right-sidebar-toggle {
    z-index: -1;
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0;
    margin-left: 0;
    transition: all 0.3s ease-in-out; }
  .right-sidebar-mini.right-sidebar {
    transform: translateX(calc(111% + -2em)); }
    .right-sidebar-mini.right-sidebar .right-sidebar-toggle {
      margin-left: -44px;
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1; }
  body.right-sidebar-close footer {
    width: calc(100vw - 260px); } }

@media (min-width: 1300px) and (max-width: 1499px) {
  .right-sidebar-mini {
    transform: translateX(calc(111% + -8em)); }
    .right-sidebar-mini .media-body {
      -webkit-opacity: 0;
      -moz-opacity: 0;
      -ms-opacity: 0;
      -o-opacity: 0;
      opacity: 0; }
  .right-sidebar-mini.right-sidebar {
    transform: translateX(calc(10% + -1em)); }
    .right-sidebar-mini.right-sidebar .media-body {
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1; } }

.basic-drop-shadow {
  box-shadow: 0 0 10px rgba(0, 0, 0, 0.15); }

.bottom-left {
  box-shadow: -5px 5px 10px rgba(0, 0, 0, 0.15); }

.bottom-right {
  box-shadow: 5px 5px 10px rgba(0, 0, 0, 0.15); }

.top-left {
  box-shadow: -5px -5px 10px rgba(0, 0, 0, 0.15); }

.top-right {
  box-shadow: 5px -5px 10px rgba(0, 0, 0, 0.15); }

.shadow-bottom {
  box-shadow: 0 10px 10px -5px rgba(0, 0, 0, 0.15); }

.inner-shadow {
  box-shadow: inset 0 0 10px rgba(0, 0, 0, 0.15); }

.blur-shadow {
  box-shadow: 1px 1px 25px rgba(0, 0, 0, 0.15); }

.media-support {
  display: inline-block;
  width: 100%; }

.media-support-user-img img {
  height: 60px; }

.media-support-header {
  display: flex;
  align-items: flex-start; }

.media-support-info {
  flex: 1; }

.projects-media img {
  height: 60px; }

.iq-media-group .iq-media {
  margin-left: -20px;
  position: relative;
  z-index: 0;
  transition: all 0.3s ease-in-out; }

.iq-media-group .iq-media:hover {
    z-index: 9; }

.iq-media-group .iq-media img {
    border: 2px solid #C2C6CF; }

.iq-media-group .iq-media:first-child {
    margin-left: 0; }

.iq-media-group .iq-media.border {
  border: 2px solid #C2C6CF; }

.iq-media {
  display: inline-flex;
  background-repeat: no-repeat;
  background-position: center center;
  background-size: cover; }

.iq-media:hover {
    text-decoration: none; }

.media-pl {
  text-align: center; }

.badge {
  padding: .3em .6em !important;
  line-height: 1.3 !important;
  text-transform: capitalize !important;
  border-radius: 0px !important; }

.breadcrumb.bg-primary .breadcrumb-item + .breadcrumb-item::before {
  color: #fff; }

.alert {
  display: flex;
  align-items: stretch; }

.alert.bg-white {
    border-width: 2px; }

.alert .iq-alert-icon {
    display: flex;
    align-items: center;
    padding: 0 1.30rem 0 0; }

.alert .iq-alert-icon i {
      font-size: 2.441em;
      line-height: normal; }

.alert .iq-alert-text {
    align-self: center;
    flex-grow: 1; }

.alert .close {
    float: right;
    font-size: 20px;
    font-weight: 400;
    line-height: 1;
    color: #fff;
    text-shadow: none;
    opacity: 1; }

.close:not(:disabled):not(.disabled):focus {
  outline: none; }

.close:not(:disabled):not(.disabled):hover {
  outline: none; }

.dark .alert-primary {
  color: #47b4ac;
  background-color: rgba(71, 180, 172, 0.2);
  border-color: #cbeae8; }

.dark .alert-primary hr {
    border-top-color: #b9e3e0; }

.dark .alert-primary .alert-link {
    color: #398f89; }

.dark .alert-primary.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-secondary {
  color: #323c9c;
  background-color: rgba(50, 60, 156, 0.2);
  border-color: #c6c8e3; }

.dark .alert-secondary hr {
    border-top-color: #b5b8db; }

.dark .alert-secondary .alert-link {
    color: #262d75; }

.dark .alert-secondary.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-success {
  color: #47b473;
  background-color: rgba(71, 180, 115, 0.2);
  border-color: #cbead8; }

.dark .alert-success hr {
    border-top-color: #b9e3ca; }

.dark .alert-success .alert-link {
    color: #398f5c; }

.dark .alert-success.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-info {
  color: #1b98e0;
  background-color: rgba(27, 152, 224, 0.2);
  border-color: #bfe2f6; }

.dark .alert-info hr {
    border-top-color: #a9d8f3; }

.dark .alert-info .alert-link {
    color: #1679b2; }

.dark .alert-info.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-warning {
  color: #cca43b;
  background-color: rgba(204, 164, 59, 0.2);
  border-color: #f1e6c8; }

.dark .alert-warning hr {
    border-top-color: #ecddb4; }

.dark .alert-warning .alert-link {
    color: #a8862c; }

.dark .alert-warning.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-danger {
  color: #d75842;
  background-color: rgba(215, 88, 66, 0.2);
  border-color: #f4d0ca; }

.dark .alert-danger hr {
    border-top-color: #f0bdb5; }

.dark .alert-danger .alert-link {
    color: #be3e28; }

.dark .alert-danger.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-light {
  color: #f6f8fb;
  background-color: rgba(246, 248, 251, 0.2);
  border-color: #fcfdfe; }

.dark .alert-light hr {
    border-top-color: #e9f0f8; }

.dark .alert-light .alert-link {
    color: #d3ddeb; }

.dark .alert-light.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-dark {
  color: #01041b;
  background-color: rgba(1, 4, 27, 0.2);
  border-color: #b8b9bf; }

.dark .alert-dark hr {
    border-top-color: #abacb3; }

.dark .alert-dark .alert-link {
    color: black; }

.dark .alert-dark.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-orange {
  color: #323c9c;
  background-color: rgba(50, 60, 156, 0.2);
  border-color: #c6c8e3; }

.dark .alert-orange hr {
    border-top-color: #b5b8db; }

.dark .alert-orange .alert-link {
    color: #262d75; }

.dark .alert-orange.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-purple {
  color: #4731b6;
  background-color: rgba(71, 49, 182, 0.2);
  border-color: #cbc5eb; }

.dark .alert-purple hr {
    border-top-color: #bab2e4; }

.dark .alert-purple .alert-link {
    color: #37268e; }

.dark .alert-purple.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-skyblue {
  color: #158df7;
  background-color: rgba(21, 141, 247, 0.2);
  border-color: #bddffd; }

.dark .alert-skyblue hr {
    border-top-color: #a4d3fc; }

.dark .alert-skyblue .alert-link {
    color: #0773d2; }

.dark .alert-skyblue.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-light-gray {
  color: #f4f5fa;
  background-color: rgba(244, 245, 250, 0.2);
  border-color: #fcfcfe; }

.dark .alert-light-gray hr {
    border-top-color: #e9e9f8; }

.dark .alert-light-gray .alert-link {
    color: #d1d5ea; }

.dark .alert-light-gray.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.dark .alert-white {
  color: white;
  background-color: rgba(255, 255, 255, 0.2);
  border-color: white; }

.dark .alert-white hr {
    border-top-color: #f2f2f2; }

.dark .alert-white .alert-link {
    color: #e6e6e6; }

.dark .alert-white.bg-white {
    background-color: #0D0D0D !important;
    color: #F6F8FB !important; }

.swal2-styled.swal2-confirm {
  border: 0;
  border-radius: .25em;
  background: initial;
  background-color: rgb(127, 205, 199) !important;
  color: #fff;
  font-size: 1.0625em; }

.swal2-styled:focus {
  outline: none;
  box-shadow: 0 0 0 3px rgba(57, 144, 138, 0.3) !important; }

.iq-example-row .row > .col {
  padding-top: .75rem;
  color: #737B8E;
  padding-bottom: .75rem;
  background-color: rgba(86, 61, 124, 0.15);
  border: 1px solid rgba(86, 61, 124, 0.2); }

.iq-example-row .row > [class^=col-] {
  padding-top: .75rem;
  color: #737B8E;
  padding-bottom: .75rem;
  background-color: rgba(86, 61, 124, 0.15);
  border: 1px solid rgba(86, 61, 124, 0.2); }

.iq-example-row-flex-cols .row {
  margin-bottom: 15px;
  min-height: 10rem;
  background-color: rgba(255, 0, 0, 0.1); }

.gap-3 {
  gap: 1.25rem; }

.d-grid {
  display: grid; }

.col-auto {
  grid-column: auto; }

.col-span-full {
  grid-column: 1 / -1; }

.col-start-auto {
  grid-column-start: auto; }

.col-end-auto {
  grid-column-end: auto; }

.grid-rows-none {
  grid-template-rows: none; }

.gap-0 {
  gap: 0px; }

.gap-x-0 {
  column-gap: 0px; }

.gap-y-0 {
  row-gap: 0px; }

.grid-flow-col {
  grid-auto-flow: column; }

.grid-cols-1 {
  grid-template-columns: repeat(1, minmax(0, 1fr)); }

.grid-rows-1 {
  grid-template-rows: repeat(1, minmax(0, 1fr)); }

.col-span-1 {
  grid-column: span 1/span 1; }

.col-start-1 {
  grid-column-start: 1; }

.col-end-1 {
  grid-column-end: 1; }

.row-span-1 {
  grid-row: span 1/span 1; }

.grid-cols-2 {
  grid-template-columns: repeat(2, minmax(0, 1fr)); }

.grid-rows-2 {
  grid-template-rows: repeat(2, minmax(0, 1fr)); }

.col-span-2 {
  grid-column: span 2/span 2; }

.col-start-2 {
  grid-column-start: 2; }

.col-end-2 {
  grid-column-end: 2; }

.row-span-2 {
  grid-row: span 2/span 2; }

.grid-cols-3 {
  grid-template-columns: repeat(3, minmax(0, 1fr)); }

.grid-rows-3 {
  grid-template-rows: repeat(3, minmax(0, 1fr)); }

.col-span-3 {
  grid-column: span 3/span 3; }

.col-start-3 {
  grid-column-start: 3; }

.col-end-3 {
  grid-column-end: 3; }

.row-span-3 {
  grid-row: span 3/span 3; }

.grid-cols-4 {
  grid-template-columns: repeat(4, minmax(0, 1fr)); }

.grid-rows-4 {
  grid-template-rows: repeat(4, minmax(0, 1fr)); }

.col-span-4 {
  grid-column: span 4/span 4; }

.col-start-4 {
  grid-column-start: 4; }

.col-end-4 {
  grid-column-end: 4; }

.row-span-4 {
  grid-row: span 4/span 4; }

.grid-cols-5 {
  grid-template-columns: repeat(5, minmax(0, 1fr)); }

.grid-rows-5 {
  grid-template-rows: repeat(5, minmax(0, 1fr)); }

.col-span-5 {
  grid-column: span 5/span 5; }

.col-start-5 {
  grid-column-start: 5; }

.col-end-5 {
  grid-column-end: 5; }

.row-span-5 {
  grid-row: span 5/span 5; }

.grid-cols-6 {
  grid-template-columns: repeat(6, minmax(0, 1fr)); }

.grid-rows-6 {
  grid-template-rows: repeat(6, minmax(0, 1fr)); }

.col-span-6 {
  grid-column: span 6/span 6; }

.col-start-6 {
  grid-column-start: 6; }

.col-end-6 {
  grid-column-end: 6; }

.row-span-6 {
  grid-row: span 6/span 6; }

.grid-cols-7 {
  grid-template-columns: repeat(7, minmax(0, 1fr)); }

.grid-rows-7 {
  grid-template-rows: repeat(7, minmax(0, 1fr)); }

.col-span-7 {
  grid-column: span 7/span 7; }

.col-start-7 {
  grid-column-start: 7; }

.col-end-7 {
  grid-column-end: 7; }

.row-span-7 {
  grid-row: span 7/span 7; }

.grid-cols-8 {
  grid-template-columns: repeat(8, minmax(0, 1fr)); }

.grid-rows-8 {
  grid-template-rows: repeat(8, minmax(0, 1fr)); }

.col-span-8 {
  grid-column: span 8/span 8; }

.col-start-8 {
  grid-column-start: 8; }

.col-end-8 {
  grid-column-end: 8; }

.row-span-8 {
  grid-row: span 8/span 8; }

.grid-cols-9 {
  grid-template-columns: repeat(9, minmax(0, 1fr)); }

.grid-rows-9 {
  grid-template-rows: repeat(9, minmax(0, 1fr)); }

.col-span-9 {
  grid-column: span 9/span 9; }

.col-start-9 {
  grid-column-start: 9; }

.col-end-9 {
  grid-column-end: 9; }

.row-span-9 {
  grid-row: span 9/span 9; }

.grid-cols-10 {
  grid-template-columns: repeat(10, minmax(0, 1fr)); }

.grid-rows-10 {
  grid-template-rows: repeat(10, minmax(0, 1fr)); }

.col-span-10 {
  grid-column: span 10/span 10; }

.col-start-10 {
  grid-column-start: 10; }

.col-end-10 {
  grid-column-end: 10; }

.row-span-10 {
  grid-row: span 10/span 10; }

.grid-cols-11 {
  grid-template-columns: repeat(11, minmax(0, 1fr)); }

.grid-rows-11 {
  grid-template-rows: repeat(11, minmax(0, 1fr)); }

.col-span-11 {
  grid-column: span 11/span 11; }

.col-start-11 {
  grid-column-start: 11; }

.col-end-11 {
  grid-column-end: 11; }

.row-span-11 {
  grid-row: span 11/span 11; }

.grid-cols-12 {
  grid-template-columns: repeat(12, minmax(0, 1fr)); }

.grid-rows-12 {
  grid-template-rows: repeat(12, minmax(0, 1fr)); }

.col-span-12 {
  grid-column: span 12/span 12; }

.col-start-12 {
  grid-column-start: 12; }

.col-end-12 {
  grid-column-end: 12; }

.row-span-12 {
  grid-row: span 12/span 12; }

.grid-cols--1 {
  grid-template-columns: repeat(1, minmax(0, 1fr)); }

.grid-rows--1 {
  grid-template-rows: repeat(1, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--1 {
  grid-template-columns: repeat(1, minmax(0, 1fr)); }

.grid-rows--1 {
  grid-template-rows: repeat(1, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--sm-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--sm-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--md-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--md-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--lg-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--lg-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--xl-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-1 {
    grid-template-columns: repeat(1, minmax(0, 1fr)); }
  .grid-rows--xl-1 {
    grid-template-rows: repeat(1, minmax(0, 1fr)); } }

.grid-cols--2 {
  grid-template-columns: repeat(2, minmax(0, 1fr)); }

.grid-rows--2 {
  grid-template-rows: repeat(2, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--2 {
  grid-template-columns: repeat(2, minmax(0, 1fr)); }

.grid-rows--2 {
  grid-template-rows: repeat(2, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--sm-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--sm-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--md-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--md-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--lg-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--lg-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--xl-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-2 {
    grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .grid-rows--xl-2 {
    grid-template-rows: repeat(2, minmax(0, 1fr)); } }

.grid-cols--3 {
  grid-template-columns: repeat(3, minmax(0, 1fr)); }

.grid-rows--3 {
  grid-template-rows: repeat(3, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--3 {
  grid-template-columns: repeat(3, minmax(0, 1fr)); }

.grid-rows--3 {
  grid-template-rows: repeat(3, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--sm-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--sm-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--md-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--md-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--lg-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--lg-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--xl-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-3 {
    grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .grid-rows--xl-3 {
    grid-template-rows: repeat(3, minmax(0, 1fr)); } }

.grid-cols--4 {
  grid-template-columns: repeat(4, minmax(0, 1fr)); }

.grid-rows--4 {
  grid-template-rows: repeat(4, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--4 {
  grid-template-columns: repeat(4, minmax(0, 1fr)); }

.grid-rows--4 {
  grid-template-rows: repeat(4, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--sm-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--sm-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--md-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--md-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--lg-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--lg-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--xl-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-4 {
    grid-template-columns: repeat(4, minmax(0, 1fr)); }
  .grid-rows--xl-4 {
    grid-template-rows: repeat(4, minmax(0, 1fr)); } }

.grid-cols--5 {
  grid-template-columns: repeat(5, minmax(0, 1fr)); }

.grid-rows--5 {
  grid-template-rows: repeat(5, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--5 {
  grid-template-columns: repeat(5, minmax(0, 1fr)); }

.grid-rows--5 {
  grid-template-rows: repeat(5, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--sm-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--sm-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--md-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--md-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--lg-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--lg-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--xl-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-5 {
    grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .grid-rows--xl-5 {
    grid-template-rows: repeat(5, minmax(0, 1fr)); } }

.grid-cols--6 {
  grid-template-columns: repeat(6, minmax(0, 1fr)); }

.grid-rows--6 {
  grid-template-rows: repeat(6, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--6 {
  grid-template-columns: repeat(6, minmax(0, 1fr)); }

.grid-rows--6 {
  grid-template-rows: repeat(6, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--sm-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--sm-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--md-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--md-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--lg-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--lg-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--xl-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-6 {
    grid-template-columns: repeat(6, minmax(0, 1fr)); }
  .grid-rows--xl-6 {
    grid-template-rows: repeat(6, minmax(0, 1fr)); } }

.grid-cols--7 {
  grid-template-columns: repeat(7, minmax(0, 1fr)); }

.grid-rows--7 {
  grid-template-rows: repeat(7, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--7 {
  grid-template-columns: repeat(7, minmax(0, 1fr)); }

.grid-rows--7 {
  grid-template-rows: repeat(7, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--sm-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--sm-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--md-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--md-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--lg-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--lg-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--xl-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-7 {
    grid-template-columns: repeat(7, minmax(0, 1fr)); }
  .grid-rows--xl-7 {
    grid-template-rows: repeat(7, minmax(0, 1fr)); } }

.grid-cols--8 {
  grid-template-columns: repeat(8, minmax(0, 1fr)); }

.grid-rows--8 {
  grid-template-rows: repeat(8, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--8 {
  grid-template-columns: repeat(8, minmax(0, 1fr)); }

.grid-rows--8 {
  grid-template-rows: repeat(8, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--sm-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--sm-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--md-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--md-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--lg-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--lg-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--xl-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-8 {
    grid-template-columns: repeat(8, minmax(0, 1fr)); }
  .grid-rows--xl-8 {
    grid-template-rows: repeat(8, minmax(0, 1fr)); } }

.grid-cols--9 {
  grid-template-columns: repeat(9, minmax(0, 1fr)); }

.grid-rows--9 {
  grid-template-rows: repeat(9, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--9 {
  grid-template-columns: repeat(9, minmax(0, 1fr)); }

.grid-rows--9 {
  grid-template-rows: repeat(9, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--sm-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--sm-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--md-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--md-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--lg-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--lg-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--xl-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-9 {
    grid-template-columns: repeat(9, minmax(0, 1fr)); }
  .grid-rows--xl-9 {
    grid-template-rows: repeat(9, minmax(0, 1fr)); } }

.grid-cols--10 {
  grid-template-columns: repeat(10, minmax(0, 1fr)); }

.grid-rows--10 {
  grid-template-rows: repeat(10, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--10 {
  grid-template-columns: repeat(10, minmax(0, 1fr)); }

.grid-rows--10 {
  grid-template-rows: repeat(10, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--sm-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--sm-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--md-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--md-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--lg-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--lg-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--xl-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-10 {
    grid-template-columns: repeat(10, minmax(0, 1fr)); }
  .grid-rows--xl-10 {
    grid-template-rows: repeat(10, minmax(0, 1fr)); } }

.grid-cols--11 {
  grid-template-columns: repeat(11, minmax(0, 1fr)); }

.grid-rows--11 {
  grid-template-rows: repeat(11, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--11 {
  grid-template-columns: repeat(11, minmax(0, 1fr)); }

.grid-rows--11 {
  grid-template-rows: repeat(11, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--sm-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--sm-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--md-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--md-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--lg-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--lg-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--xl-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-11 {
    grid-template-columns: repeat(11, minmax(0, 1fr)); }
  .grid-rows--xl-11 {
    grid-template-rows: repeat(11, minmax(0, 1fr)); } }

.grid-cols--12 {
  grid-template-columns: repeat(12, minmax(0, 1fr)); }

.grid-rows--12 {
  grid-template-rows: repeat(12, minmax(0, 1fr)); }

.grid-flow-col- {
  grid-auto-flow: column; }

.grid-cols--12 {
  grid-template-columns: repeat(12, minmax(0, 1fr)); }

.grid-rows--12 {
  grid-template-rows: repeat(12, minmax(0, 1fr)); }

@media (min-width: 576px) {
  .grid-cols--sm-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--sm-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); }
  .grid-flow-col--sm {
    grid-auto-flow: column; }
  .grid-cols--sm-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--sm-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); } }

@media (min-width: 768px) {
  .grid-cols--md-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--md-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); }
  .grid-flow-col--md {
    grid-auto-flow: column; }
  .grid-cols--md-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--md-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); } }

@media (min-width: 992px) {
  .grid-cols--lg-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--lg-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); }
  .grid-flow-col--lg {
    grid-auto-flow: column; }
  .grid-cols--lg-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--lg-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); } }

@media (min-width: 1200px) {
  .grid-cols--xl-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--xl-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); }
  .grid-flow-col--xl {
    grid-auto-flow: column; }
  .grid-cols--xl-12 {
    grid-template-columns: repeat(12, minmax(0, 1fr)); }
  .grid-rows--xl-12 {
    grid-template-rows: repeat(12, minmax(0, 1fr)); } }

.nav-pills {
  border-radius: 10px 10px 0 10px; }

.nav-pills .nav-item a {
    color: #737B8E; }

.nav-pills .nav-item .nav-link {
    padding: 11px 30px; }

.nav-pills .nav-link.active {
    color: #47B4AC;
    background: #DBF6F0; }

.nav-pills .show > .nav-link {
    color: #47B4AC;
    background: #DBF6F0; }

.nav-pills .nav-link:hover {
    color: #47B4AC; }

.nav-tabs {
  border-bottom: 2px solid #DBF6F0;
  margin-bottom: 15px; }

.nav-tabs .nav-item {
    margin-bottom: -2px; }

.nav-tabs .nav-item a {
      color: #737B8E;
      border: none;
      border-bottom: 2px solid transparent; }

.nav-tabs .nav-item.show .nav-link {
    border-bottom: 2px solid #47B4AC;
    color: #47B4AC; }

.nav-tabs .nav-link.active {
    border-bottom: 2px solid #47B4AC;
    color: #47B4AC; }

ul.custom-tabs {
  margin: 0px;
  padding: 0px;
  list-style: none;
  background: #fff;
  border-radius: 10px 10px 0 10px; }

ul.custom-tabs li {
    background: none;
    color: #737B8E;
    display: inline-block;
    padding: 5px 29px;
    cursor: pointer; }

ul.custom-tabs li.active {
    background: #47B4AC;
    color: #fff;
    border-radius: 10px 10px 0 10px; }

.custom-tab-content {
  display: none; }

.custom-tab-content.active {
  display: inherit; }

.custom-checkbox .custom-control-label::before {
  border-radius: 50px; }

.custom-checkbox.custom-checkbox-color input.bg-primary ~ label::before {
  background-color: #47B4AC !important;
  border-color: #47B4AC !important;
/*  -webkit-border-radius: 10px 10px 0 10px;
  -moz-border-radius: 10px 10px 0 10px;
  -ms-border-radius: 10px 10px 0 10px;
  -o-border-radius: 10px 10px 0 10px;
  border-radius: 10px 10px 0 10px;*/
    border-radius:0px;

   }

.custom-checkbox.custom-checkbox-color input.bg-success ~ label::before {
  background-color: #47B473 !important;
  border-color: #47B473 !important; }

.custom-checkbox.custom-checkbox-color input.bg-danger ~ label::before {
  background-color: #D75842 !important;
  border-color: #D75842 !important; }

.custom-checkbox.custom-checkbox-color input.bg-warning ~ label::before {
  background-color: #CCA43B !important;
  border-color: #CCA43B !important; }

.custom-checkbox.custom-checkbox-color input.bg-dark ~ label::before {
  background-color: #737B8E !important;
  border-color: #737B8E !important; }

.custom-checkbox.custom-checkbox-color input.bg-info ~ label::before {
  background-color: #1B98E0 !important;
  border-color: #1B98E0 !important; }

.custom-checkbox.custom-checkbox-color-check input:checked.bg-primary ~ label::before {
  background-color: #47B4AC !important;
  border-color: #47B4AC !important; }

.custom-checkbox.custom-checkbox-color-check input:checked.bg-success ~ label::before {
  background-color: #47B473 !important;
  border-color: #47B473 !important; }

.custom-checkbox.custom-checkbox-color-check input:checked.bg-danger ~ label::before {
  background-color: #D75842 !important;
  border-color: #D75842 !important; }

.custom-checkbox.custom-checkbox-color-check input:checked.bg-warning ~ label::before {
  background-color: #CCA43B !important;
  border-color: #CCA43B !important; }

.custom-checkbox.custom-checkbox-color-check input:checked.bg-dark ~ label::before {
  background-color: #737B8E !important;
  border-color: #737B8E !important; }

.custom-checkbox.custom-checkbox-color-check input:checked.bg-info ~ label::before {
  background-color: #1B98E0 !important;
  border-color: #1B98E0 !important; }

.custom-radio.custom-radio-color input.bg-primary ~ label::before {
  background-color: #47B4AC !important;
  border-color: #47B4AC !important; }

.custom-radio.custom-radio-color input.bg-success ~ label::before {
  background-color: #47B473 !important;
  border-color: #47B473 !important; }

.custom-radio.custom-radio-color input.bg-danger ~ label::before {
  background-color: #D75842 !important;
  border-color: #D75842 !important; }

.custom-radio.custom-radio-color input.bg-warning ~ label::before {
  background-color: #CCA43B !important;
  border-color: #CCA43B !important; }

.custom-radio.custom-radio-color input.bg-dark ~ label::before {
  background-color: #737B8E !important;
  border-color: #737B8E !important; }

.custom-radio.custom-radio-color input.bg-info ~ label::before {
  background-color: #1B98E0 !important;
  border-color: #1B98E0 !important; }

.custom-radio.custom-radio-color-checked input:checked.bg-primary ~ label::before {
  background-color: #47B4AC !important;
  border-color: #47B4AC !important; }

.custom-radio.custom-radio-color-checked input:checked.bg-success ~ label::before {
  background-color: #47B473 !important;
  border-color: #47B473 !important; }

.custom-radio.custom-radio-color-checked input:checked.bg-danger ~ label::before {
  background-color: #D75842 !important;
  border-color: #D75842 !important; }

.custom-radio.custom-radio-color-checked input:checked.bg-warning ~ label::before {
  background-color: #CCA43B !important;
  border-color: #CCA43B !important; }

.custom-radio.custom-radio-color-checked input:checked.bg-dark ~ label::before {
  background-color: #737B8E !important;
  border-color: #737B8E !important; }

.custom-radio.custom-radio-color-checked input:checked.bg-info ~ label::before {
  background-color: #1B98E0 !important;
  border-color: #1B98E0 !important; }

.custom-switch.custom-switch-color input:checked.bg-primary ~ label::before {
  background-color: #47B4AC !important;
  border-color: #47B4AC !important; }

.custom-switch.custom-switch-color input:checked.bg-success ~ label::before {
  background-color: #47B473 !important;
  border-color: #47B473 !important; }

.custom-switch.custom-switch-color input:checked.bg-danger ~ label::before {
  background-color: #D75842 !important;
  border-color: #D75842 !important; }

.custom-switch.custom-switch-color input:checked.bg-warning ~ label::before {
  background-color: #CCA43B !important;
  border-color: #CCA43B !important; }

.custom-switch.custom-switch-color input:checked.bg-dark ~ label::before {
  background-color: #737B8E !important;
  border-color: #737B8E !important; }

.custom-switch.custom-switch-color input:checked.bg-info ~ label::before {
  background-color: #1B98E0 !important;
  border-color: #1B98E0 !important; }

.custom-checkbox.checkbox-icon label i {
  position: absolute;
  top: 6px;
  left: -21px;
  font-size: 10px;
  transform: scale(0);
  transition: all 0.3s ease-in-out; }

.custom-checkbox.checkbox-icon input:checked ~ label i {
  transform: scale(1);
  color: #fff; }

.custom-checkbox.checkbox-icon input:checked ~ label::after {
  display: none; }

/*checkboxes toggel*/

.checkbox-toggle input {
  display: none; }

.checkbox-toggle label {
  outline: 0;
  display: block;
  width: 45px;
  height: 17px;
  background: #e2e4e4;
  position: relative;
  cursor: pointer;
  border-radius: 2em;
  padding: 2px;
  transition: all 0.4s ease; }

.checkbox-toggle label:after {
    position: relative;
    display: block;
    content: "";
    width: 24px;
    height: 24px;
    border-radius: 50%;
    background: #F6F8FB;
    transition: all 0.2s ease;
    border: 1px solid #F6F8FB;
    border-color: #F6F8FB;
    box-shadow: 0 2px 4px -1px rgba(134, 95, 95, 0.2);
    left: -2px;
    top: -6px; }

.checkbox-toggle input:checked + label {
  background: #737B8E; }

.checkbox-toggle input:checked + label:after {
    left: 50%;
    background: #35405A;
    border: 1px solid #35405A; }

.custom-switch-primary label {
  background: white; }

.custom-switch-primary label:after {
    background: #47B4AC;
    border-color: #47B4AC; }

.custom-switch-primary input:checked + label {
  background: white; }

.custom-switch-secondary label {
  background: white; }

.custom-switch-secondary label:after {
    background: #323C9C;
    border-color: #323C9C; }

.custom-switch-secondary input:checked + label {
  background: white; }

.custom-switch-success label {
  background: white; }

.custom-switch-success label:after {
    background: #47B473;
    border-color: #47B473; }

.custom-switch-success input:checked + label {
  background: white; }

.custom-switch-info label {
  background: white; }

.custom-switch-info label:after {
    background: #1B98E0;
    border-color: #1B98E0; }

.custom-switch-info input:checked + label {
  background: white; }

.custom-switch-warning label {
  background: white; }

.custom-switch-warning label:after {
    background: #CCA43B;
    border-color: #CCA43B; }

.custom-switch-warning input:checked + label {
  background: white; }

.custom-switch-danger label {
  background: white; }

.custom-switch-danger label:after {
    background: #D75842;
    border-color: #D75842; }

.custom-switch-danger input:checked + label {
  background: white; }

.custom-switch-light label {
  background: white; }

.custom-switch-light label:after {
    background: #F6F8FB;
    border-color: #F6F8FB; }

.custom-switch-light input:checked + label {
  background: white; }

.custom-switch-dark label {
  background: #e9ebfe; }

.custom-switch-dark label:after {
    background: #01041b;
    border-color: #01041b; }

.custom-switch-dark input:checked + label {
  background: #e9ebfe; }

.custom-switch-orange label {
  background: white; }

.custom-switch-orange label:after {
    background: #323C9C;
    border-color: #323C9C; }

.custom-switch-orange input:checked + label {
  background: white; }

.custom-switch-purple label {
  background: white; }

.custom-switch-purple label:after {
    background: #4731b6;
    border-color: #4731b6; }

.custom-switch-purple input:checked + label {
  background: white; }

.custom-switch-skyblue label {
  background: white; }

.custom-switch-skyblue label:after {
    background: #158df7;
    border-color: #158df7; }

.custom-switch-skyblue input:checked + label {
  background: white; }

.custom-switch-light-gray label {
  background: white; }

.custom-switch-light-gray label:after {
    background: #f4f5fa;
    border-color: #f4f5fa; }

.custom-switch-light-gray input:checked + label {
  background: white; }

.custom-switch-white label {
  background: white; }

.custom-switch-white label:after {
    background: #fff;
    border-color: #fff; }

.custom-switch-white input:checked + label {
  background: white; }

/*circle checkbox*/

.checkbox.custom-checkbox {
  width: auto;
  position: relative;
  display: block; }

.checkbox.custom-checkbox input[type="checkbox"] {
    width: auto;
    opacity: 0.00000001;
    position: absolute;
    left: 0;
    margin-left: -20px; }

.checkbox.custom-checkbox label {
    position: relative;
    min-height: auto;
    padding-left: 20px;
    margin-bottom: 0;
    font-weight: normal;
    cursor: pointer;
    vertical-align: top; }

.checkbox.custom-checkbox label:before {
      content: '';
      position: absolute;
      left: 0;
      top: 0;
      margin: 3px 0 0;
      width: 20px;
      height: 20px;
      transition: transform 0.28s ease;
      border-radius: 50%;
      border: 1px solid #47B4AC; }

.checkbox.custom-checkbox label:after {
      content: '';
      width: 10px;
      height: 5px;
      border-bottom: 2px solid #fff;
      border-left: 2px solid #fff;
      transform: rotate(-45deg) scale(0);
      transition: transform ease 0.25s;
      will-change: transform;
      position: absolute;
      top: 9px;
      left: 6px; }

.checkbox.custom-checkbox label span {
      position: absolute;
      top: 50%;
      transform: translateY(-50%); }

.checkbox.custom-checkbox input[type="checkbox"]:checked ~ label::before {
    color: #fff;
    background: #47B4AC; }

.checkbox.custom-checkbox input[type="checkbox"]:checked ~ label::after {
    transform: rotate(-45deg) scale(1); }

.checkbox.custom-checkbox input[type="checkbox"]:focus + label::before {
    outline: 0; }

.custom-control-input:checked ~ .custom-control-label::before {
  background-color: #47B4AC;
  border-color: #47B4AC; }

.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: #DBF6F0;
  color: #47B4AC; }

.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: #DBF6F0;
  color: #47B4AC; }

.custom-select:focus {
  box-shadow: none; }

.custom-control-label {
  line-height: 22px; }

.custom-switch.custom-switch-icon {
  padding-left: 0; }

.custom-switch.custom-switch-icon label .switch-icon-left {
    position: absolute;
    cursor: pointer;
    -webkit-user-select: none;
    user-select: none;
    top: -2px;
    left: 8px;
    right: auto;
    color: #fff; }

.custom-switch.custom-switch-icon label .switch-icon-left i {
      font-size: 10px; }

.custom-switch.custom-switch-icon label .switch-icon-right {
    position: absolute;
    cursor: pointer;
    -webkit-user-select: none;
    user-select: none;
    top: -3px;
    right: 5px;
    left: auto; }

.custom-switch.custom-switch-icon label .switch-icon-right i {
      font-size: 10px; }

.custom-switch.custom-switch-icon .custom-control-label {
    height: 20px;
    width: 42px;
    padding: 0; }

.custom-switch.custom-switch-icon .custom-control-label::before {
      height: 20px;
      transition: all 0.3s ease-in-out;
      -webkit-user-select: none;
              user-select: none;
      top: 0;
      left: 1px;
      width: 2.75rem; }

.custom-switch.custom-switch-icon .custom-control-label:after {
      position: absolute;
      top: 1px;
      left: 2px;
      transition: all 0.3s ease-in-out;
      -webkit-user-select: none;
              user-select: none;
      height: 18px;
      width: 18px; }

.custom-switch.custom-switch-icon .custom-control-input:checked ~ .custom-control-label::after {
    transform: translateX(1.4rem); }

.custom-switch.custom-switch-text {
  padding-left: 0; }

.custom-switch.custom-switch-text label .switch-icon-left {
    position: absolute;
    cursor: pointer;
    -webkit-user-select: none;
    user-select: none;
    top: -3px;
    left: 8px;
    right: auto;
    color: #fff; }

.custom-switch.custom-switch-text label .switch-icon-right {
    position: absolute;
    cursor: pointer;
    -webkit-user-select: none;
    user-select: none;
    top: -3px;
    right: 5px;
    left: auto; }

.custom-switch.custom-switch-text label::before {
    color: #000;
    content: attr(data-off-label);
    width: 2.85rem;
    height: 20px;
    padding: 0 4px;
    font-size: 11px;
    line-height: 18px;
    text-align: right; }

.custom-switch.custom-switch-text label:after {
    position: absolute;
    transition: all 0.3s ease-in-out;
    -webkit-user-select: none;
            user-select: none;
    height: 16px;
    width: 16px; }

.custom-switch.custom-switch-text .custom-control-label {
    width: 46px; }

.custom-switch.custom-switch-text .custom-control-label::before {
      height: 20px;
      transition: all 0.3s ease-in-out;
      -webkit-user-select: none;
              user-select: none;
      top: 0;
      left: 1px;
      width: 2.75rem;
      width: 100%; }

.custom-switch.custom-switch-text .custom-control-label:after {
      position: absolute;
      top: 1px;
      left: 2px;
      transition: all 0.3s ease-in-out;
      -webkit-user-select: none;
              user-select: none;
      height: 18px;
      width: 18px; }

.custom-switch.custom-switch-text .custom-control-input:checked ~ .custom-control-label::after {
    transform: translateX(1.6rem); }

.custom-switch.custom-switch-text input:checked ~ label::before {
    color: #fff;
    content: attr(data-on-label);
    text-align: left; }

.custom-switch.custom-switch-text input:checked ~ label.custom-control-label::after {
    transform: translateX(1.6rem); }

.custom-switch-inner {
  display: block;
  text-align: center; }

.form-label-group {
  position: relative;
  margin-bottom: 1.5rem; }

.form-label-group > label {
    position: absolute;
    top: 0;
    left: 0;
    display: block;
    transition: all 0.3s ease-in-out;
    padding: .6rem;
    color: #475F7B;
    font-size: .85rem;
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0; }

.counter-value {
  color: #fff;
  padding: 1px 6px;
  font-size: .6rem;
  border-radius: 0 0 10px 10px 0 10px 10px 10px 0 10px;
  margin-right: 1rem; }

.vector-map.h-500 {
  width: 100%;
  height: 500px; }

.countdown {
  margin: 60px 0 0;
  padding: 0; }

.countdown li span {
    font-size: 60px;
    display: inline-block;
    width: 100%;
    color: #47B4AC; }

.countdown li:last-child {
    margin-right: 0; }

.iq-comingsoon-form {
  position: relative; }

.iq-comingsoon-form button {
    position: absolute;
    right: 0;
    top: 0;
    padding: 11px 30px; }

.btn {
  display: inline-block !important;
  font-family: "Open Sans", sans-serif !important;
  font-weight: 400 !important;
  text-align: center !important;
  vertical-align: middle !important;
  -webkit-user-select: none !important;
          user-select: none !important;
  padding: 0.625rem 0.938rem !important;
  font-size: 0.875rem !important;
  line-height: 1.5 !important;
  border-radius: 0px !important;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out !important; }

@media (prefers-reduced-motion: reduce) {
    .btn {
      transition: none; } }

.btn:hover {
    color: #737B8E;
    text-decoration: none; }

.btn:focus, .btn.focus {
    outline: none;
    box-shadow: none; }

.btn.disabled, .btn:disabled {
    opacity: 0.65;
    box-shadow: none; }

.btn:not(:disabled):not(.disabled) {
    cursor: pointer; }

.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active {
      box-shadow: none; }

.btn:not(:disabled):not(.disabled):active:focus, .btn:not(:disabled):not(.disabled).active:focus {
        box-shadow: none; }

a.btn.disabled,
fieldset:disabled a.btn {
  pointer-events: none; }

/*  .btn-primary:hover {
    color: #fff !important;
    background-color: #3c9992 !important;
    border-color: #398f89 !important; }
  .btn-primary:focus, .btn-primary.focus {
    color: #fff;
    background-color: #3c9992;
    border-color: #398f89;
    box-shadow: unset, 0 0 0 0.2rem rgba(99, 191, 184, 0.5); }
  .btn-primary.disabled, .btn-primary:disabled {
    color: #fff;
    background-color: #47B4AC;
    border-color: #47B4AC; }
	*/

.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active,
  .show > .btn-primary.dropdown-toggle {
    color: #fff;
    background-color: #398f89;
    border-color: #358680; }

.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus,
    .show > .btn-primary.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(99, 191, 184, 0.5); }

.btn-secondary {
  color: #fff;
  background-color: #323C9C;
  border-color: #323C9C;
  box-shadow: 0px 4px 12px 0px rgba(50, 60, 156, 0.5); }

.btn-secondary:hover {
    color: #fff;
    background-color: #29317f;
    border-color: #262d75; }

.btn-secondary:focus, .btn-secondary.focus {
    color: #fff;
    background-color: #29317f;
    border-color: #262d75;
    box-shadow: unset, 0 0 0 0.2rem rgba(81, 89, 171, 0.5); }

.btn-secondary.disabled, .btn-secondary:disabled {
    color: #fff;
    background-color: #323C9C;
    border-color: #323C9C; }

.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active,
  .show > .btn-secondary.dropdown-toggle {
    color: #fff;
    background-color: #262d75;
    border-color: #23296c; }

.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus,
    .show > .btn-secondary.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(81, 89, 171, 0.5); }

.btn-success {
  color: #fff;
  background-color: #47B473;
  border-color: #47B473;
}

.btn-success:hover {
    color: #fff;
    background-color: #3c9961;
    border-color: #398f5c; }

.btn-success:focus, .btn-success.focus {
    color: #fff;
    background-color: #3c9961;
    border-color: #398f5c;
    box-shadow: unset, 0 0 0 0.2rem rgba(99, 191, 136, 0.5); }

.btn-success.disabled, .btn-success:disabled {
    color: #fff;
    background-color: #47B473;
    border-color: #47B473; }

.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active,
  .show > .btn-success.dropdown-toggle {
    color: #fff;
    background-color: #398f5c;
    border-color: #358656; }

.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus,
    .show > .btn-success.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(99, 191, 136, 0.5); }

.btn-info {
  color: #fff;
  background-color: #1B98E0;
  border-color: #1B98E0;
}

.btn-info:hover {
    color: #fff;
    background-color: #1781be;
    border-color: #1679b2; }

.btn-info:focus, .btn-info.focus {
    color: #fff;
    background-color: #1781be;
    border-color: #1679b2;
    box-shadow: unset, 0 0 0 0.2rem rgba(61, 167, 229, 0.5); }

.btn-info.disabled, .btn-info:disabled {
    color: #fff;
    background-color: #1B98E0;
    border-color: #1B98E0; }

.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active,
  .show > .btn-info.dropdown-toggle {
    color: #fff;
    background-color: #1679b2;
    border-color: #1471a7; }

.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus,
    .show > .btn-info.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(61, 167, 229, 0.5); }

.btn-warning {
  color: #fff;
  background-color: #CCA43B;
  border-color: #CCA43B;
  box-shadow: 0px 4px 12px 0px rgba(204, 164, 59, 0.5); }

.btn-warning:hover {
    color: #fff;
    background-color: #b28e2e;
    border-color: #a8862c; }

.btn-warning:focus, .btn-warning.focus {
    color: #fff;
    background-color: #b28e2e;
    border-color: #a8862c;
    box-shadow: unset, 0 0 0 0.2rem rgba(212, 178, 88, 0.5); }

.btn-warning.disabled, .btn-warning:disabled {
    color: #fff;
    background-color: #CCA43B;
    border-color: #CCA43B; }

.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active,
  .show > .btn-warning.dropdown-toggle {
    color: #fff;
    background-color: #a8862c;
    border-color: #9e7e29; }

.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus,
    .show > .btn-warning.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(212, 178, 88, 0.5); }

.btn-danger {
  color: #fff !important;
  background-color: #D75842!important;
  border-color: #D75842 !important;
/*  box-shadow: 0px 4px 12px 0px rgba(215, 88, 66, 0.5)!important;*/ }

.btn-danger:hover {
    color: #fff !important;
    background-color: #c8422a !important;
    border-color: #be3e28 !important; }

.btn-danger:focus, .btn-danger.focus {
    color: #fff !important;
    background-color: #c8422a !important;
    border-color: #be3e28 !important;
    box-shadow: unset, 0 0 0 0.2rem rgba(221, 113, 94, 0.5) !important; }

.btn-danger.disabled, .btn-danger:disabled {
    color: #fff;
    background-color: #D75842;
    border-color: #D75842; }

.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active,
  .show > .btn-danger.dropdown-toggle {
    color: #fff;
    background-color: #be3e28;
    border-color: #b33b26; }

.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus,
    .show > .btn-danger.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(221, 113, 94, 0.5); }

.btn-light {
  color: #212529;
  background-color: #F6F8FB;
  border-color: #F6F8FB;
  box-shadow: 0px 4px 12px 0px rgba(246, 248, 251, 0.5); }

.btn-light:hover {
    color: #212529;
    background-color: #dce3ef;
    border-color: #d3ddeb; }

.btn-light:focus, .btn-light.focus {
    color: #212529;
    background-color: #dce3ef;
    border-color: #d3ddeb;
    box-shadow: unset, 0 0 0 0.2rem rgba(214, 216, 220, 0.5); }

.btn-light.disabled, .btn-light:disabled {
    color: #212529;
    background-color: #F6F8FB;
    border-color: #F6F8FB; }

.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active,
  .show > .btn-light.dropdown-toggle {
    color: #212529;
    background-color: #d3ddeb;
    border-color: #cad6e7; }

.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus,
    .show > .btn-light.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(214, 216, 220, 0.5); }

.btn-dark {
  color: #fff;
  background-color: #01041b;
  border-color: #01041b;
  box-shadow: 0px 4px 12px 0px rgba(1, 4, 27, 0.5); }

.btn-dark:hover {
    color: #fff;
    background-color: black;
    border-color: black; }

.btn-dark:focus, .btn-dark.focus {
    color: #fff;
    background-color: black;
    border-color: black;
    box-shadow: unset, 0 0 0 0.2rem rgba(39, 42, 61, 0.5); }

.btn-dark.disabled, .btn-dark:disabled {
    color: #fff;
    background-color: #01041b;
    border-color: #01041b; }

.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active,
  .show > .btn-dark.dropdown-toggle {
    color: #fff;
    background-color: black;
    border-color: black; }

.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus,
    .show > .btn-dark.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(39, 42, 61, 0.5); }

.btn-orange {
  color: #fff;
  background-color: #323C9C;
  border-color: #323C9C;
  box-shadow: 0px 4px 12px 0px rgba(50, 60, 156, 0.5); }

.btn-orange:hover {
    color: #fff;
    background-color: #29317f;
    border-color: #262d75; }

.btn-orange:focus, .btn-orange.focus {
    color: #fff;
    background-color: #29317f;
    border-color: #262d75;
    box-shadow: unset, 0 0 0 0.2rem rgba(81, 89, 171, 0.5); }

.btn-orange.disabled, .btn-orange:disabled {
    color: #fff;
    background-color: #323C9C;
    border-color: #323C9C; }

.btn-orange:not(:disabled):not(.disabled):active, .btn-orange:not(:disabled):not(.disabled).active,
  .show > .btn-orange.dropdown-toggle {
    color: #fff;
    background-color: #262d75;
    border-color: #23296c; }

.btn-orange:not(:disabled):not(.disabled):active:focus, .btn-orange:not(:disabled):not(.disabled).active:focus,
    .show > .btn-orange.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(81, 89, 171, 0.5); }

.btn-purple {
  color: #fff;
  background-color: #4731b6;
  border-color: #4731b6;
  box-shadow: 0px 4px 12px 0px rgba(71, 49, 182, 0.5); }

.btn-purple:hover {
    color: #fff;
    background-color: #3b2998;
    border-color: #37268e; }

.btn-purple:focus, .btn-purple.focus {
    color: #fff;
    background-color: #3b2998;
    border-color: #37268e;
    box-shadow: unset, 0 0 0 0.2rem rgba(99, 80, 193, 0.5); }

.btn-purple.disabled, .btn-purple:disabled {
    color: #fff;
    background-color: #4731b6;
    border-color: #4731b6; }

.btn-purple:not(:disabled):not(.disabled):active, .btn-purple:not(:disabled):not(.disabled).active,
  .show > .btn-purple.dropdown-toggle {
    color: #fff;
    background-color: #37268e;
    border-color: #332384; }

.btn-purple:not(:disabled):not(.disabled):active:focus, .btn-purple:not(:disabled):not(.disabled).active:focus,
    .show > .btn-purple.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(99, 80, 193, 0.5); }

.btn-skyblue {
  color: #fff;
  background-color: #158df7;
  border-color: #158df7;
  box-shadow: 0px 4px 12px 0px rgba(21, 141, 247, 0.5); }

.btn-skyblue:hover {
    color: #fff;
    background-color: #087ade;
    border-color: #0773d2; }

.btn-skyblue:focus, .btn-skyblue.focus {
    color: #fff;
    background-color: #087ade;
    border-color: #0773d2;
    box-shadow: unset, 0 0 0 0.2rem rgba(56, 158, 248, 0.5); }

.btn-skyblue.disabled, .btn-skyblue:disabled {
    color: #fff;
    background-color: #158df7;
    border-color: #158df7; }

.btn-skyblue:not(:disabled):not(.disabled):active, .btn-skyblue:not(:disabled):not(.disabled).active,
  .show > .btn-skyblue.dropdown-toggle {
    color: #fff;
    background-color: #0773d2;
    border-color: #076cc5; }

.btn-skyblue:not(:disabled):not(.disabled):active:focus, .btn-skyblue:not(:disabled):not(.disabled).active:focus,
    .show > .btn-skyblue.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(56, 158, 248, 0.5); }

.btn-light-gray {
  color: #212529;
  background-color: #f4f5fa;
  border-color: #f4f5fa;
  box-shadow: 0px 4px 12px 0px rgba(244, 245, 250, 0.5); }

.btn-light-gray:hover {
    color: #212529;
    background-color: #daddee;
    border-color: #d1d5ea; }

.btn-light-gray:focus, .btn-light-gray.focus {
    color: #212529;
    background-color: #daddee;
    border-color: #d1d5ea;
    box-shadow: unset, 0 0 0 0.2rem rgba(212, 214, 219, 0.5); }

.btn-light-gray.disabled, .btn-light-gray:disabled {
    color: #212529;
    background-color: #f4f5fa;
    border-color: #f4f5fa; }

.btn-light-gray:not(:disabled):not(.disabled):active, .btn-light-gray:not(:disabled):not(.disabled).active,
  .show > .btn-light-gray.dropdown-toggle {
    color: #212529;
    background-color: #d1d5ea;
    border-color: #c8cde6; }

.btn-light-gray:not(:disabled):not(.disabled):active:focus, .btn-light-gray:not(:disabled):not(.disabled).active:focus,
    .show > .btn-light-gray.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(212, 214, 219, 0.5); }

.btn-white {
  color: #212529;
  background-color: #fff;
  border-color: #fff;
  box-shadow: 0px 4px 12px 0px rgba(255, 255, 255, 0.5); }

.btn-white:hover {
    color: #212529;
    background-color: #ececec;
    border-color: #e6e6e6; }

.btn-white:focus, .btn-white.focus {
    color: #212529;
    background-color: #ececec;
    border-color: #e6e6e6;
    box-shadow: unset, 0 0 0 0.2rem rgba(222, 222, 223, 0.5); }

.btn-white.disabled, .btn-white:disabled {
    color: #212529;
    background-color: #fff;
    border-color: #fff; }

.btn-white:not(:disabled):not(.disabled):active, .btn-white:not(:disabled):not(.disabled).active,
  .show > .btn-white.dropdown-toggle {
    color: #212529;
    background-color: #e6e6e6;
    border-color: #dfdfdf; }

.btn-white:not(:disabled):not(.disabled):active:focus, .btn-white:not(:disabled):not(.disabled).active:focus,
    .show > .btn-white.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(222, 222, 223, 0.5); }

.btn-outline-primary {
  color: #47B4AC !important;
  border-color: #47B4AC !important; }

.btn-outline-primary:hover {
    color: #fff !important;
    background-color: #47B4AC !important;
    border-color: #47B4AC !important; }

.btn-outline-primary:focus, .btn-outline-primary.focus {
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 172, 0.5) !important; }

.btn-outline-primary.disabled, .btn-outline-primary:disabled {
    color: #47B4AC !important;
    background-color: transparent !important; }

.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active,
  .show > .btn-outline-primary.dropdown-toggle {
    color: #fff !important;
    background-color: #47B4AC !important;
    border-color: #47B4AC !important;  }

.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-primary.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(71, 180, 172, 0.5)!important; }

.btn-outline-secondary {
  color: #323C9C;
  border-color: #323C9C; }

.btn-outline-secondary:hover {
    color: #fff;
    background-color: #323C9C;
    border-color: #323C9C; }

.btn-outline-secondary:focus, .btn-outline-secondary.focus {
    box-shadow: 0 0 0 0.2rem rgba(50, 60, 156, 0.5); }

.btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
    color: #323C9C;
    background-color: transparent; }

.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active,
  .show > .btn-outline-secondary.dropdown-toggle {
    color: #fff;
    background-color: #323C9C;
    border-color: #323C9C; }

.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-secondary.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(50, 60, 156, 0.5); }

.btn-outline-success {
  color: #47B473;
  border-color: #47B473; }

.btn-outline-success:hover {
    color: #fff !important;
    background-color: #47B473;
    border-color: #47B473; }

.btn-outline-success:focus, .btn-outline-success.focus {
    box-shadow: 0 0 0 0.2rem rgba(71, 180, 115, 0.5); }

.btn-outline-success.disabled, .btn-outline-success:disabled {
    color: #47B473;
    background-color: transparent; }

.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active,
  .show > .btn-outline-success.dropdown-toggle {
    color: #fff;
    background-color: #47B473;
    border-color: #47B473; }

.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-success.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(71, 180, 115, 0.5); }

.btn-outline-info {
  color: #1B98E0;
  border-color: #1B98E0; }

.btn-outline-info:hover {
    color: #fff !important;
    background-color: #1B98E0;
    border-color: #1B98E0; }

.btn-outline-info:focus, .btn-outline-info.focus {
    box-shadow: 0 0 0 0.2rem rgba(27, 152, 224, 0.5); }

.btn-outline-info.disabled, .btn-outline-info:disabled {
    color: #1B98E0;
    background-color: transparent; }

.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active,
  .show > .btn-outline-info.dropdown-toggle {
    color: #fff;
    background-color: #1B98E0;
    border-color: #1B98E0; }

.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-info.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(27, 152, 224, 0.5); }

.btn-outline-warning {
  color: #CCA43B;
  border-color: #CCA43B; }

.btn-outline-warning:hover {
    color: #fff;
    background-color: #CCA43B;
    border-color: #CCA43B; }

.btn-outline-warning:focus, .btn-outline-warning.focus {
    box-shadow: 0 0 0 0.2rem rgba(204, 164, 59, 0.5); }

.btn-outline-warning.disabled, .btn-outline-warning:disabled {
    color: #CCA43B;
    background-color: transparent; }

.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active,
  .show > .btn-outline-warning.dropdown-toggle {
    color: #fff;
    background-color: #CCA43B;
    border-color: #CCA43B; }

.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-warning.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(204, 164, 59, 0.5); }

.btn-outline-danger {
  color: #D75842;
  border-color: #D75842; }

.btn-outline-danger:hover {
    color: #fff !important;
    background-color: #D75842;
    border-color: #D75842; }

.btn-outline-danger:focus, .btn-outline-danger.focus {
    box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.5); }

.btn-outline-danger.disabled, .btn-outline-danger:disabled {
    color: #D75842;
    background-color: transparent; }

.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active,
  .show > .btn-outline-danger.dropdown-toggle {
    color: #fff;
    background-color: #D75842;
    border-color: #D75842; }

.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-danger.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(215, 88, 66, 0.5); }

.btn-outline-light {
  color: #F6F8FB;
  border-color: #F6F8FB; }

.btn-outline-light:hover {
    color: #212529;
    background-color: #F6F8FB;
    border-color: #F6F8FB; }

.btn-outline-light:focus, .btn-outline-light.focus {
    box-shadow: 0 0 0 0.2rem rgba(246, 248, 251, 0.5); }

.btn-outline-light.disabled, .btn-outline-light:disabled {
    color: #F6F8FB;
    background-color: transparent; }

.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active,
  .show > .btn-outline-light.dropdown-toggle {
    color: #212529;
    background-color: #F6F8FB;
    border-color: #F6F8FB; }

.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-light.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(246, 248, 251, 0.5); }

.btn-outline-dark {
  color: #01041b;
  border-color: #01041b; }

.btn-outline-dark:hover {
    color: #fff;
    background-color: #01041b;
    border-color: #01041b; }

.btn-outline-dark:focus, .btn-outline-dark.focus {
    box-shadow: 0 0 0 0.2rem rgba(1, 4, 27, 0.5); }

.btn-outline-dark.disabled, .btn-outline-dark:disabled {
    color: #01041b;
    background-color: transparent; }

.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active,
  .show > .btn-outline-dark.dropdown-toggle {
    color: #fff;
    background-color: #01041b;
    border-color: #01041b; }

.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-dark.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(1, 4, 27, 0.5); }

.btn-outline-orange {
  color: #323C9C;
  border-color: #323C9C; }

.btn-outline-orange:hover {
    color: #fff;
    background-color: #323C9C;
    border-color: #323C9C; }

.btn-outline-orange:focus, .btn-outline-orange.focus {
    box-shadow: 0 0 0 0.2rem rgba(50, 60, 156, 0.5); }

.btn-outline-orange.disabled, .btn-outline-orange:disabled {
    color: #323C9C;
    background-color: transparent; }

.btn-outline-orange:not(:disabled):not(.disabled):active, .btn-outline-orange:not(:disabled):not(.disabled).active,
  .show > .btn-outline-orange.dropdown-toggle {
    color: #fff;
    background-color: #323C9C;
    border-color: #323C9C; }

.btn-outline-orange:not(:disabled):not(.disabled):active:focus, .btn-outline-orange:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-orange.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(50, 60, 156, 0.5); }

.btn-outline-purple {
  color: #4731b6;
  border-color: #4731b6; }

.btn-outline-purple:hover {
    color: #fff;
    background-color: #4731b6;
    border-color: #4731b6; }

.btn-outline-purple:focus, .btn-outline-purple.focus {
    box-shadow: 0 0 0 0.2rem rgba(71, 49, 182, 0.5); }

.btn-outline-purple.disabled, .btn-outline-purple:disabled {
    color: #4731b6;
    background-color: transparent; }

.btn-outline-purple:not(:disabled):not(.disabled):active, .btn-outline-purple:not(:disabled):not(.disabled).active,
  .show > .btn-outline-purple.dropdown-toggle {
    color: #fff;
    background-color: #4731b6;
    border-color: #4731b6; }

.btn-outline-purple:not(:disabled):not(.disabled):active:focus, .btn-outline-purple:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-purple.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(71, 49, 182, 0.5); }

.btn-outline-skyblue {
  color: #158df7;
  border-color: #158df7; }

.btn-outline-skyblue:hover {
    color: #fff;
    background-color: #158df7;
    border-color: #158df7; }

.btn-outline-skyblue:focus, .btn-outline-skyblue.focus {
    box-shadow: 0 0 0 0.2rem rgba(21, 141, 247, 0.5); }

.btn-outline-skyblue.disabled, .btn-outline-skyblue:disabled {
    color: #158df7;
    background-color: transparent; }

.btn-outline-skyblue:not(:disabled):not(.disabled):active, .btn-outline-skyblue:not(:disabled):not(.disabled).active,
  .show > .btn-outline-skyblue.dropdown-toggle {
    color: #fff;
    background-color: #158df7;
    border-color: #158df7; }

.btn-outline-skyblue:not(:disabled):not(.disabled):active:focus, .btn-outline-skyblue:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-skyblue.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(21, 141, 247, 0.5); }

.btn-outline-light-gray {
  color: #f4f5fa;
  border-color: #f4f5fa; }

.btn-outline-light-gray:hover {
    color: #212529;
    background-color: #f4f5fa;
    border-color: #f4f5fa; }

.btn-outline-light-gray:focus, .btn-outline-light-gray.focus {
    box-shadow: 0 0 0 0.2rem rgba(244, 245, 250, 0.5); }

.btn-outline-light-gray.disabled, .btn-outline-light-gray:disabled {
    color: #f4f5fa;
    background-color: transparent; }

.btn-outline-light-gray:not(:disabled):not(.disabled):active, .btn-outline-light-gray:not(:disabled):not(.disabled).active,
  .show > .btn-outline-light-gray.dropdown-toggle {
    color: #212529;
    background-color: #f4f5fa;
    border-color: #f4f5fa; }

.btn-outline-light-gray:not(:disabled):not(.disabled):active:focus, .btn-outline-light-gray:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-light-gray.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(244, 245, 250, 0.5); }

.btn-outline-white {
  color: #fff;
  border-color: #fff; }

.btn-outline-white:hover {
    color: #212529;
    background-color: #fff;
    border-color: #fff; }

.btn-outline-white:focus, .btn-outline-white.focus {
    box-shadow: 0 0 0 0.2rem rgba(255, 255, 255, 0.5); }

.btn-outline-white.disabled, .btn-outline-white:disabled {
    color: #fff;
    background-color: transparent; }

.btn-outline-white:not(:disabled):not(.disabled):active, .btn-outline-white:not(:disabled):not(.disabled).active,
  .show > .btn-outline-white.dropdown-toggle {
    color: #212529;
    background-color: #fff;
    border-color: #fff; }

.btn-outline-white:not(:disabled):not(.disabled):active:focus, .btn-outline-white:not(:disabled):not(.disabled).active:focus,
    .show > .btn-outline-white.dropdown-toggle:focus {
      box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125), 0 0 0 0.2rem rgba(255, 255, 255, 0.5); }

.btn-link {
  font-weight: 400;
  color: #47B4AC;
  text-decoration: none; }

.btn-link:hover {
    color: #317d78;
    text-decoration: none; }

.btn-link:focus, .btn-link.focus {
    text-decoration: none; }

.btn-link:disabled, .btn-link.disabled {
    color: #6c757d;
    pointer-events: none; }

.btn-lg, .btn-group-lg > .btn {
  padding: 0.938rem 1.25rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px; }

.btn-sm, .btn-group-sm > .btn {
  padding: 0.313rem 0.625rem !important;
  font-size: 0.75rem !important; 
  line-height: 1.5 !important;
  border-radius: 0px !important; }

.btn-block {
  display: block;
  width: 100%; }

.btn-block + .btn-block {
    margin-top: 0.5rem; }

input[type="submit"].btn-block,
input[type="reset"].btn-block,
input[type="button"].btn-block {
  width: 100%; }

.iq-progress-bar {
  background: #F6F8FB;
  box-shadow: 0 0 0;
  height: 6px;
  margin: 0;
  position: relative;
  width: 100%;
  border-radius: 10px 10px 0 10px; }

.iq-progress-bar > span {
    background: #47B4AC none repeat scroll 0 0;
    position: relative;
    display: block;
    height: 100%;
    width: 0;
    border-radius: 10px 10px 0 10px; }

.iq-progress-bar .progress-text {
    position: absolute;
    right: -10px;
    top: -25px;
    font-size: 13px;
    font-weight: 500; }

.iq-progress-bar.iq-progress-bar-icon > span:after {
  content: "";
  width: 12px;
  height: 12px;
  border-radius: 50%;
  background: #fff;
  border: 3px solid transparent;
  position: absolute;
  bottom: -3px;
  right: 0;
  z-index: 1; }

.iq-progress-bar.iq-progress-bar-icon > span.bg-primary:after {
  border-color: #47B4AC; }

.iq-progress-bar.iq-progress-bar-icon > span.bg-danger:after {
  border-color: #D75842; }

.iq-progress-bar.iq-progress-bar-icon > span.bg-success:after {
  border-color: #47B473; }

.iq-progress-bar.iq-progress-bar-icon > span.bg-warning:after {
  border-color: #CCA43B; }

.iq-progress-bar.iq-progress-bar-icon > span.bg-info:after {
  border-color: #1B98E0; }

.iq-progress-bar.iq-progress-bar-icon > span.bg-dark:after {
  border-color: #01041b; }

.progress-round.heatmap-progress {
  height: 97px;
  width: 97px; }

.progress-round.heatmap-progress .progress-bar {
    border-width: 10px; }

.progress-round.heatmap-progress::after {
    border: 10px solid #ff9273; }

.progress-round.income-progress .progress-bar {
  border-width: 10px; }

.progress-round.income-progress::after {
  border: 10px solid #ff9273; }

.progress-round.alarams-progress {
  height: 110px;
  width: 110px; }

.iq-progress-bar .progress-text-one {
  position: absolute;
  right: -15px;
  top: -35px;
  font-size: 13px;
  line-height: 24px;
  font-weight: 500;
  background: #D75842;
  color: #fff;
  padding: 0px 5px; }

.iq-progress-bar > span.bg-primary .progress-text-one:after {
  border-color: #47B4AC transparent transparent transparent; }

.iq-progress-bar > span.bg-success .progress-text-one:after {
  border-color: #47B473 transparent transparent transparent; }

.iq-progress-bar > span.bg-warning .progress-text-one:after {
  border-color: #CCA43B transparent transparent transparent; }

.iq-progress-bar > span.bg-orange .progress-text-one:after {
  border-color: #323C9C transparent transparent transparent; }

.iq-progress-bar > span.bg-danger .progress-text-one:after {
  border-color: #D75842 transparent transparent transparent; }

.iq-progress-bar > span.bg-dark .progress-text-one:after {
  border-color: #01041b transparent transparent transparent; }

.iq-progress-bar > span.bg-info .progress-text-one:after {
  border-color: #1B98E0 transparent transparent transparent; }

.iq-progress-bar > span.bg-skyblue .progress-text-one:after {
  border-color: #158df7 transparent transparent transparent; }

.progress-text-one {
  position: relative; }

.progress-text-one:after {
    content: "";
    position: absolute;
    top: 100%;
    left: 50%;
    margin-left: -5px;
    border-width: 5px;
    border-style: solid; }

.iq-circle-progressbar {
  margin: 0 auto;
  width: 100px !important;
  height: 100px !important; }

.iq-circle-progressbar .percent {
    font-size: 1.3rem !important; }

.iq-circle-progressbar svg {
    width: 100px !important;
    height: 100px !important; }

.progress-round {
  width: 50px;
  height: 50px;
  background: none;
  position: relative; }

.progress-round::after {
    content: "";
    width: 100%;
    height: 100%;
    border-radius: 50%;
    border: 3px solid #C2C6CF;
    position: absolute;
    top: 0;
    left: 0; }

.progress-round > span {
    width: 50%;
    height: 100%;
    overflow: hidden;
    position: absolute;
    top: 0;
    z-index: 1; }

.progress-round .progress-left {
    left: 0; }

.progress-round .progress-left .progress-bar {
      left: 100%;
      border-top-right-radius: 80px;
      border-bottom-right-radius: 80px;
      border-left: 0;
      transform-origin: center left; }

.progress-round .progress-bar {
    width: 100%;
    height: 100%;
    background: none;
    border-width: 3px;
    border-style: solid;
    position: absolute;
    top: 0; }

.progress-round .progress-right {
    right: 0; }

.progress-round .progress-right .progress-bar {
      left: -100%;
      border-top-left-radius: 80px;
      border-bottom-left-radius: 80px;
      border-right: 0;
      transform-origin: center right; }

.progress-round .progress-value {
    position: absolute;
    top: 0;
    left: 0; }

.progress-round.income-progress {
  height: 78px;
  width: 78px; }

.progress-round.income-progress .progress-bar {
    border-width: 10px; }

.progress-round.income-progress::after {
    border: 10px solid #ff9273; }

.progress-round.alarams-progress {
  height: 110px;
  width: 110px; }

.progress-round.goal-progress {
  width: 130px;
  height: 130px; }

.progress-round.goal-progress .progress-bar {
  border-width: 10px; }

.progress-round.goal-progress::after {
  border: 10px solid #f4f4f4; }

@keyframes progress-loading-1 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(180deg); } }

@keyframes progress-loading-2 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(80deg); } }

.progress.progress-round {
  width: 60px;
  height: 60px;
  line-height: 60px;
  background: none;
  margin: 0 auto;
  box-shadow: none;
  position: relative; }

.progress.progress-round > span {
    width: 50%;
    height: 100%;
    overflow: hidden;
    position: absolute;
    top: 0;
    z-index: 1; }

.progress.progress-round .progress-left {
    left: 0; }

.progress.progress-round .progress-left .progress-bar {
      left: 100%;
      border-top-right-radius: 80px;
      border-bottom-right-radius: 80px;
      border-left: 0;
      transform-origin: center left;
      animation: progress-loading-2 1.5s linear forwards 1.8s; }

.progress.progress-round .progress-bar {
    border-width: 5px; }

.progress.progress-round .progress-right {
    right: 0; }

.progress.progress-round .progress-right .progress-bar {
      left: -100%;
      border-top-left-radius: 80px;
      border-bottom-left-radius: 80px;
      border-right: 0;
      transform-origin: center right;
      animation: progress-loading-1 1.8s linear forwards; }

.progress.progress-round:after {
    content: "";
    width: 100%;
    height: 100%;
    border-radius: 50%;
    border: 5px solid #F6F8FB;
    position: absolute;
    top: 0;
    left: 0; }

.progress.progress-round .progress-value {
    font-size: 16px;
    left: 18px; }

.progress.danger .progress-bar {
  border-color: #D75842; }

.progress.warning .progress-bar {
  border-color: #CCA43B; }

.progress.success .progress-bar {
  border-color: #47B473; }

.progress.info .progress-bar {
  border-color: #1B98E0; }

.progress.primary .progress-bar {
  border-color: #47B4AC; }

.progress.orange .progress-bar {
  border-color: #323C9C; }

.page-item:first-child .page-link {
  border-radius: 10px 0px 0px 10px; }

.page-item:last-child .page-link {
  border-radius: 0px 10px 0px 0px; }

.br-theme-bars-1to10 .br-widget {
  height: 50px;
  white-space: nowrap; }

.br-theme-bars-1to10 .br-widget a {
    display: block;
    width: 12px;
    padding: 5px 0;
    height: 28px;
    float: left;
    background-color: #ddd;
    margin: 1px;
    text-align: center; }

.br-theme-bars-1to10 .br-widget a.br-active {
    background-color: #47B4AC; }

.br-theme-bars-1to10 .br-widget a.br-selected {
    background-color: #47B4AC; }

.br-theme-bars-1to10 .br-widget .br-current-rating {
    font-size: 20px;
    line-height: 2;
    float: right;
    color: #47B4AC;
    font-weight: 400; }

.br-theme-bars-1to10 .br-readonly a {
  cursor: default; }

.br-theme-bars-1to10 .br-readonly a.br-active {
  background-color: #f2cd95; }

.br-theme-bars-1to10 .br-readonly a.br-selected {
  background-color: #f2cd95; }

.br-theme-bars-1to10 .br-readonly .br-current-rating {
  color: #f2cd95; }

.br-theme-bars-pill .br-widget {
  white-space: nowrap; }

.br-theme-bars-pill .br-widget a {
    padding: 7px 15px;
    background-color: #ddd;
    color: #737B8E;
    text-decoration: none;
    font-size: 13px;
    line-height: 3;
    text-align: center;
    font-weight: 400; }

.br-theme-bars-pill .br-widget a:first-child {
      -webkit-border-top-left-radius: 999px;
      -webkit-border-bottom-left-radius: 999px;
      -moz-border-radius-topleft: 999px;
      -moz-border-radius-bottomleft: 999px;
      border-top-left-radius: 999px;
      border-bottom-left-radius: 999px; }

.br-theme-bars-pill .br-widget a:last-child {
      -webkit-border-top-right-radius: 999px;
      -webkit-border-bottom-right-radius: 999px;
      -moz-border-radius-top-right: 999px;
      -moz-border-radius-bottom-right: 999px;
      border-top-right-radius: 999px !important;
      border-bottom-right-radius: 999px !important; }

.br-theme-bars-pill .br-widget a.br-active {
    background-color: #47B4AC;
    color: white; }

.br-theme-bars-pill .br-widget a.br-selected {
    background-color: #47B4AC;
    color: white; }

.br-theme-bars-pill .br-readonly a {
  cursor: default; }

.br-theme-bars-pill .br-readonly a.br-active {
  background-color: #7cead1; }

.br-theme-bars-pill .br-readonly a.br-selected {
  background-color: #7cead1; }

.br-theme-fontawesome-stars .br-widget a {
  margin-right: 8px !important; }

.br-theme-fontawesome-stars .br-widget a:after {
    font-family: "Font Awesome 5 Free";
    font-weight: 900; }

i.amber-text {
  color: #47B4AC !important; }

#rateMe1 i {
  font-size: 18px; }

.mdb-rating .rate-popover {
  color: #808080; }

.mdb-rating .live {
  color: #000; }

.mdb-rating .oneStar {
  color: #44370f; }

.mdb-rating .twoStars {
  color: #96781e; }

.mdb-rating .threeStars {
  color: #e2b52e; }

.mdb-rating .fourStars {
  color: #f1ba12; }

.mdb-rating .fiveStars {
  color: #f3cb06; }

.mdb-rating .amber-text {
  color: #ffc107; }

.rating-faces i {
  font-size: 21px; }

.br-theme-bars-movie .br-widget {
  white-space: nowrap; }

.br-theme-bars-movie .br-widget a {
    display: block;
    width: 60px;
    height: 10px;
    float: left;
    background-color: transparent;
    border: 1px solid #47B4AC;
    margin: 1px; }

.br-theme-bars-movie .br-widget a.br-active {
    background-color: #47B4AC; }

.br-theme-bars-movie .br-widget a.br-selected {
    background-color: #47B4AC; }

.br-theme-bars-movie .br-widget .br-current-rating {
    clear: both;
    width: 240px;
    text-align: center;
    font-weight: 600;
    display: block;
    padding-top: .5em;
    color: #47B4AC;
    font-weight: 400; }

.br-theme-bars-movie .br-readonly a {
  cursor: default; }

.br-theme-bars-movie .br-readonly a.br-active {
  background-color: #729bf8; }

.br-theme-bars-movie .br-readonly a.br-selected {
  background-color: #729bf8; }

.br-theme-bars-movie .br-readonly .br-current-rating {
  color: #729bf8; }

.br-theme-fontawesome-stars .br-widget {
  height: 28px;
  white-space: nowrap; }

.br-theme-fontawesome-stars .br-widget a {
    text-rendering: auto;
    -webkit-font-smoothing: antialiased;
    text-decoration: none;
    margin-right: 2px; }

.br-theme-fontawesome-stars .br-widget a:after {
      content: '\f005';
      color: #d2d2d2; }

.br-theme-fontawesome-stars .br-widget a.br-active:after {
    color: #edb867; }

.br-theme-fontawesome-stars .br-widget a.br-selected:after {
    color: #edb867; }

.br-theme-fontawesome-stars .br-widget .br-current-rating {
    display: none; }

.br-theme-fontawesome-stars .br-readonly a {
  cursor: default; }

/*------------ Basic Tree -------------------------------------*/

/*-------------------- Checkbox Tree ----------------------------*/

.basic-tree li {
  list-style-type: none;
  margin: 0;
  padding: 10px 5px 0 5px;
  position: relative;
  color: #35405A; }

.basic-tree li::before {
    content: '';
    left: -20px;
    position: absolute;
    right: auto;
    border-left: 1px solid #999;
    bottom: 50px;
    height: 100%;
    top: 0;
    width: 1px; }

.basic-tree li::after {
    content: '';
    left: -20px;
    position: absolute;
    right: auto;
    border-top: 1px solid #999;
    height: 20px;
    top: 25px;
    width: 25px; }

.basic-tree li:last-child::before {
    height: 30px; }

.basic-tree li.t-parent > span {
  cursor: pointer; }

.basic-tree li.t-parent > span:hover {
    color: #47B4AC;
    color: #47B4AC; }

.basic-tree > ul > li::before {
  border: 0; }

.basic-tree > ul > li::after {
  border: 0; }

.flex-tree li {
  position: relative;
  list-style: none;
  margin: 0; }

.flex-tree li::before {
    content: '';
    left: -20px;
    position: absolute;
    right: auto;
    border-left: 1px solid #999;
    bottom: 50px;
    height: 100%;
    top: 0;
    width: 1px;
    left: -25px; }

.flex-tree li::after {
    content: '';
    left: -20px;
    position: absolute;
    right: auto;
    border-top: 1px solid #999;
    height: 20px;
    top: 25px;
    width: 25px;
    top: 12px;
    left: -25px; }

.flex-tree li:last-child::before {
    height: 25px; }

.flex-tree li label {
    cursor: pointer; }

.flex-tree li span {
    cursor: pointer; }

.flex-tree li span label {
      cursor: pointer; }

.flex-tree li span.open:after {
    content: "\025BE";
    display: inline-block;
    font: 400 16px/1 Arial, "Helvetica Neue", Helvetica, sans-serif;
    width: 20px;
    margin-top: 4px;
    padding-left: 3px;
    color: #ababab; }

.flex-tree li span.closed:after {
    content: "\025BE";
    display: inline-block;
    font: 400 16px/1 Arial, "Helvetica Neue", Helvetica, sans-serif;
    width: 20px;
    margin-top: 4px;
    padding-left: 3px;
    color: #ababab;
    content: "\025B4"; }

.flex-tree > ul > li::before {
  border: 0; }

.flex-tree > ul > li::after {
  border: 0; }

.flex-tree label {
  font-weight: normal; }

.flex-tree label.node {
  font-weight: bold; }

.flex-tree input[type="checkbox"] {
  border: 1px solid #b4b9be;
  background: #fff;
  color: #555;
  clear: none;
  cursor: pointer;
  display: inline-block;
  line-height: 0;
  height: 16px;
  margin: -4px 4px 0 0;
  outline: 0;
  padding: 0;
  text-align: center;
  vertical-align: middle;
  width: 16px;
  min-width: 16px;
  -webkit-appearance: none;
  box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
  transition: 0.05s border-color ease-in-out; }

.flex-tree input[type="checkbox"]:focus {
    border-color: #5b9dd9;
    box-shadow: 0 0 2px rgba(30, 140, 190, 0.8); }

.flex-tree input[type="checkbox"]:checked {
    background: #47B4AC;
    border: none; }

.flex-tree input[type="checkbox"]:checked:before {
      float: left;
      display: inline-block;
      vertical-align: middle;
      width: 16px;
      font: 400 20px/1 Arial, "Helvetica Neue", Helvetica, sans-serif;
      -webkit-font-smoothing: antialiased;
      content: "\02713";
      color: var(--white);
      margin: 1px 0 0 0;
      font-size: 17px !important; }

.flex-tree input[type="checkbox"]:indeterminate:before {
    float: left;
    display: inline-block;
    vertical-align: middle;
    width: 16px;
    font: 400 20px/1 Arial, "Helvetica Neue", Helvetica, sans-serif;
    -webkit-font-smoothing: antialiased;
    content: "\02043";
    color: #47B4AC;
    margin: -4px 0 0 -1px; }

.flex-tree input[type="checkbox"].indeterminate {
  background-color: #eee; }

.ic-square {
  width: 20px;
  height: 20px;
  background: transparent;
  border: 1px solid #737B8E;
  text-align: center;
  line-height: 19px;
  font-size: 12px; }

.tree-box {
  margin: 0; }

.iq-footer {
  padding: 0 15px;
  margin-left: 260px;
  width: calc(100vw - 264px);
  background: #fff;
  box-shadow: none;
  transition: all 0.3s ease-in-out; }

.iq-footer ul li a {
    color: #737B8E; }

.iq-footer ul li a:hover {
      color: #47B4AC;
      text-decoration: none; }

body.tab-horizontal .iq-footer {
  margin-left: 0;
  width: 100%; }

.iq-mt--70 {
  margin-top: -70px; }

.banner-main-text {
  position: absolute;
  left: 15%;
  bottom: 13%; }

.nav.nav-pills.style-three {
  margin-top: 10px; }

.nav.nav-pills.style-three .nav-link.active:before {
    display: inline-block;
    width: 100%;
    height: 3px;
    background: #47B4AC;
    content: "";
    position: absolute;
    left: 0;
    bottom: 0px; }

.nav.nav-pills.style-three .nav-link:hover:before {
    display: inline-block;
    width: 100%;
    height: 3px;
    background: #47B4AC;
    content: "";
    position: absolute;
    left: 0;
    bottom: 0px; }

.nav.nav-pills.style-three .nav-link:before {
    width: 0;
    transition: all 0.3s ease-in-out;
    height: 3px;
    background: #47B4AC;
    content: "";
    position: absolute;
    right: 0;
    bottom: 0px; }

.nav.nav-pills.style-three a {
    background: transparent;
    position: relative;
    margin-right: 30px;
    padding: 10px 0px; }

.nav.nav-pills.style-three a:last-child {
      margin-right: 0px; }

.iq-card-body.banner-box {
  padding-bottom: 0; }

@media (min-width: 1300px) {
  body.sidebar-main .iq-footer {
    margin-left: 70px;
    width: calc(100vw - 74px); } }

@media (max-width: 1299px) {
  .iq-footer {
    padding: 0px 15px;
    margin-left: 0;
    width: 100%; }
  body.sidebar-main .iq-footer {
    padding: 15px 10px;
    margin-left: 0;
    width: 100%; }
  .without-right-sidebar .iq-footer {
    width: 100%; } }

@media (max-width: 991px) {
  .iq-footer {
    text-align: center !important;
    padding: 0; }
    .iq-footer .col-lg-6.text-right {
      text-align: center !important; } }

.clear {
  clear: both; }

@media (min-width: 1300px) {
  .iq-menu-horizontal .iq-sidebar-menu li .iq-submenu.iq-submenu-data {
    position: static; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-sidebar-logo {
    display: none !important; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li:first-child a {
    padding-left: 0px; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li a:hover {
    color: #47B4AC; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li li .iq-arrow-right {
    transform: rotate(0deg); }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li ul {
    display: block;
    position: absolute;
    top: 100%;
    padding: 10px 0px;
    min-width: 200px;
    background: #fff;
    z-index: 9;
    transition: all 0.3s ease-in-out;
    display: none;
    animation: fade-in-bottom 0.6s cubic-bezier(0.39, 0.575, 0.565, 1) both;
    transform: translateY(100%);
    border-radius: 10px 10px 0 10px;
    -ms-box-shadow: 0px 16px 40px 0px #0000000A;
    -o-box-shadow: 0px 16px 40px 0px #0000000A;
    box-shadow: 0px 16px 40px 0px #0000000A; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu .iq-submenu li a {
    padding: 12px 13px 12px 15px; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu > li:hover > a {
    color: #47B4AC; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li.menu-open .iq-arrow-right {
    transform: rotate(90deg); }
  .iq-menu-horizontal .iq-sidebar-menu li:hover > .iq-submenu {
    display: block;
    transition: all 0.3s ease-in-out; }
  .iq-menu-horizontal .iq-sidebar-menu li:hover > .iq-submenu.iq-submenu-data {
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1;
    transition: all 0.3s ease-in-out; }
  .iq-menu-horizontal .iq-sidebar-menu li > .iq-submenu.iq-submenu-data {
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0;
    visibility: visible;
    left: 100%;
    top: 0;
    transform-origin: left center 0; }
  .iq-menu-horizontal .iq-sidebar-menu li > .iq-submenu .iq-arrow-right {
    margin-right: 0px; }
  .iq-menu-horizontal .sub-scrll {
    max-height: 315px;
    overflow-y: scroll;
    overflow-x: hidden; }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li:hover .iq-arrow-right {
    transform: rotate(90deg); }
  .iq-menu-horizontal .iq-sidebar-menu .iq-menu li:hover li .iq-arrow-right {
    transform: rotate(0deg); } }

@media (max-width: 1299px) {
  .iq-menu-horizontal {
    position: fixed;
    left: 0;
    right: 0;
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0;
    top: 0;
    width: 0;
    background: #fff;
    height: 100vh;
    z-index: 9;
    overflow-y: scroll;
    overflow-x: hidden;
    transition: all 0.3s ease-in-out; }
    .iq-menu-horizontal ul.iq-menu {
      display: block !important;
      background: #fff; }
    .iq-menu-horizontal .iq-sidebar-menu .iq-menu li a {
      padding: 15px 20px 15px 30px; }
      .iq-menu-horizontal .iq-sidebar-menu .iq-menu li a:hover {
        color: #47B4AC; }
    .iq-menu-horizontal .iq-sidebar-menu .iq-menu li ul {
      position: static;
      box-shadow: none; }
  .iq-menu-horizontal ul.iq-menu li a[aria-expanded=true] .iq-arrow-right {
    transform: rotate(90deg); }
  .sidebar-main .iq-menu-horizontal {
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1;
    width: 260px;
    transition: all 0.3s ease-in-out; } }

.table {
  border-radius: 10px 10px 0 10px;
  overflow: hidden;
  color: #35405A; }

.table.table-dark th {
    border-color: #35405A;
    color: #fff; }

.table.table-dark td {
    border-color: #35405A;
    color: #fff; }

.table span, .table p {
    color: #737B8E; }

.table .ligth {
    white-space: nowrap; }

.table .ligth th {
      padding: 10px 20px !important;
      text-transform: capitalize;
      font-size: 15px;
      line-height: 22px;
      background: #f4f5fa;
      color: #35405A;
      border: 0px;
      font-weight: 700 !important; }

.table .ligth.ligth-data th:first-child {
      text-align: center;
      background-image: none; }

.table .ligth.ligth-data th:last-child {
      background-image: none;
      text-align: center; }

.table .ligth-body tr td:first-child {
    text-align: center; }

.table .ligth-body tr td:last-child {
    text-align: center; }

.table .ligth-body .list-action {
    justify-content: center; }

.table td {
    padding: 10px 15px !important;
    border: 0px;
	font-size:15px;
    color: #35405A; }

.table label {
    color: #35405A; }

.btn.add-list {
  padding: 0.5rem 1rem; }

@media (max-width: 576px) {
  .table td {
    padding: 15px 10px !important; } }

.dropdown-bg.btn {
  background: #f4f5fa;
  font-size: 14px; }

.dropdown-bg.btn i {
    margin-right: 0; }

.dropdown-menu {
  animation: fade 600ms ease forwards; }

@keyframes fade {
  0% {
    opacity: 0; }
  100% {
    opacity: 1; } }

@keyframes fadeInUp {
  from {
    opacity: 0;
    transform: translate3d(0, 100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

@keyframes dropdownAnimation {
  0% {
    opacity: 0;
    transform: scale(0); }
  80% {
    transform: scale(1); }
  100% {
    opacity: 1; } }

.dropdown-item {
  padding: 10px 10px 10px 10px;
  color: #737B8E; }

.dropdown-item.active i {
  color: #fff;
  text-decoration: none;
  background-color: #47B4AC; }

.dropdown-item:active i {
  color: #fff;
  text-decoration: none;
  background-color: #47B4AC; }

.dropdown {
  cursor: pointer; }

.chat-status {
  position: absolute;
  bottom: 0px;
  top: 0;
  bottom: auto;
  left: auto;
  right: -8px;
  border: 3px solid #F6F8FB;
  border-radius: 50%;
  line-height: 9px;
  background: #fff; }

.chat-status i {
    color: #47B4AC;
    font-size: 10px; }

.chat-status.chat-status-primary i {
    color: #47B4AC; }

.chat-status.chat-status-secondary i {
    color: #323C9C; }

.chat-status.chat-status-success i {
    color: #47B473; }

.chat-status.chat-status-info i {
    color: #1B98E0; }

.chat-status.chat-status-warning i {
    color: #CCA43B; }

.chat-status.chat-status-danger i {
    color: #D75842; }

.chat-status.chat-status-light i {
    color: #F6F8FB; }

.chat-status.chat-status-dark i {
    color: #01041b; }

.chat-status.chat-status-orange i {
    color: #323C9C; }

.chat-status.chat-status-purple i {
    color: #4731b6; }

.chat-status.chat-status-skyblue i {
    color: #158df7; }

.chat-status.chat-status-light-gray i {
    color: #f4f5fa; }

.chat-status.chat-status-white i {
    color: #fff; }

.online-drop i {
  color: #737B8E; }

.chat-profile {
  position: relative; }

.chat-profile img {
  border-radius: 10px 10px 0 10px; }

.chat-day-title {
  position: sticky;
  top: 10px;
  z-index: 10; }

.chat-day-date {
  text-align: center;
  margin: 15px 0; }

.chat-day-date span {
    background: #F6F8FB;
    padding: 0px 10px;
    color: #737B8E;
    display: inline-block;
    font-size: 12px;
    box-shadow: 0px 4px 12px 0px rgba(160, 165, 164, 0.15);
    border-radius: 50px; }

.other-user {
  flex-direction: row-reverse;
  text-align: right; }

.other-user .icon.chat-icon-box {
    margin-right: 0;
    margin-left: 25px; }

.other-user .chat-right {
    justify-content: flex-end; }

.other-user .chating {
    padding: 10px 15px;
    margin-right: 20px;
    color: #737B8E !important;
    border-radius: 10px 10px 0 10px; }

.current-user .chating {
  padding: 10px 15px;
  margin-left: 20px;
  color: #737B8E !important;
  border-radius: 10px 10px 10px 0px; }

.current-user .chat-profile img {
  border-radius: 10px 10px 10px 0px; }

.chat-footer {
  position: fixed;
  bottom: 0;
  padding: 15px 15px 15px 15px;
  margin-left: 365px;
  width: calc(100vw - 365px);
  right: 0;
  display: -1; }

.chat-footer i.iq-card-icon-small {
    line-height: 40px; }

.chat-footer .form-control {
    height: 40px;
    line-height: 40px; }

.chat-footer .btn i {
    margin-right: 0px;
    line-height: 40px; }

.chat-footer .chat-attagment-option i.smily-icon {
    font-size: 1.2em; }

.chat-list li.chat-list-title .chat-user-box {
  padding: 10px;
  border-radius: 10px 10px 0 10px; }

.chat-list li.chat-list-title .drop-box {
  display: none; }

.chat-list li.chat-list-title:hover {
  background: #fff;
  border-radius: 10px 10px 0 10px;
  cursor: pointer; }

.chat-list li.chat-list-title:hover .drop-box {
    display: block; }

.chat-list li.active {
  background: #fff;
  border-radius: 10px 10px 0 10px; }

.chat-list li.active .drop-box {
    display: block; }

[data-toggle-extra="tab-content"].active {
  display: block; }

[data-toggle-extra="tab-content"] {
  display: none; }

/*---------------------------------------------------------------------
Chat
-----------------------------------------------------------------------*/

.other-user, .current-user {
  visibility: visible; }

.current-user + .media:not(.other-user) .chat-profile > img {
  visibility: hidden; }

.other-user + .media:not(.current-user) .chat-profile > img {
  visibility: hidden; }

.setting-icon a {
  color: #737B8E; }

.chat-data-left {
  width: 320px;
  background: #F6F8FB;
  z-index: -1; }

.creat-btn {
  height: 45px; }

.chat-sidebar-channel {
  overflow-y: scroll;
  overflow-x: hidden;
  height: calc(100vh - 17rem);
  margin-bottom: 20px;
   scrollbar-width: thin;          /* "auto" or "thin" */
  scrollbar-color: #47B4AC #ccc; }

.chat-data {
  background: #fff; }

.chat-data .tab-content {
    position: relative; }

.chat-content {
  height: calc(100vh - 10rem); }

.chat-message {
  position: relative;
  float: right;
  text-align: right;
  padding: .75rem 1rem;
  margin: 0 1.33rem 1.33rem .3rem;
  clear: both;
  word-break: break-word;
  color: #fff;
  background: #47B4AC;
  border-radius: 15px;
  box-shadow: 0 2px 4px 0 #50b5ff; }

.chat-message > p {
    margin: 0; }

.chat-head {
  -ms-box-shadow: 0px 7px 16px 0px rgba(0, 0, 0, 0.04);
  -o-box-shadow: 0px 7px 16px 0px rgba(0, 0, 0, 0.04);
  box-shadow: 0px 7px 16px 0px rgba(0, 0, 0, 0.04); }

i.contc-list {
  cursor: pointer; }

button.close-btn-res {
  display: none; }

div.sidebar-toggle {
  display: none; }

.dropdown-toggle::after {
  display: none; }

.chat-mobile-header {
  display: none; }

.default-box {
  height: 100%; }

.default-box .default-chat-btn {
    display: none; }

.content-page-chat {
  overflow: hidden;
  padding: 0px;
  margin-left: 365px;
  min-height: 100vh;
  transition: all 0.3s ease-in-out; }

.new-chat {
  height: 100vh;
  position: relative; }

div.sidebar-toggle {
  transform: rotate(180deg); }

@media (max-width: 1299px) {
  .chat-data-left {
    position: absolute;
    left:0px;
    max-width: 320px;
    top: 0;
    z-index: 9;
    background: #fff;
    transition: all 0.45s ease 0s;
    box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.175);
    height: 100%;
    background: #F6F8FB;
 }
    .chat-data-left.show {
      transition: all 0.45s ease 0s;
      display: block; }
  .chat-mobile-header {
    display: block; }
  .chat-sidebar-channel {
    overflow-y: auto;
    height: calc(100vh - 17rem);
    padding-left: 0 !important; }
  .default-box img {
    width: 45%; }
  .default-box .default-chat-btn {
    display: block;
    margin: 0 auto; }
  button.close-btn-res {
    display: block;
    margin: 5px;
    padding: 0px;
    background: #DBF6F0;
    border: none;
    font-size: 15px;
    font-weight: 600;
    position: absolute;
    top: 9%;
    left: auto;
    right: -8%;
    color: #47B4AC;
    line-height: 35px;
    height: 35px;
    width: 35px;
    border-radius: 10px 10px 0 10px;
    z-index: 99; }
  div.sidebar-toggle {
    display: block; }
  .sidebar-toggle {
    background: #DBF6F0;
    padding: 10px;
    margin-right: 10px;
    border-radius: 10px 10px 0 10px;
    height: 35px;
    width: 35px;
    line-height: 17px;
    text-align: center;
    color: #47B4AC; }
  .content-page-chat {
    padding-top: 0px;
    margin-left: 0px; }
  .chat-footer {
    margin-left: 0px;
    width: 100%; }
  .chat-content {
    height: calc(100vh - 15rem); } }

.chating {
  max-width: 80%; }

@media (max-width: 992px) {
  .default-box img {
    width: 60%; } }

.modal-header {
  padding: 20px; }

.modal-body {
  padding: 20px; }

.modal-footer {
  padding: 20px; }

/*
 * Background color 
 */

.bg-blue {
  color: #fff !important;
  background-color: #47B4AC !important; }

a.bg-blue:hover, a.bg-blue:focus,
button.bg-blue:hover,
button.bg-blue:focus {
  color: #fff !important;
  background-color: #398f89 !important; }

.bg-indigo {
  color: #fff !important;
  background-color: #6610f2 !important; }

a.bg-indigo:hover, a.bg-indigo:focus,
button.bg-indigo:hover,
button.bg-indigo:focus {
  color: #fff !important;
  background-color: #510bc4 !important; }

.bg-purple {
  color: #fff !important;
  background-color: #4731b6 !important; }

a.bg-purple:hover, a.bg-purple:focus,
button.bg-purple:hover,
button.bg-purple:focus {
  color: #fff !important;
  background-color: #37268e !important; }

.bg-pink {
  color: #fff !important;
  background-color: #e83e8c !important; }

a.bg-pink:hover, a.bg-pink:focus,
button.bg-pink:hover,
button.bg-pink:focus {
  color: #fff !important;
  background-color: #d91a72 !important; }

.bg-red {
  color: #fff !important;
  background-color: #D75842 !important; }

a.bg-red:hover, a.bg-red:focus,
button.bg-red:hover,
button.bg-red:focus {
  color: #fff !important;
  background-color: #be3e28 !important; }

.bg-orange {
  color: #fff !important;
  background-color: #323C9C !important; }

a.bg-orange:hover, a.bg-orange:focus,
button.bg-orange:hover,
button.bg-orange:focus {
  color: #fff !important;
  background-color: #262d75 !important; }

.bg-yellow {
  color: #fff !important;
  background-color: #CCA43B !important; }

a.bg-yellow:hover, a.bg-yellow:focus,
button.bg-yellow:hover,
button.bg-yellow:focus {
  color: #fff !important;
  background-color: #a8862c !important; }

.bg-green {
  color: #fff !important;
  background-color: #47B473 !important; }

a.bg-green:hover, a.bg-green:focus,
button.bg-green:hover,
button.bg-green:focus {
  color: #fff !important;
  background-color: #398f5c !important; }

.bg-teal {
  color: #fff !important;
  background-color: #20c997 !important; }

a.bg-teal:hover, a.bg-teal:focus,
button.bg-teal:hover,
button.bg-teal:focus {
  color: #fff !important;
  background-color: #199d76 !important; }

.bg-cyan {
  color: #fff !important;
  background-color: #1B98E0 !important; }

a.bg-cyan:hover, a.bg-cyan:focus,
button.bg-cyan:hover,
button.bg-cyan:focus {
  color: #fff !important;
  background-color: #1679b2 !important; }

.bg-white {
  color: #212529 !important;
  background-color: #fff !important; }

a.bg-white:hover, a.bg-white:focus,
button.bg-white:hover,
button.bg-white:focus {
  color: #fff !important;
  background-color: #e6e6e6 !important; }

.bg-gray {
  color: #fff !important;
  background-color: #6c757d !important; }

a.bg-gray:hover, a.bg-gray:focus,
button.bg-gray:hover,
button.bg-gray:focus {
  color: #fff !important;
  background-color: #545b62 !important; }

.bg-gray-dark {
  color: #fff !important;
  background-color: #01041b !important; }

a.bg-gray-dark:hover, a.bg-gray-dark:focus,
button.bg-gray-dark:hover,
button.bg-gray-dark:focus {
  color: #fff !important;
  background-color: black !important; }

.bg-skyblue {
  color: #fff !important;
  background-color: #158df7 !important; }

a.bg-skyblue:hover, a.bg-skyblue:focus,
button.bg-skyblue:hover,
button.bg-skyblue:focus {
  color: #fff !important;
  background-color: #0773d2 !important; }

.bg-gradient-blue {
  background: #47B4AC linear-gradient(180deg, #63bfb8, #47B4AC) repeat-x !important; }

.bg-gradient-indigo {
  background: #6610f2 linear-gradient(180deg, #7d34f4, #6610f2) repeat-x !important; }

.bg-gradient-purple {
  background: #4731b6 linear-gradient(180deg, #6350c1, #4731b6) repeat-x !important; }

.bg-gradient-pink {
  background: #e83e8c linear-gradient(180deg, #eb5b9d, #e83e8c) repeat-x !important; }

.bg-gradient-red {
  background: #D75842 linear-gradient(180deg, #dd715e, #D75842) repeat-x !important; }

.bg-gradient-orange {
  background: #323C9C linear-gradient(180deg, #5159ab, #323C9C) repeat-x !important; }

.bg-gradient-yellow {
  background: #CCA43B linear-gradient(180deg, #d4b258, #CCA43B) repeat-x !important; }

.bg-gradient-green {
  background: #47B473 linear-gradient(180deg, #63bf88, #47B473) repeat-x !important; }

.bg-gradient-teal {
  background: #20c997 linear-gradient(180deg, #41d1a7, #20c997) repeat-x !important; }

.bg-gradient-cyan {
  background: #1B98E0 linear-gradient(180deg, #3da7e5, #1B98E0) repeat-x !important; }

.bg-gradient-white {
  background: #fff linear-gradient(180deg, white, #fff) repeat-x !important; }

.bg-gradient-gray {
  background: #6c757d linear-gradient(180deg, #828a91, #6c757d) repeat-x !important; }

.bg-gradient-gray-dark {
  background: #01041b linear-gradient(180deg, #272a3d, #01041b) repeat-x !important; }

.bg-gradient-skyblue {
  background: #158df7 linear-gradient(180deg, #389ef8, #158df7) repeat-x !important; }

.bg-gradient-primary {
  background: #47B4AC linear-gradient(180deg, #63bfb8, #47B4AC) repeat-x !important; }

.bg-gradient-secondary {
  background: #323C9C linear-gradient(180deg, #5159ab, #323C9C) repeat-x !important; }

.bg-gradient-success {
  background: #47B473 linear-gradient(180deg, #63bf88, #47B473) repeat-x !important; }

.bg-gradient-info {
  background: #1B98E0 linear-gradient(180deg, #3da7e5, #1B98E0) repeat-x !important; }

.bg-gradient-warning {
  background: #CCA43B linear-gradient(180deg, #d4b258, #CCA43B) repeat-x !important; }

.bg-gradient-danger {
  background: #D75842 linear-gradient(180deg, #dd715e, #D75842) repeat-x !important; }

.bg-gradient-light {
  background: #F6F8FB linear-gradient(180deg, #f7f9fc, #F6F8FB) repeat-x !important; }

.bg-gradient-dark {
  background: #01041b linear-gradient(180deg, #272a3d, #01041b) repeat-x !important; }

.bg-gradient-orange {
  background: #323C9C linear-gradient(180deg, #5159ab, #323C9C) repeat-x !important; }

.bg-gradient-purple {
  background: #4731b6 linear-gradient(180deg, #6350c1, #4731b6) repeat-x !important; }

.bg-gradient-skyblue {
  background: #158df7 linear-gradient(180deg, #389ef8, #158df7) repeat-x !important; }

.bg-gradient-light-gray {
  background: #f4f5fa linear-gradient(180deg, #f6f7fb, #f4f5fa) repeat-x !important; }

.bg-gradient-white {
  background: #fff linear-gradient(180deg, white, #fff) repeat-x !important; }

.bg-primary {
  color: #fff !important;
  background-color: #47B4AC !important; }

a.bg-primary:hover, a.bg-primary:focus,
button.bg-primary:hover,
button.bg-primary:focus {
  color: #fff !important;
  background-color: #398f89 !important; }

.badge-primary {
  color: #fff !important;
  background-color: #47B4AC !important; }

a.badge-primary:hover, a.badge-primary:focus,
button.badge-primary:hover,
button.badge-primary:focus {
  color: #fff !important;
  background-color: #398f89 !important; }

.bg-secondary {
  color: #fff !important;
  background-color: #323C9C !important; }

a.bg-secondary:hover, a.bg-secondary:focus,
button.bg-secondary:hover,
button.bg-secondary:focus {
  color: #fff !important;
  background-color: #262d75 !important; }

.badge-secondary {
  color: #fff !important;
  background-color: #323C9C !important; }

a.badge-secondary:hover, a.badge-secondary:focus,
button.badge-secondary:hover,
button.badge-secondary:focus {
  color: #fff !important;
  background-color: #262d75 !important; }

.bg-success {
  color: #fff !important;
  background-color: #47B473 !important; }

a.bg-success:hover, a.bg-success:focus,
button.bg-success:hover,
button.bg-success:focus {
  color: #fff !important;
  background-color: #398f5c !important; }

.badge-success {
  color: #fff !important;
  background-color: #47B473 !important; }

a.badge-success:hover, a.badge-success:focus,
button.badge-success:hover,
button.badge-success:focus {
  color: #fff !important;
  background-color: #398f5c !important; }

.bg-info {
  color: #fff !important;
  background-color: #1B98E0 !important; }

a.bg-info:hover, a.bg-info:focus,
button.bg-info:hover,
button.bg-info:focus {
  color: #fff !important;
  background-color: #1679b2 !important; }

.badge-info {
  color: #fff !important;
  background-color: #1B98E0 !important; }

a.badge-info:hover, a.badge-info:focus,
button.badge-info:hover,
button.badge-info:focus {
  color: #fff !important;
  background-color: #1679b2 !important; }

.bg-warning {
  color: #fff !important;
  background-color: #CCA43B !important; }

a.bg-warning:hover, a.bg-warning:focus,
button.bg-warning:hover,
button.bg-warning:focus {
  color: #fff !important;
  background-color: #a8862c !important; }

.badge-warning {
  color: #fff !important;
  background-color: #CCA43B !important; }

a.badge-warning:hover, a.badge-warning:focus,
button.badge-warning:hover,
button.badge-warning:focus {
  color: #fff !important;
  background-color: #a8862c !important; }

.bg-danger {
  color: #fff !important;
  background-color: #D75842 !important; }

a.bg-danger:hover, a.bg-danger:focus,
button.bg-danger:hover,
button.bg-danger:focus {
  color: #fff !important;
  background-color: #be3e28 !important; }

.badge-danger {
  color: #fff !important;
  background-color: #D75842 !important; }

a.badge-danger:hover, a.badge-danger:focus,
button.badge-danger:hover,
button.badge-danger:focus {
  color: #fff !important;
  background-color: #be3e28 !important; }

.bg-light {
  color: #212529 !important;
  background-color: #F6F8FB !important; }

a.bg-light:hover, a.bg-light:focus,
button.bg-light:hover,
button.bg-light:focus {
  color: #fff !important;
  background-color: #d3ddeb !important; }

.badge-light {
  color: #212529 !important;
  background-color: #F6F8FB !important; }

a.badge-light:hover, a.badge-light:focus,
button.badge-light:hover,
button.badge-light:focus {
  color: #fff !important;
  background-color: #d3ddeb !important; }

.bg-dark {
  color: #fff !important;
  background-color: #01041b !important; }

a.bg-dark:hover, a.bg-dark:focus,
button.bg-dark:hover,
button.bg-dark:focus {
  color: #fff !important;
  background-color: black !important; }

.badge-dark {
  color: #fff !important;
  background-color: #01041b !important; }

a.badge-dark:hover, a.badge-dark:focus,
button.badge-dark:hover,
button.badge-dark:focus {
  color: #fff !important;
  background-color: black !important; }

.bg-orange {
  color: #fff !important;
  background-color: #323C9C !important; }

a.bg-orange:hover, a.bg-orange:focus,
button.bg-orange:hover,
button.bg-orange:focus {
  color: #fff !important;
  background-color: #262d75 !important; }

.badge-orange {
  color: #fff !important;
  background-color: #323C9C !important; }

a.badge-orange:hover, a.badge-orange:focus,
button.badge-orange:hover,
button.badge-orange:focus {
  color: #fff !important;
  background-color: #262d75 !important; }

.bg-purple {
  color: #fff !important;
  background-color: #4731b6 !important; }

a.bg-purple:hover, a.bg-purple:focus,
button.bg-purple:hover,
button.bg-purple:focus {
  color: #fff !important;
  background-color: #37268e !important; }

.badge-purple {
  color: #fff !important;
  background-color: #4731b6 !important; }

a.badge-purple:hover, a.badge-purple:focus,
button.badge-purple:hover,
button.badge-purple:focus {
  color: #fff !important;
  background-color: #37268e !important; }

.bg-skyblue {
  color: #fff !important;
  background-color: #158df7 !important; }

a.bg-skyblue:hover, a.bg-skyblue:focus,
button.bg-skyblue:hover,
button.bg-skyblue:focus {
  color: #fff !important;
  background-color: #0773d2 !important; }

.badge-skyblue {
  color: #fff !important;
  background-color: #158df7 !important; }

a.badge-skyblue:hover, a.badge-skyblue:focus,
button.badge-skyblue:hover,
button.badge-skyblue:focus {
  color: #fff !important;
  background-color: #0773d2 !important; }

.bg-light-gray {
  color: #212529 !important;
  background-color: #f4f5fa !important; }

a.bg-light-gray:hover, a.bg-light-gray:focus,
button.bg-light-gray:hover,
button.bg-light-gray:focus {
  color: #fff !important;
  background-color: #d1d5ea !important; }

.badge-light-gray {
  color: #212529 !important;
  background-color: #f4f5fa !important; }

a.badge-light-gray:hover, a.badge-light-gray:focus,
button.badge-light-gray:hover,
button.badge-light-gray:focus {
  color: #fff !important;
  background-color: #d1d5ea !important; }

.bg-white {
  color: #212529 !important;
  background-color: #fff !important; }

a.bg-white:hover, a.bg-white:focus,
button.bg-white:hover,
button.bg-white:focus {
  color: #fff !important;
  background-color: #e6e6e6 !important; }

.badge-white {
  color: #212529 !important;
  background-color: #fff !important; }

a.badge-white:hover, a.badge-white:focus,
button.badge-white:hover,
button.badge-white:focus {
  color: #fff !important;
  background-color: #e6e6e6 !important; }

.bg-primary-light {
  color: #2aa88c !important;
  background-color: #DBF6F0 !important; }

a.bg-primary-light:hover, a.bg-primary-light:focus,
button.bg-primary-light:hover,
button.bg-primary-light:focus {
  color: #2aa88c !important;
  background-color: #b2ecdf !important; }

.bg-secondary-light {
  color: #222a6d !important;
  background-color: #AAB0E4 !important; }

a.bg-secondary-light:hover, a.bg-secondary-light:focus,
button.bg-secondary-light:hover,
button.bg-secondary-light:focus {
  color: #222a6d !important;
  background-color: #838cd8 !important; }

.bg-success-light {
  color: #2c6e47 !important;
  background-color: #b6e2c8 !important; }

a.bg-success-light:hover, a.bg-success-light:focus,
button.bg-success-light:hover,
button.bg-success-light:focus {
  color: #2c6e47 !important;
  background-color: #92d4ad !important; }

.bg-info-light {
  color: #136390 !important;
  background-color: #AEDBF4 !important; }

a.bg-info-light:hover, a.bg-info-light:focus,
button.bg-info-light:hover,
button.bg-info-light:focus {
  color: #136390 !important;
  background-color: #81c7ee !important; }

.bg-warning-light {
  color: #816722 !important;
  background-color: #ECDDB6 !important; }

a.bg-warning-light:hover, a.bg-warning-light:focus,
button.bg-warning-light:hover,
button.bg-warning-light:focus {
  color: #816722 !important;
  background-color: #e1ca8e !important; }

.bg-danger-light {
  color: #7e2a1b !important;
  background-color: #edb5ab !important; }

a.bg-danger-light:hover, a.bg-danger-light:focus,
button.bg-danger-light:hover,
button.bg-danger-light:focus {
  color: #7e2a1b !important;
  background-color: #e49081 !important; }

.bg-light-light {
  color: #4a70a8 !important;
  background-color: #F6F8FB !important; }

a.bg-light-light:hover, a.bg-light-light:focus,
button.bg-light-light:hover,
button.bg-light-light:focus {
  color: #4a70a8 !important;
  background-color: #d3ddeb !important; }

.bg-dark-light {
  color: rgba(68, 74, 87, 0.1) !important;
  background-color: rgba(199, 203, 211, 0.1) !important; }

a.bg-dark-light:hover, a.bg-dark-light:focus,
button.bg-dark-light:hover,
button.bg-dark-light:focus {
  color: rgba(68, 74, 87, 0.1) !important;
  background-color: rgba(170, 176, 189, 0.1) !important; }

.bg-orange-light {
  color: #222a6d !important;
  background-color: #AAB0E4 !important; }

a.bg-orange-light:hover, a.bg-orange-light:focus,
button.bg-orange-light:hover,
button.bg-orange-light:focus {
  color: #222a6d !important;
  background-color: #838cd8 !important; }

.bg-purple-light {
  color: #2200c0 !important;
  background-color: #cbc0ff !important; }

a.bg-purple-light:hover, a.bg-purple-light:focus,
button.bg-purple-light:hover,
button.bg-purple-light:focus {
  color: #2200c0 !important;
  background-color: #a18dff !important; }

.bg-skyblue-light {
  color: #005aaa !important;
  background-color: #aad7ff !important; }

a.bg-skyblue-light:hover, a.bg-skyblue-light:focus,
button.bg-skyblue-light:hover,
button.bg-skyblue-light:focus {
  color: #005aaa !important;
  background-color: #77bfff !important; }

.bg-white-light {
  color: gray !important;
  background-color: #fff !important; }

a.bg-white-light:hover, a.bg-white-light:focus,
button.bg-white-light:hover,
button.bg-white-light:focus {
  color: gray !important;
  background-color: #e6e6e6 !important; }

/*** Sections backgrounds ***/

/*** Background colors with transparency ***/

.avatar-25 {
  height: 25px;
  width: 25px;
  line-height: 25px;
  min-width: 25px; }

.avatar-30 {
  height: 30px;
  width: 30px;
  line-height: 30px;
  min-width: 30px; }

.avatar-35 {
  height: 35px;
  width: 35px;
  line-height: 35px;
  min-width: 35px; }

.avatar-40 {
  height: 40px;
  width: 40px;
  line-height: 40px;
  min-width: 40px; }

.avatar-45 {
  height: 45px;
  width: 45px;
  line-height: 45px;
  min-width: 45px; }

.avatar-50 {
  height: 50px;
  width: 50px;
  line-height: 50px;
  min-width: 50px; }

.avatar-60 {
  height: 60px;
  width: 60px;
  line-height: 60px;
  min-width: 60px; }

.avatar-70 {
  height: 70px;
  width: 70px;
  line-height: 70px;
  min-width: 70px; }

.avatar-80 {
  height: 80px;
  width: 80px;
  line-height: 80px;
  min-width: 80px; }

.avatar-90 {
  height: 90px;
  width: 90px;
  line-height: 90px;
  min-width: 90px; }

.avatar-100 {
  height: 100px;
  width: 100px;
  line-height: 100px;
  min-width: 100px; }

.avatar-110 {
  height: 110px;
  width: 110px;
  line-height: 110px;
  min-width: 110px; }

.avatar-120 {
  height: 120px;
  width: 120px;
  line-height: 120px;
  min-width: 120px; }

.avatar-130 {
  height: 130px;
  width: 130px;
  line-height: 130px;
  min-width: 130px; }

.avatar-155 {
  height: 155px;
  width: 155px;
  line-height: 155px;
  min-width: 155px; }

.avatar-235 {
  height: 235px;
  width: 235px;
  line-height: 235px;
  min-width: 235px; }

/*
 * Font Helper
 */

.font-size-12 {
  font-size: 12px !important; }

.font-size-14 {
  font-size: 14px !important; }

.font-size-16 {
  font-size: 16px !important; }

.font-size-18 {
  font-size: 18px !important; }

.font-size-20 {
  font-size: 20px !important; }

.font-size-32 {
  font-size: 32px !important; }

.font-size-40 {
  font-size: 40px !important; }

/*** Weight and italics ***/

.font-weight-300 {
  font-weight: 300 !important; }

.font-weight-400 {
  font-weight: 400 !important; }

.font-weight-500 {
  font-weight: 500 !important; }

.font-weight-600 {
  font-weight: 600 !important; }

.font-weight-700 {
  font-weight: 700 !important; }

.font-weight-800 {
  font-weight: 800 !important; }

.font-weight-900 {
  font-weight: 900 !important; }

/*** Text decorations ***/

.text-underline {
  text-decoration: underline; }

.text-through {
  text-decoration: line-through; }

/*** Text size ***/

@media (min-width: 576px) {
  .text-xs-chirag {
    font-size: 12 !important; } }

.text-sm {
  font-size: 12 !important; }

.text-lg {
  font-size: 20 !important; }

.text-xl {
  font-size: 1.563 !important; }

/*** Line heights ***/

.line-height-100 {
  line-height: 1; }

.line-height-110 {
  line-height: 1.1; }

.line-height-120 {
  line-height: 1.2; }

.line-height-130 {
  line-height: 1.3; }

.line-height-140 {
  line-height: 1.4; }

.line-height-150 {
  line-height: 1.5; }

.line-height-160 {
  line-height: 1.6; }

.line-height-170 {
  line-height: 1.7; }

.line-height-180 {
  line-height: 1.8; }

/*** Letter spacings ***/

.letter-spacing-1 {
  letter-spacing: .0625rem; }

.letter-spacing-15 {
  letter-spacing: .09375rem; }

.letter-spacing-2 {
  letter-spacing: 0.125rem; }

/*** Text color variations ***/

.text-blue {
  color: #47B4AC !important; }

a.text-blue:hover, a.text-blue:focus {
  color: #317d78 !important; }

.text-indigo {
  color: #6610f2 !important; }

a.text-indigo:hover, a.text-indigo:focus {
  color: #4709ac !important; }

.text-purple {
  color: #4731b6 !important; }

a.text-purple:hover, a.text-purple:focus {
  color: #2f217a !important; }

.text-pink {
  color: #e83e8c !important; }

a.text-pink:hover, a.text-pink:focus {
  color: #c21766 !important; }

.text-red {
  color: #D75842 !important; }

a.text-red:hover, a.text-red:focus {
  color: #a93724 !important; }

.text-orange {
  color: #323C9C !important; }

a.text-orange:hover, a.text-orange:focus {
  color: #1f2662 !important; }

.text-yellow {
  color: #CCA43B !important; }

a.text-yellow:hover, a.text-yellow:focus {
  color: #947627 !important; }

.text-green {
  color: #47B473 !important; }

a.text-green:hover, a.text-green:focus {
  color: #317d50 !important; }

.text-teal {
  color: #20c997 !important; }

a.text-teal:hover, a.text-teal:focus {
  color: #158765 !important; }

.text-cyan {
  color: #1B98E0 !important; }

a.text-cyan:hover, a.text-cyan:focus {
  color: #136a9c !important; }

.text-white {
  color: #fff !important; }

a.text-white:hover, a.text-white:focus {
  color: #d9d9d9 !important; }

.text-gray {
  color: #6c757d !important; }

a.text-gray:hover, a.text-gray:focus {
  color: #494f54 !important; }

.text-gray-dark {
  color: #01041b !important; }

a.text-gray-dark:hover, a.text-gray-dark:focus {
  color: black !important; }

.text-skyblue {
  color: #158df7 !important; }

a.text-skyblue:hover, a.text-skyblue:focus {
  color: #0665b9 !important; }

/*
 * Image Align
 */

.img-center {
  display: block;
  margin-left: auto;
  margin-right: auto; }

.w-60 {
  width: 60%; }

.rounded-top {
  border-top-left-radius: 10px 10px 0 10px !important;
  border-top-right-radius: 10px 10px 0 10px !important; }

/*!
Animate.css - http://daneden.me/animate
Licensed under the MIT license

Copyright (c) 2013 Daniel Eden

Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:

The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.

THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
*/

.animated {
  animation-duration: 1s;
  animation-fill-mode: both; }

.animated.hinge {
  animation-duration: 2s; }

@keyframes bounce {
  0%, 20%, 50%, 80%, 100% {
    transform: translateY(0); }
  40% {
    transform: translateY(-30px); }
  60% {
    transform: translateY(-15px); } }

.bounce {
  animation-name: bounce; }

@keyframes flash {
  0%, 50%, 100% {
    opacity: 1; }
  25%, 75% {
    opacity: 0; } }

.flash {
  animation-name: flash; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes pulse {
  0% {
    transform: scale(1); }
  50% {
    transform: scale(1.1); }
  100% {
    transform: scale(1); } }

.pulse {
  animation-name: pulse; }

@keyframes shake {
  0%, 100% {
    transform: translateX(0); }
  10%, 30%, 50%, 70%, 90% {
    transform: translateX(-10px); }
  20%, 40%, 60%, 80% {
    transform: translateX(10px); } }

.shake {
  animation-name: shake; }

@keyframes swing {
  20% {
    transform: rotate(15deg); }
  40% {
    transform: rotate(-10deg); }
  60% {
    transform: rotate(5deg); }
  80% {
    transform: rotate(-5deg); }
  100% {
    transform: rotate(0deg); } }

.swing {
  transform-origin: top center;
  animation-name: swing; }

@keyframes tada {
  0% {
    transform: scale(1); }
  10%, 20% {
    transform: scale(0.9) rotate(-3deg); }
  30%, 50%, 70%, 90% {
    transform: scale(1.1) rotate(3deg); }
  40%, 60%, 80% {
    transform: scale(1.1) rotate(-3deg); }
  100% {
    transform: scale(1) rotate(0); } }

.tada {
  animation-name: tada; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes wobble {
  0% {
    transform: translateX(0%); }
  15% {
    transform: translateX(-25%) rotate(-5deg); }
  30% {
    transform: translateX(20%) rotate(3deg); }
  45% {
    transform: translateX(-15%) rotate(-3deg); }
  60% {
    transform: translateX(10%) rotate(2deg); }
  75% {
    transform: translateX(-5%) rotate(-1deg); }
  100% {
    transform: translateX(0%); } }

.wobble {
  animation-name: wobble; }

@keyframes bounceIn {
  0% {
    opacity: 0;
    transform: scale(0.3); }
  50% {
    opacity: 1;
    transform: scale(1.05); }
  70% {
    transform: scale(0.9); }
  100% {
    transform: scale(1); } }

.bounceIn {
  animation-name: bounceIn; }

@keyframes bounceInDown {
  0% {
    opacity: 0;
    transform: translateY(-2000px); }
  60% {
    opacity: 1;
    transform: translateY(30px); }
  80% {
    transform: translateY(-10px); }
  100% {
    transform: translateY(0); } }

.bounceInDown {
  animation-name: bounceInDown; }

@keyframes bounceInLeft {
  0% {
    opacity: 0;
    transform: translateX(-2000px); }
  60% {
    opacity: 1;
    transform: translateX(30px); }
  80% {
    transform: translateX(-10px); }
  100% {
    transform: translateX(0); } }

.bounceInLeft {
  animation-name: bounceInLeft; }

@keyframes bounceInRight {
  0% {
    opacity: 0;
    transform: translateX(2000px); }
  60% {
    opacity: 1;
    transform: translateX(-30px); }
  80% {
    transform: translateX(10px); }
  100% {
    transform: translateX(0); } }

.bounceInRight {
  animation-name: bounceInRight; }

@keyframes bounceInUp {
  0% {
    opacity: 0;
    transform: translateY(2000px); }
  60% {
    opacity: 1;
    transform: translateY(-30px); }
  80% {
    transform: translateY(10px); }
  100% {
    transform: translateY(0); } }

.bounceInUp {
  animation-name: bounceInUp; }

@keyframes bounceOut {
  0% {
    transform: scale(1); }
  25% {
    transform: scale(0.95); }
  50% {
    opacity: 1;
    transform: scale(1.1); }
  100% {
    opacity: 0;
    transform: scale(0.3); } }

.bounceOut {
  animation-name: bounceOut; }

@keyframes bounceOutDown {
  0% {
    transform: translateY(0); }
  20% {
    opacity: 1;
    transform: translateY(-20px); }
  100% {
    opacity: 0;
    transform: translateY(2000px); } }

.bounceOutDown {
  animation-name: bounceOutDown; }

@keyframes bounceOutLeft {
  0% {
    transform: translateX(0); }
  20% {
    opacity: 1;
    transform: translateX(20px); }
  100% {
    opacity: 0;
    transform: translateX(-2000px); } }

.bounceOutLeft {
  animation-name: bounceOutLeft; }

@keyframes bounceOutRight {
  0% {
    transform: translateX(0); }
  20% {
    opacity: 1;
    transform: translateX(-20px); }
  100% {
    opacity: 0;
    transform: translateX(2000px); } }

.bounceOutRight {
  animation-name: bounceOutRight; }

@keyframes bounceOutUp {
  0% {
    transform: translateY(0); }
  20% {
    opacity: 1;
    transform: translateY(20px); }
  100% {
    opacity: 0;
    transform: translateY(-2000px); } }

.bounceOutUp {
  animation-name: bounceOutUp; }

@keyframes fadeIn {
  0% {
    opacity: 0; }
  100% {
    opacity: 1; } }

.fadeIn {
  animation-name: fadeIn; }

@keyframes fadeInDown {
  0% {
    opacity: 0;
    transform: translateY(-20px); }
  100% {
    opacity: 1;
    transform: translateY(0); } }

.fadeInDown {
  animation-name: fadeInDown; }

@keyframes fadeInDownBig {
  0% {
    opacity: 0;
    transform: translateY(-2000px); }
  100% {
    opacity: 1;
    transform: translateY(0); } }

.fadeInDownBig {
  animation-name: fadeInDownBig; }

@keyframes fadeInLeft {
  0% {
    opacity: 0;
    transform: translateX(-20px); }
  100% {
    opacity: 1;
    transform: translateX(0); } }

.fadeInLeft {
  animation-name: fadeInLeft; }

@keyframes fadeInLeftBig {
  0% {
    opacity: 0;
    transform: translateX(-2000px); }
  100% {
    opacity: 1;
    transform: translateX(0); } }

.fadeInLeftBig {
  animation-name: fadeInLeftBig; }

@keyframes fadeInRight {
  0% {
    opacity: 0;
    transform: translateX(20px); }
  100% {
    opacity: 1;
    transform: translateX(0); } }

.fadeInRight {
  animation-name: fadeInRight; }

@keyframes fadeInRightBig {
  0% {
    opacity: 0;
    transform: translateX(2000px); }
  100% {
    opacity: 1;
    transform: translateX(0); } }

.fadeInRightBig {
  animation-name: fadeInRightBig; }

@keyframes fadeInUp {
  0% {
    opacity: 0;
    transform: translateY(20px); }
  100% {
    opacity: 1;
    transform: translateY(0); } }

.fadeInUp {
  animation-name: fadeInUp; }

@keyframes fadeInUpBig {
  0% {
    opacity: 0;
    transform: translateY(2000px); }
  100% {
    opacity: 1;
    transform: translateY(0); } }

.fadeInUpBig {
  animation-name: fadeInUpBig; }

@keyframes fadeOut {
  0% {
    opacity: 1; }
  100% {
    opacity: 0; } }

.fadeOut {
  animation-name: fadeOut; }

@keyframes fadeOutDown {
  0% {
    opacity: 1;
    transform: translateY(0); }
  100% {
    opacity: 0;
    transform: translateY(20px); } }

.fadeOutDown {
  animation-name: fadeOutDown; }

@keyframes fadeOutDownBig {
  0% {
    opacity: 1;
    transform: translateY(0); }
  100% {
    opacity: 0;
    transform: translateY(2000px); } }

.fadeOutDownBig {
  animation-name: fadeOutDownBig; }

@keyframes fadeOutLeft {
  0% {
    opacity: 1;
    transform: translateX(0); }
  100% {
    opacity: 0;
    transform: translateX(-20px); } }

.fadeOutLeft {
  animation-name: fadeOutLeft; }

@keyframes fadeOutLeftBig {
  0% {
    opacity: 1;
    transform: translateX(0); }
  100% {
    opacity: 0;
    transform: translateX(-2000px); } }

.fadeOutLeftBig {
  animation-name: fadeOutLeftBig; }

@keyframes fadeOutRight {
  0% {
    opacity: 1;
    transform: translateX(0); }
  100% {
    opacity: 0;
    transform: translateX(20px); } }

.fadeOutRight {
  animation-name: fadeOutRight; }

@keyframes fadeOutRightBig {
  0% {
    opacity: 1;
    transform: translateX(0); }
  100% {
    opacity: 0;
    transform: translateX(2000px); } }

.fadeOutRightBig {
  animation-name: fadeOutRightBig; }

@keyframes fadeOutUp {
  0% {
    opacity: 1;
    transform: translateY(0); }
  100% {
    opacity: 0;
    transform: translateY(-20px); } }

.fadeOutUp {
  animation-name: fadeOutUp; }

@keyframes fadeOutUpBig {
  0% {
    opacity: 1;
    transform: translateY(0); }
  100% {
    opacity: 0;
    transform: translateY(-2000px); } }

.fadeOutUpBig {
  animation-name: fadeOutUpBig; }

@keyframes flip {
  0% {
    transform: perspective(400px) translateZ(0) rotateY(0) scale(1);
    animation-timing-function: ease-out; }
  40% {
    transform: perspective(400px) translateZ(150px) rotateY(170deg) scale(1);
    animation-timing-function: ease-out; }
  50% {
    transform: perspective(400px) translateZ(150px) rotateY(190deg) scale(1);
    animation-timing-function: ease-in; }
  80% {
    transform: perspective(400px) translateZ(0) rotateY(360deg) scale(0.95);
    animation-timing-function: ease-in; }
  100% {
    transform: perspective(400px) translateZ(0) rotateY(360deg) scale(1);
    animation-timing-function: ease-in; } }

.animated.flip {
  backface-visibility: visible;
  animation-name: flip; }

@keyframes flipInX {
  0% {
    transform: perspective(400px) rotateX(90deg);
    opacity: 0; }
  40% {
    transform: perspective(400px) rotateX(-10deg); }
  70% {
    transform: perspective(400px) rotateX(10deg); }
  100% {
    transform: perspective(400px) rotateX(0deg);
    opacity: 1; } }

.flipInX {
  backface-visibility: visible !important;
  animation-name: flipInX; }

@keyframes flipInY {
  0% {
    transform: perspective(400px) rotateY(90deg);
    opacity: 0; }
  40% {
    transform: perspective(400px) rotateY(-10deg); }
  70% {
    transform: perspective(400px) rotateY(10deg); }
  100% {
    transform: perspective(400px) rotateY(0deg);
    opacity: 1; } }

.flipInY {
  backface-visibility: visible !important;
  animation-name: flipInY; }

@keyframes flipOutX {
  0% {
    transform: perspective(400px) rotateX(0deg);
    opacity: 1; }
  100% {
    transform: perspective(400px) rotateX(90deg);
    opacity: 0; } }

.flipOutX {
  animation-name: flipOutX;
  backface-visibility: visible !important; }

@keyframes flipOutY {
  0% {
    transform: perspective(400px) rotateY(0deg);
    opacity: 1; }
  100% {
    transform: perspective(400px) rotateY(90deg);
    opacity: 0; } }

.flipOutY {
  backface-visibility: visible !important;
  animation-name: flipOutY; }

@keyframes lightSpeedIn {
  0% {
    transform: translateX(100%) skewX(-30deg);
    opacity: 0; }
  60% {
    transform: translateX(-20%) skewX(30deg);
    opacity: 1; }
  80% {
    transform: translateX(0%) skewX(-15deg);
    opacity: 1; }
  100% {
    transform: translateX(0%) skewX(0deg);
    opacity: 1; } }

.lightSpeedIn {
  animation-name: lightSpeedIn;
  animation-timing-function: ease-out; }

@keyframes lightSpeedOut {
  0% {
    transform: translateX(0%) skewX(0deg);
    opacity: 1; }
  100% {
    transform: translateX(100%) skewX(-30deg);
    opacity: 0; } }

.lightSpeedOut {
  animation-name: lightSpeedOut;
  animation-timing-function: ease-in; }

@keyframes rotateIn {
  0% {
    transform-origin: center center;
    transform: rotate(-200deg);
    opacity: 0; }
  100% {
    transform-origin: center center;
    transform: rotate(0);
    opacity: 1; } }

.rotateIn {
  animation-name: rotateIn; }

@keyframes rotateInDownLeft {
  0% {
    transform-origin: left bottom;
    transform: rotate(-90deg);
    opacity: 0; }
  100% {
    transform-origin: left bottom;
    transform: rotate(0);
    opacity: 1; } }

.rotateInDownLeft {
  animation-name: rotateInDownLeft; }

@keyframes rotateInDownRight {
  0% {
    transform-origin: right bottom;
    transform: rotate(90deg);
    opacity: 0; }
  100% {
    transform-origin: right bottom;
    transform: rotate(0);
    opacity: 1; } }

.rotateInDownRight {
  animation-name: rotateInDownRight; }

@keyframes rotateInUpLeft {
  0% {
    transform-origin: left bottom;
    transform: rotate(90deg);
    opacity: 0; }
  100% {
    transform-origin: left bottom;
    transform: rotate(0);
    opacity: 1; } }

.rotateInUpLeft {
  animation-name: rotateInUpLeft; }

@keyframes rotateInUpRight {
  0% {
    transform-origin: right bottom;
    transform: rotate(-90deg);
    opacity: 0; }
  100% {
    transform-origin: right bottom;
    transform: rotate(0);
    opacity: 1; } }

.rotateInUpRight {
  animation-name: rotateInUpRight; }

@keyframes rotateOut {
  0% {
    transform-origin: center center;
    transform: rotate(0);
    opacity: 1; }
  100% {
    transform-origin: center center;
    transform: rotate(200deg);
    opacity: 0; } }

.rotateOut {
  animation-name: rotateOut; }

@keyframes rotateOutDownLeft {
  0% {
    transform-origin: left bottom;
    transform: rotate(0);
    opacity: 1; }
  100% {
    transform-origin: left bottom;
    transform: rotate(90deg);
    opacity: 0; } }

.rotateOutDownLeft {
  animation-name: rotateOutDownLeft; }

@keyframes rotateOutDownRight {
  0% {
    transform-origin: right bottom;
    transform: rotate(0);
    opacity: 1; }
  100% {
    transform-origin: right bottom;
    transform: rotate(-90deg);
    opacity: 0; } }

.rotateOutDownRight {
  animation-name: rotateOutDownRight; }

@keyframes rotateOutUpLeft {
  0% {
    transform-origin: left bottom;
    transform: rotate(0);
    opacity: 1; }
  100% {
    transform-origin: left bottom;
    transform: rotate(-90deg);
    opacity: 0; } }

.rotateOutUpLeft {
  animation-name: rotateOutUpLeft; }

@keyframes rotateOutUpRight {
  0% {
    transform-origin: right bottom;
    transform: rotate(0);
    opacity: 1; }
  100% {
    transform-origin: right bottom;
    transform: rotate(90deg);
    opacity: 0; } }

.rotateOutUpRight {
  animation-name: rotateOutUpRight; }

@keyframes slideInDown {
  0% {
    opacity: 0;
    transform: translateY(-2000px); }
  100% {
    transform: translateY(0); } }

.slideInDown {
  animation-name: slideInDown; }

@keyframes slideInLeft {
  0% {
    opacity: 0;
    transform: translateX(-2000px); }
  100% {
    transform: translateX(0); } }

.slideInLeft {
  animation-name: slideInLeft; }

@keyframes slideInRight {
  0% {
    opacity: 0;
    transform: translateX(2000px); }
  100% {
    transform: translateX(0); } }

.slideInRight {
  animation-name: slideInRight; }

@keyframes slideOutLeft {
  0% {
    transform: translateX(0); }
  100% {
    opacity: 0;
    transform: translateX(-2000px); } }

.slideOutLeft {
  animation-name: slideOutLeft; }

@keyframes slideOutRight {
  0% {
    transform: translateX(0); }
  100% {
    opacity: 0;
    transform: translateX(2000px); } }

.slideOutRight {
  animation-name: slideOutRight; }

@keyframes slideOutUp {
  0% {
    transform: translateY(0); }
  100% {
    opacity: 0;
    transform: translateY(-2000px); } }

.slideOutUp {
  animation-name: slideOutUp; }

@keyframes hinge {
  0% {
    transform: rotate(0);
    transform-origin: top left;
    animation-timing-function: ease-in-out; }
  20%, 60% {
    transform: rotate(80deg);
    transform-origin: top left;
    animation-timing-function: ease-in-out; }
  40% {
    transform: rotate(60deg);
    transform-origin: top left;
    animation-timing-function: ease-in-out; }
  80% {
    transform: rotate(60deg) translateY(0);
    opacity: 1;
    transform-origin: top left;
    animation-timing-function: ease-in-out; }
  100% {
    transform: translateY(700px);
    opacity: 0; } }

.hinge {
  animation-name: hinge; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes rollIn {
  0% {
    opacity: 0;
    transform: translateX(-100%) rotate(-120deg); }
  100% {
    opacity: 1;
    transform: translateX(0px) rotate(0deg); } }

.rollIn {
  animation-name: rollIn; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes rollOut {
  0% {
    opacity: 1;
    transform: translateX(0px) rotate(0deg); }
  100% {
    opacity: 0;
    transform: translateX(100%) rotate(120deg); } }

.rollOut {
  animation-name: rollOut; }

.swal2-popup.swal2-toast {
  flex-direction: row;
  align-items: center;
  width: auto;
  padding: 0.625em;
  overflow-y: hidden;
  background: #fff;
  box-shadow: 0 0 0.625em #d9d9d9; }

.swal2-popup.swal2-toast .swal2-header {
    flex-direction: row;
    padding: 0; }

.swal2-popup.swal2-toast .swal2-title {
    flex-grow: 1;
	padding-top: 10px;
    justify-content: flex-start;
    margin: 0 0.6em;
    font-size: 1em; }

.swal2-popup.swal2-toast .swal2-footer {
    margin: 0.5em 0 0;
    padding: 0.5em 0 0;
    font-size: 0.8em; }

.swal2-popup.swal2-toast .swal2-close {
    position: static;
    width: 0.8em;
    height: 0.8em;
    line-height: 0.8; }

.swal2-popup.swal2-toast .swal2-content {
    justify-content: flex-start;
    padding: 0;
    font-size: 1em; }

.swal2-popup.swal2-toast .swal2-icon {
	  grid-column: 1;
grid-row: 1/99;
    width: 2em;
    min-width: 2em;
    height: 2em;
    margin: 0; }

.swal2-popup.swal2-toast > * {
  grid-column: 2;
}

.swal2-popup.swal2-toast .swal2-icon .swal2-icon-content {
      display: flex;
      align-items: center;
      font-size: 1.8em;
      font-weight: bold; }

@media all and (-ms-high-contrast: none), (-ms-high-contrast: active) {
        .swal2-popup.swal2-toast .swal2-icon .swal2-icon-content {
          font-size: .25em; } }

.swal2-popup.swal2-toast .swal2-icon.swal2-success .swal2-success-ring {
      width: 2em;
      height: 2em; }

.swal2-popup.swal2-toast .swal2-icon.swal2-error [class^='swal2-x-mark-line'] {
      top: .875em;
      width: 1.375em; }

.swal2-popup.swal2-toast .swal2-icon.swal2-error [class^='swal2-x-mark-line'][class$='left'] {
        left: .3125em; }

.swal2-popup.swal2-toast .swal2-icon.swal2-error [class^='swal2-x-mark-line'][class$='right'] {
        right: .3125em; }

.swal2-popup.swal2-toast .swal2-actions {
    flex-basis: auto !important;
    width: auto;
    height: auto;
    margin: 0 .3125em;
    padding: 0; }

.swal2-popup.swal2-toast .swal2-styled {
    margin: .125em .3125em;
    padding: .3125em .625em;
    font-size: 1em; }

.swal2-popup.swal2-toast .swal2-styled:focus {
      box-shadow: 0 0 0 1px #fff, 0 0 0 3px rgba(100, 150, 200, 0.5); }

.swal2-popup.swal2-toast .swal2-success {
    border-color: #a5dc86; }

.swal2-popup.swal2-toast .swal2-success [class^='swal2-success-circular-line'] {
      position: absolute;
      width: 1.6em;
      height: 3em;
      transform: rotate(45deg);
      border-radius: 50%; }

.swal2-popup.swal2-toast .swal2-success [class^='swal2-success-circular-line'][class$='left'] {
        top: -.8em;
        left: -.5em;
        transform: rotate(-45deg);
        transform-origin: 2em 2em;
        border-radius: 4em 0 0 4em; }

.swal2-popup.swal2-toast .swal2-success [class^='swal2-success-circular-line'][class$='right'] {
        top: -.25em;
        left: .9375em;
        transform-origin: 0 1.5em;
        border-radius: 0 4em 4em 0; }

.swal2-popup.swal2-toast .swal2-success .swal2-success-ring {
      width: 2em;
      height: 2em; }

.swal2-popup.swal2-toast .swal2-success .swal2-success-fix {
      top: 0;
      left: .4375em;
      width: .4375em;
      height: 2.6875em; }

.swal2-popup.swal2-toast .swal2-success [class^='swal2-success-line'] {
      height: .3125em; }

.swal2-popup.swal2-toast .swal2-success [class^='swal2-success-line'][class$='tip'] {
        top: 1.125em;
        left: .1875em;
        width: .75em; }

.swal2-popup.swal2-toast .swal2-success [class^='swal2-success-line'][class$='long'] {
        top: .9375em;
        right: .1875em;
        width: 1.375em; }

.swal2-popup.swal2-toast .swal2-success.swal2-icon-show .swal2-success-line-tip {
      animation: swal2-toast-animate-success-line-tip .75s; }

.swal2-popup.swal2-toast .swal2-success.swal2-icon-show .swal2-success-line-long {
      animation: swal2-toast-animate-success-line-long .75s; }

.swal2-popup.swal2-toast.swal2-show {
    animation: swal2-toast-show 0.5s; }

.swal2-popup.swal2-toast.swal2-hide {
    animation: swal2-toast-hide 0.1s forwards; }

.swal2-popup.swal2-toast.swal2-icon-success.swal2-show{
	border-left:4px solid #a5dc86;
	border-radius:0px;
	
	}

.swal2-popup.swal2-toast.swal2-icon-info.swal2-show{
border-left:4px solid #3fc3ee;
	border-radius:0px;	
}

.swal2-popup.swal2-toast.swal2-icon-error.swal2-show{
	border-left:4px solid #f27474;
	border-radius:0px;	
}

.swal2-container {
  display: flex;
  position: fixed;
  z-index: 1060;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  flex-direction: row;
  align-items: center;
  justify-content: center;
  padding: 0.625em;
  overflow-x: hidden;
  transition: background-color 0.1s;
  -webkit-overflow-scrolling: touch; }

.swal2-container.swal2-backdrop-show, .swal2-container.swal2-noanimation {
    background: rgba(0, 0, 0, 0.8) none repeat scroll 0% 0%;
animation-duration: 0.4s;
animation-delay: 0s;
	
	 }

.swal2-container.swal2-backdrop-hide {
    background: transparent !important; }

.swal2-container.swal2-top {
    align-items: flex-start; }

.swal2-container.swal2-top-start, .swal2-container.swal2-top-left {
    align-items: flex-start;
    justify-content: flex-start; }

.swal2-container.swal2-top-end, .swal2-container.swal2-top-right {
    align-items: flex-start;
    justify-content: flex-end; }

.swal2-container.swal2-center {
    align-items: center; }

.swal2-container.swal2-center-start, .swal2-container.swal2-center-left {
    align-items: center;
    justify-content: flex-start; }

.swal2-container.swal2-center-end, .swal2-container.swal2-center-right {
    align-items: center;
    justify-content: flex-end; }

.swal2-container.swal2-bottom {
    align-items: flex-end; }

.swal2-container.swal2-bottom-start, .swal2-container.swal2-bottom-left {
    align-items: flex-end;
    justify-content: flex-start; }

.swal2-container.swal2-bottom-end, .swal2-container.swal2-bottom-right {
    align-items: flex-end;
    justify-content: flex-end; }

.swal2-container.swal2-bottom > :first-child,
  .swal2-container.swal2-bottom-start > :first-child,
  .swal2-container.swal2-bottom-left > :first-child,
  .swal2-container.swal2-bottom-end > :first-child,
  .swal2-container.swal2-bottom-right > :first-child {
    margin-top: auto; }

.swal2-container.swal2-grow-fullscreen > .swal2-modal {
    display: flex !important;
    flex: 1;
    align-self: stretch;
    justify-content: center; }

.swal2-container.swal2-grow-row > .swal2-modal {
    display: flex !important;
    flex: 1;
    align-content: center;
    justify-content: center; }

.swal2-container.swal2-grow-column {
    flex: 1;
    flex-direction: column; }

.swal2-container.swal2-grow-column.swal2-top, .swal2-container.swal2-grow-column.swal2-center, .swal2-container.swal2-grow-column.swal2-bottom {
      align-items: center; }

.swal2-container.swal2-grow-column.swal2-top-start, .swal2-container.swal2-grow-column.swal2-center-start, .swal2-container.swal2-grow-column.swal2-bottom-start, .swal2-container.swal2-grow-column.swal2-top-left, .swal2-container.swal2-grow-column.swal2-center-left, .swal2-container.swal2-grow-column.swal2-bottom-left {
      align-items: flex-start; }

.swal2-container.swal2-grow-column.swal2-top-end, .swal2-container.swal2-grow-column.swal2-center-end, .swal2-container.swal2-grow-column.swal2-bottom-end, .swal2-container.swal2-grow-column.swal2-top-right, .swal2-container.swal2-grow-column.swal2-center-right, .swal2-container.swal2-grow-column.swal2-bottom-right {
      align-items: flex-end; }

.swal2-container.swal2-grow-column > .swal2-modal {
      display: flex !important;
      flex: 1;
      align-content: center;
      justify-content: center; }

.swal2-container.swal2-no-transition {
    transition: none !important; }

.swal2-container:not(.swal2-top):not(.swal2-top-start):not(.swal2-top-end):not(.swal2-top-left):not(.swal2-top-right):not(.swal2-center-start):not(.swal2-center-end):not(.swal2-center-left):not(.swal2-center-right):not(.swal2-bottom):not(.swal2-bottom-start):not(.swal2-bottom-end):not(.swal2-bottom-left):not(.swal2-bottom-right):not(.swal2-grow-fullscreen) > .swal2-modal {
    margin: auto; }

@media all and (-ms-high-contrast: none), (-ms-high-contrast: active) {
    .swal2-container .swal2-modal {
      margin: 0 !important; } }

.swal2-icon-warning{
 outline: solid 1px #47B4AC;
outline-offset: 4px;	
	}

.swal2-confirm.swal2-styled.swal2-default-outline {
  background: #fff !important;
  color: #000;
}

#swal2-html-container {
  margin-bottom: 25px !important;
}

.swal2-popup {
  display: none;


  position: relative;
  box-sizing: border-box;
  flex-direction: column;
  justify-content: center;
  width: 25em;
/*  width: 32em;*/
  max-width: 100%;
  padding: 1.25em;
  border: none;
  border-radius: 0px;
  background: #fff;
  font-family: inherit;
  font-size: 1rem; }

.swal2-popup:focus {
    outline: none; }

.swal2-popup.swal2-loading {
    overflow-y: hidden; }

.swal2-header {
  display: flex;
  flex-direction: column;
  align-items: center;
  padding: 0 1.8em; }

.swal2-title {
  position: relative;
  max-width: 100%;
  margin: 0 0 0.4em;
  padding: 0;
  color: #595959;
  font-size: 1.875em;
  font-weight: 600;
  text-align: center;
  text-transform: none;
  word-wrap: break-word; }

.swal2-actions {
  display: flex;
  z-index: 1;
  box-sizing: border-box;
  flex-wrap: wrap;
  align-items: center;
  justify-content: center;
  width: 100%;
  margin: 1.25em auto 0;
  padding: 8px 1.6em; }

.swal2-actions:not(.swal2-loading) .swal2-styled[disabled] {
    opacity: .4; }

.swal2-actions:not(.swal2-loading) .swal2-styled:hover {
    background-image: linear-gradient(rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.1)); }

.swal2-actions:not(.swal2-loading) .swal2-styled:active {
    background-image: linear-gradient(rgba(0, 0, 0, 0.2), rgba(0, 0, 0, 0.2)); }

.swal2-loader {
  display: none;
  align-items: center;
  justify-content: center;
  width: 2.2em;
  height: 2.2em;
  margin: 0 1.875em;
  animation: swal2-rotate-loading 1.5s linear 0s infinite normal;
  border-width: 0.25em;
  border-style: solid;
  border-radius: 100%;
  border-color: #2778c4 transparent #2778c4 transparent; }

.swal2-styled {
  margin: 0.3125em;
  padding: 5px 15px;
  box-shadow: none;
font-weight: 600 !important;
font-size: 14px !important;
   }

.swal2-styled:not([disabled]) {
    cursor: pointer; }

.swal2-styled.swal2-confirm {
    border: 0;
    border-radius: 0.25em;
    background: initial;
    background-color: #2778c4;
    color: #fff;
    font-size: 1.0625em; }

.swal2-styled.swal2-deny {
    border: 0;
    border-radius: 0.25em;
    background: initial;
    background-color: rgb(50, 128, 122);
    color: #fff;
    font-size: 1.0625em; }

.swal2-styled.swal2-cancel {
    border: 0;
    border-radius: 0.25em;
    background: initial;
    background-color: rgb(22, 55, 52);
    color: #fff;
    font-size: 1.0625em; }

.swal2-styled:focus {
    outline: none;
    box-shadow: 0 0 0 3px rgba(100, 150, 200, 0.5); }

.swal2-styled::-moz-focus-inner {
    border: 0; }

.swal2-footer {
  justify-content: center;
  margin: 1.25em 0 0;
  padding: 1em 0 0;
  border-top: 1px solid #eee;
  color: #545454;
  font-size: 1em; }

.swal2-timer-progress-bar-container {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  height: 0.25em;
  overflow: hidden;
  border-bottom-right-radius: 5px;
  border-bottom-left-radius: 5px; }

.swal2-timer-progress-bar {
  width: 100%;
  height: 0.25em;
  background: rgba(0, 0, 0, 0.2); }

.swal2-image {
  max-width: 100%;
  margin: 1.25em auto; }

.swal2-close {
  position: absolute;
  z-index: 2;
  top: 0;
  right: 0;
  align-items: center;
  justify-content: center;
  width: 1.2em;
  height: 1.2em;
  padding: 0;
  overflow: hidden;
  transition: color 0.1s ease-out;
  border: none;
  border-radius: 5px;
  background: transparent;
  color: #cccccc;
  font-family: serif;
  font-size: 2.5em;
  line-height: 1.2;
  cursor: pointer; }

.swal2-close:hover {
    transform: none;
    background: transparent;
    color: #f27474; }

.swal2-close:focus {
    outline: none;
    box-shadow: inset 0 0 0 3px rgba(100, 150, 200, 0.5); }

.swal2-close::-moz-focus-inner {
    border: 0; }

.swal2-content {
  z-index: 1;
  justify-content: center;
  margin: 0;
  padding: 0 1.6em;
  color: #545454;
  font-size: 1.125em;
  font-weight: normal;
  line-height: normal;
  text-align: center;
  word-wrap: break-word; }

.swal2-input,
.swal2-file,
.swal2-textarea,
.swal2-select,
.swal2-radio,
.swal2-checkbox {
  margin: .1em auto; }

.swal2-input,
.swal2-file,
.swal2-textarea {
  box-sizing: border-box;
  width: 100%;
  transition: border-color 0.3s, box-shadow 0.3s;
  border: 1px solid #d9d9d9;
  border-radius: 0.1875em;
  background: inherit;
  box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.06);
  color: inherit;
  font-size: 1.125em; }

.swal2-input.swal2-inputerror,
  .swal2-file.swal2-inputerror,
  .swal2-textarea.swal2-inputerror {
    border-color: #f27474 !important;
    box-shadow: 0 0 2px #f27474 !important; }

.swal2-input:focus,
  .swal2-file:focus,
  .swal2-textarea:focus {
    border: 1px solid #b4dbed;
    outline: none;
    box-shadow: 0 0 0 3px rgba(100, 150, 200, 0.5); }

.swal2-input::placeholder,
  .swal2-file::placeholder,
  .swal2-textarea::placeholder {
    color: #cccccc; }

.swal2-range {
  margin: 1em auto;
  background: #fff; }

.swal2-range input {
    width: 80%; }

.swal2-range output {
    width: 20%;
    color: inherit;
    font-weight: 600;
    text-align: center; }

.swal2-range input,
  .swal2-range output {
    height: 2.625em;
    padding: 0;
    font-size: 1.125em;
    line-height: 2.625em; }

.swal2-input {
  height: 2.625em;
  padding: 0 0.75em; }

.swal2-input[type='number'] {
    max-width: 10em; }

.swal2-file {
  background: inherit;
  font-size: 1.125em; }

.swal2-textarea {
  height: 6.75em;
  padding: 0.75em; }

.swal2-select {
  min-width: 50%;
  max-width: 100%;
  padding: .375em .625em;
  background: inherit;
  color: inherit;
  font-size: 1.125em; }

.swal2-radio,
.swal2-checkbox {
  align-items: center;
  justify-content: center;
  background: #fff;
  color: inherit; }

.swal2-radio label,
  .swal2-checkbox label {
    margin: 0 .6em;
    font-size: 1.125em; }

.swal2-radio input,
  .swal2-checkbox input {
    margin: 0 .4em; }

.swal2-input-label {
  display: flex;
  justify-content: center;
  margin: 1em auto; }

.swal2-validation-message {
  display: none;
  align-items: center;
  justify-content: center;
  margin: 0 -2.7em;
  padding: 0.625em;
  overflow: hidden;
  background: #f0f0f0;
  color: #666666;
  font-size: 1em;
  font-weight: 300; }

.swal2-validation-message::before {
    content: '!';
    display: inline-block;
    width: 1.5em;
    min-width: 1.5em;
    height: 1.5em;
    margin: 0 .625em;
    border-radius: 50%;
    background-color: #f27474;
    color: #fff;
    font-weight: 600;
    line-height: 1.5em;
    text-align: center; }

.swal2-icon {
  position: relative;
  box-sizing: content-box;
  justify-content: center;
  width: 5em;
  height: 5em;
  margin: 1.25em auto 1.875em;
  border: 0.25em solid transparent;
  border-radius: 50%;
  border-color: #000;
  font-family: inherit;
  line-height: 5em;
  margin: 0px auto;
  cursor: default;
  -webkit-user-select: none;
          user-select: none; }

.swal2-icon .swal2-icon-content {
    display: flex;
    align-items: center;
    font-size: 3.75em; }

.swal2-icon.swal2-error {
    border-color: #f27474;
    color: #f27474;
 }

.swal2-icon.swal2-error .swal2-x-mark {
      position: relative;
      flex-grow: 1; }

.swal2-icon.swal2-error [class^='swal2-x-mark-line'] {
      display: block;
      position: absolute;
      top: 2.3125em;
      width: 2.9375em;
      height: .3125em;
      border-radius: .125em;
      background-color: #f27474; }

.swal2-icon.swal2-error [class^='swal2-x-mark-line'][class$='left'] {
        left: 1.0625em;
        transform: rotate(45deg); }

.swal2-icon.swal2-error [class^='swal2-x-mark-line'][class$='right'] {
        right: 1em;
        transform: rotate(-45deg); }

.swal2-icon.swal2-error.swal2-icon-show {
      animation: swal2-animate-error-icon .5s; }

.swal2-icon.swal2-error.swal2-icon-show .swal2-x-mark {
        animation: swal2-animate-error-x-mark .5s; }

.swal2-icon.swal2-warning {
    border-color: #facea8;
    color: #f8bb86; }

.swal2-icon.swal2-info {
    border-color: #9de0f6;
    color: #3fc3ee; }

.swal2-icon.swal2-question {
    border-color: #c9dae1;
    color: #87adbd; }

.swal2-icon.swal2-success {
    border-color: #a5dc86;
    color: #a5dc86; }

.swal2-icon.swal2-success [class^='swal2-success-circular-line'] {
      position: absolute;
      width: 3.75em;
      height: 7.5em;
      transform: rotate(45deg);
      border-radius: 50%; }

.swal2-icon.swal2-success [class^='swal2-success-circular-line'][class$='left'] {
        top: -.4375em;
        left: -2.0635em;
        transform: rotate(-45deg);
        transform-origin: 3.75em 3.75em;
        border-radius: 7.5em 0 0 7.5em; }

.swal2-icon.swal2-success [class^='swal2-success-circular-line'][class$='right'] {
        top: -.6875em;
        left: 1.875em;
        transform: rotate(-45deg);
        transform-origin: 0 3.75em;
        border-radius: 0 7.5em 7.5em 0; }

.swal2-icon.swal2-success .swal2-success-ring {
      position: absolute;
      z-index: 2;
      top: -.25em;
      left: -.25em;
      box-sizing: content-box;
      width: 100%;
      height: 100%;
      border: 0.25em solid rgba(165, 220, 134, 0.3);
      border-radius: 50%; }

.swal2-icon.swal2-success .swal2-success-fix {
      position: absolute;
      z-index: 1;
      top: .5em;
      left: 1.625em;
      width: .4375em;
      height: 5.625em;
      transform: rotate(-45deg); }

.swal2-icon.swal2-success [class^='swal2-success-line'] {
      display: block;
      position: absolute;
      z-index: 2;
      height: .3125em;
      border-radius: .125em;
      background-color: #a5dc86; }

.swal2-icon.swal2-success [class^='swal2-success-line'][class$='tip'] {
        top: 2.875em;
        left: .8125em;
        width: 1.5625em;
        transform: rotate(45deg); }

.swal2-icon.swal2-success [class^='swal2-success-line'][class$='long'] {
        top: 2.375em;
        right: .5em;
        width: 2.9375em;
        transform: rotate(-45deg); }

.swal2-icon.swal2-success.swal2-icon-show .swal2-success-line-tip {
      animation: swal2-animate-success-line-tip .75s; }

.swal2-icon.swal2-success.swal2-icon-show .swal2-success-line-long {
      animation: swal2-animate-success-line-long .75s; }

.swal2-icon.swal2-success.swal2-icon-show .swal2-success-circular-line-right {
      animation: swal2-rotate-success-circular-line 4.25s ease-in; }

.swal2-progress-steps {
  flex-wrap: wrap;
  align-items: center;
  max-width: 100%;
  margin: 0 0 1.25em;
  padding: 0;
  background: inherit;
  font-weight: 600; }

.swal2-progress-steps li {
    display: inline-block;
    position: relative; }

.swal2-progress-steps .swal2-progress-step {
    z-index: 20;
    flex-shrink: 0;
    width: 2em;
    height: 2em;
    border-radius: 2em;
    background: #2778c4;
    color: #fff;
    line-height: 2em;
    text-align: center; }

.swal2-progress-steps .swal2-progress-step.swal2-active-progress-step {
      background: #2778c4; }

.swal2-progress-steps .swal2-progress-step.swal2-active-progress-step ~ .swal2-progress-step {
        background: #add8e6;
        color: #fff; }

.swal2-progress-steps .swal2-progress-step.swal2-active-progress-step ~ .swal2-progress-step-line {
        background: #add8e6; }

.swal2-progress-steps .swal2-progress-step-line {
    z-index: 10;
    flex-shrink: 0;
    width: 2.5em;
    height: .4em;
    margin: 0 -1px;
    background: #2778c4; }

[class^='swal2'] {
  -webkit-tap-highlight-color: transparent; }

.swal2-show {
  animation: swal2-show 0.3s; }

.swal2-hide {
  animation: swal2-hide 0.15s forwards; }

.swal2-noanimation {
  transition: none; }

.swal2-scrollbar-measure {
  position: absolute;
  top: -9999px;
  width: 50px;
  height: 50px;
  overflow: scroll; }

.swal2-rtl .swal2-close {
  right: auto;
  left: 0; }

.swal2-rtl .swal2-timer-progress-bar {
  right: 0;
  left: auto; }

@supports (-ms-accelerator: true) {
  .swal2-range input {
    width: 100% !important; }
  .swal2-range output {
    display: none; } }

@media all and (-ms-high-contrast: none), (-ms-high-contrast: active) {
  .swal2-range input {
    width: 100% !important; }
  .swal2-range output {
    display: none; } }

@keyframes swal2-toast-show {
  0% {
    transform: translateY(-0.625em) rotateZ(2deg); }
  33% {
    transform: translateY(0) rotateZ(-2deg); }
  66% {
    transform: translateY(0.3125em) rotateZ(2deg); }
  100% {
    transform: translateY(0) rotateZ(0deg); } }

@keyframes swal2-toast-hide {
  100% {
    transform: rotateZ(1deg);
    opacity: 0; } }

@keyframes swal2-toast-animate-success-line-tip {
  0% {
    top: .5625em;
    left: .0625em;
    width: 0; }
  54% {
    top: .125em;
    left: .125em;
    width: 0; }
  70% {
    top: .625em;
    left: -.25em;
    width: 1.625em; }
  84% {
    top: 1.0625em;
    left: .75em;
    width: .5em; }
  100% {
    top: 1.125em;
    left: .1875em;
    width: .75em; } }

@keyframes swal2-toast-animate-success-line-long {
  0% {
    top: 1.625em;
    right: 1.375em;
    width: 0; }
  65% {
    top: 1.25em;
    right: .9375em;
    width: 0; }
  84% {
    top: .9375em;
    right: 0;
    width: 1.125em; }
  100% {
    top: .9375em;
    right: .1875em;
    width: 1.375em; } }

@keyframes swal2-show {
  0% {
    transform: scale(0.7); }
  45% {
    transform: scale(1.05); }
  80% {
    transform: scale(0.95); }
  100% {
    transform: scale(1); } }

@keyframes swal2-hide {
  0% {
    transform: scale(1);
    opacity: 1; }
  100% {
    transform: scale(0.5);
    opacity: 0; } }

@keyframes swal2-animate-success-line-tip {
  0% {
    top: 1.1875em;
    left: .0625em;
    width: 0; }
  54% {
    top: 1.0625em;
    left: .125em;
    width: 0; }
  70% {
    top: 2.1875em;
    left: -.375em;
    width: 3.125em; }
  84% {
    top: 3em;
    left: 1.3125em;
    width: 1.0625em; }
  100% {
    top: 2.8125em;
    left: .8125em;
    width: 1.5625em; } }

@keyframes swal2-animate-success-line-long {
  0% {
    top: 3.375em;
    right: 2.875em;
    width: 0; }
  65% {
    top: 3.375em;
    right: 2.875em;
    width: 0; }
  84% {
    top: 2.1875em;
    right: 0;
    width: 3.4375em; }
  100% {
    top: 2.375em;
    right: .5em;
    width: 2.9375em; } }

@keyframes swal2-rotate-success-circular-line {
  0% {
    transform: rotate(-45deg); }
  5% {
    transform: rotate(-45deg); }
  12% {
    transform: rotate(-405deg); }
  100% {
    transform: rotate(-405deg); } }

@keyframes swal2-animate-error-x-mark {
  0% {
    margin-top: 1.625em;
    transform: scale(0.4);
    opacity: 0; }
  50% {
    margin-top: 1.625em;
    transform: scale(0.4);
    opacity: 0; }
  80% {
    margin-top: -.375em;
    transform: scale(1.15); }
  100% {
    margin-top: 0;
    transform: scale(1);
    opacity: 1; } }

@keyframes swal2-animate-error-icon {
  0% {
    transform: rotateX(100deg);
    opacity: 0; }
  100% {
    transform: rotateX(0deg);
    opacity: 1; } }

@keyframes swal2-rotate-loading {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

body.swal2-shown:not(.swal2-no-backdrop):not(.swal2-toast-shown) {
  overflow: hidden; }

body.swal2-height-auto {
  height: auto !important; }

body.swal2-no-backdrop .swal2-container {
  top: auto;
  right: auto;
  bottom: auto;
  left: auto;
  max-width: calc(100% - 0.625em * 2);
  background-color: transparent !important; }

body.swal2-no-backdrop .swal2-container > .swal2-modal {
    box-shadow: 0 0 10px rgba(0, 0, 0, 0.4); }

body.swal2-no-backdrop .swal2-container.swal2-top {
    top: 0;
    left: 50%;
    transform: translateX(-50%); }

body.swal2-no-backdrop .swal2-container.swal2-top-start, body.swal2-no-backdrop .swal2-container.swal2-top-left {
    top: 0;
    left: 0; }

body.swal2-no-backdrop .swal2-container.swal2-top-end, body.swal2-no-backdrop .swal2-container.swal2-top-right {
    top: 0;
    right: 0; }

body.swal2-no-backdrop .swal2-container.swal2-center {
    top: 50%;
    left: 50%;
    transform: translate(-50%, -50%); }

body.swal2-no-backdrop .swal2-container.swal2-center-start, body.swal2-no-backdrop .swal2-container.swal2-center-left {
    top: 50%;
    left: 0;
    transform: translateY(-50%); }

body.swal2-no-backdrop .swal2-container.swal2-center-end, body.swal2-no-backdrop .swal2-container.swal2-center-right {
    top: 50%;
    right: 0;
    transform: translateY(-50%); }

body.swal2-no-backdrop .swal2-container.swal2-bottom {
    bottom: 0;
    left: 50%;
    transform: translateX(-50%); }

body.swal2-no-backdrop .swal2-container.swal2-bottom-start, body.swal2-no-backdrop .swal2-container.swal2-bottom-left {
    bottom: 0;
    left: 0; }

body.swal2-no-backdrop .swal2-container.swal2-bottom-end, body.swal2-no-backdrop .swal2-container.swal2-bottom-right {
    right: 0;
    bottom: 0; }

@media print {
  body.swal2-shown:not(.swal2-no-backdrop):not(.swal2-toast-shown) {
    overflow-y: scroll !important; }
    body.swal2-shown:not(.swal2-no-backdrop):not(.swal2-toast-shown) > [aria-hidden='true'] {
      display: none; }
    body.swal2-shown:not(.swal2-no-backdrop):not(.swal2-toast-shown) .swal2-container {
      position: static !important; } }

body.swal2-toast-shown .swal2-container {
  background-color: transparent; }

body.swal2-toast-shown .swal2-container.swal2-top {
    top: 0;
    right: auto;
    bottom: auto;
    left: 50%;
    transform: translateX(-50%); }

body.swal2-toast-shown .swal2-container.swal2-top-end, body.swal2-toast-shown .swal2-container.swal2-top-right {
    top: 0;
    right: 0;
    bottom: auto;
    left: auto; }

body.swal2-toast-shown .swal2-container.swal2-top-start, body.swal2-toast-shown .swal2-container.swal2-top-left {
    top: 0;
    right: auto;
    bottom: auto;
    left: 0; }

body.swal2-toast-shown .swal2-container.swal2-center-start, body.swal2-toast-shown .swal2-container.swal2-center-left {
    top: 50%;
    right: auto;
    bottom: auto;
    left: 0;
    transform: translateY(-50%); }

body.swal2-toast-shown .swal2-container.swal2-center {
    top: 50%;
    right: auto;
    bottom: auto;
    left: 50%;
    transform: translate(-50%, -50%); }

body.swal2-toast-shown .swal2-container.swal2-center-end, body.swal2-toast-shown .swal2-container.swal2-center-right {
    top: 50%;
    right: 0;
    bottom: auto;
    left: auto;
    transform: translateY(-50%); }

body.swal2-toast-shown .swal2-container.swal2-bottom-start, body.swal2-toast-shown .swal2-container.swal2-bottom-left {
    top: auto;
    right: auto;
    bottom: 0;
    left: 0; }

body.swal2-toast-shown .swal2-container.swal2-bottom {
    top: auto;
    right: auto;
    bottom: 0;
    left: 50%;
    transform: translateX(-50%); }

body.swal2-toast-shown .swal2-container.swal2-bottom-end, body.swal2-toast-shown .swal2-container.swal2-bottom-right {
    top: auto;
    right: 0;
    bottom: 0;
    left: auto; }

body.swal2-toast-column .swal2-toast {
  flex-direction: column;
  align-items: stretch; }

body.swal2-toast-column .swal2-toast .swal2-actions {
    flex: 1;
    align-self: stretch;
    height: 2.2em;
    margin-top: .3125em; }

body.swal2-toast-column .swal2-toast .swal2-loading {
    justify-content: center; }

body.swal2-toast-column .swal2-toast .swal2-input {
    height: 2em;
    margin: .3125em auto;
    font-size: 1em; }

body.swal2-toast-column .swal2-toast .swal2-validation-message {
    font-size: 1em; }

/*!
 * animate.css - https://animate.style/
 * Version - 4.1.1
 * Licensed under the MIT license - http://opensource.org/licenses/MIT
 *
 * Copyright (c) 2020 Animate.css
 */

:root {
  --animate-duration: 1s;
  --animate-delay: 1s;
  --animate-repeat: 1; }

.animate__animated {
  animation-duration: 1s;
  animation-duration: var(--animate-duration);
  animation-fill-mode: both; }

.animate__animated.animate__infinite {
  animation-iteration-count: infinite; }

.animate__animated.animate__repeat-1 {
  animation-iteration-count: 1;
  animation-iteration-count: var(--animate-repeat); }

.animate__animated.animate__repeat-2 {
  animation-iteration-count: calc(1 * 2);
  animation-iteration-count: calc(var(--animate-repeat) * 2); }

.animate__animated.animate__repeat-3 {
  animation-iteration-count: calc(1 * 3);
  animation-iteration-count: calc(var(--animate-repeat) * 3); }

.animate__animated.animate__delay-1s {
  animation-delay: 1s;
  animation-delay: var(--animate-delay); }

.animate__animated.animate__delay-2s {
  animation-delay: calc(1s * 2);
  animation-delay: calc(var(--animate-delay) * 2); }

.animate__animated.animate__delay-3s {
  animation-delay: calc(1s * 3);
  animation-delay: calc(var(--animate-delay) * 3); }

.animate__animated.animate__delay-4s {
  animation-delay: calc(1s * 4);
  animation-delay: calc(var(--animate-delay) * 4); }

.animate__animated.animate__delay-5s {
  animation-delay: calc(1s * 5);
  animation-delay: calc(var(--animate-delay) * 5); }

.animate__animated.animate__faster {
  animation-duration: calc(1s / 2);
  animation-duration: calc(var(--animate-duration) / 2); }

.animate__animated.animate__fast {
  animation-duration: calc(1s * 0.8);
  animation-duration: calc(var(--animate-duration) * 0.8); }

.animate__animated.animate__slow {
  animation-duration: calc(1s * 2);
  animation-duration: calc(var(--animate-duration) * 2); }

.animate__animated.animate__slower {
  animation-duration: calc(1s * 3);
  animation-duration: calc(var(--animate-duration) * 3); }

@media print, (prefers-reduced-motion: reduce) {
  .animate__animated {
    animation-duration: 1ms !important;
    transition-duration: 1ms !important;
    animation-iteration-count: 1 !important; }
  .animate__animated[class*='Out'] {
    opacity: 0; } }

/* Attention seekers  */

@keyframes bounce {
  from,
  20%,
  53%,
  to {
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    transform: translate3d(0, 0, 0); }
  40%,
  43% {
    animation-timing-function: cubic-bezier(0.755, 0.05, 0.855, 0.06);
    transform: translate3d(0, -30px, 0) scaleY(1.1); }
  70% {
    animation-timing-function: cubic-bezier(0.755, 0.05, 0.855, 0.06);
    transform: translate3d(0, -15px, 0) scaleY(1.05); }
  80% {
    transition-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    transform: translate3d(0, 0, 0) scaleY(0.95); }
  90% {
    transform: translate3d(0, -4px, 0) scaleY(1.02); } }

.animate__bounce {
  animation-name: bounce;
  transform-origin: center bottom; }

@keyframes flash {
  from,
  50%,
  to {
    opacity: 1; }
  25%,
  75% {
    opacity: 0; } }

.animate__flash {
  animation-name: flash; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes pulse {
  from {
    transform: scale3d(1, 1, 1); }
  50% {
    transform: scale3d(1.05, 1.05, 1.05); }
  to {
    transform: scale3d(1, 1, 1); } }

.animate__pulse {
  animation-name: pulse;
  animation-timing-function: ease-in-out; }

@keyframes rubberBand {
  from {
    transform: scale3d(1, 1, 1); }
  30% {
    transform: scale3d(1.05, 0.75, 1); }
  40% {
    transform: scale3d(0.75, 1.25, 1); }
  50% {
    transform: scale3d(1.08, 0.75, 1); }
  65% {
    transform: scale3d(0.95, 1.05, 1); }
  75% {
    transform: scale3d(1.02, 0.95, 1); }
  to {
    transform: scale3d(1, 1, 1); } }

.animate__rubberBand {
  animation-name: rubberBand; }

@keyframes shakeX {
  from,
  to {
    transform: translate3d(0, 0, 0); }
  10%,
  30%,
  50%,
  70%,
  90% {
    transform: translate3d(-10px, 0, 0); }
  20%,
  40%,
  60%,
  80% {
    transform: translate3d(10px, 0, 0); } }

.animate__shakeX {
  animation-name: shakeX; }

@keyframes shakeY {
  from,
  to {
    transform: translate3d(0, 0, 0); }
  10%,
  30%,
  50%,
  70%,
  90% {
    transform: translate3d(0, -10px, 0); }
  20%,
  40%,
  60%,
  80% {
    transform: translate3d(0, 10px, 0); } }

.animate__shakeY {
  animation-name: shakeY; }

@keyframes headShake {
  0% {
    transform: translateX(0); }
  6.5% {
    transform: translateX(-6px) rotateY(-9deg); }
  18.5% {
    transform: translateX(5px) rotateY(7deg); }
  31.5% {
    transform: translateX(-3px) rotateY(-5deg); }
  43.5% {
    transform: translateX(2px) rotateY(3deg); }
  50% {
    transform: translateX(0); } }

.animate__headShake {
  animation-timing-function: ease-in-out;
  animation-name: headShake; }

@keyframes swing {
  20% {
    transform: rotate3d(0, 0, 1, 15deg); }
  40% {
    transform: rotate3d(0, 0, 1, -10deg); }
  60% {
    transform: rotate3d(0, 0, 1, 5deg); }
  80% {
    transform: rotate3d(0, 0, 1, -5deg); }
  to {
    transform: rotate3d(0, 0, 1, 0deg); } }

.animate__swing {
  transform-origin: top center;
  animation-name: swing; }

@keyframes tada {
  from {
    transform: scale3d(1, 1, 1); }
  10%,
  20% {
    transform: scale3d(0.9, 0.9, 0.9) rotate3d(0, 0, 1, -3deg); }
  30%,
  50%,
  70%,
  90% {
    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg); }
  40%,
  60%,
  80% {
    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg); }
  to {
    transform: scale3d(1, 1, 1); } }

.animate__tada {
  animation-name: tada; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes wobble {
  from {
    transform: translate3d(0, 0, 0); }
  15% {
    transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg); }
  30% {
    transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg); }
  45% {
    transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg); }
  60% {
    transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg); }
  75% {
    transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__wobble {
  animation-name: wobble; }

@keyframes jello {
  from,
  11.1%,
  to {
    transform: translate3d(0, 0, 0); }
  22.2% {
    transform: skewX(-12.5deg) skewY(-12.5deg); }
  33.3% {
    transform: skewX(6.25deg) skewY(6.25deg); }
  44.4% {
    transform: skewX(-3.125deg) skewY(-3.125deg); }
  55.5% {
    transform: skewX(1.5625deg) skewY(1.5625deg); }
  66.6% {
    transform: skewX(-0.78125deg) skewY(-0.78125deg); }
  77.7% {
    transform: skewX(0.39062deg) skewY(0.39062deg); }
  88.8% {
    transform: skewX(-0.19531deg) skewY(-0.19531deg); } }

.animate__jello {
  animation-name: jello;
  transform-origin: center; }

@keyframes heartBeat {
  0% {
    transform: scale(1); }
  14% {
    transform: scale(1.3); }
  28% {
    transform: scale(1); }
  42% {
    transform: scale(1.3); }
  70% {
    transform: scale(1); } }

.animate__heartBeat {
  animation-name: heartBeat;
  animation-duration: calc(1s * 1.3);
  animation-duration: calc(var(--animate-duration) * 1.3);
  animation-timing-function: ease-in-out; }

/* Back entrances */

@keyframes backInDown {
  0% {
    transform: translateY(-1200px) scale(0.7);
    opacity: 0.7; }
  80% {
    transform: translateY(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: scale(1);
    opacity: 1; } }

.animate__backInDown {
  animation-name: backInDown; }

@keyframes backInLeft {
  0% {
    transform: translateX(-2000px) scale(0.7);
    opacity: 0.7; }
  80% {
    transform: translateX(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: scale(1);
    opacity: 1; } }

.animate__backInLeft {
  animation-name: backInLeft; }

@keyframes backInRight {
  0% {
    transform: translateX(2000px) scale(0.7);
    opacity: 0.7; }
  80% {
    transform: translateX(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: scale(1);
    opacity: 1; } }

.animate__backInRight {
  animation-name: backInRight; }

@keyframes backInUp {
  0% {
    transform: translateY(1200px) scale(0.7);
    opacity: 0.7; }
  80% {
    transform: translateY(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: scale(1);
    opacity: 1; } }

.animate__backInUp {
  animation-name: backInUp; }

/* Back exits */

@keyframes backOutDown {
  0% {
    transform: scale(1);
    opacity: 1; }
  20% {
    transform: translateY(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: translateY(700px) scale(0.7);
    opacity: 0.7; } }

.animate__backOutDown {
  animation-name: backOutDown; }

@keyframes backOutLeft {
  0% {
    transform: scale(1);
    opacity: 1; }
  20% {
    transform: translateX(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: translateX(-2000px) scale(0.7);
    opacity: 0.7; } }

.animate__backOutLeft {
  animation-name: backOutLeft; }

@keyframes backOutRight {
  0% {
    transform: scale(1);
    opacity: 1; }
  20% {
    transform: translateX(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: translateX(2000px) scale(0.7);
    opacity: 0.7; } }

.animate__backOutRight {
  animation-name: backOutRight; }

@keyframes backOutUp {
  0% {
    transform: scale(1);
    opacity: 1; }
  20% {
    transform: translateY(0px) scale(0.7);
    opacity: 0.7; }
  100% {
    transform: translateY(-700px) scale(0.7);
    opacity: 0.7; } }

.animate__backOutUp {
  animation-name: backOutUp; }

/* Bouncing entrances  */

@keyframes bounceIn {
  from,
  20%,
  40%,
  60%,
  80%,
  to {
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1); }
  0% {
    opacity: 0;
    transform: scale3d(0.3, 0.3, 0.3); }
  20% {
    transform: scale3d(1.1, 1.1, 1.1); }
  40% {
    transform: scale3d(0.9, 0.9, 0.9); }
  60% {
    opacity: 1;
    transform: scale3d(1.03, 1.03, 1.03); }
  80% {
    transform: scale3d(0.97, 0.97, 0.97); }
  to {
    opacity: 1;
    transform: scale3d(1, 1, 1); } }

.animate__bounceIn {
  animation-duration: calc(1s * 0.75);
  animation-duration: calc(var(--animate-duration) * 0.75);
  animation-name: bounceIn; }

@keyframes bounceInDown {
  from,
  60%,
  75%,
  90%,
  to {
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1); }
  0% {
    opacity: 0;
    transform: translate3d(0, -3000px, 0) scaleY(3); }
  60% {
    opacity: 1;
    transform: translate3d(0, 25px, 0) scaleY(0.9); }
  75% {
    transform: translate3d(0, -10px, 0) scaleY(0.95); }
  90% {
    transform: translate3d(0, 5px, 0) scaleY(0.985); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__bounceInDown {
  animation-name: bounceInDown; }

@keyframes bounceInLeft {
  from,
  60%,
  75%,
  90%,
  to {
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1); }
  0% {
    opacity: 0;
    transform: translate3d(-3000px, 0, 0) scaleX(3); }
  60% {
    opacity: 1;
    transform: translate3d(25px, 0, 0) scaleX(1); }
  75% {
    transform: translate3d(-10px, 0, 0) scaleX(0.98); }
  90% {
    transform: translate3d(5px, 0, 0) scaleX(0.995); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__bounceInLeft {
  animation-name: bounceInLeft; }

@keyframes bounceInRight {
  from,
  60%,
  75%,
  90%,
  to {
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1); }
  from {
    opacity: 0;
    transform: translate3d(3000px, 0, 0) scaleX(3); }
  60% {
    opacity: 1;
    transform: translate3d(-25px, 0, 0) scaleX(1); }
  75% {
    transform: translate3d(10px, 0, 0) scaleX(0.98); }
  90% {
    transform: translate3d(-5px, 0, 0) scaleX(0.995); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__bounceInRight {
  animation-name: bounceInRight; }

@keyframes bounceInUp {
  from,
  60%,
  75%,
  90%,
  to {
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1); }
  from {
    opacity: 0;
    transform: translate3d(0, 3000px, 0) scaleY(5); }
  60% {
    opacity: 1;
    transform: translate3d(0, -20px, 0) scaleY(0.9); }
  75% {
    transform: translate3d(0, 10px, 0) scaleY(0.95); }
  90% {
    transform: translate3d(0, -5px, 0) scaleY(0.985); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__bounceInUp {
  animation-name: bounceInUp; }

/* Bouncing exits  */

@keyframes bounceOut {
  20% {
    transform: scale3d(0.9, 0.9, 0.9); }
  50%,
  55% {
    opacity: 1;
    transform: scale3d(1.1, 1.1, 1.1); }
  to {
    opacity: 0;
    transform: scale3d(0.3, 0.3, 0.3); } }

.animate__bounceOut {
  animation-duration: calc(1s * 0.75);
  animation-duration: calc(var(--animate-duration) * 0.75);
  animation-name: bounceOut; }

@keyframes bounceOutDown {
  20% {
    transform: translate3d(0, 10px, 0) scaleY(0.985); }
  40%,
  45% {
    opacity: 1;
    transform: translate3d(0, -20px, 0) scaleY(0.9); }
  to {
    opacity: 0;
    transform: translate3d(0, 2000px, 0) scaleY(3); } }

.animate__bounceOutDown {
  animation-name: bounceOutDown; }

@keyframes bounceOutLeft {
  20% {
    opacity: 1;
    transform: translate3d(20px, 0, 0) scaleX(0.9); }
  to {
    opacity: 0;
    transform: translate3d(-2000px, 0, 0) scaleX(2); } }

.animate__bounceOutLeft {
  animation-name: bounceOutLeft; }

@keyframes bounceOutRight {
  20% {
    opacity: 1;
    transform: translate3d(-20px, 0, 0) scaleX(0.9); }
  to {
    opacity: 0;
    transform: translate3d(2000px, 0, 0) scaleX(2); } }

.animate__bounceOutRight {
  animation-name: bounceOutRight; }

@keyframes bounceOutUp {
  20% {
    transform: translate3d(0, -10px, 0) scaleY(0.985); }
  40%,
  45% {
    opacity: 1;
    transform: translate3d(0, 20px, 0) scaleY(0.9); }
  to {
    opacity: 0;
    transform: translate3d(0, -2000px, 0) scaleY(3); } }

.animate__bounceOutUp {
  animation-name: bounceOutUp; }

/* Fading entrances  */

@keyframes fadeIn {
  from {
    opacity: 0; }
  to {
    opacity: 1; } }

.animate__fadeIn {
  animation-name: fadeIn; }

@keyframes fadeInDown {
  from {
    opacity: 0;
    transform: translate3d(0, -100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInDown {
  animation-name: fadeInDown; }

@keyframes fadeInDownBig {
  from {
    opacity: 0;
    transform: translate3d(0, -2000px, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInDownBig {
  animation-name: fadeInDownBig; }

@keyframes fadeInLeft {
  from {
    opacity: 0;
    transform: translate3d(-100%, 0, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInLeft {
  animation-name: fadeInLeft; }

@keyframes fadeInLeftBig {
  from {
    opacity: 0;
    transform: translate3d(-2000px, 0, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInLeftBig {
  animation-name: fadeInLeftBig; }

@keyframes fadeInRight {
  from {
    opacity: 0;
    transform: translate3d(100%, 0, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInRight {
  animation-name: fadeInRight; }

@keyframes fadeInRightBig {
  from {
    opacity: 0;
    transform: translate3d(2000px, 0, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInRightBig {
  animation-name: fadeInRightBig; }

@keyframes fadeInUp {
  from {
    opacity: 0;
    transform: translate3d(0, 100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInUp {
  animation-name: fadeInUp; }

@keyframes fadeInUpBig {
  from {
    opacity: 0;
    transform: translate3d(0, 2000px, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInUpBig {
  animation-name: fadeInUpBig; }

@keyframes fadeInTopLeft {
  from {
    opacity: 0;
    transform: translate3d(-100%, -100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInTopLeft {
  animation-name: fadeInTopLeft; }

@keyframes fadeInTopRight {
  from {
    opacity: 0;
    transform: translate3d(100%, -100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInTopRight {
  animation-name: fadeInTopRight; }

@keyframes fadeInBottomLeft {
  from {
    opacity: 0;
    transform: translate3d(-100%, 100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInBottomLeft {
  animation-name: fadeInBottomLeft; }

@keyframes fadeInBottomRight {
  from {
    opacity: 0;
    transform: translate3d(100%, 100%, 0); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__fadeInBottomRight {
  animation-name: fadeInBottomRight; }

/* Fading exits */

@keyframes fadeOut {
  from {
    opacity: 1; }
  to {
    opacity: 0; } }

.animate__fadeOut {
  animation-name: fadeOut; }

@keyframes fadeOutDown {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(0, 100%, 0); } }

.animate__fadeOutDown {
  animation-name: fadeOutDown; }

@keyframes fadeOutDownBig {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(0, 2000px, 0); } }

.animate__fadeOutDownBig {
  animation-name: fadeOutDownBig; }

@keyframes fadeOutLeft {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(-100%, 0, 0); } }

.animate__fadeOutLeft {
  animation-name: fadeOutLeft; }

@keyframes fadeOutLeftBig {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(-2000px, 0, 0); } }

.animate__fadeOutLeftBig {
  animation-name: fadeOutLeftBig; }

@keyframes fadeOutRight {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(100%, 0, 0); } }

.animate__fadeOutRight {
  animation-name: fadeOutRight; }

@keyframes fadeOutRightBig {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(2000px, 0, 0); } }

.animate__fadeOutRightBig {
  animation-name: fadeOutRightBig; }

@keyframes fadeOutUp {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(0, -100%, 0); } }

.animate__fadeOutUp {
  animation-name: fadeOutUp; }

@keyframes fadeOutUpBig {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(0, -2000px, 0); } }

.animate__fadeOutUpBig {
  animation-name: fadeOutUpBig; }

@keyframes fadeOutTopLeft {
  from {
    opacity: 1;
    transform: translate3d(0, 0, 0); }
  to {
    opacity: 0;
    transform: translate3d(-100%, -100%, 0); } }

.animate__fadeOutTopLeft {
  animation-name: fadeOutTopLeft; }

@keyframes fadeOutTopRight {
  from {
    opacity: 1;
    transform: translate3d(0, 0, 0); }
  to {
    opacity: 0;
    transform: translate3d(100%, -100%, 0); } }

.animate__fadeOutTopRight {
  animation-name: fadeOutTopRight; }

@keyframes fadeOutBottomRight {
  from {
    opacity: 1;
    transform: translate3d(0, 0, 0); }
  to {
    opacity: 0;
    transform: translate3d(100%, 100%, 0); } }

.animate__fadeOutBottomRight {
  animation-name: fadeOutBottomRight; }

@keyframes fadeOutBottomLeft {
  from {
    opacity: 1;
    transform: translate3d(0, 0, 0); }
  to {
    opacity: 0;
    transform: translate3d(-100%, 100%, 0); } }

.animate__fadeOutBottomLeft {
  animation-name: fadeOutBottomLeft; }

/* Flippers */

@keyframes flip {
  from {
    transform: perspective(400px) scale3d(1, 1, 1) translate3d(0, 0, 0) rotate3d(0, 1, 0, -360deg);
    animation-timing-function: ease-out; }
  40% {
    transform: perspective(400px) scale3d(1, 1, 1) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
    animation-timing-function: ease-out; }
  50% {
    transform: perspective(400px) scale3d(1, 1, 1) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
    animation-timing-function: ease-in; }
  80% {
    transform: perspective(400px) scale3d(0.95, 0.95, 0.95) translate3d(0, 0, 0) rotate3d(0, 1, 0, 0deg);
    animation-timing-function: ease-in; }
  to {
    transform: perspective(400px) scale3d(1, 1, 1) translate3d(0, 0, 0) rotate3d(0, 1, 0, 0deg);
    animation-timing-function: ease-in; } }

.animate__animated.animate__flip {
  backface-visibility: visible;
  animation-name: flip; }

@keyframes flipInX {
  from {
    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    animation-timing-function: ease-in;
    opacity: 0; }
  40% {
    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    animation-timing-function: ease-in; }
  60% {
    transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
    opacity: 1; }
  80% {
    transform: perspective(400px) rotate3d(1, 0, 0, -5deg); }
  to {
    transform: perspective(400px); } }

.animate__flipInX {
  backface-visibility: visible !important;
  animation-name: flipInX; }

@keyframes flipInY {
  from {
    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    animation-timing-function: ease-in;
    opacity: 0; }
  40% {
    transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
    animation-timing-function: ease-in; }
  60% {
    transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
    opacity: 1; }
  80% {
    transform: perspective(400px) rotate3d(0, 1, 0, -5deg); }
  to {
    transform: perspective(400px); } }

.animate__flipInY {
  backface-visibility: visible !important;
  animation-name: flipInY; }

@keyframes flipOutX {
  from {
    transform: perspective(400px); }
  30% {
    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    opacity: 1; }
  to {
    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    opacity: 0; } }

.animate__flipOutX {
  animation-duration: calc(1s * 0.75);
  animation-duration: calc(var(--animate-duration) * 0.75);
  animation-name: flipOutX;
  backface-visibility: visible !important; }

@keyframes flipOutY {
  from {
    transform: perspective(400px); }
  30% {
    transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
    opacity: 1; }
  to {
    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    opacity: 0; } }

.animate__flipOutY {
  animation-duration: calc(1s * 0.75);
  animation-duration: calc(var(--animate-duration) * 0.75);
  backface-visibility: visible !important;
  animation-name: flipOutY; }

/* Lightspeed */

@keyframes lightSpeedInRight {
  from {
    transform: translate3d(100%, 0, 0) skewX(-30deg);
    opacity: 0; }
  60% {
    transform: skewX(20deg);
    opacity: 1; }
  80% {
    transform: skewX(-5deg); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__lightSpeedInRight {
  animation-name: lightSpeedInRight;
  animation-timing-function: ease-out; }

@keyframes lightSpeedInLeft {
  from {
    transform: translate3d(-100%, 0, 0) skewX(30deg);
    opacity: 0; }
  60% {
    transform: skewX(-20deg);
    opacity: 1; }
  80% {
    transform: skewX(5deg); }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__lightSpeedInLeft {
  animation-name: lightSpeedInLeft;
  animation-timing-function: ease-out; }

@keyframes lightSpeedOutRight {
  from {
    opacity: 1; }
  to {
    transform: translate3d(100%, 0, 0) skewX(30deg);
    opacity: 0; } }

.animate__lightSpeedOutRight {
  animation-name: lightSpeedOutRight;
  animation-timing-function: ease-in; }

@keyframes lightSpeedOutLeft {
  from {
    opacity: 1; }
  to {
    transform: translate3d(-100%, 0, 0) skewX(-30deg);
    opacity: 0; } }

.animate__lightSpeedOutLeft {
  animation-name: lightSpeedOutLeft;
  animation-timing-function: ease-in; }

/* Rotating entrances */

@keyframes rotateIn {
  from {
    transform: rotate3d(0, 0, 1, -200deg);
    opacity: 0; }
  to {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

.animate__rotateIn {
  animation-name: rotateIn;
  transform-origin: center; }

@keyframes rotateInDownLeft {
  from {
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0; }
  to {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

.animate__rotateInDownLeft {
  animation-name: rotateInDownLeft;
  transform-origin: left bottom; }

@keyframes rotateInDownRight {
  from {
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0; }
  to {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

.animate__rotateInDownRight {
  animation-name: rotateInDownRight;
  transform-origin: right bottom; }

@keyframes rotateInUpLeft {
  from {
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0; }
  to {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

.animate__rotateInUpLeft {
  animation-name: rotateInUpLeft;
  transform-origin: left bottom; }

@keyframes rotateInUpRight {
  from {
    transform: rotate3d(0, 0, 1, -90deg);
    opacity: 0; }
  to {
    transform: translate3d(0, 0, 0);
    opacity: 1; } }

.animate__rotateInUpRight {
  animation-name: rotateInUpRight;
  transform-origin: right bottom; }

/* Rotating exits */

@keyframes rotateOut {
  from {
    opacity: 1; }
  to {
    transform: rotate3d(0, 0, 1, 200deg);
    opacity: 0; } }

.animate__rotateOut {
  animation-name: rotateOut;
  transform-origin: center; }

@keyframes rotateOutDownLeft {
  from {
    opacity: 1; }
  to {
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0; } }

.animate__rotateOutDownLeft {
  animation-name: rotateOutDownLeft;
  transform-origin: left bottom; }

@keyframes rotateOutDownRight {
  from {
    opacity: 1; }
  to {
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0; } }

.animate__rotateOutDownRight {
  animation-name: rotateOutDownRight;
  transform-origin: right bottom; }

@keyframes rotateOutUpLeft {
  from {
    opacity: 1; }
  to {
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0; } }

.animate__rotateOutUpLeft {
  animation-name: rotateOutUpLeft;
  transform-origin: left bottom; }

@keyframes rotateOutUpRight {
  from {
    opacity: 1; }
  to {
    transform: rotate3d(0, 0, 1, 90deg);
    opacity: 0; } }

.animate__rotateOutUpRight {
  animation-name: rotateOutUpRight;
  transform-origin: right bottom; }

/* Specials */

@keyframes hinge {
  0% {
    animation-timing-function: ease-in-out; }
  20%,
  60% {
    transform: rotate3d(0, 0, 1, 80deg);
    animation-timing-function: ease-in-out; }
  40%,
  80% {
    transform: rotate3d(0, 0, 1, 60deg);
    animation-timing-function: ease-in-out;
    opacity: 1; }
  to {
    transform: translate3d(0, 700px, 0);
    opacity: 0; } }

.animate__hinge {
  animation-duration: calc(1s * 2);
  animation-duration: calc(var(--animate-duration) * 2);
  animation-name: hinge;
  transform-origin: top left; }

@keyframes jackInTheBox {
  from {
    opacity: 0;
    transform: scale(0.1) rotate(30deg);
    transform-origin: center bottom; }
  50% {
    transform: rotate(-10deg); }
  70% {
    transform: rotate(3deg); }
  to {
    opacity: 1;
    transform: scale(1); } }

.animate__jackInTheBox {
  animation-name: jackInTheBox; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes rollIn {
  from {
    opacity: 0;
    transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); }
  to {
    opacity: 1;
    transform: translate3d(0, 0, 0); } }

.animate__rollIn {
  animation-name: rollIn; }

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@keyframes rollOut {
  from {
    opacity: 1; }
  to {
    opacity: 0;
    transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg); } }

.animate__rollOut {
  animation-name: rollOut; }

/* Zooming entrances */

@keyframes zoomIn {
  from {
    opacity: 0;
    transform: scale3d(0.3, 0.3, 0.3); }
  50% {
    opacity: 1; } }

.animate__zoomIn {
  animation-name: zoomIn; }

@keyframes zoomInDown {
  from {
    opacity: 0;
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -1000px, 0);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19); }
  60% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1); } }

.animate__zoomInDown {
  animation-name: zoomInDown; }

@keyframes zoomInLeft {
  from {
    opacity: 0;
    transform: scale3d(0.1, 0.1, 0.1) translate3d(-1000px, 0, 0);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19); }
  60% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(10px, 0, 0);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1); } }

.animate__zoomInLeft {
  animation-name: zoomInLeft; }

@keyframes zoomInRight {
  from {
    opacity: 0;
    transform: scale3d(0.1, 0.1, 0.1) translate3d(1000px, 0, 0);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19); }
  60% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(-10px, 0, 0);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1); } }

.animate__zoomInRight {
  animation-name: zoomInRight; }

@keyframes zoomInUp {
  from {
    opacity: 0;
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 1000px, 0);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19); }
  60% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1); } }

.animate__zoomInUp {
  animation-name: zoomInUp; }

/* Zooming exits */

@keyframes zoomOut {
  from {
    opacity: 1; }
  50% {
    opacity: 0;
    transform: scale3d(0.3, 0.3, 0.3); }
  to {
    opacity: 0; } }

.animate__zoomOut {
  animation-name: zoomOut; }

@keyframes zoomOutDown {
  40% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19); }
  to {
    opacity: 0;
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 2000px, 0);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1); } }

.animate__zoomOutDown {
  animation-name: zoomOutDown;
  transform-origin: center bottom; }

@keyframes zoomOutLeft {
  40% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(42px, 0, 0); }
  to {
    opacity: 0;
    transform: scale(0.1) translate3d(-2000px, 0, 0); } }

.animate__zoomOutLeft {
  animation-name: zoomOutLeft;
  transform-origin: left center; }

@keyframes zoomOutRight {
  40% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(-42px, 0, 0); }
  to {
    opacity: 0;
    transform: scale(0.1) translate3d(2000px, 0, 0); } }

.animate__zoomOutRight {
  animation-name: zoomOutRight;
  transform-origin: right center; }

@keyframes zoomOutUp {
  40% {
    opacity: 1;
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19); }
  to {
    opacity: 0;
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -2000px, 0);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1); } }

.animate__zoomOutUp {
  animation-name: zoomOutUp;
  transform-origin: center bottom; }

/* Sliding entrances */

@keyframes slideInDown {
  from {
    transform: translate3d(0, -100%, 0);
    visibility: visible; }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__slideInDown {
  animation-name: slideInDown; }

@keyframes slideInLeft {
  from {
    transform: translate3d(-100%, 0, 0);
    visibility: visible; }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__slideInLeft {
  animation-name: slideInLeft; }

@keyframes slideInRight {
  from {
    transform: translate3d(100%, 0, 0);
    visibility: visible; }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__slideInRight {
  animation-name: slideInRight; }

@keyframes slideInUp {
  from {
    transform: translate3d(0, 100%, 0);
    visibility: visible; }
  to {
    transform: translate3d(0, 0, 0); } }

.animate__slideInUp {
  animation-name: slideInUp; }

/* Sliding exits */

@keyframes slideOutDown {
  from {
    transform: translate3d(0, 0, 0); }
  to {
    visibility: hidden;
    transform: translate3d(0, 100%, 0); } }

.animate__slideOutDown {
  animation-name: slideOutDown; }

@keyframes slideOutLeft {
  from {
    transform: translate3d(0, 0, 0); }
  to {
    visibility: hidden;
    transform: translate3d(-100%, 0, 0); } }

.animate__slideOutLeft {
  animation-name: slideOutLeft; }

@keyframes slideOutRight {
  from {
    transform: translate3d(0, 0, 0); }
  to {
    visibility: hidden;
    transform: translate3d(100%, 0, 0); } }

.animate__slideOutRight {
  animation-name: slideOutRight; }

@keyframes slideOutUp {
  from {
    transform: translate3d(0, 0, 0); }
  to {
    visibility: hidden;
    transform: translate3d(0, -100%, 0); } }

.animate__slideOutUp {
  animation-name: slideOutUp; }

.scroller {
  overflow-y: auto;
  scrollbar-color: #47B4AC;
  scrollbar-width: thin; }

.scroller::-webkit-scrollbar-thumb {
    background-color: #47B4AC; }

.scroller::-webkit-scrollbar-track {
    background-color: transparent; }

.scroller::-moz-scrollbar-thumb {
    background-color: #47B4AC; }

.scroller::-moz-scrollbar-track {
    background-color: transparent; }

::-webkit-scrollbar {
  width: 8px;
  height: 8px;
  border-radius: 20px; }

::-moz-scrollbar {
  width: 8px;
  height: 8px;
  border-radius: 20px; }

::-webkit-scrollbar-track {
  background: transparent;
  border-radius: 20px; }

::-webkit-scrollbar-thumb {
  background: transparent;
  border-radius: 20px; }

::-webkit-scrollbar-thumb:hover {
    background: transparent;
    border-radius: 20px; }

::-moz-scrollbar-thumb {
  background: transparent;
  border-radius: 20px; }

::-moz-scrollbar-thumb:hover {
    background: transparent;
    border-radius: 20px; }

::-webkit-scrollbar {
  width: 4px;
  height: 8px;
  border-radius: 10px 10px 0 10px; }

::-moz-scrollbar {
  width: 4px;
  height: 8px;
  border-radius: 10px 10px 0 10px; }

.scrollbar-thumb {
  width: 4px !important; }

.scrollbar-track-y {
  width: 4px !important; }

body {
  font-family: "Open Sans", sans-serif;
  font-weight: 400;
  font-style: normal;
  font-size: 14px;
  padding: 0;
  margin: 0;
  color: #737B8E;
  background: #ffffff; }

a:hover {
  text-decoration: none; }

.iq-mb-3 {
  margin-bottom: 30px !important; }

h1 {
  font-family: "Open Sans", sans-serif;
  font-weight: 600;
  margin: 0px;
  line-height: 1;
  color: #35405A;
  font-size: 3.052rem; }

h1 a {
    color: inherit; }

h2 {
  font-family: "Open Sans", sans-serif;
  font-weight: 600;
  margin: 0px;
  line-height: 1.5;
  color: #35405A;
  font-size: 2.441rem; }

h2 a {
    color: inherit; }

h3 {
  font-family: "Open Sans", sans-serif;
  font-weight: 600;
  margin: 0px;
  line-height: 1.5;
  color: #35405A;
  font-size: 1.953rem; }

h3 a {
    color: inherit; }

h4 {
  font-family: "Open Sans", sans-serif;
  font-weight: 600;
  margin: 0px;
  line-height: 1;
  color: #35405A;
  font-size: 1.563rem; }

h4 a {
    color: inherit; }

h5 {
  font-family: "Open Sans", sans-serif;
  font-weight: 600;
  margin: 0px;
  line-height: 1.5;
  color: #35405A;
  font-size: 1.25rem; }

h5 a {
    color: inherit; }

h6 {
  font-family: "Open Sans", sans-serif;
  font-weight: 600;
  margin: 0px;
  line-height: 1.5;
  color: #35405A;
  font-size: 1rem; }

h6 a {
    color: inherit; }

button:focus {
  outline: none; }

.line-height {
  line-height: normal; }

.rounded-normal, .rounded-small {
  border-radius: 10px 10px 0 10px; }

:focus {
  outline: none; }

.text-break {
  word-break: break-all; }

.border-none {
  border: none !important; }

.breadcrumb-item + .breadcrumb-item::before {
  margin-top: 0px; }

.user-list-files {
  justify-content: flex-end; }

.user-list-files a {
    padding: 10px 15px;
    margin: 0 0 0 10px;
    border-radius: 5px;
    line-height: normal; }

code {
  color: #D75842; }

.slick-loading .slick-list {
  background: transparent !important; }

ul.iq-edit-profile li a {
  padding: 1rem 1rem !important;
  text-align: center; }

.change-mode {
  margin-right: 0;
  margin-top: 0px; }

.change-mode .custom-switch.custom-switch-icon .custom-control-input {
    height: 100%; }

.change-mode .custom-switch.custom-switch-icon .custom-control-input:checked ~ .custom-control-label:after {
      transform: translateX(1.6rem); }

.change-mode .custom-switch.custom-switch-icon .custom-control-input:checked ~ .custom-control-label:before {
      background-color: #0D0D0D;
      border-color: #0D0D0D; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label {
    height: 31px;
    width: 30px; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label:after {
      top: 0;
      left: 0;
      width: 35px;
      height: 30px;
      border-radius: 5px 0 0 5px;
      background-color: #47B4AC;
      border-color: #47B4AC;
      z-index: 0;
      display: none; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label:before {
      width: 38px;
      height: 38px;
      top: 0;
      left: 0;
      background-color: #fff;
      border: 1px solid #C2C6CF;
      border-radius: 10px 10px 0 10px; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label .switch-icon-left {
      top: 5px;
      z-index: 1;
      left: 11px;
      line-height: 24px; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label .switch-icon-left i {
        font-size: 16px; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label .switch-icon-right {
      right: 3px;
      top: 5px;
      line-height: 24px; }

.change-mode .custom-switch.custom-switch-icon label.custom-control-label .switch-icon-right i {
        font-size: 16px; }

.custom-control-input:focus ~ .custom-control-label:before {
  box-shadow: none !important; }

g[aria-describedby="id-22-description"] {
  stroke: none; }

@media (min-width: 1400px) {
  .container {
    max-width: 1400px; }
  .container-lg {
    max-width: 1300px; }
  .container-md {
    max-width: 1300px; }
  .container-sm {
    max-width: 1300px; }
  .container-xl {
    max-width: 1300px; } }

@media (max-width: 1300px) {
  .flatpickr-rContainer {
    padding-right: 40px; }
  .flatpickr-months .flatpickr-next-month {
    padding-right: 40px; }
  .flatpickr-months .flatpickr-prev-month {
    padding-right: 40px; }
  .flatpickr-current-month {
    left: 7.5%; } }

@media (max-width: 767px) {
  .table {
    width: 100%;
    max-width: 100%;
    margin-bottom: 1rem;
/*    display: block;
*/    overflow-x: auto; }
  .tree {
    display: inline-table; } }

@media (max-width: 575px) {
  .user-list-files {
    justify-content: center;
    margin-top: 15px; } }

.content-page {
  overflow: hidden;
padding: 10px 0px; 

  min-height: 85vh;
  transition: all 0.3s ease-in-out; }

@media (max-width: 1299px) {
  .content-page {
    margin-left: 0;
    padding: 10px 0px; } }

@media (max-width: 991px) {
  .content-page {
    padding: 10px 0px;  }
  h1 {
    font-size: 2.5rem; }
  h2 {
    font-size: 2rem; } }

@media (max-width: 479px) {
  .welcome-content {
    display: block !important;
    text-align: center; }
    .welcome-content .breadcrumb {
      justify-content: center; } }

label {
  color: #01041b; }

.table td {
  vertical-align: middle; }

.table th {
  vertical-align: middle; }

.form-control {
  height: 45px;
  line-height: 45px;
  background: #ffffff;
  border: 1px solid #C2C6CF;
  font-size: 14px;
  color: #737B8E;
  border-radius: 10px 10px 0 10px;
  box-shadow: none; }

.form-control:focus {
    color: #01041b;
    border-color: #47B4AC;
    box-shadow: none; }

.form-control-sm {
  height: 30px;
  line-height: 30px; }

.form-control-lg {
  height: 50px;
  line-height: 50px; }

.spin {
  animation: spin 2s infinite linear; }

.input-group .input-group-prepend .input-group-text {
  border: 1px solid #bfc9d4;
  background-color: #ffffff; }

.input-group .input-group-append .input-group-text {
  border: 1px solid #bfc9d4;
  background-color: #ffffff; }

textarea.form-control {
  background-color: #ffffff;
  line-height: 28px; }

#editor {
  height: 375px; }

.uploader-file {
  display: block;
  clear: both;
  margin: 0 auto;
  width: 100%;
  max-width: 600px; }

.uploader-file label {
    float: left;
    clear: both;
    width: 100%;
    padding: 2rem 1.5rem;
    text-align: center;
    background: #fff;
    border-radius: 7px;
    border: 3px solid #eee;
    transition: all 0.3s ease-in-out;
    -webkit-user-select: none;
            user-select: none; }

.uploader-file label.hover {
    border: 3px solid;
    box-shadow: inset 0 0 0 6px #eee; }

.uploader-file label.hover #start-one i.fa {
      transform: scale(0.8);
      -webkit-opacity: 0.3;
      -moz-opacity: 0.3;
      -ms-opacity: 0.3;
      -o-opacity: 0.3;
      opacity: 0.3; }

.uploader-file #start-one {
    float: left;
    clear: both;
    width: 100%; }

.uploader-file #start-one i.fa {
      font-size: 50px;
      margin-bottom: 1rem;
      transition: all 0.3s ease-in-out; }

.uploader-file #start-one.hidden {
    display: none; }

.uploader-file #response {
    float: left;
    clear: both;
    width: 100%; }

.uploader-file #response #messages {
      margin-bottom: 0.5rem; }

.uploader-file #response.hidden {
    display: none; }

.uploader-file #file-image {
    display: inline;
    margin: 0 auto 0.5rem auto;
    width: auto;
    height: auto;
    max-width: 180px; }

.uploader-file #file-image.hidden {
    display: none; }

.uploader-file #notimage {
    display: block;
    float: left;
    clear: both;
    width: 100%; }

.uploader-file #notimage.hidden {
    display: none; }

.uploader-file progress {
    display: inline;
    clear: both;
    margin: 0 auto;
    width: 100%;
    max-width: 180px;
    height: 8px;
    border: 0;
    border-radius: 4px;
    background-color: #eee;
    overflow: hidden; }

.uploader-file .progress {
    display: inline;
    clear: both;
    margin: 0 auto;
    width: 100%;
    max-width: 180px;
    height: 8px;
    border: 0;
    border-radius: 4px;
    background-color: #eee;
    overflow: hidden; }

.uploader-file input[type="file"] {
    display: none; }

.uploader-file div {
    margin: 0 0 0.5rem 0;
    color: #5f6982; }

.spin {
  animation: spin 2s infinite linear; }

.input-group .input-group-prepend .input-group-text {
  border: 2px solid #F6F8FB;
  background-color: #ffffff; }

.input-group .input-group-append .input-group-text {
  border: 1px solid #C2C6CF;
  background-color: #ffffff; }

.custom-select {
  height: 46px;
  border: 1px solid #C2C6CF; }

.dropone.dropdown-toggle:after {
  display: none; }

.input-group-sm > .custom-select {
  height: 30px; }

.input-group-sm > .form-control:not(textarea) {
  height: 30px; }

.input-group-lg > .custom-select {
  height: 50px; }

.input-group-lg > .form-control:not(textarea) {
  height: 50px; }

.input-group-text.text-area {
  padding: 1.9rem .75rem; }

.custom-file-label::after {
  background-color: #ffffff;
  color: #737B8E; }

.custom-file-input:focus ~ .custom-file-label {
  border-color: #47B4AC;
  box-shadow: none; }

.btn-outline-primary.disabled {
  color: #47B4AC;
  background-color: transparent; }

.btn-outline-primary:disabled {
  color: #47B4AC;
  background-color: transparent; }

table.dataTable thead td {
  padding: 10px 10px !important; }

table.dataTable thead th {
  padding: 10px 10px !important; }

.table-striped tbody tr:nth-of-type(odd) {
  background-color: #ffffff; }

.table-bordered {
  border: 1px solid #C2C6CF; }

.table-bordered td {
    border: 1px solid #C2C6CF; }

.table-bordered th {
    border: 1px solid #C2C6CF; }

.dataTables_wrapper .dataTables_filter {
  color: #737B8E; }

.dataTables_wrapper .dataTables_info {
  color: #737B8E; }

.dataTables_wrapper .dataTables_length {
  color: #737B8E; }

.dataTables_wrapper .dataTables_paginate {
  color: #737B8E; }

.dataTables_wrapper .dataTables_processing {
  color: #737B8E; }

.dataTables_wrapper .dataTables_paginate .paginate_button {
  padding: 0px 10px;
  border-radius: 10px 10px 0 10px;
  margin: 0 3px; }

.dataTables_wrapper .dataTables_paginate .paginate_button:hover {
    color: #01041b !important;
    border: 1px solid #47B4AC !important;
    background: #DBF6F0 !important; }

.dataTables_wrapper .dataTables_paginate span .paginate_button {
  padding: 0px 10px;
  border-radius: 10px 10px 0 10px;
  margin: 0 3px; }

.dataTables_wrapper .dataTables_paginate span .paginate_button.current {
    padding: 3px 10px;
    color: #47B4AC !important;
    border: 1px solid #47B4AC !important;
    background: #DBF6F0 !important;
    border-radius: 10px 10px 0 10px; }

.dataTables_wrapper .dataTables_paginate span .paginate_button.current:hover {
      color: #47B4AC !important;
      border: 1px solid #47B4AC !important;
      background: #DBF6F0 !important; }

.dataTables_wrapper .dataTables_paginate span .paginate_button:hover {
    color: #01041b !important;
    border: 1px solid #47B4AC !important;
    background: #DBF6F0 !important; }

.dataTables_wrapper .dataTables_filter input {
  border-color: #C2C6CF;
  background-color: transparent;
  border-style: solid;
  border-width: 1px;
  border-radius: 10px 10px 0 10px; }

table.dataTable thead td {
  padding: 10px 18px;
  border-bottom: 1px solid #C2C6CF !important; }

table.dataTable thead th {
  padding: 10px 18px;
  border-bottom: 1px solid #C2C6CF !important;
  color: #35405A !important; }

table.dataTable.no-footer {
  border-bottom: 1px solid #C2C6CF !important; }

.dataTables_wrapper .dataTables_paginate .paginate_button {
  box-shadow: none !important;
  outline: none !important; }

.dataTables_wrapper .dataTables_info {
  padding-top: 15px !important; }

.dataTables_wrapper .dataTables_length label {
  border-color: #C2C6CF !important; }

.dataTables_wrapper .dataTables_length select {
  border-color: #C2C6CF !important; }

.custom-control-label:after {
  top: .25rem; }

.custom-control-label:before {
  top: .25rem; }

.custom-switch .custom-control-label::after {
  top: calc(.25rem + 2px); }

.select2-container--default .select2-selection--multiple {
  height: 45px;
  line-height: 34px;
  background: #fafbfe;
  border: 1px solid #f1f1f1;
  font-size: 14px;
  color: #535f6b;
  border-radius: 5px; }

.iq-icons-list {
  line-height: 50px;
  margin-bottom: 15px;
  display: inline-block; }

.iq-icons-list i {
    text-align: center;
    vertical-align: middle;
    font-size: 22px;
    width: 40px;
    height: 50px;
    line-height: 50px;
    margin-right: 10px;
    display: inline-block; }

.iq-icons-list .icon {
    text-align: center;
    vertical-align: middle;
    font-size: 22px;
    width: 40px;
    height: 40px;
    line-height: 50px;
    margin-right: 10px;
    display: inline-block; }

.iq-icons-list span {
    display: inline-block;
    vertical-align: middle; }

.iq-card-icon {
  height: 60px;
  width: 60px;
  display: inline-block;
  line-height: 60px;
  text-align: center;
  font-size: 22px; }

.ion-icon {
  height: 15px;
  width: 15px;
  line-height: 15px;
  font-size: 22px;
  margin-right: 10px; }

.iq-iconbox {
  height: 50px;
  width: 50px;
  line-height: 50px;
  text-align: center;
  font-size: 25px;
  border-radius: 10px 10px 0 10px; }

.iq-icon-box {
  height: 64px;
  width: 64px;
  min-width: 64px;
  line-height: 64px;
  text-align: center;
  margin-right: 10px;
  font-size: 26px;
  text-decoration: none; }

.card.iq-border-box {
  border-bottom: 4px solid; }

.profile-icon {
  height: 40px;
  width: 40px;
  line-height: 40px;
  text-align: center;
  font-size: 20px;
  font-weight: 700;
  border-radius: 50%; }

.iq-error {
  width: 100%;
  overflow: hidden;
  display: inline-block; }

.iq-error h1.text-in-box {
    position: absolute;
    top: 0;
    left: 0;
    right: 0;
    font-size: 8em;
    font-weight: 700; }

.iq-error-img {
  position: static;
  display: inline-block;
  margin-bottom: 20px; }

.iq-error .iq-error-img {
  width: 70%; }

.height-self-center {
  height: 100vh;
  border-radius: 10px 10px 0 10px; }

.iq-maintenance img {
  width: 50%; }

@media (max-width: 767px) {
  .iq-error h1.text-in-box {
    font-size: 5em; }
  .iq-error .iq-error-img {
    width: 90%; }
  .iq-maintenance img {
    width: 90%; }
  .iq-maintenance h3 {
    padding: 0px 15px; } }

@media (max-width: 479px) {
  .iq-error h1.text-in-box {
    font-size: 4em; }
  .iq-error h2 {
    font-size: 1.5em; } }

.login-content_as {
  position: relative;
  height: 100vh; }

.login-content_as .floating-label label {
    color: #737B8E;
    font-size: 14px;
    font-weight: 400;
    position: absolute;
    pointer-events: none;
    left: 12px;
    top: 50%;
    transform: translateY(-50%);
    transition: all 0.3s ease-in-out; }

.login-content_as .form-control {
    border-color: #F6F8FB; }

.login-content_as .form-control:focus {
      border-color: #47B4AC; }

.login-content_as .custom-control-label::before {
    background-color: #ffffff; }

.login-content_as .custom-control-label.control-label-1 {
    line-height: 24px; }

.login-content_as .auth-card {
    position: relative;
    overflow: hidden;
	scrollbar-width: thin;
scrollbar-color: #47B4AC #ccc;
    width: 100%;
    min-height: 480px;
    height: auto;
    margin: 0px auto;
    display: block; }

.login-content_as .auth-card .auth-content {
      min-height: 480px;
      height: 100% !important; }

.floating-label {
  position: relative;
 }

.floating-input:focus ~ label {
  color: #47B4AC;
  top: 0;
  left: 6px;
  font-size: 10px;
  background: #ffffff;
  padding: 0px 8px;
  border-radius: 10px 10px 0 10px; }

.floating-input:not(:placeholder-shown) {
  color: #737B8E;
  border: 1px solid #C2C6CF; }

.floating-input:not(:placeholder-shown) ~ label {
    top: 0;
    font-size: 14px;
    background: #ffffff;
    padding: 5px 8px; }

@media (min-width: 992px) {
  .lb-img {
    position: absolute;
    bottom: 0;
    left: 0;
    width: 213px; }
  .rb-img {
    position: absolute;
    bottom: 0;
    right: 0;
    width: 194px; }
  .cnf-mail {
    width: 80%; } }

@media (max-width: 991px) {
  .lb-img {
    display: none; }
  .rb-img {
    display: none; }
  .content-right {
    display: none; } }

#loading {
  background-color: #ffffff;
  height: 100%;
  width: 100%;
  position: fixed;
  margin-top: 0px;
  top: 0px;
  left: 0px;
  bottom: 0px;
  overflow: hidden !important;
  right: 0px;
  z-index: 999999; }

#loading-center {
  background: url(https://theofficearea.in/user-demo/assets/my/bssp-gif.gif) no-repeat scroll center center;
  background-size: 20%;
  width: 100%;
  height: 100%;
  position: relative; }

.loader {
  width: 3em;
  height: 3em;
  margin: auto;
  left: 0;
  right: 0;
  top: 0;
  bottom: 0;
  position: absolute; }

/*------------------*/

@keyframes loader1 {
  0%, 100% {
    box-shadow: 0em -2.6em 0em 0em #4788ff, 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.5), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.7); }
  12.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.7), 1.8em -1.8em 0 0em #4788ff, 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.5); }
  25% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.5), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.7), 2.5em 0em 0 0em #4788ff, 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  37.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.5), 2.5em 0em 0 0em rgba(71, 136, 255, 0.7), 1.75em 1.75em 0 0em #4788ff, 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  50% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.5), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.7), 0em 2.5em 0 0em #4788ff, -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  62.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.5), 0em 2.5em 0 0em rgba(71, 136, 255, 0.7), -1.8em 1.8em 0 0em #4788ff, -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  75% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.5), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.7), -2.6em 0em 0 0em #4788ff, -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  87.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.5), -2.6em 0em 0 0em rgba(71, 136, 255, 0.7), -1.8em -1.8em 0 0em #4788ff; } }

@keyframes loader2 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader-3-outter {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader-3-inner {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(-360deg); } }

@keyframes loader4 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader5 {
  0%, 100% {
    transform: translateX(0px); }
  75% {
    transform: translateX(30px); } }

@keyframes loader5_1 {
  0%, 100% {
    transform: translateY(0px); }
  75% {
    transform: translateY(30px); } }

@keyframes loader5_2 {
  0%, 100% {
    transform: translate(0px, 0px); }
  75% {
    transform: translate(30px, 30px); } }

@keyframes inner1 {
  0% {
    transform: rotateX(35deg) rotateY(-45deg) rotateZ(0deg); }
  100% {
    transform: rotateX(35deg) rotateY(-45deg) rotateZ(360deg); } }

@keyframes inner2 {
  0% {
    transform: rotateX(50deg) rotateY(10deg) rotateZ(0deg); }
  100% {
    transform: rotateX(50deg) rotateY(10deg) rotateZ(360deg); } }

@keyframes inner3 {
  0% {
    transform: rotateX(35deg) rotateY(55deg) rotateZ(0deg); }
  100% {
    transform: rotateX(35deg) rotateY(55deg) rotateZ(360deg); } }

@keyframes loader7 {
  0% {
    transform: rotate(0); }
  50% {
    transform: rotateY(180deg); }
  100% {
    transform: rotateY(180deg) rotateX(180deg); } }

@keyframes loader8 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader9 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader10 {
  0%, 100% {
    transform: translate(0, 0) rotate(0); }
  25% {
    transform: translate(40px, 40px) rotate(45deg); }
  50% {
    transform: translate(0px, 80px) rotate(0deg); }
  75% {
    transform: translate(-40px, 40px) rotate(45deg); } }

@keyframes loader11 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader12 {
  0% {
    transform: rotate(0deg);
    border-radius: 50%; }
  50% {
    transform: rotate(90deg);
    border-radius: 0%; }
  100% {
    transform: rotate(180deg);
    border-radius: 50%; } }

@keyframes loader13 {
  to {
    transform: rotate(360deg); } }

@keyframes loader14 {
  0% {
    transform: scale(0);
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0; }
  50% {
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1; }
  100% {
    transform: scale(1);
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0; } }

@keyframes loader15-inner {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(-360deg); } }

@keyframes loader15 {
  0% {
    border-width: 0px; }
  100% {
    border-width: 10px; } }

@keyframes loader16 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

.iq-loader-box {
  height: 150px;
  text-align: center;
  display: flex;
  align-items: center;
  vertical-align: middle;
  justify-content: center; }

.iq-loader-box [class*="loader-"] {
    display: inline-block;
    width: 60px;
    height: 60px;
    color: inherit;
    vertical-align: middle;
    position: relative;
    border-radius: 50%; }

.iq-loader-box .iq-loader-1 {
    width: 1em;
    height: 1em;
    border-radius: 50%;
    position: relative;
    text-indent: -9999em;
    animation: loader1 1.1s infinite ease;
    transform: translateZ(0); }

.iq-loader-box .iq-loader-2 {
    border: 7px double #37e6b0;
    animation: loader2 1s linear infinite; }

.iq-loader-box .iq-loader-2:before {
      content: "";
      position: absolute;
      width: 12px;
      height: 12px;
      background: #37e6b0;
      border-radius: 50%;
      bottom: 0;
      right: 37px; }

.iq-loader-box .iq-loader-2:after {
      content: "";
      position: absolute;
      width: 12px;
      height: 12px;
      background: #37e6b0;
      border-radius: 50%;
      bottom: 0;
      right: 37px;
      left: 37px;
      top: 0; }

.iq-loader-box .iq-loader-3 {
    position: relative;
    border-radius: 50%;
    display: inline-block;
    vertical-align: middle; }

.iq-loader-box .iq-loader-3 .loader-outter {
      position: absolute;
      border: 4px solid #f50057;
      border-left-color: transparent;
      border-bottom: 0;
      width: 100%;
      height: 100%;
      border-radius: 50%;
      animation: loader-3-outter 1s cubic-bezier(0.42, 0.61, 0.58, 0.41) infinite; }

.iq-loader-box .iq-loader-3 .loader-inner {
      position: absolute;
      border: 4px solid #f50057;
      border-radius: 50%;
      width: 40px;
      height: 40px;
      left: calc(50% - 20px);
      top: calc(50% - 20px);
      border-right: 0;
      border-top-color: transparent;
      animation: loader-3-inner 1s cubic-bezier(0.42, 0.61, 0.58, 0.41) infinite; }

.iq-loader-box .iq-loader-4 {
    border: .2em solid transparent;
    border-top-color: #fe721c;
    border-bottom-color: #fe721c;
    border-radius: 50%;
    position: relative;
    animation: 1s loader4 linear infinite; }

.iq-loader-box .iq-loader-4:before {
      content: '';
      display: block;
      width: 0;
      height: 0;
      position: absolute;
      border: .2em solid transparent;
      border-bottom-color: #fe721c;
      transform: rotate(135deg);
      right: -.3em;
      top: -.05em; }

.iq-loader-box .iq-loader-4:after {
      content: '';
      display: block;
      width: 0;
      height: 0;
      position: absolute;
      border: .2em solid transparent;
      border-bottom-color: #fe721c;
      transform: rotate(-45deg);
      left: -.3em;
      bottom: -.05em; }

.iq-loader-box .iq-loader-5 {
    width: 100px;
    height: 100px;
    border-radius: 100%;
    position: relative;
    margin: 0 auto; }

.iq-loader-box .iq-loader-5 span {
      display: block;
      position: absolute;
      left: calc(50% - 20px);
      top: calc(50% - 20px);
      width: 20px;
      height: 20px;
      background-color: var(--info); }

.iq-loader-box .iq-loader-5 span:nth-child(1) {
        animation: loader5 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-5 span:nth-child(2) {
        animation: loader5_1 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-5 span:nth-child(3) {
        animation: loader5_2 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-6 .inner {
    position: absolute;
    box-sizing: border-box;
    width: 100%;
    height: 100%;
    border-radius: 50%; }

.iq-loader-box .iq-loader-6 .inner1 {
    left: 0%;
    top: 0%;
    animation: inner1 1s linear infinite;
    border-bottom: 3px solid #ff4b4b; }

.iq-loader-box .iq-loader-6 .inner2 {
    right: 0%;
    top: 0%;
    animation: inner2 1s linear infinite;
    border-right: 3px solid #ff4b4b; }

.iq-loader-box .iq-loader-6 .inner3 {
    right: 0%;
    bottom: 0%;
    animation: inner3 1s linear infinite;
    border-top: 3px solid #ff4b4b; }

.iq-loader-box .iq-loader-7:before {
    content: "";
    position: absolute;
    left: 0px;
    width: 50px;
    height: 50px;
    background-color: #3498db;
    animation: loader7 1s infinite; }

.iq-loader-box .iq-loader-8 {
    border: 1.2em solid transparent;
    border-left-color: #d0bac2;
    border-right-color: #d0bac2;
    border-radius: 50%;
    animation: 1s loader8 linear infinite; }

.iq-loader-box .iq-loader-9 {
    border-radius: 50%;
    width: 7em;
    height: 7em;
    margin: 60px auto;
    font-size: 10px;
    position: relative;
    text-indent: -9999em;
    border-top: 1.1em solid rgba(255, 107, 208, 0.2);
    border-right: 1.1em solid rgba(255, 107, 208, 0.2);
    border-bottom: 1.1em solid rgba(255, 107, 208, 0.2);
    border-left: 1.1em solid #ff6bd0;
    transform: translateZ(0);
    animation: loader9 1.1s infinite linear; }

.iq-loader-box .iq-loader-9:after {
      border-radius: 50%;
      width: 7em;
      height: 7em; }

.iq-loader-box .iq-loader-10:before {
    content: "";
    width: 20px;
    height: 20px;
    position: absolute;
    top: -10px;
    left: calc(50% - 10px);
    background-color: #3450db;
    animation: loader10 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-10:after {
    content: "";
    width: 20px;
    height: 20px;
    position: absolute;
    top: -10px;
    left: calc(50% - 10px);
    background-color: #3450db;
    animation: loader10 1s ease-in-out infinite;
    bottom: 0;
    animation-delay: 0.5s; }

.iq-loader-box .iq-loader-11 {
    background: #000000; }

.iq-loader-box .iq-loader-11:before {
      content: '';
      position: absolute;
      border-radius: 50%;
      width: 25px;
      height: 25px;
      margin: 0 0 0 -12px;
      background-color: white;
      top: auto;
      bottom: 0;
      left: 50%;
      transform-origin: 50% 0%;
      animation: loader11 1s infinite linear; }

.iq-loader-box .iq-loader-12 {
    animation: loader12 1s infinite linear;
    background: #6dca5c; }

.iq-loader-box .iq-loader-13 {
    border-top: 0.2em solid #a7a4ca;
    border-right: .2em solid transparent;
    animation: loader13 1s linear infinite;
    border-radius: 100%;
    position: relative; }

.iq-loader-box .iq-loader-14 {
    border: 0 solid transparent;
    border-radius: 50%;
    position: relative; }

.iq-loader-box .iq-loader-14:before {
      content: '';
      border: 1em solid #13d7eb;
      border-radius: 50%;
      width: inherit;
      height: inherit;
      position: absolute;
      top: 0;
      left: 0;
      animation: loader14 1s linear infinite;
      -webkit-opacity: 0;
      -moz-opacity: 0;
      -ms-opacity: 0;
      -o-opacity: 0;
      opacity: 0;
      animation-delay: 1s; }

.iq-loader-box .iq-loader-14:after {
      content: '';
      border: 1em solid #13d7eb;
      border-radius: 50%;
      width: inherit;
      height: inherit;
      position: absolute;
      top: 0;
      left: 0;
      animation: loader14 1s linear infinite;
      -webkit-opacity: 0;
      -moz-opacity: 0;
      -ms-opacity: 0;
      -o-opacity: 0;
      opacity: 0;
      animation-delay: .5s; }

.iq-loader-box .iq-loader-15 {
    border: 6px groove #7e57c2;
    transform: rotate(360deg);
    transition: all 1s ease;
    animation: loader15-inner 1s ease-out alternate infinite; }

.iq-loader-box .iq-loader-15 .loader-inner {
      border: 0px inset #9575cd;
      border-radius: 50%;
      width: 100%;
      height: 100%;
      animation: loader15 1s ease-out alternate infinite; }

.iq-loader-box .iq-loader-16 {
    width: 70px;
    height: 70px;
    border: 5px dashed #b3a57c;
    animation: loader16 2s linear both infinite; }

.active-faq a.accordion-title {
  display: block;
  padding-right: 45px; }

.iq-accordion.career-style.faq-style .iq-accordion-block {
  padding: 10px 5px;
  border-radius: 10px 10px 0 10px; }

.iq-accordion.career-style.faq-style .iq-accordion-block .accordion-title span {
    padding-left: 0px; }

.iq-accordion.career-style.faq-style .iq-accordion-block .accordion-details p {
    padding-left: 15px;
    padding-top: 15px;
    padding-bottom: 15px; }

.iq-accordion.career-style.faq-style .accordion-title:before {
  display: inline-block;
  cursor: pointer;
  content: "";
  font-family: remixicon;
  position: absolute;
  top: -8px;
  right: 15px;
  color: #1e1e1e;
  font-size: 16px;
  line-height: 16px;
  font-weight: normal;
  transition: all 0.3s ease-in-out;
  border-radius: 10px 10px 0 10px;
  width: 45px;
  height: 45px;
  line-height: 45px;
  text-align: center;
  border-radius: 90px; }

.iq-accordion.career-style.faq-style .iq-accordion-block.accordion-active .accordion-title:before {
  content: "";
  display: inline-block;
  border-radius: 90px; }

.iq-accordion.career-style.faq-style .active-faq .row {
  background: transparent;
  padding: 10px 0px; }

.iq-accordion.career-style .iq-accordion-block {
  margin-bottom: 30px; }

.iq-accordion.career-style .iq-accordion-block .accordion-title span {
    font-size: 16px;
    display: table-cell;
    color: #01041b; }

#loading {
  background-color: #ffffff;
  height: 100%;
  width: 100%;
  position: fixed;
  margin-top: 0px;
  top: 0px;
  left: 0px;
  bottom: 0px;
  overflow: hidden !important;
  right: 0px;
  z-index: 999999; }

#loading-center {
  background: url(https://theofficearea.in/user-demo/assets/my/bssp-gif.gif) no-repeat scroll center center;
  background-size: 20%;
  width: 100%;
  height: 100%;
  position: relative; }

.loader {
  width: 3em;
  height: 3em;
  margin: auto;
  left: 0;
  right: 0;
  top: 0;
  bottom: 0;
  position: absolute; }

/*------------------*/

@keyframes loader1 {
  0%, 100% {
    box-shadow: 0em -2.6em 0em 0em #4788ff, 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.5), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.7); }
  12.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.7), 1.8em -1.8em 0 0em #4788ff, 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.5); }
  25% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.5), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.7), 2.5em 0em 0 0em #4788ff, 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  37.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.5), 2.5em 0em 0 0em rgba(71, 136, 255, 0.7), 1.75em 1.75em 0 0em #4788ff, 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  50% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.5), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.7), 0em 2.5em 0 0em #4788ff, -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.2), -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  62.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.5), 0em 2.5em 0 0em rgba(71, 136, 255, 0.7), -1.8em 1.8em 0 0em #4788ff, -2.6em 0em 0 0em rgba(71, 136, 255, 0.2), -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  75% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.5), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.7), -2.6em 0em 0 0em #4788ff, -1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2); }
  87.5% {
    box-shadow: 0em -2.6em 0em 0em rgba(71, 136, 255, 0.2), 1.8em -1.8em 0 0em rgba(71, 136, 255, 0.2), 2.5em 0em 0 0em rgba(71, 136, 255, 0.2), 1.75em 1.75em 0 0em rgba(71, 136, 255, 0.2), 0em 2.5em 0 0em rgba(71, 136, 255, 0.2), -1.8em 1.8em 0 0em rgba(71, 136, 255, 0.5), -2.6em 0em 0 0em rgba(71, 136, 255, 0.7), -1.8em -1.8em 0 0em #4788ff; } }

@keyframes loader2 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader-3-outter {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader-3-inner {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(-360deg); } }

@keyframes loader4 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader5 {
  0%, 100% {
    transform: translateX(0px); }
  75% {
    transform: translateX(30px); } }

@keyframes loader5_1 {
  0%, 100% {
    transform: translateY(0px); }
  75% {
    transform: translateY(30px); } }

@keyframes loader5_2 {
  0%, 100% {
    transform: translate(0px, 0px); }
  75% {
    transform: translate(30px, 30px); } }

@keyframes inner1 {
  0% {
    transform: rotateX(35deg) rotateY(-45deg) rotateZ(0deg); }
  100% {
    transform: rotateX(35deg) rotateY(-45deg) rotateZ(360deg); } }

@keyframes inner2 {
  0% {
    transform: rotateX(50deg) rotateY(10deg) rotateZ(0deg); }
  100% {
    transform: rotateX(50deg) rotateY(10deg) rotateZ(360deg); } }

@keyframes inner3 {
  0% {
    transform: rotateX(35deg) rotateY(55deg) rotateZ(0deg); }
  100% {
    transform: rotateX(35deg) rotateY(55deg) rotateZ(360deg); } }

@keyframes loader7 {
  0% {
    transform: rotate(0); }
  50% {
    transform: rotateY(180deg); }
  100% {
    transform: rotateY(180deg) rotateX(180deg); } }

@keyframes loader8 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader9 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader10 {
  0%, 100% {
    transform: translate(0, 0) rotate(0); }
  25% {
    transform: translate(40px, 40px) rotate(45deg); }
  50% {
    transform: translate(0px, 80px) rotate(0deg); }
  75% {
    transform: translate(-40px, 40px) rotate(45deg); } }

@keyframes loader11 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

@keyframes loader12 {
  0% {
    transform: rotate(0deg);
    border-radius: 50%; }
  50% {
    transform: rotate(90deg);
    border-radius: 0%; }
  100% {
    transform: rotate(180deg);
    border-radius: 50%; } }

@keyframes loader13 {
  to {
    transform: rotate(360deg); } }

@keyframes loader14 {
  0% {
    transform: scale(0);
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0; }
  50% {
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1; }
  100% {
    transform: scale(1);
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0; } }

@keyframes loader15-inner {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(-360deg); } }

@keyframes loader15 {
  0% {
    border-width: 0px; }
  100% {
    border-width: 10px; } }

@keyframes loader16 {
  0% {
    transform: rotate(0deg); }
  100% {
    transform: rotate(360deg); } }

.iq-loader-box {
  height: 150px;
  text-align: center;
  display: flex;
  align-items: center;
  vertical-align: middle;
  justify-content: center; }

.iq-loader-box [class*="loader-"] {
    display: inline-block;
    width: 60px;
    height: 60px;
    color: inherit;
    vertical-align: middle;
    position: relative;
    border-radius: 50%; }

.iq-loader-box .iq-loader-1 {
    width: 1em;
    height: 1em;
    border-radius: 50%;
    position: relative;
    text-indent: -9999em;
    animation: loader1 1.1s infinite ease;
    transform: translateZ(0); }

.iq-loader-box .iq-loader-2 {
    border: 7px double #37e6b0;
    animation: loader2 1s linear infinite; }

.iq-loader-box .iq-loader-2:before {
      content: "";
      position: absolute;
      width: 12px;
      height: 12px;
      background: #37e6b0;
      border-radius: 50%;
      bottom: 0;
      right: 37px; }

.iq-loader-box .iq-loader-2:after {
      content: "";
      position: absolute;
      width: 12px;
      height: 12px;
      background: #37e6b0;
      border-radius: 50%;
      bottom: 0;
      right: 37px;
      left: 37px;
      top: 0; }

.iq-loader-box .iq-loader-3 {
    position: relative;
    border-radius: 50%;
    display: inline-block;
    vertical-align: middle; }

.iq-loader-box .iq-loader-3 .loader-outter {
      position: absolute;
      border: 4px solid #f50057;
      border-left-color: transparent;
      border-bottom: 0;
      width: 100%;
      height: 100%;
      border-radius: 50%;
      animation: loader-3-outter 1s cubic-bezier(0.42, 0.61, 0.58, 0.41) infinite; }

.iq-loader-box .iq-loader-3 .loader-inner {
      position: absolute;
      border: 4px solid #f50057;
      border-radius: 50%;
      width: 40px;
      height: 40px;
      left: calc(50% - 20px);
      top: calc(50% - 20px);
      border-right: 0;
      border-top-color: transparent;
      animation: loader-3-inner 1s cubic-bezier(0.42, 0.61, 0.58, 0.41) infinite; }

.iq-loader-box .iq-loader-4 {
    border: .2em solid transparent;
    border-top-color: #fe721c;
    border-bottom-color: #fe721c;
    border-radius: 50%;
    position: relative;
    animation: 1s loader4 linear infinite; }

.iq-loader-box .iq-loader-4:before {
      content: '';
      display: block;
      width: 0;
      height: 0;
      position: absolute;
      border: .2em solid transparent;
      border-bottom-color: #fe721c;
      transform: rotate(135deg);
      right: -.3em;
      top: -.05em; }

.iq-loader-box .iq-loader-4:after {
      content: '';
      display: block;
      width: 0;
      height: 0;
      position: absolute;
      border: .2em solid transparent;
      border-bottom-color: #fe721c;
      transform: rotate(-45deg);
      left: -.3em;
      bottom: -.05em; }

.iq-loader-box .iq-loader-5 {
    width: 100px;
    height: 100px;
    border-radius: 100%;
    position: relative;
    margin: 0 auto; }

.iq-loader-box .iq-loader-5 span {
      display: block;
      position: absolute;
      left: calc(50% - 20px);
      top: calc(50% - 20px);
      width: 20px;
      height: 20px;
      background-color: var(--info); }

.iq-loader-box .iq-loader-5 span:nth-child(1) {
        animation: loader5 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-5 span:nth-child(2) {
        animation: loader5_1 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-5 span:nth-child(3) {
        animation: loader5_2 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-6 .inner {
    position: absolute;
    box-sizing: border-box;
    width: 100%;
    height: 100%;
    border-radius: 50%; }

.iq-loader-box .iq-loader-6 .inner1 {
    left: 0%;
    top: 0%;
    animation: inner1 1s linear infinite;
    border-bottom: 3px solid #ff4b4b; }

.iq-loader-box .iq-loader-6 .inner2 {
    right: 0%;
    top: 0%;
    animation: inner2 1s linear infinite;
    border-right: 3px solid #ff4b4b; }

.iq-loader-box .iq-loader-6 .inner3 {
    right: 0%;
    bottom: 0%;
    animation: inner3 1s linear infinite;
    border-top: 3px solid #ff4b4b; }

.iq-loader-box .iq-loader-7:before {
    content: "";
    position: absolute;
    left: 0px;
    width: 50px;
    height: 50px;
    background-color: #3498db;
    animation: loader7 1s infinite; }

.iq-loader-box .iq-loader-8 {
    border: 1.2em solid transparent;
    border-left-color: #d0bac2;
    border-right-color: #d0bac2;
    border-radius: 50%;
    animation: 1s loader8 linear infinite; }

.iq-loader-box .iq-loader-9 {
    border-radius: 50%;
    width: 7em;
    height: 7em;
    margin: 60px auto;
    font-size: 10px;
    position: relative;
    text-indent: -9999em;
    border-top: 1.1em solid rgba(255, 107, 208, 0.2);
    border-right: 1.1em solid rgba(255, 107, 208, 0.2);
    border-bottom: 1.1em solid rgba(255, 107, 208, 0.2);
    border-left: 1.1em solid #ff6bd0;
    transform: translateZ(0);
    animation: loader9 1.1s infinite linear; }

.iq-loader-box .iq-loader-9:after {
      border-radius: 50%;
      width: 7em;
      height: 7em; }

.iq-loader-box .iq-loader-10:before {
    content: "";
    width: 20px;
    height: 20px;
    position: absolute;
    top: -10px;
    left: calc(50% - 10px);
    background-color: #3450db;
    animation: loader10 1s ease-in-out infinite; }

.iq-loader-box .iq-loader-10:after {
    content: "";
    width: 20px;
    height: 20px;
    position: absolute;
    top: -10px;
    left: calc(50% - 10px);
    background-color: #3450db;
    animation: loader10 1s ease-in-out infinite;
    bottom: 0;
    animation-delay: 0.5s; }

.iq-loader-box .iq-loader-11 {
    background: #000000; }

.iq-loader-box .iq-loader-11:before {
      content: '';
      position: absolute;
      border-radius: 50%;
      width: 25px;
      height: 25px;
      margin: 0 0 0 -12px;
      background-color: white;
      top: auto;
      bottom: 0;
      left: 50%;
      transform-origin: 50% 0%;
      animation: loader11 1s infinite linear; }

.iq-loader-box .iq-loader-12 {
    animation: loader12 1s infinite linear;
    background: #6dca5c; }

.iq-loader-box .iq-loader-13 {
    border-top: 0.2em solid #a7a4ca;
    border-right: .2em solid transparent;
    animation: loader13 1s linear infinite;
    border-radius: 100%;
    position: relative; }

.iq-loader-box .iq-loader-14 {
    border: 0 solid transparent;
    border-radius: 50%;
    position: relative; }

.iq-loader-box .iq-loader-14:before {
      content: '';
      border: 1em solid #13d7eb;
      border-radius: 50%;
      width: inherit;
      height: inherit;
      position: absolute;
      top: 0;
      left: 0;
      animation: loader14 1s linear infinite;
      -webkit-opacity: 0;
      -moz-opacity: 0;
      -ms-opacity: 0;
      -o-opacity: 0;
      opacity: 0;
      animation-delay: 1s; }

.iq-loader-box .iq-loader-14:after {
      content: '';
      border: 1em solid #13d7eb;
      border-radius: 50%;
      width: inherit;
      height: inherit;
      position: absolute;
      top: 0;
      left: 0;
      animation: loader14 1s linear infinite;
      -webkit-opacity: 0;
      -moz-opacity: 0;
      -ms-opacity: 0;
      -o-opacity: 0;
      opacity: 0;
      animation-delay: .5s; }

.iq-loader-box .iq-loader-15 {
    border: 6px groove #7e57c2;
    transform: rotate(360deg);
    transition: all 1s ease;
    animation: loader15-inner 1s ease-out alternate infinite; }

.iq-loader-box .iq-loader-15 .loader-inner {
      border: 0px inset #9575cd;
      border-radius: 50%;
      width: 100%;
      height: 100%;
      animation: loader15 1s ease-out alternate infinite; }

.iq-loader-box .iq-loader-16 {
    width: 70px;
    height: 70px;
    border: 5px dashed #b3a57c;
    animation: loader16 2s linear both infinite; }

.treegrid-indent {
  width: 0px;
  height: 16px;
  display: inline-block;
  position: relative; }

.tab-content .table tbody tr {
  color: #000; }

.table-data .table tbody tr {
  color: #000; }

.treegrid-expander {
  width: 0px;
  height: 16px;
  display: inline-block;
  position: relative;
  left: -17px;
  cursor: pointer; }

.glyphicon.glyphicon-chevron-right:before {
  position: absolute;
  content: "\EA6E";
  font-family: remixicon;
  top: 0;
  bottom: 0;
  left: 0;
  right: 0; }

.glyphicon.glyphicon-chevron-down:before {
  position: absolute;
  content: "\EA4E";
  font-family: remixicon;
  top: 0;
  bottom: 0;
  left: 0;
  right: 0; }

.glyphicon.glyphicon-plus:before {
  position: absolute;
  content: "\EA13";
  font-family: remixicon;
  top: 0;
  bottom: 0;
  left: 0;
  right: 0; }

.glyphicon.glyphicon-minus:before {
  position: absolute;
  content: "\F1AF";
  font-family: remixicon;
  top: 0;
  bottom: 0;
  left: 0;
  right: 0; }

.grid-m {
  margin-bottom: 30px; }

.grid-m:nth-last-child(-n+4) {
    margin-bottom: 0; }

.g-box {
  background: #ffffff; }

.g-desc {
  border: 1px solid rgba(210, 201, 255, 0.4); }

.masonry .item {
  width: 25%;
  padding: 10px;
  display: block; }

.masonry .item a {
    cursor: zoom-in; }

.masonry .item img {
    width: 100%; }

.grid-sizer {
  width: 25%;
  padding: 10px;
  display: block; }

.b-radius-top {
  border-radius: 10px 10px 0 10px 10px 10px 0 10px 0 0; }

.b-radius-bottom {
  border-radius: 0 0 10px 10px 0 10px 10px 10px 0 10px; }

.hover-effects {
  overflow: hidden;
  position: relative; }

.hover-effects a {
    cursor: pointer; }

.hover-effects:hover .effect-1 {
    transform: scale3d(1.2, 1.2, 1); }

.hover-effects:hover .effect-2 {
    transform: scale(1); }

.hover-effects:hover .effect-3 {
    margin-left: 0; }

.hover-effects:hover .effect-4 {
    transform: rotate(0) scale(1); }

.hover-effects:hover .ovrlay-1-a {
    left: 0;
    top: 0; }

.hover-effects:hover .ovrlay-1-b {
    left: 0;
    top: 0; }

.hover-effects:hover .ovrlay-2-a {
    left: 0; }

.hover-effects:hover .ovrlay-2-b {
    left: 0; }

.hover-effects:hover .ovrlay-3-a {
    transform: scale(1); }

.hover-effects:hover .ovrlay-3-b {
    transform: scale(1); }

.hover-effects:hover .ovrlay-4-a {
    top: 0; }

.hover-effects:hover .ovrlay-4-b {
    top: 0; }

.hover-effects:hover .ovrlay-5 {
    left: 0;
    opacity: 1;
    visibility: visible; }

.hover-effects:hover .ovrlay-6 {
    visibility: visible;
    transform: perspective(600px) rotateX(0deg); }

.hover-effects:hover .ovrlay-7 {
    opacity: 1;
    transform: perspective(400px) rotateX(0deg); }

.hover-effects:hover .ovrlay-8 {
    right: 0; }

.hover-effects:hover .effect-8 {
    right: 40px; }

.effect-1 {
  transition: all 0.3s ease-in-out; }

.effect-2 {
  transition: all 0.3s ease-in-out;
  transform: scale(1.2); }

.effect-3 {
  margin-left: 30px;
  transition: all 0.3s ease-in-out;
  transform: scale(1.3); }

.effect-4 {
  transition: all 0.3s ease-in-out;
  transform: rotate(12deg) scale(1.4); }

.ovrlay-1-a {
  background: rgba(0, 0, 0, 0.25);
  height: 100%;
  position: absolute;
  width: 100%;
  transition: all 0.3s ease-in-out;
  left: -100%;
  top: -100%; }

.ovrlay-1-b {
  background: rgba(0, 0, 0, 0.25);
  height: 100%;
  position: absolute;
  width: 100%;
  transition: all 0.3s ease-in-out;
  left: 100%;
  top: 100%; }

.ovrlay-2-a {
  background: rgba(0, 0, 0, 0.25);
  height: 100%;
  position: absolute;
  top: 0;
  width: 100%;
  transition: all 0.3s ease-in-out;
  left: -100%; }

.ovrlay-2-b {
  background: rgba(0, 0, 0, 0.25);
  height: 100%;
  position: absolute;
  top: 0;
  width: 100%;
  transition: all 0.3s ease-in-out;
  left: 100%; }

.ovrlay-3-a {
  position: absolute;
  background: rgba(0, 0, 0, 0.25);
  height: 100%;
  left: 0;
  top: 0;
  width: 100%;
  transform: scale(0);
  top: 100%; }

.ovrlay-3-a .ovrlay-3-b {
    position: absolute;
    background: rgba(0, 0, 0, 0.25);
    height: 100%;
    left: 0;
    top: 0;
    width: 100%;
    transform: scale(0);
    transition: all 0.3s ease-in-out; }

.ovrlay-3-a .ovrlay-4-a {
    background: rgba(0, 0, 0, 0.25);
    height: 100%;
    position: absolute;
    left: 0;
    width: 100%;
    transition: all 0.3s ease-in-out;
    top: -100%; }

.ovrlay-3-a .ovrlay-4-b {
    background: rgba(0, 0, 0, 0.25);
    height: 100%;
    position: absolute;
    left: 0;
    width: 100%; }

.ovrlay-5 {
  position: absolute;
  background: #47B4AC;
  width: 100%;
  height: 100%;
  top: 0;
  padding: 0 15px 0 15px;
  left: -100%;
  z-index: 1;
  overflow: auto;
  visibility: hidden;
  transition: all 0.3s ease-in-out;
  color: #fff; }

.ovrlay-5 h4 {
    color: #fff; }

.ovrlay-6 {
  background: #47B4AC;
  width: 100%;
  position: absolute;
  height: 100%;
  top: 0;
  left: 0;
  overflow: auto;
  visibility: hidden;
  padding: 0 15px;
  transform: perspective(600px) rotateX(-90deg);
  transition: all 0.3s ease-in-out; }

.ovrlay-6 h4 {
    color: #fff; }

.ovrlay-6 p {
    color: #fff; }

.ovrlay-8 {
  background: #47B4AC;
  width: 40%;
  height: 100%;
  top: 0;
  transition: all 0.3s ease-in-out;
  position: absolute;
  right: -40%;
  overflow: auto;
  padding: 0 10px; }

.ovrlay-8 h4 {
    color: #fff; }

.ovrlay-8 .i-btn {
    position: absolute;
    bottom: 10px;
    right: 10%;
    width: 40px;
    height: 40px;
    line-height: 40px;
    font-size: 17px;
    border-radius: 50%;
    border: 1px solid #fff;
    background: transparent;
    text-align: center;
    transform: translateX(-50%);
    color: #fff !important; }

.ovrlay-7 {
  position: absolute;
  background: rgba(0, 0, 0, 0.8);
  height: 100%;
  left: 0;
  top: 0;
  width: 100%;
  -webkit-opacity: 0;
  -moz-opacity: 0;
  -ms-opacity: 0;
  -o-opacity: 0;
  opacity: 0;
  transform: perspective(400px) rotateX(-90deg);
  transform-origin: top;
  transition: all 0.3s ease-in-out; }

.ovrlay-7 .button {
    position: absolute;
    top: 50%;
    left: 50%;
    transform: translate(-50%, -50%);
    width: 40px;
    height: 40px;
    border-radius: 50%;
    background: #fff;
    text-align: center;
    line-height: 40px; }

.ovrlay-7 .button i {
      color: #47B4AC; }

.effect-8 {
  width: 100%;
  position: relative;
  right: 0;
  top: 0;
  transition: all 0.3s ease-in-out; }

.data-table .table th {
  border-bottom-width: 1px;
  border-top: none; }

.dataTables_filter .form-control:focus {
  background-color: #ffffff;
  border-color: #47B4AC; }

.dataTables_length .form-control:focus {
  background-color: #ffffff;
  border-color: #47B4AC; }

@media (max-width: 991px) {
  .masonry .item {
    width: 33.33%; }
  .masonry .grid-sizer {
    width: 33.33%; } }

@media (max-width: 767px) {
  .masonry .item {
    width: 100%;
    padding: 0 0 18px 0; }
  .masonry .grid-sizer {
    width: 100%;
    padding: 0 0 18px 0; } }

.logo-invoice {
  height: 40px; }

.print .card-title {
  color: #fff; }

.print .table thead {
  background: #ffffff; }

.print .table thead th {
    border: 0; }

.print .table th {
  border: 0; }

.print .table td {
  border-top: 0; }

.print .table tr {
  border-top: 1px solid #dee2e6; }

.print .table tr:first-child {
    border-top: 0; }

.btn-primary-dark {
  background: #235854;
  color: #fff; }

.btn-primary-dark:hover {
    color: #fff; }

.or-detail {
  background: #ffffff;
  border: 1px solid rgba(210, 201, 255, 0.4); }

.or-detail p {
    margin-bottom: 0; }

.ttl-amt {
  border-top: 1px solid rgba(210, 201, 255, 0.4); }

#scroll1 {
  position: relative;
  width: 600px;
  height: 250px; }

.sweet_al .btn {
  margin-right: 5px; }

@media (max-width: 479px) {
  .header-invoice {
    display: block !important;
    text-align: center; }
    .header-invoice .invoice-btn {
      margin-top: 15px; } }

.pricing .table th {
  border-top: none;
  border-bottom: 1px solid #dee2e6; }

.pricing .table td {
  border-top: none !important; }

.pricing .table tr {
  border-bottom: 1px solid #dee2e6; }

.pricing .table tr:last-child {
    border-bottom: 0; }

.prc-box {
  background: #DBF6F0;
  padding: 15px;
  position: relative;
  border-radius: 10px 10px 0 10px; }

.type {
  position: absolute;
  background: #47B4AC;
  padding: 9px 25px;
  color: #fff;
  top: -15px;
  left: 50%;
  transform: translateX(-50%);
  font-weight: 500; }

.type:before {
    position: absolute;
    content: '';
    width: 0;
    height: 0;
    right: -15px;
    top: 0px;
    border-left: 15px solid #235854;
    border-top: 15px solid transparent; }

.type:after {
    position: absolute;
    content: '';
    width: 0;
    height: 0;
    left: -15px;
    top: 0px;
    border-right: 15px solid #235854;
    border-top: 15px solid transparent; }

.prc-box.active {
  background: #47B4AC; }

.prc-box.active .h3 {
    color: #fff; }

.prc-box.active .type {
    background: #DBF6F0;
    color: #01041b; }

.prc-box.active .type:before {
      border-left: 16px solid #235854;
      right: -16px; }

.prc-box.active .type:after {
      border-right: 16px solid #235854;
      left: -16px; }

.prc-wrap {
  border-bottom: none !important; }

.i_close {
  font-size: 22px; }

.p-image {
  position: absolute;
  top: auto;
  right: 6px;
  bottom: 10px;
  transition: all .3s ease;
  background: #47B4AC;
  color: #fff;
  border-radius: 50%;
  height: 30px;
  width: 30px;
  line-height: 28px;
  text-align: center;
  font-size: 12px;
  cursor: pointer; }

.upload-button {
  font-size: 1.5em; }

/*.file-upload {
  display: none; }
*/

.upload_profile {
  position: relative; }

.child-cell.active {
  color: #47B4AC; }

.iq-social ul li a {
  display: block;
  text-align: center;
  font-size: 16px;
  line-height: 43px; }

.card .pricing-radius-box {
  border-radius: 60px 0 60px 0; }

.pricing-header {
  padding: 20px 0;
  background: #f5f6f9;
  border-radius: 10px 10px 50% 50%;
  transition: all 0.3s ease-in-out;
  margin-bottom: 20px; }

.pricing-details .icon-data {
  font-size: 50px; }

.pricing-custom-tab .tab-pane.fade.active.show {
  display: block; }

.pricing-custom-tab .tab-pane.fade {
  display: none; }

.pricing-custom-tab li.nav-item .nav-link {
  border: 1px solid #C2C6CF;
  color: #01041b;
  font-size: 16px;
  padding: 12px 35px;
  border-radius: 0; }

.pricing-custom-tab li.nav-item .nav-link.active {
  color: #fff;
  background: #47B4AC; }

.pricing-custom-tab li.nav-item .star-circle {
  background-color: #47B4AC;
  border-radius: 50%;
  -ms-box-shadow: 0 0 0 3px rgba(255, 255, 255, 0.5);
  -o-box-shadow: 0 0 0 3px rgba(255, 255, 255, 0.5);
  box-shadow: 0 0 0 3px rgba(255, 255, 255, 0.5);
  color: #fff;
  display: block;
  font-size: 13px;
  height: 25px;
  padding: 0;
  line-height: 23px;
  text-align: center;
  width: 20px;
  position: absolute;
  top: -14px;
  left: -14px;
  z-index: 1; }

.nav-pills li {
  position: relative; }

.iq-avatars .iq-avatar {
  margin-right: 10px;
  margin-bottom: 10px;
  position: relative;
  display: inline-block; }

.subscriber-detail .title {
  padding: 5px 20px;
  line-height: 26px; }

.subscriber-detail .iq-card-btn {
  position: absolute;
  top: 0px;
  left: -15px;
  margin: 0 auto;
  border: 4px solid #fff;
  padding: 2px;
  height: 40px;
  width: 40px;
  line-height: 22px;
  font-size: 20px; }

.subscriber-detail .iq-card-btn.title-instagram {
  background-color: #d6249f !important;
  background: radial-gradient(circle at 30% 107%, #fdf497 0, #fdf497 5%, #fd5949 45%, #d6249f 60%, #285aeb 90%) !important;
  color: #fff; }

.subscriber-detail .iq-card-btn.title-whatsapp {
  background-color: #00e676 !important;
  color: #fff;
  text-shadow: 1px 1px 10px rgba(0, 0, 0, 0.22); }

.subscriber-detail .iq-card-btn.title-twitter {
  background-color: #1da1f2 !important;
  color: #fff; }

.subscriber-detail .iq-card-btn.title-facebook {
  background-color: #3b5998 !important;
  background-image: linear-gradient(#4e69a2, #3b5998 50%) !important;
  color: #fff; }

.add-form-list .form-control.image-file {
  line-height: 26px; }

.bootstrap-select .dropdown-toggle {
  padding: 0px 15px;
  background-color:#fff;
  font-size: 14px;
  height: 45px;
  line-height: 45px;
  border: 1px solid #C2C6CF;
  border-radius: 10px 10px 0 10px; }

.bootstrap-select .dropdown-toggle .filter-option-inner-inner {
    font-weight: normal;
    color: #737B8E; }

.bootstrap-select .dropdown-toggle:focus {
    outline: unset !important; }

.bootstrap-select .dropdown-menu {
  border: 1px solid #C2C6CF;
  box-shadow: none; }

.bootstrap-select .dropdown-menu li a:hover {
    background-color: #ffffff; }

.bootstrap-select .dropdown-menu li a.active {
    background-color: #ffffff;
    color: #35405A; }

.bootstrap-select .dropdown-menu .inner {
    border: unset; }

.dataTables_wrapper .dataTables_length {
  margin-bottom: 20px; }

@media (max-width: 790px) {
  .add-list {
    margin-top: 20px; } }

.ui-kit .iq-top-navbar {
  width: 100%;
  padding: 0 15px; }

.ui-kit .content-page {
  margin: 0; }

.ui-kit .iq-footer {
  width: 100%;
  margin: 0; }

.ui-kit .header-logo {
  display: flex;
  align-items: flex-start; }

.ui-kit .header-logo img {
    height: 25px; }

.ui-kit .section-content {
  padding: 50px 0; }

.ui-kit .section-content .buttons button {
    margin-right: 10px; }

.ui-kit .section-content .content-shadow-input {
    background: #f4f5fa;
    padding: 50px 0;
    margin-bottom: 50px; }

.ui-kit .section-content .form-control-alt {
    box-shadow: 0 1px 3px rgba(50, 50, 93, 0.15), 0 1px 0 rgba(0, 0, 0, 0.2);
    border: 0;
    transition: all 0.15s ease-in-out; }

.profile-icon.iq-icon-box {
  height: 58px;
  width: 58px;
  line-height: 58px;
  text-align: center;
  margin-right: 10px;
  font-size: 26px;
  text-decoration: none; }

.profile-bg {
  border-radius: 10px 10px 0px; }

.profile-overly {
  position: absolute;
  left: auto;
  bottom: 0;
  right: 0;
  background: #fff;
  padding: 10px 30px;
  text-align: center;
  border-radius: 10px 10px 0 0; }

ul.iq-contact-rest li a p {
  word-break: break-all; }

.crm-p-image {
  position: absolute;
  top: auto;
  left: 69px;
  bottom: -9px;
  transition: all 0.3s cubic-bezier(0.175, 0.885, 0.32, 1.275);
  border-radius: 50%;
  height: 35px;
  width: 35px;
  text-align: center;
  font-size: 12px;
  line-height: 30px;
  cursor: pointer;
  border: 5px solid #fff; }

.card-profile {
  margin-top: -120px;
  font-size: 16px; }

.skill-number {
  margin-right: 10px;
  margin-left: 5px; }

.profile-tab.nav-pills .nav-item {
  margin-bottom: 10px; }

.profile-tab.nav-pills .nav-item:first-child .nav-link {
    margin-left: 0; }

.profile-tab.nav-pills .nav-link {
  font-size: 18px;
  -webkit-opacity: 0.5;
  -moz-opacity: 0.5;
  -ms-opacity: 0.5;
  -o-opacity: 0.5;
  opacity: 0.5;
  position: relative;
  padding: 0 0px 10px;
  margin: 0 20px; }

.profile-tab.nav-pills .nav-link:before {
    content: "";
    border: 1px solid #35405A;
    background: #35405A;
    width: 100%;
    height: 1px;
    position: absolute;
    left: 0;
    bottom: 0;
    -webkit-opacity: 0;
    -moz-opacity: 0;
    -ms-opacity: 0;
    -o-opacity: 0;
    opacity: 0;
    transition: all 0.3s ease-in-out; }

.profile-tab.nav-pills .nav-link.active {
    background: transparent;
    color: #35405A;
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1; }

.profile-tab.nav-pills .nav-link.active:before {
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1; }

.profile-tab.nav-pills .nav-link:hover {
    background: transparent;
    color: #35405A;
    -webkit-opacity: 1;
    -moz-opacity: 1;
    -ms-opacity: 1;
    -o-opacity: 1;
    opacity: 1; }

.profile-tab.nav-pills .nav-link:hover:before {
      -webkit-opacity: 1;
      -moz-opacity: 1;
      -ms-opacity: 1;
      -o-opacity: 1;
      opacity: 1; }

.profile-content {
  font-size: 16px; }

.profile-info {
  position: relative;
  padding: 0 10px; }

.profile-info:before {
    content: "";
    border-right: 1px solid #C2C6CF;
    background: #C2C6CF;
    height: 50px;
    width: 1px;
    position: absolute;
    right: 0;
    top: 30px; }

.profile-info:first-child {
    padding-left: 0; }

.profile-info:last-child {
    padding-right: 0; }

.profile-info:last-child:before {
      display: none; }

.profile-info .profile-icon.icon {
    line-height: 36px; }

.profile-media {
  position: relative;
  padding-bottom: 40px;
  z-index: 9; }

.profile-media:before {
    content: "";
    border-right: 2px solid #C2C6CF;
    background: #C2C6CF;
    height: 100%;
    width: 1px;
    position: absolute;
    left: 9px;
    top: 0;
    z-index: -1; }

.profile-dots {
  height: 20px;
  width: 20px;
  border: 2px solid;
  border-radius: 3px;
  background: #fff; }

.iq-progress-primary {
  background: #398f89 !important; }

.iq-progress-secondary {
  background: #262d75 !important; }

.iq-progress-success {
  background: #398f5c !important; }

.iq-progress-info {
  background: #1679b2 !important; }

.iq-progress-warning {
  background: #a8862c !important; }

.iq-progress-danger {
  background: #be3e28 !important; }

.iq-progress-light {
  background: #d3ddeb !important; }

.iq-progress-dark {
  background: black !important; }

.iq-progress-orange {
  background: #262d75 !important; }

.iq-progress-purple {
  background: #37268e !important; }

.iq-progress-skyblue {
  background: #0773d2 !important; }

.iq-progress-light-gray {
  background: #d1d5ea !important; }

.iq-progress-white {
  background: #e6e6e6 !important; }

.icon-primary {
  color: #1c4643 !important; }

.icon-text-primary {
  color: #1c4643 !important; }

.icon-secondary {
  color: #0d0f28 !important; }

.icon-text-secondary {
  color: #0d0f28 !important; }

.icon-success {
  color: #1c462d !important; }

.icon-text-success {
  color: #1c462d !important; }

.icon-info {
  color: #0b3b57 !important; }

.icon-text-info {
  color: #0b3b57 !important; }

.icon-warning {
  color: #574517 !important; }

.icon-text-warning {
  color: #574517 !important; }

.icon-danger {
  color: #6a2316 !important; }

.icon-text-danger {
  color: #6a2316 !important; }

.icon-light {
  color: #8ca6cc !important; }

.icon-text-light {
  color: #8ca6cc !important; }

.icon-dark {
  color: black !important; }

.icon-text-dark {
  color: black !important; }

.icon-orange {
  color: #0d0f28 !important; }

.icon-text-orange {
  color: #0d0f28 !important; }

.icon-purple {
  color: #18113d !important; }

.icon-text-purple {
  color: #18113d !important; }

.icon-skyblue {
  color: #043d6f !important; }

.icon-text-skyblue {
  color: #043d6f !important; }

.icon-light-gray {
  color: #8b95ca !important; }

.icon-text-light-gray {
  color: #8b95ca !important; }

.icon-white {
  color: #b3b3b3 !important; }

.icon-text-white {
  color: #b3b3b3 !important; }

@media (max-width: 991px) {
  .profile-info:before {
    display: none; } }

@media (max-width: 575px) {
  .card-profile {
    margin-top: -70px; } }

@media (max-width: 479px) {
  .profile-overly h3 {
    font-size: 18px; } }

@media (max-width: 379px) {
  .profile-tab.nav-pills .nav-item {
    width: 100%; }
    .profile-tab.nav-pills .nav-item .nav-link {
      margin: 0; } }

.dark {
  background: #0D0D0D;
  color: #676E8A;
  transition: all 0.3s ease-in-out; }

.dark .bg-primary-light {
    background-color: rgba(71, 136, 255, 0.1) !important; }

.dark a.bg-primary-light:hover, .dark a.bg-primary-light:focus,
  .dark button.bg-primary-light:hover,
  .dark button.bg-primary-light:focus {
    background-color: rgba(20, 103, 255, 0.1) !important; }

.dark .bg-secondary-light {
    background-color: rgba(108, 117, 125, 0.1) !important; }

.dark a.bg-secondary-light:hover, .dark a.bg-secondary-light:focus,
  .dark button.bg-secondary-light:hover,
  .dark button.bg-secondary-light:focus {
    background-color: rgba(84, 91, 98, 0.1) !important; }

.dark .bg-success-light {
    background-color: rgba(55, 230, 178, 0.1) !important; }

.dark a.bg-success-light:hover, .dark a.bg-success-light:focus,
  .dark button.bg-success-light:hover,
  .dark button.bg-success-light:focus {
    background-color: rgba(26, 208, 154, 0.1) !important; }

.dark .bg-info-light {
    background-color: rgba(135, 108, 254, 0.1) !important; }

.dark a.bg-info-light:hover, .dark a.bg-info-light:focus,
  .dark button.bg-info-light:hover,
  .dark button.bg-info-light:focus {
    background-color: rgba(94, 57, 254, 0.1) !important; }

.dark .bg-warning-light {
    background-color: rgba(254, 114, 28, 0.1) !important; }

.dark a.bg-warning-light:hover, .dark a.bg-warning-light:focus,
  .dark button.bg-warning-light:hover,
  .dark button.bg-warning-light:focus {
    background-color: rgba(230, 88, 1, 0.1) !important; }

.dark .bg-danger-light {
    background-color: rgba(255, 75, 75, 0.1) !important; }

.dark a.bg-danger-light:hover, .dark a.bg-danger-light:focus,
  .dark button.bg-danger-light:hover,
  .dark button.bg-danger-light:focus {
    background-color: rgba(255, 24, 24, 0.1) !important; }

.dark .bg-light-light {
    background-color: rgba(199, 203, 211, 0.1) !important; }

.dark a.bg-light-light:hover, .dark a.bg-light-light:focus,
  .dark button.bg-light-light:hover,
  .dark button.bg-light-light:focus {
    background-color: rgba(170, 176, 189, 0.1) !important; }

.dark .bg-dark-light {
    background-color: rgba(1, 4, 27, 0.1) !important; }

.dark a.bg-dark-light:hover, .dark a.bg-dark-light:focus,
  .dark button.bg-dark-light:hover,
  .dark button.bg-dark-light:focus {
    background-color: rgba(0, 0, 0, 0.1) !important; }

.dark .bg-orange-light {
    background-color: rgba(253, 126, 20, 0.1) !important; }

.dark a.bg-orange-light:hover, .dark a.bg-orange-light:focus,
  .dark button.bg-orange-light:hover,
  .dark button.bg-orange-light:focus {
    background-color: rgba(220, 101, 2, 0.1) !important; }

.dark .bg-purple-light {
    background-color: rgba(71, 49, 182, 0.1) !important; }

.dark a.bg-purple-light:hover, .dark a.bg-purple-light:focus,
  .dark button.bg-purple-light:hover,
  .dark button.bg-purple-light:focus {
    background-color: rgba(55, 38, 142, 0.1) !important; }

.dark #loading-center {
    background-image: url('dark-loader.a2184045fe80d147.html'); }

.dark h1, .dark h2, .dark h3, .dark h4, .dark h5, .dark h6 {
    color: #AEA8F5; }

.dark hr {
    border-color: #212532; }

.dark span, .dark p, .dark label {
    color: #676E8A; }

.dark .btn {
    color: #676E8A; }

.dark .btn span {
      color: inherit; }

.dark .dropdown-bg.btn {
    background: #151515; }

.dark .card-header .view-btn.light-gray {
    background: #151515; }

.dark .prc-box .h3 {
    color: #AEA8F5; }

.dark #loading {
    background-color: #0D0D0D; }

.dark ::-webkit-scrollbar-track {
    background: #212532; }

.dark span.btn-outline-primary, .dark span.btn-outline-success, .dark span.btn-outline-danger, .dark span.btn-outline-warning, .dark span.btn-outline-info {
    color: inherit; }

.dark .border.border-primary, .dark .border.border-success, .dark .border.border-danger, .dark .border.border-warning, .dark .border.border-info {
    border-color: inherit !important; }

.dark .border-right {
    border-color: #212532 !important; }

.dark .btn-outline-primary.view-more {
    color: #47B4AC; }

.dark .btn-outline-primary.view-more:hover {
      background: transparent; }

.dark .bg-primary-light span {
    color: inherit; }

.dark .bg-warning-light span {
    color: inherit; }

.dark .bg-danger-light span {
    color: inherit; }

.dark .bg-success-light span {
    color: inherit; }

.dark .bg-info-light span {
    color: inherit; }

.dark span.apexcharts-legend-text {
    color: #676E8A !important; }

.dark .apexcharts-yaxis text {
    fill: #676E8A; }

.dark .dataTables_wrapper .dataTables_paginate .paginate_button.disabled {
    cursor: default;
    color: #676E8A !important; }

.dark .dataTables_wrapper .dataTables_paginate .paginate_button.disabled:active {
      cursor: default;
      color: #676E8A !important; }

.dark .dataTables_wrapper .dataTables_paginate .paginate_button.disabled:hover {
      cursor: default;
      color: #676E8A !important; }

.dark .flatpickr-current-month .flatpickr-monthDropdown-months .flatpickr-monthDropdown-month {
    background-color: #2b343b !important; }

.dark .iq-sidebar {
    background: #0D0D0D; }

.dark .sidebar-default .iq-sidebar-menu .iq-menu > li.active > a {
    background: #151515; }

.dark .iq-sidebar-menu .iq-menu li a {
    color: #676E8A; }

.dark .iq-sidebar-menu .iq-menu li a span {
      color: #676E8A; }

.dark .iq-sidebar-menu .iq-menu li:hover > a {
    color: #47B4AC; }

.dark .iq-sidebar-menu .iq-menu li:hover > a span {
      color: #47B4AC; }

.dark .wrapper-menu {
    color: #AEA8F5; }

.dark .sidebar-default .iq-sidebar-menu .iq-menu > li.active > a {
    color: #47B4AC; }

.dark .sidebar-default .iq-sidebar-menu .iq-menu > li.active > a span {
      color: #47B4AC; }

.dark .sidebar-default .iq-sidebar-menu .iq-menu > li.active .iq-submenu li.active > a {
    color: #47B4AC; }

.dark .sidebar-default .iq-sidebar-menu .iq-menu > li.active .iq-submenu li.active > a span {
      color: #47B4AC; }

.dark .iq-top-navbar {
    background: #0D0D0D; }

.dark .iq-top-navbar .iq-sub-dropdown {
      background: #0D0D0D; }

.dark .navbar-list li .iq-sub-dropdown .iq-sub-card {
    color: #676E8A; }

.dark .navbar-list li > a {
    color: #676E8A; }

.dark .iq-search-bar .search-input {
    border-color: #212532;
    background: #0D0D0D;
    color: #676E8A; }

.dark .cust-title {
    border-color: #212532; }

.dark .iq-footer {
    background: #0D0D0D; }

.dark .iq-footer ul li a {
      color: #676E8A; }

.dark .iq-footer ul li a:hover {
        color: #47B4AC; }

.dark .change-mode .custom-switch.custom-switch-icon .custom-control-input:checked ~ .custom-control-label:before {
    border-color: #212532; }

.dark .card {
    background-color: #0D0D0D;
    border-color: #212532;
    transition: all 0.3s ease-in-out; }

.dark .card .card-header {
      border-color: #212532; }

.dark .card-transparent {
    background: transparent; }

.dark .text-dark- {
    color: #fff !important; }

.dark .text-body {
    color: #676E8A !important; }

.dark .text-muted {
    color: #676E8A !important; }

.dark .breadcrumb-item.active {
    color: #676E8A; }

.dark .table {
    color: #676E8A; }

.dark .table .ligth th {
      background-color: #151515; }

.dark .table td {
      border-color: #212532;
      color: #AEA8F5; }

.dark .tab-content .table tbody tr {
    color: #676E8A; }

.dark .table-data .table tbody tr {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_paginate span .paginate_button.current {
    background: rgba(71, 136, 255, 0.1) !important; }

.dark table.dataTable thead td {
    border-color: #212532 !important; }

.dark table.dataTable thead th {
    border-color: #212532 !important; }

.dark table.dataTable.no-footer {
    border-color: #212532 !important; }

.dark .iq-top-navbar .navbar-toggler {
    background: #0D0D0D;
    color: #AEA8F5; }

.dark .iq-alert-text p, .dark .iq-alert-text h1, .dark .iq-alert-text h2, .dark .iq-alert-text h3, .dark .iq-alert-text h4, .dark .iq-alert-text h5, .dark .iq-alert-text h6 {
    color: inherit; }

.dark .border {
    border-color: #212532 !important; }

.dark .border-bottom {
    border-color: #212532 !important; }

.dark .breadcrumb {
    background: #0D0D0D; }

.dark .list-group-item {
    background: #0D0D0D; }

.dark .blockquote-footer {
    color: #676E8A; }

.dark pre {
    color: #676E8A; }

.dark .modal-content {
    background: #0D0D0D; }

.dark .page-link {
    background-color: #0D0D0D; }

.dark .page-item.disabled .page-link {
    background-color: #0D0D0D;
    border-color: #47B4AC; }

.dark .popover {
    background-color: #0D0D0D; }

.dark .popover .popover-header {
      background-color: #0D0D0D;
      color: #676E8A;
      border-color: #212532; }

.dark .popover .popover-body {
      color: #676E8A; }

.dark .add-form-list .bootstrap-select .dropdown-toggle {
    border-color: #212532; }

.dark .add-form-list .bootstrap-select .dropdown-menu {
    border-color: #212532; }

.dark .add-form-list .bootstrap-select .dropdown-menu li a.active {
      background-color: #151515; }

.dark .add-form-list .bootstrap-select .dropdown-menu li a:hover {
      background-color: #151515; }

.dark .dropdown-menu {
    background-color: #0D0D0D; }

.dark .dropdown-menu .dropdown-item {
      color: #676E8A; }

.dark .dropdown-menu .dropdown-item:hover {
        background-color: #47B4AC; }

.dark .dropdown-menu .dropdown-item:focus {
        background-color: #47B4AC; }

.dark .dropdown-menu .dropdown-divider {
      border-top-color: #212532; }

.dark .nav-tabs .nav-item a {
    color: #676E8A; }

.dark .nav-tabs .nav-item.show .nav-link {
    color: #47B4AC; }

.dark .nav-tabs .nav-link.active {
    color: #47B4AC; }

.dark .nav-pills .nav-item a {
    color: #676E8A; }

.dark .nav-pills .nav-link.active {
    color: #47B4AC; }

.dark .nav-pills .show > .nav-link {
    color: #47B4AC; }

.dark .table-bordered {
    border-color: #212532; }

.dark .table-bordered td {
      border-color: #212532; }

.dark .table-bordered th {
      border-color: #212532; }

.dark .table-striped tbody tr:nth-of-type(odd) {
    background-color: #0D0D0D; }

.dark .iq-example-row .row > .col {
    color: #676E8A; }

.dark .iq-example-row .row > [class^=col-] {
    color: #676E8A; }

.dark table.dataTable tbody tr {
    background-color: #0D0D0D; }

.dark table.dataTable thead th {
    color: #AEA8F5 !important; }

.dark .dataTables_wrapper .dataTables_filter input {
    border-color: #212532; }

.dark .table-hover tbody tr:hover {
    color: #fff; }

.dark .dataTables_wrapper .dataTables_filter {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_info {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_length {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_paginate {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_processing {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_filter input {
    color: #676E8A; }

.dark .dataTables_wrapper .dataTables_paginate .paginate_button {
    color: #676E8A !important; }

.dark .form-control {
    color: #676E8A;
    background: #0D0D0D;
    border-color: #212532; }

.dark .custom-file-label {
    background: #0D0D0D;
    border-color: #212532; }

.dark .input-group .input-group-append .input-group-text {
    border-color: #212532;
    background-color: #0D0D0D; }

.dark .input-group .input-group-prepend .input-group-text {
    border-color: #212532;
    background-color: #0D0D0D; }

.dark .custom-select {
    color: #676E8A;
    border-color: #212532;
    background-color: #0D0D0D; }

.dark .custom-file-label:after {
    background-color: #0D0D0D;
    color: #676E8A; }

.dark ::placeholder {
    color: #676E8A; }

.dark .form-control::placeholder {
    color: #676E8A; }

.dark .select2-container--default .select2-selection--multiple {
    background-color: #0D0D0D;
    border-color: #212532; }

.dark .select2-container--default .select2-selection--multiple .select2-selection__choice {
    background-color: #0D0D0D;
    border-color: #212532; }

.dark .select2-container--default .select2-results__option[aria-selected=true] {
    background-color: #0D0D0D; }

.dark .select2-results__options {
    background-color: #0D0D0D; }

.dark .uploader-file label {
    background-color: #0D0D0D;
    border-color: #212532; }

.dark .ql-snow .ql-stroke {
    stroke: #fff; }

.dark form.form-border .form-control {
    border-color: #212532; }

.dark .ic-square {
    border-color: #212532; }

.dark .swal2-popup {
    background: #0D0D0D; }

.dark .swal2-popup .swal2-content {
      color: #676E8A; }

.dark .flatpickr-calendar.inline {
    background: transparent; }

.dark .flatpickr-calendar {
    background: #0D0D0D; }

.dark .flatpickr-months .flatpickr-month {
    background: transparent;
    color: #fff;
    fill: #fff; }

.dark .flatpickr-months .flatpickr-next-month svg {
    color: #fff;
    fill: #fff; }

.dark .flatpickr-months .flatpickr-prev-month svg {
    color: #fff;
    fill: #fff; }

.dark span.flatpickr-weekday {
    color: #fff; }

.dark .stepwizard-row .wizard-step a.btn {
    background: #0D0D0D; }

.dark #top-tabbar-vertical li a {
    background: #0D0D0D;
    color: #676E8A; }

.dark .g-box {
    background: #0D0D0D; }

.dark .g-desc {
    border-color: #212532; }

.dark .blog-left .blog-description {
    background: #0D0D0D; }

.dark .blog-detail .blog-meta {
    background: #0D0D0D;
    color: #676E8A; }

.dark .profile-box {
    background: #0D0D0D; }

.dark .pro-content {
    background: #0D0D0D; }

.dark .social-ic {
    background: #0D0D0D; }

.dark .social-ic a i {
      color: #676E8A; }

.dark .timeline-page .iq-timeline0 li .timeline-dots1 {
    background: #0D0D0D; }

.dark .timeline-page .iq-timeline0 li .timeline-dots {
    background: #0D0D0D !important; }

.dark .timeline-page .iq-timeline1 li .timeline-dots {
    background: #0D0D0D; }

.dark .prc-box.active .type {
    background: #47B4AC;
    color: #fff; }

.dark .pricing-header {
    background-color: #0D0D0D; }

.dark .print .table thead {
    background: #0D0D0D; }

.dark .or-detail {
    background: #0D0D0D;
    border-color: #212532; }

.dark .or-detail .ttl-amt {
      border-color: #212532; }

.dark .subscriber-detail .iq-card-btn {
    border-color: #0D0D0D; }

.dark .iq-accordion.career-style .iq-accordion-block .accordion-title span {
    color: #676E8A; }

.dark .iq-accordion.career-style .iq-accordion-block .accordion-title:before {
    color: #676E8A; }

.dark .iq-progress-bar.progress-bar-vertical > span:after {
    background: #0D0D0D; }

.dark .chat-data {
    background: #0D0D0D; }

.dark span.iq-start-icon {
    background: #0D0D0D; }

.dark .chat-button {
    background: #0D0D0D;
    color: #676E8A; }

.dark .chat-head .bg-white {
    background: #0D0D0D !important;
    color: #676E8A !important; }

.dark .chat-footer.bg-white {
    background: #0D0D0D !important;
    color: #676E8A !important; }

.dark .chat-content .chat-left .chat-message {
    background: #0D0D0D; }

.dark .iq-chat-ui .nav-pills li a.active {
    background-color: #0D0D0D; }

.dark ul.todo-task-lists li.active-task {
    background: #0D0D0D; }

.dark ul.todo-task-lists li:hover {
    background: #0D0D0D; }

.dark .iq-todo-page ul li a {
    color: #676E8A; }

.dark .add-new-project > a {
    color: #676E8A; }

.dark .chat-sidebar-channel h5 {
    border-color: #212532; }

.dark .iq-chat-ui li a {
    border-color: #212532; }

.dark .iq-email-listbox .iq-email-sender-list > li {
    border-color: #212532; }

.dark .iq-email-listbox .iq-email-sender-list > li:hover {
      background: #0D0D0D; }

.dark .iq-email-listbox .iq-email-sender-list .iq-social-media {
    background: #0D0D0D; }

.dark .email-app-details {
    background-color: #0D0D0D; }

.dark .profile-overly {
    background: #0D0D0D; }

.dark .light-title .card-title {
    color: #47B4AC; }

.dark .view-crm a {
    color: #fff; }

.dark .crm2 .feature-list {
    background-color: #0D0D0D; }

.dark .crm2 .title-text {
    color: #fff; }

.dark .crm2 .card-score {
    background: #0D0D0D; }

.dark .crm2 .crm-p-image {
    border-color: #0D0D0D; }

.dark .iq-social-icon a {
    color: #676E8A; }

.dark .iq-acivity span {
    background: #0D0D0D; }

.dark .iq-acivity:after {
    border-top-color: #212532; }

.dark .search-menu-options .form-control {
    background: #0D0D0D; }

.dark .search-menu-options .iq-search-bar .search-input {
    background: #0D0D0D; }

.dark .floating-input:focus ~ label {
    background: #0D0D0D; }

.dark .floating-input:not(:placeholder-shown) ~ label {
    background: #0D0D0D;
    color: #676E8A; }

.dark svg tspan {
    fill: #676E8A; }

.dark .highcharts-background {
    fill: #0D0D0D; }

.dark .jvectormap-container {
    background: #0D0D0D !important; }

.dark .change-mode .custom-switch.custom-switch-icon label.custom-control-label:after {
    border-radius: 0 5px 5px 0;
    left: 10px; }

.dark .change-mode .custom-switch.custom-switch-icon label.custom-control-label .switch-icon-right {
    z-index: 9; }

.dark .reporting_table tbody tr {
    border-bottom: 10px solid #222;
    background-color: #171717; }

.dark .dashboard2-header-style .analytic {
    background: #0D0D0D;
    width: 100%; }

.dark .iq-menu-horizontal .iq-sidebar-menu .iq-menu li ul {
    background: #222; }

.dark .flatpickr-day.nextMonthDay {
    color: #737B8E; }

.dark .dashboard3-fixed-menu .dashboard3-info {
    background: #0D0D0D !important; }

@media (min-width: 1300px) {
  .dark .white-bg-menu {
    background: #0D0D0D; }
  .dark .dashboard2-header-style .bg-analytic-horizontal {
    background: transparent; }
  .dark .header-style-1 .iq-menu-horizontal .iq-sidebar-menu .iq-menu > li > a {
    color: #fff; }
    .dark .header-style-1 .iq-menu-horizontal .iq-sidebar-menu .iq-menu > li > a > span {
      color: #fff; }
  .dark.salon-2-saidbar-main .iq-menu-horizontal .iq-sidebar-menu .iq-menu li > a {
    color: #fff; }
    .dark.salon-2-saidbar-main .iq-menu-horizontal .iq-sidebar-menu .iq-menu li > a > span {
      color: #fff; }
  .dark.salon-2-saidbar-main .iq-menu-horizontal .iq-sidebar-menu .iq-menu li li:hover > a {
    color: #47B473; }
    .dark.salon-2-saidbar-main .iq-menu-horizontal .iq-sidebar-menu .iq-menu li li:hover > a > span {
      color: #47B473; }
  .dark.tab-horizontal .top-menu .iq-sidebar-menu .iq-menu > li > a {
    color: #fff; }
    .dark.tab-horizontal .top-menu .iq-sidebar-menu .iq-menu > li > a > span {
      color: #fff; }
  .dark.tab-horizontal .top-menu .iq-sidebar-menu .iq-menu > li:hover > a {
    color: #fff; }
    .dark.tab-horizontal .top-menu .iq-sidebar-menu .iq-menu > li:hover > a > span {
      color: #fff; }
  .dark.tab-horizontal .top-menu .iq-sidebar-menu .iq-menu li.active > a {
    color: #fff; }
    .dark.tab-horizontal .top-menu .iq-sidebar-menu .iq-menu li.active > a > span {
      color: #fff; } }

@media (max-width: 1299px) {
  .dark .iq-menu-horizontal {
    background: #0D0D0D; }
    .dark .iq-menu-horizontal ul.iq-menu {
      background: #0D0D0D; } }

@media (max-width: 991px) {
  .dark .navbar-collapse {
    background: #0D0D0D; } }

.card-body.meeting-body {
  padding: 50px 0px; }

.tooltip-inner {
  max-width: 200px;
  padding: .25rem .5rem;
  color: #ffffff;
  text-align: center;
  background-color: #444444;
  border-radius: 5px; }

.tooltip .arrow {
  display: none; }

.content-box {
  height: calc(100vh - 225px);
  overflow-y: scroll;
  position: relative;
  overflow-x: hidden; }

.edit-one {
  position: absolute;
  left: auto;
  right: 30px;
  top: 48px; }

.edit-two {
  position: absolute;
  left: auto;
  right: 30px;
  margin-top: -37px; }

.CodeMirror-composing {
 border-bottom:2px solid
}

div.CodeMirror span.CodeMirror-matchingbracket {
 color:#0f0
}

div.CodeMirror span.CodeMirror-nonmatchingbracket {
 color:#f22
}

.CodeMirror-matchingtag {
 background:rgba(255,150,0,.3)
}

.CodeMirror-activeline-background {
 background:#e8f2ff
}

.CodeMirror {
 position:relative;
 overflow:hidden;
 background:#fff
}

.CodeMirror-scroll {
 overflow:scroll!important;
 margin-bottom:-30px;
 margin-right:-30px;
 padding-bottom:30px;
 height:100%;
 outline:0;
 position:relative
}

.CodeMirror-sizer {
 position:relative;
 border-right:30px solid transparent
}

.CodeMirror-gutter-filler,
.CodeMirror-hscrollbar,
.CodeMirror-scrollbar-filler,
.CodeMirror-vscrollbar {
 position:absolute;
 z-index:6;
 display:none
}

.CodeMirror-vscrollbar {
 right:0;
 top:0;
 overflow-x:hidden;
 overflow-y:scroll
}

.CodeMirror-hscrollbar {
 bottom:0;
 left:0;
 overflow-y:hidden;
 overflow-x:scroll
}

.CodeMirror-scrollbar-filler {
 right:0;
 bottom:0
}

.CodeMirror-gutter-filler {
 left:0;
 bottom:0
}

.CodeMirror-gutters {
 position:absolute;
 left:0;
 top:0;
 min-height:100%;
 z-index:3
}

.CodeMirror-gutter {
 white-space:normal;
 height:100%;
 display:inline-block;
 vertical-align:top;
 margin-bottom:-30px
}

.CodeMirror-gutter-wrapper {
 position:absolute;
 z-index:4;
 background:0 0!important;
 border:none!important;
 -webkit-user-select:none;
         user-select:none
}

.CodeMirror-gutter-background {
 position:absolute;
 top:0;
 bottom:0;
 z-index:4
}

.CodeMirror-gutter-elt {
 position:absolute;
 cursor:default;
 z-index:4
}

.CodeMirror-lines {
 cursor:text;
 min-height:1px
}

.CodeMirror pre {
 border-radius:0;
 border-width:0;
 background:0 0;
 font-family:inherit;
 font-size:inherit;
 margin:0;
 white-space:pre;
 word-wrap:normal;
 line-height:inherit;
 color:inherit;
 z-index:2;
 position:relative;
 overflow:visible;
 font-variant-ligatures:none
}

.CodeMirror-wrap pre {
 word-wrap:break-word;
 white-space:pre-wrap;
 word-break:normal
}

.CodeMirror-linebackground {
 position:absolute;
 left:0;
 right:0;
 top:0;
 bottom:0;
 z-index:0
}

.CodeMirror-linewidget {
 position:relative;
 z-index:2;
 overflow:auto
}

.CodeMirror-code {
 outline:0
}

.CodeMirror-gutter,
.CodeMirror-gutters,
.CodeMirror-linenumber,
.CodeMirror-scroll,
.CodeMirror-sizer {
 box-sizing:content-box
}

.CodeMirror-measure {
 position:absolute;
 width:100%;
 height:0;
 overflow:hidden;
 visibility:hidden
}

.CodeMirror-cursor {
 position:absolute;
 pointer-events:none
}

.CodeMirror-measure pre {
 position:static
}

div.CodeMirror-cursors {
 visibility:hidden;
 position:relative;
 z-index:3
}

.CodeMirror-focused div.CodeMirror-cursors,
div.CodeMirror-dragcursors {
 visibility:visible
}

.CodeMirror-selected {
 background:#d9d9d9
}

.CodeMirror-focused .CodeMirror-selected,
.CodeMirror-line::selection,
.CodeMirror-line>span::selection,
.CodeMirror-line>span>span::selection {
 background:#d7d4f0
}

.CodeMirror-crosshair {
 cursor:crosshair
}

.CodeMirror-line::-moz-selection,
.CodeMirror-line>span::-moz-selection,
.CodeMirror-line>span>span::-moz-selection {
 background:#d7d4f0
}

.cm-searching {
 background:#ffa;
 background:rgba(255,255,0,.4)
}

.cm-force-border {
 padding-right:.1px
}

@media print {
 .CodeMirror div.CodeMirror-cursors {
  visibility:hidden
 }
}

.cm-tab-wrap-hack:after {
 content:''
}

span.CodeMirror-selectedtext {
 background:0 0
}

.syntaxhighlighter a,
.syntaxhighlighter code,
.syntaxhighlighter div,
.syntaxhighlighter table,
.syntaxhighlighter table caption,
.syntaxhighlighter table tbody,
.syntaxhighlighter table td,
.syntaxhighlighter table thead,
.syntaxhighlighter table tr,
.syntaxhighlighter textarea {
 -moz-border-radius:0!important;
 -webkit-border-radius:0!important;
 background:0 0!important;
 border:0!important;
 bottom:auto!important;
 float:none!important;
 height:auto!important;
 left:auto!important;
 line-height:1.1em!important;
 margin:0!important;
 outline:0!important;
 overflow:visible!important;
 padding:0!important;
 position:static!important;
 right:auto!important;
 text-align:left!important;
 top:auto!important;
 vertical-align:baseline!important;
 width:auto!important;
 box-sizing:content-box!important;
 font-family:Consolas,"Bitstream Vera Sans Mono","Courier New",Courier,monospace!important;
 font-weight:400!important;
 font-style:normal!important;
 font-size:1em!important;
 min-height:inherit!important;
 min-height:auto!important
}

.cropping-preview,
.cropping-preview-wrap,
.fc-ltr .fc-popover .fc-header .fc-title,
.fc-rtl .fc-popover .fc-header .fc-close {
 float:left
}

.syntaxhighlighter,
.syntaxhighlighter table td.code .container {
 position:relative!important
}

.syntaxhighlighter,
.syntaxhighlighter table,
.syntaxhighlighter table td.code {
 width:100%!important
}

.syntaxhighlighter .bold,
.syntaxhighlighter .keyword,
.syntaxhighlighter .script,
.syntaxhighlighter.printing .script {
 font-weight:700!important
}

.syntaxhighlighter {
 margin:1em 0!important;
 overflow:auto!important;
 font-size:1em!important
}

.syntaxhighlighter.source {
 overflow:hidden!important
}

.syntaxhighlighter .italic {
 font-style:italic!important
}

.syntaxhighlighter .line {
 white-space:pre!important
}

.syntaxhighlighter table caption {
 text-align:left!important;
 padding:.5em 0 .5em 1em!important
}

.syntaxhighlighter table td.code .container textarea {
 box-sizing:border-box!important;
 position:absolute!important;
 left:0!important;
 top:0!important;
 width:100%!important;
 height:100%!important;
 border:none!important;
 background:#fff!important;
 padding-left:1em!important;
 overflow:hidden!important;
 white-space:pre!important
}

.rickshaw_graph .detail .item.left,
.rickshaw_graph .detail .x_label.left {
 left:0
}

.syntaxhighlighter table td.gutter .line {
 text-align:right!important;
 padding:0 .5em 0 1em!important
}

.syntaxhighlighter table td.code .line {
 padding:0 1em!important
}

.syntaxhighlighter.nogutter td.code .container textarea,
.syntaxhighlighter.nogutter td.code .line {
 padding-left:0!important
}

.syntaxhighlighter.show {
 display:block!important
}

.syntaxhighlighter.collapsed table {
 display:none!important
}

.syntaxhighlighter.collapsed .toolbar {
 padding:.1em .8em 0!important;
 font-size:1em!important;
 position:static!important;
 width:auto!important;
 height:auto!important;
 display:none
}

.syntaxhighlighter.collapsed .toolbar span {
 display:inline!important;
 margin-right:1em!important
}

.syntaxhighlighter.collapsed .toolbar span a {
 padding:0!important;
 display:none!important
}

.syntaxhighlighter.collapsed .toolbar span a.expandSource {
 display:inline!important
}

.syntaxhighlighter .toolbar {
 position:absolute!important;
 right:1px!important;
 top:1px!important;
 width:11px!important;
 height:11px!important;
 font-size:10px!important;
 z-index:10!important;
 display:none
}

.rickshaw_graph .detail .item.right,
.rickshaw_graph .detail .x_label.right {
 right:0
}

.syntaxhighlighter .toolbar span.title {
 display:inline!important
}

.syntaxhighlighter .toolbar a {
 display:block!important;
 text-align:center!important;
 padding-top:1px!important
}

.syntaxhighlighter .toolbar a.expandSource,
.syntaxhighlighter.printing .toolbar {
 display:none!important
}

.syntaxhighlighter.ie {
 font-size:.9em!important;
 padding:1px 0!important
}

.syntaxhighlighter.ie .toolbar {
 line-height:8px!important
}

.syntaxhighlighter.ie .toolbar a {
 padding-top:0!important
}

.syntaxhighlighter.printing .line.alt1 .content,
.syntaxhighlighter.printing .line.alt2 .content,
.syntaxhighlighter.printing .line.highlighted .number,
.syntaxhighlighter.printing .line.highlighted.alt1 .content,
.syntaxhighlighter.printing .line.highlighted.alt2 .content {
 background:0 0!important
}

.syntaxhighlighter.printing .line .number {
 color:#bbb!important
}

.syntaxhighlighter.printing .line .content,
.syntaxhighlighter.printing .plain,
.syntaxhighlighter.printing .plain a {
 color:#000!important
}

.syntaxhighlighter.printing .comments,
.syntaxhighlighter.printing .comments a {
 color:#008200!important
}

.syntaxhighlighter.printing .string,
.syntaxhighlighter.printing .string a {
 color:#00f!important
}

.syntaxhighlighter.printing .keyword {
 color:#069!important;
 font-weight:700!important
}

.syntaxhighlighter.printing .preprocessor {
 color:gray!important
}

.syntaxhighlighter.printing .variable {
 color:#a70!important
}

.syntaxhighlighter.printing .value {
 color:#090!important
}

.syntaxhighlighter.printing .functions {
 color:#ff1493!important
}

.syntaxhighlighter.printing .constants {
 color:#06c!important
}

.syntaxhighlighter.printing .color1,
.syntaxhighlighter.printing .color1 a {
 color:gray!important
}

.syntaxhighlighter.printing .color2,
.syntaxhighlighter.printing .color2 a {
 color:#ff1493!important
}

.syntaxhighlighter.printing .color3,
.syntaxhighlighter.printing .color3 a {
 color:red!important
}

.syntaxhighlighter .line.highlighted.number,
.syntaxhighlighter table caption,
.syntaxhighlighter.printing .break,
.syntaxhighlighter.printing .break a {
 color:#000!important
}

.syntaxhighlighter,
.syntaxhighlighter .line.alt1,
.syntaxhighlighter .line.alt2 {
 background-color:#fff!important
}

.syntaxhighlighter .line.highlighted.alt1,
.syntaxhighlighter .line.highlighted.alt2 {
 background-color:#e0e0e0!important
}

.syntaxhighlighter .gutter {
 color:#afafaf!important
}

.syntaxhighlighter .gutter .line {
 border-right:1px solid #DBE0E4!important
}

.syntaxhighlighter .gutter .line.highlighted {
 background-color:#6ce26c!important;
 color:#fff!important
}

.syntaxhighlighter.printing .line .content {
 border:none!important
}

.syntaxhighlighter.collapsed {
 overflow:visible!important
}

.cropper-view-box,
.cropper-wrap-box,
.cropping-preview,
.fc-icon {
 overflow:hidden
}

.syntaxhighlighter.collapsed .toolbar {
 color:#00f!important;
 background:#fff!important;
 border:1px solid #6ce26c!important
}

.syntaxhighlighter.collapsed .toolbar a {
 color:#00f!important
}

.syntaxhighlighter.collapsed .toolbar a:hover {
 color:red!important
}

.syntaxhighlighter .toolbar {
 color:#fff!important;
 background:#6ce26c!important;
 border:none!important
}

.syntaxhighlighter .toolbar a {
 color:#fff!important
}

.syntaxhighlighter .plain,
.syntaxhighlighter .plain a,
.syntaxhighlighter .toolbar a:hover {
 color:#000!important
}

.syntaxhighlighter .comments,
.syntaxhighlighter .comments a {
 color:#008200!important
}

.syntaxhighlighter .string,
.syntaxhighlighter .string a {
 color:#00f!important
}

.syntaxhighlighter .keyword {
 color:#069!important
}

.syntaxhighlighter .preprocessor {
 color:gray!important
}

.syntaxhighlighter .variable {
 color:#a70!important
}

.syntaxhighlighter .value {
 color:#090!important
}

.syntaxhighlighter .functions {
 color:#ff1493!important
}

.syntaxhighlighter .constants {
 color:#06c!important
}

.syntaxhighlighter .script {
 color:#069!important;
 background-color:none!important
}

.syntaxhighlighter .color1,
.syntaxhighlighter .color1 a {
 color:gray!important
}

.syntaxhighlighter .color2,
.syntaxhighlighter .color2 a {
 color:#ff1493!important
}

.syntaxhighlighter .color3,
.syntaxhighlighter .color3 a {
 color:red!important
}

.morris-hover {
 position:absolute;
 z-index:1000
}

.morris-hover.morris-default-style {
 border-radius:10px;
 padding:6px;
 color:#666;
 background:rgba(255,255,255,.9);
 border:1px solid rgba(230,230,230,.9);
 font-family:sans-serif;
 font-size:12px;
 text-align:center
}

.morris-hover.morris-default-style .morris-hover-row-label {
 font-weight:700;
 margin:.25em 0
}

.morris-hover.morris-default-style .morris-hover-point {
 white-space:nowrap;
 margin:.1em 0
}

.rickshaw_graph .detail {
 pointer-events:none;
 position:absolute;
 top:0;
 z-index:2;
 background:rgba(0,0,0,.1);
 bottom:0;
 width:1px;
 transition:opacity .25s linear;
 -moz-transition:opacity .25s linear;
 -o-transition:opacity .25s linear;
 -webkit-transition:opacity .25s linear
}

.rickshaw_graph .detail.inactive {
 opacity:0
}

.rickshaw_graph .detail .item.active {
 opacity:1
}

.rickshaw_graph .detail .x_label,
.rickshaw_graph .x_tick .title {
 font-family:Arial,sans-serif;
 opacity:.5;
 font-size:12px;
 white-space:nowrap
}

.rickshaw_graph .detail .x_label {
 border-radius:3px;
 padding:6px;
 border:1px solid #e0e0e0;
 position:absolute;
 background:#fff
}

.rickshaw_graph .detail .item {
 position:absolute;
 z-index:2;
 border-radius:3px;
 padding:.25em;
 font-size:12px;
 font-family:Arial,sans-serif;
 opacity:0;
 background:rgba(0,0,0,.4);
 color:#fff;
 border:1px solid rgba(0,0,0,.4);
 margin-left:1em;
 margin-right:1em;
 margin-top:-1em;
 white-space:nowrap
}

.rickshaw_graph .detail .item.active {
 background:rgba(0,0,0,.8)
}

.rickshaw_graph .detail .item:after {
 position:absolute;
 display:block;
 width:0;
 height:0;
 content:"";
 border:5px solid transparent
}

.rickshaw_graph .detail .item.left:after {
 top:1em;
 left:-5px;
 margin-top:-5px;
 border-right-color:rgba(0,0,0,.8);
 border-left-width:0
}

.rickshaw_graph .detail .item.right:after {
 top:1em;
 right:-5px;
 margin-top:-5px;
 border-left-color:rgba(0,0,0,.8);
 border-right-width:0
}

.rickshaw_graph .detail .dot {
 width:4px;
 height:4px;
 margin-left:-3px;
 margin-top:-3.5px;
 border-radius:5px;
 position:absolute;
 box-shadow:0 0 2px rgba(0,0,0,.6);
 box-sizing:content-box;
 -moz-box-sizing:content-box;
 background:#fff;
 border-width:2px;
 border-style:solid;
 display:none;
 background-clip:padding-box
}

.rickshaw_graph .detail .dot.active {
 display:block
}

.rickshaw_graph {
 position:relative
}

.rickshaw_graph svg {
 display:block;
 overflow:hidden
}

.rickshaw_graph .x_tick {
 position:absolute;
 top:0;
 bottom:0;
 width:0;
 border-left:1px dotted rgba(0,0,0,.2);
 pointer-events:none
}

.rickshaw_graph .x_tick .title {
 position:absolute;
 margin-left:3px;
 bottom:1px
}

.rickshaw_annotation_timeline {
 height:1px;
 border-top:1px solid #e0e0e0;
 margin-top:10px;
 position:relative
}

.rickshaw_annotation_timeline .annotation {
 position:absolute;
 height:6px;
 width:6px;
 margin-left:-2px;
 top:-3px;
 border-radius:5px;
 background-color:rgba(0,0,0,.25)
}

.rickshaw_graph .annotation_line {
 position:absolute;
 top:0;
 bottom:-6px;
 width:0;
 border-left:2px solid rgba(0,0,0,.3);
 display:none
}

.rickshaw_graph .annotation_line.active {
 display:block
}

.rickshaw_graph .annotation_range {
 background:rgba(0,0,0,.1);
 display:none;
 position:absolute;
 top:0;
 bottom:-6px
}

.rickshaw_graph .annotation_range.active {
 display:block
}

.rickshaw_graph .annotation_range.active.offscreen {
 display:none
}

.rickshaw_annotation_timeline .annotation .content {
 background:#fff;
 color:#000;
 opacity:.9;
 box-shadow:0 0 2px rgba(0,0,0,.8);
 border-radius:3px;
 position:relative;
 z-index:20;
 font-size:12px;
 padding:6px 8px 8px;
 top:18px;
 left:-11px;
 width:160px;
 display:none;
 cursor:pointer
}

.rickshaw_annotation_timeline .annotation .content:before {
 content:"\25b2";
 position:absolute;
 top:-11px;
 color:#fff;
 text-shadow:0 -1px 1px rgba(0,0,0,.8)
}

.rickshaw_annotation_timeline .annotation.active,
.rickshaw_annotation_timeline .annotation:hover {
 background-color:rgba(0,0,0,.8);
 cursor:none
}

.rickshaw_annotation_timeline .annotation .content:hover {
 z-index:50
}

.rickshaw_annotation_timeline .annotation.active .content {
 display:block
}

.rickshaw_annotation_timeline .annotation:hover .content {
 display:block;
 z-index:50
}

.rickshaw_graph .x_axis_d3,
.rickshaw_graph .y_axis {
 fill:none
}

.rickshaw_graph .x_ticks_d3 .tick,
.rickshaw_graph .y_ticks .tick line {
 stroke:rgba(0,0,0,.16);
 stroke-width:0;
 shape-rendering:crisp-edges;
 pointer-events:none
}

.rickshaw_graph .x_grid_d3 .tick,
.rickshaw_graph .y_grid .tick {
 z-index:-1;
 stroke:rgba(0,0,0,.2);
 stroke-width:1px;
 stroke-dasharray:1 1
}

.rickshaw_graph .y_grid .tick[data-y-value="0"] {
 stroke-dasharray:1 0
}

.rickshaw_graph .x_grid_d3 path,
.rickshaw_graph .y_grid path {
 fill:none;
 stroke:none
}

.rickshaw_graph .x_ticks_d3 path,
.rickshaw_graph .y_ticks path {
 fill:none;
 stroke:#DDD
}

.rickshaw_graph .x_ticks_d3 text,
.rickshaw_graph .y_ticks text {
 opacity:.5;
 font-size:12px;
 pointer-events:none
}

.rickshaw_graph .x_tick.glow .title,
.rickshaw_graph .y_ticks.glow text {
 fill:#000;
 color:#000;
 text-shadow:-1px 1px 0 rgba(255,255,255,.1),1px -1px 0 rgba(255,255,255,.1),1px 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1),0 -1px 0 rgba(255,255,255,.1),1px 0 0 rgba(255,255,255,.1),-1px 0 0 rgba(255,255,255,.1),-1px -1px 0 rgba(255,255,255,.1)
}

.rickshaw_graph .x_tick.inverse .title,
.rickshaw_graph .y_ticks.inverse text {
 fill:#fff;
 color:#fff;
 text-shadow:-1px 1px 0 rgba(0,0,0,.8),1px -1px 0 rgba(0,0,0,.8),1px 1px 0 rgba(0,0,0,.8),0 1px 0 rgba(0,0,0,.8),0 -1px 0 rgba(0,0,0,.8),1px 0 0 rgba(0,0,0,.8),-1px 0 0 rgba(0,0,0,.8),-1px -1px 0 rgba(0,0,0,.8)
}

.rickshaw_legend {
 font-family:Arial;
 font-size:12px;
 color:#fff;
 display:inline-block;
 padding:12px 5px;
 border-radius:2px;
 position:relative
}

.rickshaw_legend:hover {
 z-index:10
}

.rickshaw_legend .swatch {
 width:10px;
 height:10px;
 border:1px solid rgba(0,0,0,.2)
}

.rickshaw_legend .line {
 clear:both;
 line-height:140%;
 padding-right:15px
}

.rickshaw_legend .line .swatch {
 display:inline-block;
 margin-right:3px;
 border-radius:2px
}

.rickshaw_legend .label {
 margin:0;
 white-space:nowrap;
 display:inline;
 font-size:inherit;
 background-color:transparent;
 font-weight:400;
 line-height:normal;
 padding:0;
 text-shadow:none
}

.rickshaw_legend .action:hover {
 opacity:.6
}

.rickshaw_legend .action {
 margin-right:.2em;
 opacity:.2;
 cursor:pointer;
 font-size:14px
}

.rickshaw_legend .line.disabled {
 opacity:.4
}

.rickshaw_legend ul {
 list-style-type:none;
 padding:0;
 margin:2px;
 cursor:pointer
}

.rickshaw_legend li {
 padding:0 0 0 2px;
 min-width:80px;
 white-space:nowrap
}

.rickshaw_legend li:hover {
 background:rgba(255,255,255,.08);
 border-radius:3px
}

.rickshaw_legend li:active {
 background:rgba(255,255,255,.2);
 border-radius:3px
}

/*!
 * Cropper v2.3.3
 * https://github.com/fengyuanchen/cropper
 *
 * Copyright (c) 2014-2016 Fengyuan Chen and contributors
 * Released under the MIT license
 *
 * Date: 2016-08-10T08:58:55.176Z
 */

.cropper-container {
 font-size:0;
 line-height:0;
 position:relative;
 -webkit-user-select:none;
         user-select:none;
 direction:ltr!important
}

.fc-icon,
body .fc {
 font-size:1em
}

.fc-icon,
.fc-unselectable,
.irs {
 -webkit-user-select:none
}

.cropper-container img {
 display:block;
 width:100%;
 min-width:0!important;
 max-width:none!important;
 height:100%;
 min-height:0!important;
 max-height:none!important;
 image-orientation:0deg!important
}

.cropper-canvas,
.cropper-crop-box,
.cropper-drag-box,
.cropper-modal,
.cropper-wrap-box {
 position:absolute;
 top:0;
 right:0;
 bottom:0;
 left:0
}

.cropper-drag-box {
 opacity:0;
 background-color:#fff;
 filter:alpha(opacity=0)
}

.cropper-dashed,
.cropper-modal {
 opacity:.5;
 filter:alpha(opacity=50)
}

.cropper-modal {
 background-color:#000
}

.cropper-view-box {
 display:block;
 width:100%;
 height:100%;
 outline:#39f solid 1px;
 outline-color:rgba(51,153,255,.75)
}

.cropper-dashed {
 position:absolute;
 display:block;
 border:0 dashed #eee
}

.cropper-dashed.dashed-h {
 top:33.33333%;
 left:0;
 width:100%;
 height:33.33333%;
 border-top-width:1px;
 border-bottom-width:1px
}

.cropper-dashed.dashed-v {
 top:0;
 left:33.33333%;
 width:33.33333%;
 height:100%;
 border-right-width:1px;
 border-left-width:1px
}

.cropping-image-wrap,
.cropping-preview-wrap {
 padding:2px;
 border:1px solid #DBE0E4
}

.cropper-center {
 position:absolute;
 top:50%;
 left:50%;
 display:block;
 width:0;
 height:0;
 opacity:.75;
 filter:alpha(opacity=75)
}

.cropper-center:after,
.cropper-center:before {
 position:absolute;
 display:block;
 content:' ';
 background-color:#eee
}

.cropper-center:before {
 top:0;
 left:-3px;
 width:7px;
 height:1px
}

.cropper-center:after {
 top:-3px;
 left:0;
 width:1px;
 height:7px
}

.cropper-face,
.cropper-line,
.cropper-point {
 position:absolute;
 display:block;
 width:100%;
 height:100%;
 opacity:.1;
 filter:alpha(opacity=10)
}

.cropper-face {
 top:0;
 left:0;
 background-color:#fff
}

.cropper-line,
.cropper-point {
 background-color:#39f
}

.cropper-line.line-e {
 top:0;
 right:-3px;
 width:5px;
 cursor:e-resize
}

.cropper-line.line-n {
 top:-3px;
 left:0;
 height:5px;
 cursor:n-resize
}

.cropper-line.line-w {
 top:0;
 left:-3px;
 width:5px;
 cursor:w-resize
}

.cropper-line.line-s {
 bottom:-3px;
 left:0;
 height:5px;
 cursor:s-resize
}

.cropper-point {
 width:5px;
 height:5px;
 opacity:.75;
 filter:alpha(opacity=75)
}

.cropper-point.point-e {
 top:50%;
 right:-3px;
 margin-top:-3px;
 cursor:e-resize
}

.cropper-point.point-n {
 top:-3px;
 left:50%;
 margin-left:-3px;
 cursor:n-resize
}

.cropper-point.point-w {
 top:50%;
 left:-3px;
 margin-top:-3px;
 cursor:w-resize
}

.cropper-point.point-s {
 bottom:-3px;
 left:50%;
 margin-left:-3px;
 cursor:s-resize
}

.cropper-point.point-ne {
 top:-3px;
 right:-3px;
 cursor:ne-resize
}

.cropper-point.point-nw {
 top:-3px;
 left:-3px;
 cursor:nw-resize
}

.cropper-point.point-sw {
 bottom:-3px;
 left:-3px;
 cursor:sw-resize
}

.cropper-point.point-se {
 right:-3px;
 bottom:-3px;
 width:20px;
 height:20px;
 cursor:se-resize;
 opacity:1;
 filter:alpha(opacity=100)
}

.cropper-point.point-se:before {
 position:absolute;
 right:-50%;
 bottom:-50%;
 display:block;
 width:200%;
 height:200%;
 content:' ';
 opacity:0;
 background-color:#39f;
 filter:alpha(opacity=0)
}

.fc-bg,
.fc-row .fc-bgevent-skeleton,
.fc-row .fc-highlight-skeleton {
 bottom:0
}

@media (min-width:768px) {
 .cropper-point.point-se {
  width:15px;
  height:15px
 }
}

@media (min-width:992px) {
 .cropper-point.point-se {
  width:10px;
  height:10px
 }
}

@media (min-width:1200px) {
 .cropper-point.point-se {
  width:5px;
  height:5px;
  opacity:.75;
  filter:alpha(opacity=75)
 }
}

.cropper-invisible {
 opacity:0;
 filter:alpha(opacity=0)
}

.fc-bgevent,
.fc-highlight {
 opacity:.3;
 filter:alpha(opacity=30)
}

.cropper-bg {
 background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQAQMAAAAlPW0iAAAAA3NCSVQICAjb4U/gAAAABlBMVEXMzMz////TjRV2AAAACXBIWXMAAArrAAAK6wGCiw1aAAAAHHRFWHRTb2Z0d2FyZQBBZG9iZSBGaXJld29ya3MgQ1M26LyyjAAAABFJREFUCJlj+M/AgBVhF/0PAH6/D/HkDxOGAAAAAElFTkSuQmCC)
}

.cropper-hide {
 position:absolute;
 display:block;
 width:0;
 height:0
}

.cropper-hidden {
 display:none!important
}

.fc-button-group,
.fc-icon {
 display:inline-block
}

.cropper-move {
 cursor:move
}

.cropper-crop {
 cursor:crosshair
}

.cropper-disabled .cropper-drag-box,
.cropper-disabled .cropper-face,
.cropper-disabled .cropper-line,
.cropper-disabled .cropper-point {
 cursor:not-allowed
}

.cropping-preview {
 background:#f7f7f7;
 width:100px;
 height:100px
}

/* Using a url */

.header_top_new {
  background-color: #f6f8fb;
}

.list_new_phs1 ul {
  margin: 0px;
  padding: 0px;
}

.loader12 {
  width: 40px;
  height: 40px;
  border-radius: 100%;
  position: relative;
  margin: 0 auto;
  left: 10px;
  top: 9px;
}

.loader {
  width: 20px;
  height: 20px;
  border-radius: 100%;
  position: relative;
  margin: 0 auto;
  left: 10px;

  top: 9px;
}

/* LOADER 1 */

.loader-1:before,
.loader-1:after {
  content: "";
  position: absolute;
  top: -10px;
  left: -10px;
  width: 100%;
  height: 100%;
  border-radius: 100%;
  border: 3px solid transparent;
  border-top-color: #3498db;
}

.loader-1:before {
  z-index: 100;
  animation: spin 1s infinite;
}

.loader-1:after {
  border: 3px solid white;
}

@keyframes spin {
  0% {
    transform: rotate(0deg);
  }

  100% {
    transform: rotate(360deg);
  }
}

/* LOADER 2 */

.loader-2 span {
  display: inline-block;
  width: 20px;
  height: 20px;
  border-radius: 100%;
  background-color: #3498db;
  margin: 35px 5px;
}

.loader-2 span:nth-child(1) {
  animation: bounce 1s ease-in-out infinite;
}

.loader-2 span:nth-child(2) {
  animation: bounce 1s ease-in-out 0.33s infinite;
}

.loader-2 span:nth-child(3) {
  animation: bounce 1s ease-in-out 0.66s infinite;
}

@keyframes bounce {
  0%,
  75%,
  100% {
    transform: translateY(0);
  }

  25% {
    transform: translateY(-20px);
  }
}

/* LOADER 3 */

.loader-3:before,
.loader-3:after {
  content: "";
  width: 20px;
  height: 20px;
  position: absolute;
  top: 0;
  left: calc(50% - 10px);
  background-color: #3498db;
  animation: squaremove 1s ease-in-out infinite;
}

.loader-3:after {
  bottom: 0;
  animation-delay: 0.5s;
}

@keyframes squaremove {
  0%,
  100% {
    transform: translate(0, 0) rotate(0);
  }

  25% {
    transform: translate(40px, 40px) rotate(45deg);
  }

  50% {
    transform: translate(0px, 80px) rotate(0deg);
  }

  75% {
    transform: translate(-40px, 40px) rotate(45deg);
  }
}

/* LOADER 4 */

.loader-4 span {
  display: inline-block;
  width: 20px;
  height: 20px;
  border-radius: 100%;
  background-color: #3498db;
  margin: 35px 5px;
  opacity: 0;
}

.loader-4 span:nth-child(1) {
  animation: opacitychange 1s ease-in-out infinite;
}

.loader-4 span:nth-child(2) {
  animation: opacitychange 1s ease-in-out 0.33s infinite;
}

.loader-4 span:nth-child(3) {
  animation: opacitychange 1s ease-in-out 0.66s infinite;
}

@keyframes opacitychange {
  0%,
  100% {
    opacity: 0;
  }

  60% {
    opacity: 1;
  }
}

/* LOADER 5 */

.loader-5 span {
  display: block;
  position: absolute;
  left: calc(50% - 20px);
  top: calc(50% - 20px);
  width: 20px;
  height: 20px;
  background-color: #3498db;
}

.loader-5 span:nth-child(2) {
  animation: moveanimation1 1s ease-in-out infinite;
}

.loader-5 span:nth-child(3) {
  animation: moveanimation2 1s ease-in-out infinite;
}

.loader-5 span:nth-child(4) {
  animation: moveanimation3 1s ease-in-out infinite;
}

@keyframes moveanimation1 {
  0%,
  100% {
    transform: translateX(0px);
  }

  75% {
    transform: translateX(30px);
  }
}

@keyframes moveanimation2 {
  0%,
  100% {
    transform: translateY(0px);
  }

  75% {
    transform: translateY(30px);
  }
}

@keyframes moveanimation3 {
  0%,
  100% {
    transform: translate(0px, 0px);
  }

  75% {
    transform: translate(30px, 30px);
  }
}

/* LOADER 6 */

.loader-6 {
  top: 40px;
  left: -2.5px;
}

.loader-6 span {
  display: inline-block;
  width: 5px;
  height: 20px;
  background-color: #3498db;
}

.loader-6 span:nth-child(1) {
  animation: grow 1s ease-in-out infinite;
}

.loader-6 span:nth-child(2) {
  animation: grow 1s ease-in-out 0.15s infinite;
}

.loader-6 span:nth-child(3) {
  animation: grow 1s ease-in-out 0.3s infinite;
}

.loader-6 span:nth-child(4) {
  animation: grow 1s ease-in-out 0.45s infinite;
}

@keyframes grow {
  0%,
  100% {
    transform: scaleY(1);
  }

  50% {
    transform: scaleY(1.8);
  }
}

/* LOADER 7 */

.loader-7 {
  -ms-perspective: 120px;
  perspective: 120px;
}

.loader-7:before {
  content: "";
  position: absolute;
  left: 25px;
  top: 25px;
  width: 50px;
  height: 50px;
  background-color: #3498db;
  animation: flip 1s infinite;
}

@keyframes flip {
  0% {
    transform: rotate(0);
  }

  50% {
    transform: rotateY(180deg);
  }

  100% {
    transform: rotateY(180deg) rotateX(180deg);
  }
}

/* LOADER 8 */

.loader-8:before {
  content: "";
  position: absolute;
  width: 10px;
  height: 10px;
  top: calc(50% - 10px);
  left: 0px;
  background-color: #3498db;
  animation: rotatemove 1s infinite;
}

@keyframes rotatemove {
  0% {
    transform: scale(1) translateX(0px);
  }

  100% {
    transform: scale(2) translateX(45px);
  }
}

.loader_body2 {
  background: rgba(0, 0, 0, 0.4) none repeat scroll 0% 0%;
  animation-duration: 0.4s;
  animation-delay: 0s;
  display: flex;
  position: fixed;
  z-index: 1060;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  flex-direction: row;
  align-items: center;
  justify-content: center;
  padding: 0.625em;
  overflow-x: hidden;
  transition: background-color 0.1s;
  -webkit-overflow-scrolling: touch;
}

.loader_body {
  background: rgba(0, 0, 0, 0.4) none repeat scroll 0% 0%;
  animation-duration: 0.4s;
  animation-delay: 0s;
  display: flex;
  position: fixed;
  z-index: 1060;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  flex-direction: row;
  align-items: center;
  justify-content: center;
  padding: 0.625em;
  overflow-x: hidden;
  transition: background-color 0.1s;
  -webkit-overflow-scrolling: touch;
}

.loader_body p {
  width: 100%;
  position: absolute;
}

.list_ul li {
  list-style: none;
  display: inline-block;
  margin-right: 15px;
  font-size: 14px;
}

.with-margin p {
  color: #000 !important;
}

.text-primary1 {
  color: #47b4ac !important;
}

.border-primary1 {
  border-color: #47b4ac !important;
}

.text-info1 {
  color: #1b98e0 !important;
}

.border-info1 {
  border: 1px solid #1b98e0 !important;
}

.bg-info2 {
  background-color: #ffad33;
  color: #fff !important;
}

.bg-light3 {
  background-color: #999;
  color: #fff !important;
}

.text-danger1 {
  color: #d75842 !important;
}

.border-danger1 {
  border: 1px solid #d75842 !important;
}

.text-secondary1 {
  color: #323c9c !important;
  font-size: 14px !important;
  font-weight: 600 !important;
}

.border-secondary1 {
  border: 1px solid #323c9c !important;
}

.bg-primary1 {
  color: #fff !important;
  background-color: #47b4ac !important;
}

.bg-success1 {
  color: #fff !important;
  background-color: #47b473 !important;
}

.bg-warning1 {
  color: #fff !important;
  background-color: #cca43b !important;
}

.bg-danger1 {
  color: #fff !important;
  background-color: #d75842 !important;
}

.bg-info1 {
  color: #fff !important;
  background-color: #1b98e0 !important;
}

.home_page_menu li:hover {
  background-color: rgb(65, 165, 157) !important;
  list-style: none;
  height: 160px;
  text-align: center;
  padding: 40px 0px;
}

.btn-primary:hover {
  color: #fff;
  background-color: rgb(164, 219, 215);
  border-color: rgb(164, 219, 215);
}

.btn-primary {
  color: #fff !important;
  background-image: linear-gradient(
    to right top,
    #008f7a,
    #219c87,
    #35aa94,
    #45b8a1,
    #55c6ae
  );
  /*background-color: #47B4AC !important;*/
  border: solid 2px #47b4ac !important;
}

.ashish_b_b {
  margin-top: 5px;
  border-top: 1px solid #ccc !important;
}

.list_new_phs1 li {
  list-style: none;
  text-align: center;
  display: inline-block;
}

.message_box p:hover {
  color: rgb(65, 165, 157) !important;
}

.badge-s {
  border: 1px solid #bec7fa !important;
  border-radius: 0px !important;
  margin-right: 5px;
}

.badge-f {
  border-right: 1px solid #ccc !important;
  border-top: 1px solid #ccc !important;
  border-bottom: 1px solid #ccc !important;
  border-radius: 0px !important;
  margin-right: 5px;
  border-left: 4px solid #ffabac !important;
  background-color: #fff;
  color: #e60003 !important;
}

.badge-d {
  border-right: 1px solid #ccc !important;
  border-top: 1px solid #ccc !important;
  border-bottom: 1px solid #ccc !important;
  border-radius: 0px !important;
  margin-right: 5px;
  border-left: 4px solid #47b473 !important;
  background-color: #fff;
  color: #47b473 !important;
}

.badge-se {
  border-right: 1px solid #ccc !important;
  border-top: 1px solid #ccc !important;
  border-bottom: 1px solid #ccc !important;
  border-radius: 0px !important;
  margin-right: 5px;
  border-left: 4px solid #5dade2 !important;
  background-color: #fff;
  color: #5dade2 !important;
}

.badge-rj {
  border-right: 1px solid #ccc !important;
  border-top: 1px solid #ccc !important;
  border-bottom: 1px solid #ccc !important;
  border-radius: 0px !important;
  margin-right: 5px;
  border-left: 4px solid #333 !important;
  background-color: #fff;
  color: #333 !important;
}

.badge-oth {
  border-right: 1px solid #ccc !important;
  border-top: 1px solid #ccc !important;
  border-bottom: 1px solid #ccc !important;
  border-radius: 0px !important;
  margin-right: 5px;
  border-left: 4px solid #7f8c8d !important;
  background-color: #fff;
  color: #7f8c8d !important;
}

.primary_as:hover {
  color: #fff;
  background-color: rgb(65, 165, 157) !important;
}

.btn-light:hover {
  color: #fff !important;
  background-color: rgb(65, 165, 157) !important;
}

.primary_as {
  color: #fff;
  /*	background-image: linear-gradient(to right top, #008f7a, #219c87, #35aa94, #45b8a1, #55c6ae);*/
  background-color: #47b4ac !important;
  border: solid 2px #47b4ac;
}

.header-info a:hover {
  color: #47b4ac;
}

.btn_as {
  cursor: pointer;
  display: inline-block !important;
  font-family: "Open Sans", sans-serif !important;
  font-weight: 400 !important;
  text-align: center !important;
  vertical-align: middle !important;
  -webkit-user-select: none !important;
          user-select: none !important;
  padding: 0.625rem 0.938rem !important;
  font-size: 0.875rem !important;
  line-height: 1.5 !important;
  border-radius: 0px !important;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out,
    border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out !important;
}

.h1,
.h2,
.h3,
.h4,
.h5,
.h6,
h1,
h2,
h3,
h4,
h5,
h6 {
  font-weight: 600 !important;
}

.Template_list_all .radio input {
  width: 600px;
  position: relative;
  z-index: 9999999999999;
  display: block;
  cursor: pointer;
  height: 23px;
  margin-left: -270px;
  margin-top: 5px;
}

.btn {
  margin: 0px 3px !important;
}

.top_animation_new h6 {
  top: 5px;

  position: relative;
  white-space: nowrap;
  animation: floatText 3s infinite alternate ease-in-out;
}

.waviy {
  text-align: center;
  position: relative;
  -webkit-box-reflect: below -20px linear-gradient(transparent, rgba(0, 0, 0, 0.2));
  font-size: 15px;
}

.waviy span {
  position: relative;
  display: inline-block;
  color: #000;
  margin-right: 5px;
  animation: waviy 4s infinite;
  animation-delay: calc(0.1s * var(--i));
}

@keyframes waviy {
  0%,
  40%,
  100% {
    transform: translateY(0);
  }
  20% {
    transform: translateY(-20px);
  }
}

.list_new_phs ul {
  margin: 0px;
  padding: 0px;
}

.list_new_phs li {
  display: inline-block;
  float: left;
  margin-right: 5px;
}

.list_new_phs i {
  font-size: 16px;
  font-weight: bold;
}

.i_icon {
  font-size: 25px;
}

.status-label {
  margin-bottom: 10px;
  margin-top: 6px;
}

.esy_as_my {
  position: absolute;
  bottom: 12px;
  right: 30px;
}

#chart {
  margin: 0px auto;
}

.width-200_as input {
  /*  width: 800px;
  position: absolute;
  cursor: pointer;
  z-index: 999999999999999;
  left: -360px;
  text-align: left;
	height: 25px;*/

  width: 800px;
  position: absolute;
  cursor: pointer;
  z-index: 999999999999999;
  left: -660px;
  text-align: left;
  height: 25px;
  margin-left: 300px;
}

.btn-new {
  color: #fff !important;
  background-color: #355f81 !important;
  border-left: 3px solid #47b4ac !important;
}

.logo_tital_my h1 {
  text-transform: capitalize;
}

.bg_dark {
  background-color: #ebebeb !important;
}

.nav-tabs {
  border-bottom: 2px solid #dbf6f0 !important;
}

.alert_ashish {
  position: absolute;
  z-index: 9;
  top: -32px;
  padding: 10px 4px;
  border-radius: 0px;
  left: 9px;
  font-weight: bold;
}

.alert_ashish span {
  color: #f30;
}

.btn-warning2 {
  background-color: #fff !important;
  border: 1px solid #ccc !important;
}

.cl {
  clear: both;
}

.nav-tabs .nav-link.active {
  border-bottom: 3px solid #47b4ac !important;
  color: #47b4ac !important;
  font-weight: 600 !important;
}

.edit-menu {
  box-shadow: rgba(149, 157, 165, 0.2) 0px 8px 24px !important;
}

.Logs_ashish i {
  vertical-align: middle;
}

.campaign_ashish_new p {
  color: #333;
  text-transform: capitalize;
  font-weight: bold;
  font-size: 14px;
}

.input_width1 input {
  padding: 0px;
  width: 120px;
  text-align: center;
}

.custam_select_ashish select {
  width: 90px;
}

.user-name i {
  vertical-align: middle;
}

.custam_select_ashish2 select {
  width: 160px;
}

.custam_select_ashish1 select {
  width: 135px;
}

.user-name span {
  font-weight: bold;
  color: #333;
  text-transform: uppercase;
  font-size: 13px;
  vertical-align: middle;
}

.status-label {
  border-radius: 0px;
  padding: 4px 5px;
  display: inline-block;
  text-align: center;
  background-color: #f6ffed;
  font-size: 14px;
  text-transform: capitalize;
}

.status-label.green {
  background: rgba(11, 201, 132, 0.1);
  border: 1px solid rgba(11, 201, 132, 0.4);
  color: #0abd7c;
}

/* line 733, ../../scss/_settings_fl.scss */

.status-label.red {
  background-color: #fff1f0;
  border: 1px solid #ffa39e;
  color: #f5222d;
}

/* line 738, ../../scss/_settings_fl.scss */

.status-label.orange {
  background-color: #fff7e6;
  border: 1px solid #ffd591;
  color: #fa8c16;
}

/* line 743, ../../scss/_settings_fl.scss */

.status-label.blue {
  background-color: #edf3ff;
  border: 1px solid #87afff;
  color: #0f5ffe;
}

/* line 748, ../../scss/_settings_fl.scss */

.status-label.grey {
  background-color: #efefef;
  border: 1px solid #bbbbbb;
  color: #5f6368;
}

/* line 753, ../../scss/_settings_fl.scss */

.status-label.purple {
  background-color: #e6e6fa;
  border: 1px solid #cbc3e3;
  color: #000;
}

.browse_btn {
  display: block;
  width: 100%;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #212529;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid #ced4da;
  appearance: none;
  border-radius: 0.25rem;
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}

.close {
  background: none;
  border: none;
  color: #000;
  font-size: 24px;
}

.as_a a {
  cursor: pointer;
  position: relative;
  bottom: 30px;
}

.ashi_new_table .table td {
  padding: 10px 5px !important;
}

.ashi_new_table .table .ligth th {
  padding: 10px 5px !important;
}

.bg-b1 {
  background-color: #a3cbf0;
  color: #000 !important;
}

tbody {
  background-color: #fff;
}

.btn-info {
  color: #fff !important;
  background-color: #2a78c2 !important;
  border-color: #0dcaf0;
}

.form-select_as select {
  word-wrap: normal;
  color: #6d8aae !important;
  font-family: "Heebo", sans-serif;
  font-size: 14px !important;
  font-weight: 600 !important;
}

.md-drppicker .buttons_input button {
  box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5) !important;
  background-color: #47b4ac !important;
  color: #fff !important;
}

.md-drppicker td.active,
.md-drppicker td.active:hover {
  background-color: #47b4ac !important;
  border-color: transparent;
  color: #fff;
}

.btn-close.Template_but {
  background-color: #fff !important;
  font-size: 12px;
  font-weight: bold;
}

.md-drppicker option.disabled,
.md-drppicker td.disabled {
  color: red !important;
}

.phone_book h5 {
  color: #000;
}

.float-left {
  float: left;
}

.float-right {
  float: right;
}

.top_animation a {
  font-size: 14px;
  margin: 0px;
  padding: 0px;
  color: #7e7e7e;
}

.sm-input_ashish input {
  width: 20px !important;
}

.send_box_new .btn-sm,
.btn-group-sm > .btn {
  padding: 0.313rem 0.625rem;
  font-size: 0.75rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px;
}

.form-select_as {
  background-color: #ebebeb !important;
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right 0.75rem center;
  background-size: 16px 12px;
  border-radius: 0px !important;
  border: none !important;
  height: 41px;
  margin-bottom: 10px;
  color: #afbfd3 !important;
  font-weight: 600 !important;
  font-size: 14px !important;
  font-family: "Heebo", sans-serif !important;
  appearance: none;
}

.floating-label select {
  background-color: #fff;
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M2 5l6 6 6-6'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right 0.75rem center;
  background-size: 16px 12px;
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  appearance: none;
}

.home_page_menu li {
  background-color: #47b4ac !important;
  list-style: none;
  height: 160px;
  text-align: center;
  padding: 40px 0px;
}

.phone_book_box h5 {
  text-align: left;
  margin: 0px;
  padding: 0px;
  font-size: 15px;
  font-weight: bold;
}

.bo_re {
  border-radius: 30px 0px 0px 0px;
}

.bo_le {
  border-radius: 0px 0px 30px 0px;
}

.boder_l {
  border-left: 1px solid #3c9992 !important;
}

.boder_R {
  border-right: 1px solid #3c9992 !important;
}

.boder_T {
  border-top: 1px solid #3c9992 !important;
}

.boder_all {
  border: 1px solid #3c9992 !important;
}

.boder_B {
  border-bottom: 1px solid #3c9992 !important;
}

.boder_R_l {
  border-right: 1px solid #3c9992 !important;
  border-left: 1px solid #3c9992 !important;
}

.boder_T_B {
  border-top: 1px solid #3c9992 !important;
  border-bottom: 1px solid #3c9992 !important;
}

.home_page_menu i {
  font-size: 50px;
  text-align: center;
  width: 100%;
  margin: 0px;
  padding: 0px;
  font-weight: 600;
}

.home_page_menu p {
  text-align: center;
  text-transform: capitalize;
  font-weight: bold;
  margin: 0px;
  padding: 0px;
}

.home_page_menu a {
  color: #fff !important;
  text-align: center;
  text-transform: capitalize;
  font-weight: bold;
  margin: 0px;
  padding: 0px;
}

.home_page_menu a:hover {
  color: #fff;
}

.home_page_menu ul {
  margin: 0px auto;
  padding: 0px;
}

.ashish_box_dr {
  background-color: #fff;
}

.ashish_box_dr p {
  font-weight: 600;
  color: #737b8e;
  margin: 0px;
}

.box_st_ashish {
  background-color: #fff;
}

.phone_book_name h5 {
  white-space: nowrap;
  text-overflow: ellipsis;
  overflow: hidden;
  font-size: 13px;
  font-weight: 600;
  color: #000;
  margin-bottom: 0.2rem;
  line-height: 1;
  text-transform: capitalize;
}

.bg-light_as {
  background-color: #f6f8fb !important;
}

.modal-header_as {
  background-color: #425270 !important;
  color: #fff !important;
}

.modal-header_as h6 {
  color: #fff !important;
}

.closebtn {
  position: absolute;
  right: 10px;
  font-size: 27px;
  color: #fff;
  background: none;
  margin-left: 50px;
  border: none;
}

.mobile_no_box_new li {
  display: inline-block;
  text-align: left;
  float: left;
  margin-right: 12px;
}

.search-link {
  position: absolute;
  right: 40px !important;
  top: 30px;
  color: #737b8e;
}

.iq-search-bar {
  width: 100%;
}

.iq-search-bar .searchbox {
  width: 100%;
  position: relative;
}

.iq-search-bar .search-input {
  width: 100%;
  height: 40px;
  padding: 10px 40px 10px 20px;
  border-radius: 10px 10px 0 10px;
  border: 1px solid transparent;
  background-color: #ffffff;
}

.iq-search-bar .search-link {
  position: absolute;
  right: 24px !important;
  top: 6px;
  color: #737b8e;
}

.iq-navbar-logo {
  padding: 0;
  width: auto;
  position: relative;
  background: #fff;
  transition: all 0.3s ease-in-out;
  background: transparent;
}

.iq-navbar-logo a {
  display: flex;
  align-items: center;
}

.iq-navbar-logo a span {
  margin-left: 10px;
  font-size: 28px;
  line-height: 26px;
  font-weight: 500;
  color: #01041b;
  text-transform: capitalize;
  flex: 1;
  transition: all 0.3s ease-in-out;
}

.iq-navbar-logo a:hover {
  text-decoration: none;
}

.iq-navbar-logo a:focus {
  text-decoration: none;
}

.iq-navbar-logo img {
  height: 25px;
}

.iq-sub-dropdown.iq-sub-dropdown-large {
  width: 500px;
}

input[type="radio"],
input[type="checkbox"] {
  box-sizing: border-box;
  padding: 0;
}

.avatar-25 {
  height: 25px;
  width: 25px;
  line-height: 25px;
  min-width: 25px;
}

.avatar-30 {
  height: 30px;
  width: 30px;
  line-height: 30px;
  min-width: 30px;
}

.avatar-35 {
  height: 35px;
  width: 35px;
  line-height: 35px;
  min-width: 35px;
}

.avatar-40 {
  height: 40px;
  width: 40px;
  line-height: 40px;
  min-width: 40px;
}

.avatar-45 {
  height: 45px;
  width: 45px;
  line-height: 45px;
  min-width: 45px;
}

.avatar-50 {
  height: 50px;
  width: 50px;
  line-height: 50px;
  min-width: 50px;
}

.avatar-60 {
  height: 60px;
  width: 60px;
  line-height: 60px;
  min-width: 60px;
}

.avatar-70 {
  height: 70px;
  width: 70px;
  line-height: 70px;
  min-width: 70px;
}

.avatar-80 {
  height: 80px;
  width: 80px;
  line-height: 80px;
  min-width: 80px;
}

.avatar-90 {
  height: 90px;
  width: 90px;
  line-height: 90px;
  min-width: 90px;
}

.avatar-100 {
  height: 100px;
  width: 100px;
  line-height: 100px;
  min-width: 100px;
}

.avatar-110 {
  height: 110px;
  width: 110px;
  line-height: 110px;
  min-width: 110px;
}

.avatar-120 {
  height: 120px;
  width: 120px;
  line-height: 120px;
  min-width: 120px;
}

.avatar-130 {
  height: 130px;
  width: 130px;
  line-height: 130px;
  min-width: 130px;
}

.avatar-155 {
  height: 155px;
  width: 155px;
  line-height: 155px;
  min-width: 155px;
}

.avatar-235 {
  height: 235px;
  width: 235px;
  line-height: 235px;
  min-width: 235px;
}

.search-input {
  width: 100%;
  height: 40px;
  padding: 10px 40px 10px 20px;
  border-radius: 10px 10px 0 10px;
  border: 1px solid transparent;
  background-color: #ffffff;
}

.csv-file-chooser-section input {
  background-color: #fff;
  border: 1px solid #ccc;
  padding: 6px;
}

.file-border {
  border: 1px solid #ccc;
  width: 100%;
  padding: 0 5px;
  height: 34px;
  text-overflow: clip;
  opacity: 0;
}

.upload-btn {
  display: block;
  width: calc(100% - 30px);
  height: 34px;
  border: 1px solid #ccc;
  position: absolute;
  background-color: #fff;
  top: 0;
  z-index: -1;
  padding-left: 5px;
  line-height: 34px;
  overflow: hidden;
  text-overflow: ellipsis;
  word-break: keep-all;
}

.upload-btn::before {
  position: absolute;
  content: "Upload CSV";
  background: #47b4ac;
  color: #fff;
  height: 34px;
  width: auto;
  line-height: 24px;
  padding: 5px;
  text-transform: capitalize;
  top: -1px;
  right: 0;
}

.hide_text {
  white-space: nowrap;
  width: 200px;
  overflow: hidden;
  text-overflow: "...";
}

.profile_data span {
  font-weight: bold;
  font-size: 12px;
  text-transform: capitalize;
  color: #ababab;
  margin: 0px;
  padding: 0px;
}

.profile_data i {
  font-weight: bold;
  font-size: 23px;
  vertical-align: middle;
  color: #47b4ac;
}

.menu_top_pdd a i {
  vertical-align: middle;
  position: relative;
  bottom: 1px;
}

.profile_data h6 {
  font-weight: 600;
  font-size: 15px;
}

.ul-0 {
  margin: 0px;
  padding: 0px;
}

.my_menu ul {
  margin: 0px;
  padding: 0px;
}

.pop_div_body {
  width: 320px;
  background: #f6f8fb;
}

.pop_div_body {
  width: 100%;
  padding: 10px;
}

.Preview_SMS {
  cursor: pointer;
}

.ul_list li {
  display: inline-block;
}

.ul_list ul {
  margin: 0px;
  padding: 0px;
}

.website_icon {
  background-color: #fff;
  padding: 15px 0px;
  border-radius: 10px 10px 0 10px;
  border: 1px solid #eee;
  width: 100px;
  height: 80px;
  margin: 0px auto;
  text-align: center;
}

.website_icon .active {
  border-bottom: 5px solid #47b4ac !important;
  padding-bottom: 6px;
  border-radius: 10px 10px 0px 10px;
}

.website_icon {
  margin: 5px;
}

.website_icon i {
  font-size: 30px;
  text-align: center;
  margin: 0px auto;
}

.website_icon p {
  margin: 0px;
}

.website_icon {
  text-align: center;
}

.website_icon a {
  font-size: 13px;
  margin: 0px;
  padding: 0px;
  color: #333;
  text-transform: inherit;
  font-weight: bold;
}

.sidebar1 {
  height: 100%;
  width: 0;
  position: absolute;
  z-index: 1;
  top: 0;
  left: 0px;
  overflow-x: hidden;
  transition: 0.5s;
  padding-top: 60px;
  scrollbar-width: thin;
  scrollbar-color: #47b4ac #ccc;
}

.sidebar1 .closebtn1 {
  position: absolute;
  top: 0;
  left: 0px;
  font-size: 36px;
  margin-left: 0px;
}

.openbtn:hover {
  background-color: #444;
}

#main1 {
  transition: margin-left 0.5s;
  padding: 16px;
}

.bg_whit {
  background-color: #fff;
}

.resller_box2 h3 {
  font-size: 16px;
  text-align: left;
  font-weight: 600;
  margin: 12px auto;
}

.resller_box2 {
  text-align: center;
  background-color: #fff;
  margin: 10px 0px;
  border: 1px solid #eeeeee;
  padding: 4px 0px;
}

.icon_bal_2 i {
  vertical-align: middle;
  text-align: center;
  position: relative;
  top: 8px;
  font-weight: 500;
  font-size: 20px;
}

.icon_bal_2 {
  width: 40px;
  height: 40px;
  background-color: #ddd;
  border-radius: 50%;
  text-align: center;
  vertical-align: middle;
}

.hotline {
  float: right;
}

.font-12 a {
  font-size: 13px;
  color: #000;
}

.come-from-modal.left .modal-dialog,
.come-from-modal.right .modal-dialog {
  position: fixed;
  margin: auto;
  width: 450px;
  height: 100%;
  transform: translate3d(0%, 0, 0);
}

.come-from-modal.left .modal-content,
.come-from-modal.right .modal-content {
  height: 100%;
  overflow-y: auto;
  border-radius: 0px;
}

.come-from-modal.left .modal-body,
.come-from-modal.right .modal-body {
  padding: 15px 15px 80px;
}

.come-from-modal.right.fade .modal-dialog {
  right: 0px;
  transition: opacity 0.3s linear, right 0.3s ease-out;
}

.come-from-modal.right.fade.in .modal-dialog {
  right: 0;
}

details {
  border-radius: 4px;
  padding: 0.5em 0.5em 0;
}

summary {
  margin: -0.5em -0.5em 0;
  padding: 0.5em;
  font-size: 13px;
}

details[open] {
  padding: 0.5em;
}

details[open] summary {
  border-bottom: 1px solid #ccc;
  margin-bottom: 0.5em;
}

.cl {
  clear: both;
}

.header-info i {
  font-size: 16px;
  font-weight: bold;
  vertical-align: baseline;
}

.hotline img {
  min-width: 40px;
  margin-right: 5px;
  height: 40px;
  margin-top: 6px;
}

.header-style-1 .hotline p {
  color: #3bb77e !important;
}

.top_li_logo {
  margin: 3px 0px;
}

.hotline p {
  color: #3bb77e;
  font-size: 22px;
  font-weight: 700;
  display: block;
  line-height: 1;
  position: relative;
  top: 8px;
}

.hotline p span {
  font-weight: bold;
  font-size: 12px;
  font-family: "Lato", sans-serif;
  color: #7e7e7e;
  display: block;
  letter-spacing: 0.4px;
}

.phone_book_icon {
  background-color: #dbf6f0;
  height: 100%;
  text-align: center;
  position: relative;
  padding: 10px 0px;
  font-size: 33px;
}

.phone_book_icon a {
  cursor: pointer;
}

.header-info > ul {
  display: flex;
  margin: 0px;
  padding: 0px;
}

.header-info > ul > li {
  margin-right: 20px;
  position: relative;
  display: flex;
  align-items: center;
}

.header-info > ul > li::before {
  content: "";
  position: absolute;
  right: -10px;
  top: 50%;
  transform: translateY(-50%);
  width: 1px;
  height: 10px;
  background: #dedfe2;
}

.header-info > ul > li a {
  color: #7e7e7e;
  font-weight: 500;
  font-size: 13px;
  cursor: pointer;
}

.Logout_as a:hover {
  color: #c33 !important;
}

.header-info-right {
  display: flex;
  justify-content: flex-end;
}

.text-brand {
  color: #3bb77e !important;
}

.header-style-1 {
  background-color: #fff;
  padding: 5px 0;
  line-height: 1;
}

.top_animation {
  margin: 0px auto;
  text-align: center;
}

.top_animation h1 {
  font-size: 14px;
  margin: 0px;
  padding: 0px;
  color: #7e7e7e;
}

.ashish_bg {
  background-color: #47b4ac;
}

.right_div_top {
  z-index: 99;
}

.pl0 {
  padding-left: 0px !important;
}

.logo_bg {
  background-color: #47b4ac;
}

.bg_header ul {
  margin: 0px;
  padding: 0px;
}

.logo_bg img {
  height: 40px;
  margin: 3px 20px;
  padding: 4px;
}

.top_li_logo li {
  display: inline-block;
}

.my_menu {
  margin: 7px 0px;
}

.bg_header {
  background-color: #fff;
}

.color_as a i {
  color: #cca43b !important;
}

.color_as a i:hover {
  color: #fff !important;
}

.color_as_red a i {
  color: #f00 !important;
}

.color_as_red a i:hover {
  color: #fff !important;
}

.table-responsive {
  display: block;
  width: 100%;
  -webkit-overflow-scrolling: touch !important;
  overflow: auto;
  scrollbar-width: thin;
  scrollbar-color: #47b4ac #ccc;
}

.line {
  width: 100%;
  height: 1px;
  background-color: #ccc;
}

.file-upload {
  display: block;
  text-align: center;
  font-family: Helvetica, Arial, sans-serif;
  font-size: 12px;
}

.file-upload .file-select {
  display: block;
  border: 2px solid #dce4ec;
  color: #34495e;
  cursor: pointer;
  height: 40px;
  line-height: 40px;
  text-align: left;
  background: #ffffff;
  overflow: hidden;
  position: relative;
}

.file-upload .file-select .file-select-button {
  background: #dce4ec;
  padding: 0 10px;
  display: inline-block;
  height: 40px;
  line-height: 40px;
}

.file-upload .file-select .file-select-name {
  line-height: 40px;
  display: inline-block;
  padding: 0 10px;
}

.file-upload .file-select:hover {
  border-color: #34495e;
  transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -webkit-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
}

.file-upload .file-select:hover .file-select-button {
  background: #34495e;
  color: #ffffff;
  transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -webkit-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
}

.file-upload.active .file-select {
  border-color: #3fa46a;
  transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -webkit-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
}

.file-upload.active .file-select .file-select-button {
  background: #3fa46a;
  color: #ffffff;
  transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -webkit-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
}

.file-upload .file-select input[type="file"] {
  z-index: 100;
  cursor: pointer;
  position: absolute;
  height: 100%;
  width: 100%;
  top: 0;
  left: 0;
  opacity: 0;
  filter: alpha(opacity=0);
}

.file-upload .file-select.file-select-disabled {
  opacity: 0.65;
}

.file-upload .file-select.file-select-disabled:hover {
  cursor: default;
  display: block;
  border: 2px solid #dce4ec;
  color: #34495e;
  cursor: pointer;
  height: 40px;
  line-height: 40px;
  margin-top: 5px;
  text-align: left;
  background: #ffffff;
  overflow: hidden;
  position: relative;
}

.file-upload .file-select.file-select-disabled:hover .file-select-button {
  background: #dce4ec;
  color: #666666;
  padding: 0 10px;
  display: inline-block;
  height: 40px;
  line-height: 40px;
}

.file-upload .file-select.file-select-disabled:hover .file-select-name {
  line-height: 40px;
  display: inline-block;
  padding: 0 10px;
}

.mt-80 {
  margin-top: 80px !important;
}

/* The side navigation menu */

.sidenav {
  height: 100%; /* 100% Full-height */
  width: 0; /* 0 width - change this with JavaScript */
  position: fixed; /* Stay in place */
  z-index: 1; /* Stay on top */
  top: 0;
  left: 0;
  background-color: #111; /* Black*/
  overflow-x: hidden; /* Disable horizontal scroll */
  padding-top: 60px; /* Place content 60px from the top */
  transition: 0.5s; /* 0.5 second transition effect to slide in the sidenav */
}

/* The navigation menu links */

.sidenav a {
  padding: 8px 8px 8px 32px;
  text-decoration: none;
  font-size: 25px;
  font-family: Gotham;
  color: #818181;
  display: block;
  transition: 0.3s;
}

/* When you mouse over the navigation links, change their color */

.sidenav a:hover,
.offcanvas a:focus {
  color: #f1f1f1;
}

/* Position and style the close button (top right corner) */

.sidenav .closebtn {
  position: absolute;
  top: 0;
  right: 25px;
  font-size: 36px;
  margin-left: 50px;
}

/* Style page content - use this if you want to push the page content to the right when you open the side navigation */

#main {
  transition: margin-left 0.5s;
  padding: 20px;
}

/* On smaller screens, where height is less than 450px, change the style of the sidenav (less padding and a smaller font size) */

@media screen and (max-height: 450px) {
  .sidenav {
    padding-top: 15px;
  }
  .sidenav a {
    font-size: 18px;
  }
}

.form-control_ashish select {
  height: 70px;
  width: 100%;
  font-weight: bold;
  background-color: #47b4ac;
  color: #fff !important;
  border: none !important;
  font-size: 14px;
  padding-left: 28px;
}

.send_box {
  position: relative;
  top: 10px;
}

.form-control_ashish {
  background-color: red;
}

.box_ashish {
  width: 100%;
}

.box_ashish select {
  background-color: #47b4ac;
  color: white;
  padding: 12px;
  width: 100%;
  border: none;
  font-size: 15px;
  appearance: button;
  outline: none;
}

.box_ashish::before {
  position: absolute;
  top: 0;
  right: 0;
  width: 15%;
  height: 100%;
  text-align: center;
  font-size: 28px;
  line-height: 45px;
  color: rgba(255, 255, 255, 0.5);
  background-color: rgba(255, 255, 255, 0.1);
  pointer-events: none;
}

.ashish_bottom {
  position: relative;
  top: 60px;
}

.float-center {
  margin: 0px auto;
  text-align: center;
}

.box_ashish:hover::before {
  color: #47b4ac;
  background-color: #dbf6f0;
}

.box_ashish select option {
  padding: 30px;
  background-color: #3c9992;
  border-color: #398f89;
}

.box_ashish select option:hover {
  color: #47b4ac;
  background-color: #dbf6f0;
}

.send_box i {
  color: #fff;
  font-size: 30px;
  font-weight: 600;
  margin-top: 10px;
}

.send_box p {
  color: #fff;
}

.send_box h6 {
  color: #fff;
}

.boder_a_l {
  border-left: 1px solid #3c9992;
}

.send_div {
  background: #fff;
  border-radius: 10px 10px 0 10px;
  margin-bottom: 30px;
  border: 1px solid #c2c6cf;
  z-index: 999;
  position: relative;
  -ms-box-shadow: 0px 16px 40px 0px #0000000a;
  -o-box-shadow: 0px 16px 40px 0px #0000000a;
  box-shadow: 0px 16px 40px 0px #0000000a;
  top: 10px;
}

.phone_book_name h6 {
  white-space: nowrap;
  text-overflow: ellipsis;
  overflow: hidden;
  font-size: 13px;
  font-weight: 600;
  margin-bottom: 0.2rem;
  line-height: 1;
}

.login-content_as {
  top: 0px;
}

.pop_div_body {
  width: 320px !important;
  background: #f6f8fb;
  height: 100%;
  float: right;
}

body {
  background: #ebebeb !important;
}

.content-page-chat {
  margin-left: 0px !important;
}

.header_icon i {
  font-size: 26px;
  padding: 0px;
}

.navbar-list li {
  padding-left: 5px;
}

.iq-sidebar-logo img {
  height: 40px;
  left: 9px;
  position: relative;
}

.sidebar {
  height: 100%;
  width: 0;
  position: fixed;
  z-index: 999;
  top: 0;
  overflow: hidden;
  right: 0px;
  transition: 0.5s;
}

.sidebar .closebtn {
  position: absolute;
  top: 20px;
  right: 10px;
  font-size: 20px;
  color: #47b4ac;
  background: #dbf6f0;
  margin-left: 50px;
}

.openbtn {
  font-size: 20px;
  cursor: pointer;
  background-color: #111;
  color: white;
  padding: 10px 15px;
  border: none;
}

.openbtn:hover {
  background-color: #444;
}

.chat-data-left {
  height: 100%;
}

#main {
  transition: margin-left 0.5s;
  padding: 16px;
}

@media screen and (min-device-width: 320px) and (max-device-width: 992px) {
  .sidebar {
    position: fixed;
    z-index: 1;
    top: 0;
    left: 0px;
    overflow-x: hidden;
    transition: 0.5s;
  }
  .login-content_as {
    top: 20px !important;
  }
  #mySidebar {
    margin-top: 70px;
  }
}

/* ----- MODAL STYLE ----- */

.modal-content {
  border-radius: 0;
  border: none;
}

.modal-header {
  border-bottom-color: #eeeeee;
  background-color: #fafafa;
}

.phone-book-box {
  z-index: 99;
  position: relative;
  margin: 0px;
  left: 0px;
  right: 0px;
}

.brand_logo_as img {
  margin-top: 5px;
}

.menu_text_non {
  display: block;
}

.menu {
  display: block;
}

.menu li {
  display: inline-block;
  position: relative;
}

.menu li:first-child {
  margin-left: 0;
}

.menu i {
  font-size: 26px;
  vertical-align: middle;
}

.active > a {
  background-image: linear-gradient(
    to right top,
    #008f7a,
    #219c87,
    #35aa94,
    #45b8a1,
    #55c6ae
  ) !important;
  /*background-color: #47B4AC !important;*/
  border-color: #47b4ac !important;
  /*    background-color: #47B4AC;*/
  color: #fff !important;
}

.active > a:hover {
  background-position: right center;
  background-image: linear-gradient(
    to right top,
    #008f7a,
    #219c87,
    #35aa94,
    #45b8a1,
    #55c6ae
  ) !important;
  /*background-color: #47B4AC !important;*/
  border-color: #47b4ac !important;
  /*    background-color: #47B4AC;*/
  color: #fff !important;
}

.sub-menu .active {
  background-color: #47b4ac;
  color: #fff !important;
  border-radius: 0px 10px 0 10px;
  transition: all 0.2s ease-in-out 0s;
  font-size: 13px;
}

.header-info .active a {
  background: none !important;
  background-image: none !important;
  border: none !important;
  box-shadow: none;
  color: #47b4ac !important;
  font-weight: bold;
}

.header-info .active a i {
  background: none;
  box-shadow: none;
  color: #47b4ac !important;
  font-weight: bold;
}

.user_m_c h6 {
  font-weight: bold;
  margin: 0px;
  line-height: 1.5;
  color: #35405a;
  font-size: 1rem;
}

.crm-p-image {
  position: absolute;
  top: auto;
  left: 69px;
  bottom: -9px;
  transition: all 0.3s cubic-bezier(0.175, 0.885, 0.32, 1.275);
  border-radius: 50%;
  height: 35px;
  width: 35px;
  text-align: center;
  font-size: 12px;
  line-height: 30px;
  cursor: pointer;
  border: 5px solid #fff;
}

.btn-sm,
.btn-group-sm > .btn {
  padding: 0.313rem 0.625rem;
  font-size: 0.75rem;
  line-height: 1.5;
  border-radius: 10px 10px 0 10px;
}

.bg-primary {
  color: #fff !important;
  background-color: #47b4ac !important;
}

.upload-button {
  font-size: 1.5em;
}

.ligth th {
  padding: 10px 5px;
}

.btn-sm {
  padding: 0.25rem 0.2rem !important;
  font-size: 0.875rem;
  border-radius: 0.2rem;
  color: #fff !important;
}

.badge-primary {
  color: #fff !important;
  background-color: #47b4ac !important;
}

.progress-bar {
  background-color: #47b4ac !important;
}

.btn-outline-primary {
  color: #0d6efd;
  border-color: #47b4ac !important;
}

.btn-outline-primary:hover {
  color: #fff;
  background-color: #47b4ac !important;
  border-color: #0d6efd;
}

.font-size-12 {
  font-size: 12px !important;
}

.font-size-14 {
  font-size: 14px !important;
}

.font-size-16 {
  font-size: 16px !important;
}

.font-size-18 {
  font-size: 18px !important;
}

.font-size-20 {
  font-size: 20px !important;
}

.font-size-32 {
  font-size: 32px !important;
}

.font-size-40 {
  font-size: 40px !important;
}

.rounded1 {
  border-radius: 10px 10px 0 10px !important;
}

.box_boder_row:hover {
  border: 1px solid #47b4ac !important;
}

.icon_text_sms:hover {
  background-color: #ccc !important;
}

.active > a i {
  color: #fff !important;
}

.top_animation h1 {
  font-weight: bold;
}

a {
  text-decoration: none !important;
}

.menu li a {
  text-decoration: none;
  cursor: pointer;
  color: #737b8e;
  padding: 10px 7px;
  margin: 0 5px 8px;
  text-align: center;
  transition: all 0.2s ease-in-out 0s;
  font-size: 13px;
  vertical-align: baseline;
}

.menu li a:hover,
.menu li:hover > a {
  background-color: #47b4ac;
  color: #fff !important;
  box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
}

.menu li i:hover {
  background-color: #47b4ac;
  color: #fff !important;
  box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
}

.icon_top_m i {
  vertical-align: middle;
}

.menu ul {
  visibility: hidden;
  opacity: 0;
  margin: 0;
  padding: 0;
  width: 170px;
  position: absolute;
  left: 0px;
  background: #fff;
  z-index: 99999999999999999999999999999999;
  top: 35px;
  transform: translate(0, 20px);
  transition: all 0.2s ease-out;
  box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
}

.menu ul:after {
  bottom: 100%;
  left: 20%;
  border: solid transparent;
  content: " ";
  height: 0;
  width: 0;
  position: absolute;
  pointer-events: none;
  border-color: rgba(255, 255, 255, 0);
  border-bottom-color: #fff;
  border-width: 6px;
  margin-left: -6px;
}

.menu ul li {
  display: block;
  float: none;
  background: none;
  margin: 0;
  padding: 0;
}

.menu ul li a {
  font-size: 12px;
  font-weight: normal;
  display: block;
  color: #797979;
  background: #fff;
  text-align: left;
}

.menu ul li a:hover,
.menu ul li:hover > a {
  background-color: #47b4ac;
  color: #fff !important;
  box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
}

.menu li:hover > ul {
  visibility: visible;
  opacity: 1;
  transform: translate(0, 0);
}

.menu ul ul {
  left: 169px;
  top: 0px;
  visibility: hidden;
  opacity: 0;
  transform: translate(20px, 20px);
  transition: all 0.2s ease-out;
}

.menu ul ul:after {
  left: -6px;
  top: 10%;
  border: solid transparent;
  content: " ";
  height: 0;
  width: 0;
  position: absolute;
  pointer-events: none;
  border-color: rgba(255, 255, 255, 0);
  border-right-color: #fff;
  border-width: 6px;
  margin-top: -6px;
}

.menu li > ul ul:hover {
  visibility: visible;
  opacity: 1;
  transform: translate(0, 0);
}

.responsive-menu {
  display: none;
  width: 100%;
  padding: 20px 15px;
  background: #374147;
  color: #fff;
  text-transform: uppercase;
  font-weight: 600;
}

.responsive-menu:hover {
  background: #374147;
  color: #fff;
  text-decoration: none;
}

@media (min-width: 768px) and (max-width: 979px) {
  .menu li a {
    padding: 10px 7px;
    margin: 0px;
  }
  .hotline p {
    color: #3bb77e;
    font-size: 20px;
    font-weight: 700;
    display: inline-block;
    line-height: 1;
    position: relative;
    top: 8px;
  }
  .top_li_logo {
    margin: 0px;
    padding: 0px;
  }
  .menu i {
    font-size: 18px;
    vertical-align: sub;
  }
  .mainWrap {
    width: 768px;
  }
  .menu ul {
    top: 37px;
  }
  .menu li a {
    font-size: 11px;
  }
  .menu_text_non {
    display: block;
  }
}

@media (max-width: 767px) {
  .menu_text_non {
    display: block;
  }
  .mainWrap {
    width: auto;
    padding: 50px 20px;
  }
  .menu {
    display: none;
  }
  .responsive-menu {
    display: block;
  }
  nav {
    margin: 0;
    background: none;
  }
  .menu li {
    display: block;
    margin: 20px 0px;
  }
  .menu li a:hover,
  .menu li:hover > a {
    background: #9ca3da;
    color: #fff;
  }
  .menu ul {
    visibility: hidden;
    opacity: 0;
    top: 0;
    left: 0;
    width: 100%;
    transform: initial;
  }
  .menu li:hover > ul {
    visibility: visible;
    opacity: 1;
    position: relative;
    transform: initial;
  }
  .menu ul ul {
    left: 0;
    transform: initial;
  }
  .menu li > ul ul:hover {
    transform: initial;
  }
}

@media (min-width: 320px) and (max-width: 1100px) {
  .sidebar1 {
    height: auto !important;
    overflow: auto !important;
  }
}

@media (min-width: 511px) and (max-width: 768px) {
  .hotline img {
    min-width: 40px;
    margin-right: 0px;
    height: 40px;
    margin-top: 6px;
  }
  .hotline img {
    min-width: 30px;
    margin-right: 0px;
    height: 30px;
    margin-top: 0px;
  }
}

@media (min-width: 320px) and (max-width: 510px) {
  .come-from-modal.left .modal-dialog,
  .come-from-modal.right .modal-dialog {
    width: 310px !important;
  }
  .table-responsive {
    max-height: 400px;
    margin-bottom: 10px;
  }
  .mob_mt-10 {
    margin-top: 20px !important;
  }
  .btn {
    padding: 5px 5px !important;
  }
  .sidebar1 {
    padding-top: 15px;
  }
  .filter-list li {
    margin-right: 10px !important;
    margin-bottom: 10px !important;
  }
  .sidebar1 {
    height: auto !important;
    overflow: auto !important;
  }
  .send_box_new {
    margin-top: 15px !important;
  }
  .banner-contents .banner-title .title-span::before {
    top: 50px !important;
    right: -7px !important;
    left: -240px !important;
    height: 55px !important;
    width: 230px !important;
    z-index: -1;
    transform: rotate(-5deg);
    border-radius: 5px;
    transition: all 0.3s;
  }
  .header-info > ul > li a {
    color: #7e7e7e;
    font-weight: bold;
    font-size: 10px;
  }
  .header-info ul {
    margin: 0px auto;
    text-align: center;
    display: block ruby;
    width: 100%;
  }
  .header-info i {
    font-size: 16px;
    font-weight: bold;
    vertical-align: middle;
  }
  .mob_non {
    display: none;
  }
  .top_li_logo {
    margin: 0px;
    padding: 0px;
  }
  .brand_logo_as {
    width: 100%;
    text-align: center;
  }
  .my_menu ul {
    padding: 0px;
    position: absolute;
    z-index: 99;
    width: 310px;
    background-color: #fff;
    box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
  }
  .active > a {
    background-color: #47b4ac;
    color: #fff !important;
    box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
  }
  .hotline p {
    color: #3bb77e;
    font-size: 19px;
    font-weight: 700;
    display: inline-block;
    line-height: 1;
    position: relative;
    top: 8px;
  }
  .hotline img {
    min-width: 35px;
    margin-right: 0px;
  }
  .top_animation h1 {
    font-size: 8px;
    color: #7e7e7e;
  }
  .responsive-menu {
    width: 100%;
    padding: 10px 8px;
    background: #198754;
    color: #fff;
    text-transform: capitalize;
    font-weight: 500;
    font-size: 14px;
  }
}

/* #Navigation
================================================== */

.Submitted_color {
  background-color: #9cb0a4 !important;
  color: #fff !important;
}

.start-header {
  opacity: 1;
  transform: translateY(0);
  padding: 20px 0;
  box-shadow: 0 10px 30px 0 rgba(138, 155, 165, 0.15);
  transition: all 0.3s ease-out;
}

.start-header.scroll-on {
  box-shadow: 0 5px 10px 0 rgba(138, 155, 165, 0.15);
  padding: 10px 0;
  transition: all 0.3s ease-out;
}

.start-header.scroll-on .navbar-brand img {
  height: 24px;
  transition: all 0.3s ease-out;
}

.navigation-wrap {
  position: fixed;
  width: 100%;
  top: 0;
  left: 0;
  z-index: 1000;
  transition: all 0.3s ease-out;
}

.navbar {
  padding: 0;
}

.navbar-brand img {
  height: 28px;
  width: auto;
  display: block;
  filter: brightness(10%);
  transition: all 0.3s ease-out;
}

.navbar-toggler {
  float: right;
  border: none;
  padding-right: 0;
}

.navbar-toggler:active,
.navbar-toggler:focus {
  outline: none;
}

.navbar-light .navbar-toggler-icon {
  width: 24px;
  height: 17px;
  background-image: none;
  position: relative;
  border-bottom: 1px solid #000;
  transition: all 300ms linear;
}

.navbar-light .navbar-toggler-icon:after,
.navbar-light .navbar-toggler-icon:before {
  width: 24px;
  position: absolute;
  height: 1px;
  background-color: #000;
  top: 0;
  left: 0;
  content: "";
  z-index: 2;
  transition: all 300ms linear;
}

.navbar-light .navbar-toggler-icon:after {
  top: 8px;
}

.navbar-toggler[aria-expanded="true"] .navbar-toggler-icon:after {
  transform: rotate(45deg);
}

.navbar-toggler[aria-expanded="true"] .navbar-toggler-icon:before {
  transform: translateY(8px) rotate(-45deg);
}

.navbar-toggler[aria-expanded="true"] .navbar-toggler-icon {
  border-color: transparent;
}

.nav-link {
  color: #212121 !important;
  font-weight: 500;
  transition: all 200ms linear;
}

.nav-item:hover .nav-link {
  color: #8167a9 !important;
}

.nav-item.active .nav-link {
  color: #777 !important;
}

.nav-link {
  position: relative;
  display: inline-block;
}

.nav-item:after {
  position: absolute;
  bottom: -5px;
  left: 0;
  width: 100%;
  height: 2px;
  content: "";
  background-color: #8167a9;
  opacity: 0;
  transition: all 200ms linear;
}

.nav-item:hover:after {
  bottom: 0;
  opacity: 1;
}

.nav-item.active:hover:after {
  opacity: 0;
}

.nav-item {
  position: relative;
  transition: all 200ms linear;
}

/* #Primary style
================================================== */

.bg-light {
  background-color: #fff !important;
  transition: all 200ms linear;
}

body.hero-anime h1 span:nth-child(11) {
  opacity: 0;
  transform: translateY(30px);
}

body.hero-anime h1 span:nth-child(12) {
  opacity: 0;
  transform: translateY(50px);
}

body.hero-anime h1 span:nth-child(13) {
  opacity: 0;
  transform: translateY(20px);
}

body.hero-anime h1 span:nth-child(14) {
  opacity: 0;
  transform: translateY(30px);
}

body.hero-anime h1 span:nth-child(15) {
  opacity: 0;
  transform: translateY(50px);
}

h1 span:nth-child(11) {
  transition-delay: 1300ms;
}

h1 span:nth-child(12) {
  transition-delay: 1500ms;
}

h1 span:nth-child(13) {
  transition-delay: 1400ms;
}

h1 span:nth-child(14) {
  transition-delay: 1200ms;
}

h1 span:nth-child(15) {
  transition-delay: 1450ms;
}

#switch,
#circle {
  cursor: pointer;
  transition: all 300ms linear;
}

#switch {
  width: 60px;
  height: 8px;
  border: 2px solid #8167a9;
  border-radius: 27px;
  background: #000;
  position: relative;
  display: block;
  margin: 0 auto;
  text-align: center;
  opacity: 1;
  transform: translate(0);
  transition: all 300ms linear;
  transition-delay: 1900ms;
}

body.hero-anime #switch {
  opacity: 0;
  transform: translateY(40px);
  transition-delay: 1900ms;
}

#circle {
  position: absolute;
  top: -11px;
  left: -13px;
  width: 26px;
  height: 26px;
  border-radius: 50%;
  background: #000;
}

.switched {
  border-color: #000 !important;
  background: #8167a9 !important;
}

.switched #circle {
  left: 43px;
  box-shadow: 0 4px 4px rgba(26, 53, 71, 0.25), 0 0 0 1px rgba(26, 53, 71, 0.07);
  background: #fff;
}

.nav-item .dropdown-menu {
  transform: translate3d(0, 10px, 0);
  visibility: hidden;
  opacity: 0;
  max-height: 0;
  display: block;
  padding: 0;
  margin: 0;
  transition: all 200ms linear;
}

.nav-item.show .dropdown-menu {
  opacity: 1;
  visibility: visible;
  max-height: 999px;
  transform: translate3d(0, 0px, 0);
}

.dropdown-menu {
  padding: 5px !important;
  margin: 0;
  font-size: 13px;
  letter-spacing: 1px;
  color: #212121;
  background-color: #fcfaff;
  border: none;
  border-radius: 3px;
  box-shadow: 0 5px 10px 0 rgba(138, 155, 165, 0.15);
  transition: all 200ms linear;
}

.dropdown-toggle::after {
  display: none;
}

.dropdown-item {
  padding: 3px 15px;
  color: #212121;
  border-radius: 2px;
  transition: all 200ms linear;
}

.dropdown-item:hover,
.dropdown-item:focus {
  color: #fff;
  background-color: rgba(129, 103, 169, 0.6);
}

body.dark {
  color: #fff;
  background-color: #1f2029;
}

body.dark .navbar-brand img {
  filter: brightness(100%);
}

body.dark h1 {
  color: #fff;
}

body.dark h1 span {
  transition-delay: 0ms !important;
}

body.dark p {
  color: #fff;
  transition-delay: 0ms !important;
}

body.dark .bg-light {
  background-color: #14151a !important;
}

body.dark .start-header {
  box-shadow: 0 10px 30px 0 rgba(0, 0, 0, 0.15);
}

body.dark .start-header.scroll-on {
  box-shadow: 0 5px 10px 0 rgba(0, 0, 0, 0.15);
}

body.dark .nav-link {
  color: #fff !important;
}

body.dark .nav-item.active .nav-link {
  color: #999 !important;
}

body.dark .dropdown-menu {
  color: #fff;
  background-color: #1f2029;
  box-shadow: 0 5px 10px 0 rgba(0, 0, 0, 0.25);
}

body.dark .dropdown-item {
  color: #fff;
}

body.dark .navbar-light .navbar-toggler-icon {
  border-bottom: 1px solid #fff;
}

body.dark .navbar-light .navbar-toggler-icon:after,
body.dark .navbar-light .navbar-toggler-icon:before {
  background-color: #fff;
}

body.dark .navbar-toggler[aria-expanded="true"] .navbar-toggler-icon {
  border-color: transparent;
}

/* #Media
================================================== */

@media (max-width: 767px) {
  .nav-item:after {
    display: none;
  }
  .nav-item::before {
    position: absolute;
    display: block;
    top: 15px;
    left: 0;
    width: 11px;
    height: 1px;
    content: "";
    border: none;
    background-color: #000;
    vertical-align: 0;
  }
  .dropdown-toggle::after {
    position: absolute;
    display: block;
    top: 10px;
    left: -23px;
    width: 1px;
    height: 11px;
    content: "";
    border: none;
    background-color: #000;
    vertical-align: 0;
    transition: all 200ms linear;
  }
  .dropdown-toggle[aria-expanded="true"]::after {
    transform: rotate(90deg);
    opacity: 0;
  }
  .dropdown-menu {
    padding: 0 !important;
    background-color: transparent;
    box-shadow: none;
    transition: all 200ms linear;
  }
  .dropdown-toggle[aria-expanded="true"] + .dropdown-menu {
    margin-top: 10px !important;
    margin-bottom: 20px !important;
  }
  body.dark .nav-item::before {
    background-color: #fff;
  }
  body.dark .dropdown-toggle::after {
    background-color: #fff;
  }
  body.dark .dropdown-menu {
    background-color: transparent;
    box-shadow: none;
  }
}

/* Upload Area */

.upload-area {
  width: 100%;
  max-width: 25rem;
  background-color: var(--clr-white);
  box-shadow: 0 10px 60px rgb(218, 229, 255);
  border: 2px solid var(--clr-light-blue);
  border-radius: 24px;
  padding: 2rem 1.875rem 5rem 1.875rem;
  margin: 0.625rem;
  text-align: center;
}

.upload-area--open {
  /* Slid Down Animation */
  animation: slidDown 500ms ease-in-out;
}

@keyframes slidDown {
  from {
    height: 28.125rem; /* 450px */
  }
  to {
    height: 35rem; /* 560px */
  }
}

/* Header */

.upload-area__header {
}

.upload-area__title {
  font-size: 1.8rem;
  font-weight: 500;
  margin-bottom: 0.3125rem;
}

.upload-area__paragraph {
  font-size: 0.9375rem;
  color: var(--clr-light-gray);
  margin-top: 0;
}

.upload-area__tooltip {
  position: relative;
  color: var(--clr-light-blue);
  cursor: pointer;
  transition: color 300ms ease-in-out;
}

.upload-area__tooltip:hover {
  color: var(--clr-blue);
}

.upload-area__tooltip-data {
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -125%);
  min-width: max-content;
  background-color: var(--clr-white);
  color: var(--clr-blue);
  border: 1px solid var(--clr-light-blue);
  padding: 0.625rem 1.25rem;
  font-weight: 500;
  opacity: 0;
  visibility: hidden;
  transition: none 300ms ease-in-out;
  transition-property: opacity, visibility;
}

.bg-light2 {
  color: #212529 !important;
  background-color: #e4e6e9 !important;
}

.b-as strong {
  display: contents;
}

.upload-area__tooltip:hover .upload-area__tooltip-data {
  opacity: 1;
  visibility: visible;
}

/* Drop Zoon */

.upload-area__drop-zoon {
  position: relative;
  height: 6rem !important; /* 180px */
  display: flex;
  justify-content: center;
  align-items: center;
  flex-direction: column;
  border: 2px dashed #47b4ac;
  border-radius: 15px;
  margin-top: 2.1875rem;
  cursor: pointer;
  transition: border-color 300ms ease-in-out;
}

.upload-area__drop-zoon:hover {
  border-color: var(--clr-blue);
}

.drop-zoon__icon {
  display: flex;
  font-size: 3.75rem;
  color: var(--clr-blue);
  transition: opacity 300ms ease-in-out;
}

.drop-zoon__paragraph {
  font-size: 0.9375rem;
  color: var(--clr-light-gray);
  margin: 0;
  margin-top: 0.625rem;
  transition: opacity 300ms ease-in-out;
}

.drop-zoon:hover .drop-zoon__icon,
.drop-zoon:hover .drop-zoon__paragraph {
  opacity: 0.7;
}

.drop-zoon__loading-text {
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
  display: none;
  color: var(--clr-light-blue);
  z-index: 10;
}

.drop-zoon__preview-image {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  object-fit: contain;
  padding: 0.3125rem;
  border-radius: 10px;
  display: none;
  z-index: 1000;
  transition: opacity 300ms ease-in-out;
}

.drop-zoon:hover .drop-zoon__preview-image {
  opacity: 0.8;
}

.drop-zoon__file-input {
  display: none;
}

/* (drop-zoon--over) Modifier Class */

.drop-zoon--over {
  border-color: var(--clr-blue);
}

.drop-zoon--over .drop-zoon__icon,
.drop-zoon--over .drop-zoon__paragraph {
  opacity: 0.7;
}

/* (drop-zoon--over) Modifier Class */

.drop-zoon--Uploaded {
}

.drop-zoon--Uploaded .drop-zoon__icon,
.drop-zoon--Uploaded .drop-zoon__paragraph {
  display: none;
}

/* File Details Area */

.upload-area__file-details {
  height: 0;
  visibility: hidden;
  opacity: 0;
  text-align: left;
  transition: none 500ms ease-in-out;
  transition-property: opacity, visibility;
  transition-delay: 500ms;
}

/* (duploaded-file--open) Modifier Class */

.file-details--open {
  height: auto;
  visibility: visible;
  opacity: 1;
}

.file-details__title {
  font-size: 1.125rem;
  font-weight: 500;
  color: var(--clr-light-gray);
}

.uploaded-file__info::after {
  width: 100%;
  background-color: #47b4ac !important;
}

/* Uploaded File */

.uploaded-file {
  display: flex;
  align-items: center;
  padding: 0.625rem 0;
  visibility: hidden;
  opacity: 0;
  transition: none 500ms ease-in-out;
  transition-property: visibility, opacity;
}

/* (duploaded-file--open) Modifier Class */

.uploaded-file--open {
  visibility: visible;
  opacity: 1;
}

.uploaded-file__icon-container {
  position: relative;
  margin-right: 0.3125rem;
}

.uploaded-file__icon {
  font-size: 2rem;
  color: var(--clr-blue);
}

.uploaded-file__icon-text {
  position: absolute;
  top: 1.5rem;
  left: 50%;
  transform: translateX(-50%);
  font-size: 0.9375rem;
  font-weight: 500;
  color: var(--clr-white);
}

.uploaded-file__info {
  position: relative;
  top: -0.3125rem;
  width: 100%;
  display: flex;
  justify-content: space-between;
}

.uploaded-file__info::before,
.uploaded-file__info::after {
  content: "";
  position: absolute;
  bottom: -0.9375rem;
  width: 0;
  height: 0.5rem;
  background-color: #ebf2ff;
  border-radius: 0.625rem;
}

.uploaded-file__info::before {
  width: 100%;
}

.uploaded-file__info::after {
  width: 100%;
  background-color: #47b4ac;
}

/* Progress Animation */

.uploaded-file__info--active::after {
  animation: progressMove 800ms ease-in-out;
  animation-delay: 300ms;
}

@keyframes progressMove {
  from {
    width: 0%;
    background-color: transparent;
  }
  to {
    width: 100%;
    background-color: var(--clr-blue);
  }
}

.uploaded-file__name {
  width: 100%;
  max-width: 6.25rem; /* 100px */
  display: inline-block;
  font-size: 1rem;
  white-space: nowrap;
  overflow: hidden;
  text-overflow: ellipsis;
}

.uploaded-file__counter {
  font-size: 1rem;
  color: var(--clr-light-gray);
}

.ligth th {
  background-color: #f4f5fa !important;
  font-size: 15px !important;
}

.logoContainer {
  width: 140px;
  height: 140px;
  margin: 10px auto;
  /*background: url(http://img1.wikia.nocookie.net/__cb20130901213905/battlebears/images/9/98/Team-icon-placeholder.png) no-repeat 0 0;*/
  padding: 7px;
  text-align: center;
  line-height: 120px;
  border: dotted #47b4ac 2px;
}

.logoContainer img {
  max-width: 100%;
}

.fileContainer {
  background: #47b4ac; /* you can give it background img as well*/
  width: 202px;
  height: 31px;
  overflow: hidden;
  position: relative;
  font-size: 16px;
  line-height: 31px;
  color: #fff;
  border-radius: 10px 10px 0 10px;
  padding: 0px 31px 0 30px;
  margin: 0 auto 60px auto;
  cursor: pointer !important;
}

.fileContainer span {
  overflow: hidden;
  display: block;
  white-space: nowrap;
  text-overflow: ellipsis;
  cursor: pointer;
}

.fileContainer input[type="file"] {
  opacity: 0;
  margin: 0;
  padding: 0;
  width: 100%;
  height: 100%;
  left: 0;
  top: 0;
  position: absolute;
  cursor: pointer;
}

.messages span {
  color: #47b4ac;
  font-weight: bold;
}

.messages-content .message.typing span,
body .messages-content .message.typing::after,
body .chat {
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, 0%);
}

.action-box::after,
body .chat-title::after {
  content: "";
  display: block;
  clear: both;
}

@keyframes ball {
  0% {
    margin-top: 0;
  }
  20% {
    margin-top: 3px;
  }
  80% {
    margin-top: -5px;
  }
}

@keyframes pop {
  0% {
    transform: scale(0.6);
  }
  30% {
    transform: scale(1.1);
  }
  60% {
    transform: scale(0.9);
  }
  100% {
    transform: scale(1);
  }
}

.mCSB_container {
  margin: 0 !important;
}

.mCSB_scrollTools {
  margin-right: -3px;
}

.chat {
  width: 300px;
  height: 80vh;
  max-height: 500px;
  border-radius: 15px;
  background-color: rgba(0, 0, 0, 0.5);
  overflow: hidden;
}

.chat-title {
  background-color: rgba(0, 0, 0, 0.3);
  width: 100%;
  height: 50px;
}

.chat-title h2 {
  position: relative;
  top: -40px;
  opacity: 1;
  color: #f0f0f0;
  font-weight: normal;
  font-size: 16px;
  display: inline-block;
  line-height: 30px;
}

.chat-title .avatar {
  float: left;
  margin: 10px;
  padding: 0;
  width: 30px;
  height: 30px;
}

.chat-title .avatar img {
  border-radius: 50%;
  width: 30px;
  height: 30px;
}

.messages {
  width: 100%;
  height: calc(100% - 90px);
}

.messages-content {
  width: 100%;
  height: 100%;
  overflow-y: auto;
  box-sizing: border-box;
}

.messages-content .message {
  max-width: calc(100% - 76px);
  padding: 8px;
  margin: 8px 0 8px 12px;
  border-radius: 5px;
  background-color: #425270 !important;
  color: #fff;
  float: left;
  font-size: 13px;
  position: relative;
  /* word-break: break-all;*/
  word-break: break-word;
  clear: both;
  animation: pop 0.3s forwards;
}

.messages-content .message .timestamp {
  position: absolute;
  right: -40px;
  bottom: 0;
  font-size: 12px;
  color: #bababa;
}

.messages-content .message.personal {
  float: right;
  margin: 8px 12px 8px 0;
}

.messages-content .message.personal .timestamp {
  right: auto;
  left: -40px;
}

.messages-content .message.typing {
  width: 30px;
  height: 16px;
}

.messages-content .message.typing::after {
  content: "";
  border-radius: 50%;
  width: 3px;
  height: 3px;
  background-color: white;
  transform: translate(-50%, -50%);
  animation: ball 1.2s infinite linear;
}

.messages-content .message.typing span {
  width: 3px;
  height: 3px;
  transform: translate(-50%, -50%);
}

.messages-content .message.typing span::before,
body .messages-content .message.typing span::after {
  content: "";
  border-radius: 50%;
  width: 3px;
  height: 3px;
  position: absolute;
  background-color: white;
  animation: ball 1.2s infinite linear;
}

.messages-content .message.typing span::before {
  left: 8px;
  animation-delay: 0.3s;
}

.messages-content .message.typing span::after {
  right: 8px;
  animation-delay: -0.3s;
}

.action-box {
  background-color: rgba(0, 0, 0, 0.3);
  width: 100%;
  height: 40px;
}

.action-box-input,
body .action-box-submit {
  box-sizing: border-box;
  border: 0;
  float: left;
}

.action-box-input {
  width: calc(100% - 60px);
  background-color: transparent;
  resize: none;
  color: white;
  padding: 0 10px;
  font-size: 16px;
  letter-spacing: 1px;
  overflow: hidden;
}

.action-box-input::-webkit-input-placeholder {
  line-height: 20px;
  font-size: 13px;
}

.action-box-submit {
  width: 60px;
  height: 40px;
  background-color: rgba(189, 195, 199, 0.2);
  color: white;
  cursor: pointer;
}

.sender_id_head h6 {
  position: relative;
  top: 10px;
  text-align: center;
}

.sender_id_head {
  position: absolute;
  width: 100%;
  clear: both;
  background: #ebebeb;
  top: 21px;
  height: 40px;
}

.icon_mobile_top_new {
  text-align: right;
  padding-right: 5px;
}

.mt-140 {
  margin-top: 139px;
}

.header_mobile_top {
  width: 100%;
  background-color: #fff;
  margin: 0px auto;
  position: absolute;
}

.icon_mobile_top_new ul li {
  display: inline-block;
  color: #000;
  opacity: 1;
  font-size: 13px;
  margin: 0px;
  padding: 0px;
  font-weight: bold;
}

.icon_mobile_top_new ul {
  margin: 0px;
  padding: 0px;
}

.mobile {
  position: relative;
  width: 270px;
  height: 480px;
  background: #020c17;
}

.top_as {
  position: absolute;
  top: -50px;
  width: 100%;
  height: 50px;
  background: #efefef;
  border-top-left-radius: 40px;
  border-top-right-radius: 40px;
}

.top_as:before {
  content: "";
  position: absolute;
  top: 50%;
  left: 35%;
  transform: translateY(-50%);
  width: 4px;
  height: 4px;
  background: #ccc;
  border: 2px solid #aaa;
  border-radius: 50%;
  box-shadow: 0 0 0 1px #999;
}

.top_as:after {
  content: "";
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
  width: 40px;
  height: 3px;
  background: #333;
  border: 2px solid #aaa;
  border-radius: 3px;
}

.bottom_as {
  position: absolute;
  bottom: -50px;
  width: 100%;
  height: 50px;
  background: #efefef;
  border-bottom-left-radius: 40px;
  border-bottom-right-radius: 40px;
}

.bottom_as:before {
  content: "";
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
  width: 15px;
  height: 15px;
  border: 2px solid #999;
  cursor: pointer;
  border-radius: 6px;
}

.screen_as {
  position: relative;
  width: 100%;
  height: 100%;
  overflow: hidden;
  display: flex;
  justify-content: center;
}

.screen_as img {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  object-fit: cover;
  opacity: 0;
  transition: 0.5s;
}

.screen_as.active img {
  opacity: 1;
}

.screen_as:before {
  content: "";
  position: absolute;
  top: 0;
  left: -50%;
  width: 100%;
  height: 100%;
  background: rgba(255, 255, 255, 0.1);
  z-index: 1;
  transform: skewX(-5deg);
}

/*h2
{
	color: #fff;
	font-weight: 200;
	font-size: 3.5em;
	z-index: 1;
	transform: translateY(50px);
	line-height: 0.4em;
	transition: 0.5s;
	text-shadow: 0 1px 3px rgba(0,0,0,.5);
	opacity: 0;
}*/

.screen_as.active h2 {
  transform: translateY(0px);
  opacity: 1;
  transition-delay: 0.5s;
}

.badge-success {
  color: #fff !important;
  background-color: #47b473 !important;
}

.badge-success {
  color: #fff !important;
  background-color: #47b473 !important;
}

a.badge-success:hover,
a.badge-success:focus,
button.badge-success:hover,
button.badge-success:focus {
  color: #fff !important;
  background-color: #398f5c !important;
}

.bg-info {
  color: #fff !important;
  background-color: #1b98e0 !important;
}

a.bg-info:hover,
a.bg-info:focus,
button.bg-info:hover,
button.bg-info:focus {
  color: #fff !important;
  background-color: #1679b2 !important;
}

.badge-info {
  color: #fff !important;
  background-color: #1b98e0 !important;
}

a.badge-info:hover,
a.badge-info:focus,
button.badge-info:hover,
button.badge-info:focus {
  color: #fff !important;
  background-color: #1679b2 !important;
}

.bg-warning {
  color: #fff !important;
  background-color: #cca43b !important;
}

a.bg-warning:hover,
a.bg-warning:focus,
button.bg-warning:hover,
button.bg-warning:focus {
  color: #fff !important;
  background-color: #a8862c !important;
}

.badge-warning {
  color: #fff !important;
  background-color: #cca43b !important;
}

a.badge-warning:hover,
a.badge-warning:focus,
button.badge-warning:hover,
button.badge-warning:focus {
  color: #fff !important;
  background-color: #a8862c !important;
}

.bg-danger {
  color: #fff !important;
  background-color: #d75842 !important;
}

a.bg-danger:hover,
a.bg-danger:focus,
button.bg-danger:hover,
button.bg-danger:focus {
  color: #fff !important;
  background-color: #be3e28 !important;
}

.badge-danger {
  color: #fff !important;
  background-color: #d75842 !important;
}

a.badge-danger:hover,
a.badge-danger:focus,
button.badge-danger:hover,
button.badge-danger:focus {
  color: #fff !important;
  background-color: #be3e28 !important;
}

.bg-light {
  color: #212529 !important;
  background-color: #f6f8fb !important;
}

a.bg-light:hover,
a.bg-light:focus,
button.bg-light:hover,
button.bg-light:focus {
  color: #fff !important;
  background-color: #d3ddeb !important;
}

.badge-light {
  color: #212529 !important;
  background-color: #f6f8fb !important;
}

a.badge-light:hover,
a.badge-light:focus,
button.badge-light:hover,
button.badge-light:focus {
  color: #fff !important;
  background-color: #d3ddeb !important;
}

.bg-dark {
  color: #fff !important;
  background-color: #01041b !important;
}

a.bg-dark:hover,
a.bg-dark:focus,
button.bg-dark:hover,
button.bg-dark:focus {
  color: #fff !important;
  background-color: black !important;
}

.badge-dark {
  color: #fff !important;
  background-color: #01041b !important;
}

a.badge-dark:hover,
a.badge-dark:focus,
button.badge-dark:hover,
button.badge-dark:focus {
  color: #fff !important;
  background-color: black !important;
}

.bg-orange {
  color: #fff !important;
  background-color: #323c9c !important;
}

a.bg-orange:hover,
a.bg-orange:focus,
button.bg-orange:hover,
button.bg-orange:focus {
  color: #fff !important;
  background-color: #262d75 !important;
}

.badge-orange {
  color: #fff !important;
  background-color: #323c9c !important;
}

a.badge-orange:hover,
a.badge-orange:focus,
button.badge-orange:hover,
button.badge-orange:focus {
  color: #fff !important;
  background-color: #262d75 !important;
}

.bg-purple {
  color: #fff !important;
  background-color: #4731b6 !important;
}

a.bg-purple:hover,
a.bg-purple:focus,
button.bg-purple:hover,
button.bg-purple:focus {
  color: #fff !important;
  background-color: #37268e !important;
}

.badge-purple {
  color: #fff !important;
  background-color: #4731b6 !important;
}

a.badge-purple:hover,
a.badge-purple:focus,
button.badge-purple:hover,
button.badge-purple:focus {
  color: #fff !important;
  background-color: #37268e !important;
}

.bg-skyblue {
  color: #fff !important;
  background-color: #158df7 !important;
}

a.bg-skyblue:hover,
a.bg-skyblue:focus,
button.bg-skyblue:hover,
button.bg-skyblue:focus {
  color: #fff !important;
  background-color: #0773d2 !important;
}

.badge-skyblue {
  color: #fff !important;
  background-color: #158df7 !important;
}

a.badge-skyblue:hover,
a.badge-skyblue:focus,
button.badge-skyblue:hover,
button.badge-skyblue:focus {
  color: #fff !important;
  background-color: #0773d2 !important;
}

.bg-light-gray {
  color: #212529 !important;
  background-color: #f4f5fa !important;
}

a.bg-light-gray:hover,
a.bg-light-gray:focus,
button.bg-light-gray:hover,
button.bg-light-gray:focus {
  color: #fff !important;
  background-color: #d1d5ea !important;
}

.badge-light-gray {
  color: #212529 !important;
  background-color: #f4f5fa !important;
}

a.badge-light-gray:hover,
a.badge-light-gray:focus,
button.badge-light-gray:hover,
button.badge-light-gray:focus {
  color: #fff !important;
  background-color: #d1d5ea !important;
}

.bg-white {
  color: #212529 !important;
  background-color: #fff !important;
}

a.bg-white:hover,
a.bg-white:focus,
button.bg-white:hover,
button.bg-white:focus {
  color: #fff !important;
  background-color: #e6e6e6 !important;
}

.badge-white {
  color: #212529 !important;
  background-color: #fff !important;
}

a.badge-white:hover,
a.badge-white:focus,
button.badge-white:hover,
button.badge-white:focus {
  color: #fff !important;
  background-color: #e6e6e6 !important;
}

.bg-primary-light {
  color: #2aa88c !important;
  background-color: #dbf6f0 !important;
}

a.bg-primary-light:hover,
a.bg-primary-light:focus,
button.bg-primary-light:hover,
button.bg-primary-light:focus {
  color: #2aa88c !important;
  background-color: #b2ecdf !important;
}

.bg-secondary-light {
  color: #222a6d !important;
  background-color: #aab0e4 !important;
}

a.bg-secondary-light:hover,
a.bg-secondary-light:focus,
button.bg-secondary-light:hover,
button.bg-secondary-light:focus {
  color: #222a6d !important;
  background-color: #838cd8 !important;
}

.bg-success-light {
  color: #2c6e47 !important;
  background-color: #b6e2c8 !important;
}

a.bg-success-light:hover,
a.bg-success-light:focus,
button.bg-success-light:hover,
button.bg-success-light:focus {
  color: #2c6e47 !important;
  background-color: #92d4ad !important;
}

.bg-info-light {
  color: #136390 !important;
  background-color: #aedbf4 !important;
}

a.bg-info-light:hover,
a.bg-info-light:focus,
button.bg-info-light:hover,
button.bg-info-light:focus {
  color: #136390 !important;
  background-color: #81c7ee !important;
}

.bg-warning-light {
  color: #816722 !important;
  background-color: #ecddb6 !important;
}

a.bg-warning-light:hover,
a.bg-warning-light:focus,
button.bg-warning-light:hover,
button.bg-warning-light:focus {
  color: #816722 !important;
  background-color: #e1ca8e !important;
}

.bg-danger-light {
  color: #7e2a1b !important;
  background-color: #edb5ab !important;
}

a.bg-danger-light:hover,
a.bg-danger-light:focus,
button.bg-danger-light:hover,
button.bg-danger-light:focus {
  color: #7e2a1b !important;
  background-color: #e49081 !important;
}

.bg-light-light {
  color: #4a70a8 !important;
  background-color: #f6f8fb !important;
}

a.bg-light-light:hover,
a.bg-light-light:focus,
button.bg-light-light:hover,
button.bg-light-light:focus {
  color: #4a70a8 !important;
  background-color: #d3ddeb !important;
}

.bg-dark-light {
  color: rgba(68, 74, 87, 0.1) !important;
  background-color: rgba(199, 203, 211, 0.1) !important;
}

a.bg-dark-light:hover,
a.bg-dark-light:focus,
button.bg-dark-light:hover,
button.bg-dark-light:focus {
  color: rgba(68, 74, 87, 0.1) !important;
  background-color: rgba(170, 176, 189, 0.1) !important;
}

.bg-orange-light {
  color: #222a6d !important;
  background-color: #aab0e4 !important;
}

a.bg-orange-light:hover,
a.bg-orange-light:focus,
button.bg-orange-light:hover,
button.bg-orange-light:focus {
  color: #222a6d !important;
  background-color: #838cd8 !important;
}

.bg-purple-light {
  color: #2200c0 !important;
  background-color: #cbc0ff !important;
}

a.bg-purple-light:hover,
a.bg-purple-light:focus,
button.bg-purple-light:hover,
button.bg-purple-light:focus {
  color: #2200c0 !important;
  background-color: #a18dff !important;
}

.bg-skyblue-light {
  color: #005aaa !important;
  background-color: #aad7ff !important;
}

a.bg-skyblue-light:hover,
a.bg-skyblue-light:focus,
button.bg-skyblue-light:hover,
button.bg-skyblue-light:focus {
  color: #005aaa !important;
  background-color: #77bfff !important;
}

.bg-white-light {
  color: gray !important;
  background-color: #fff !important;
}

a.bg-white-light:hover,
a.bg-white-light:focus,
button.bg-white-light:hover,
button.bg-white-light:focus {
  color: gray !important;
  background-color: #e6e6e6 !important;
}

.btn-outline-info {
  color: #1b98e0 !important;
  border-color: #1b98e0 !important;
}

.btn-outline-success {
  color: #198754 !important;
  border-color: #198754 !important;
}

.btn-outline-danger {
  color: #d75842 !important;
  border-color: #d75842 !important;
}

.btn-outline-info:hover {
  color: #fff;
  background-color: #1b98e0;
  border-color: #1b98e0;
}

.btn-outline-info:focus,
.btn-outline-info.focus {
  box-shadow: 0 0 0 0.2rem rgba(27, 152, 224, 0.5);
}

.btn-outline-info.disabled,
.btn-outline-info:disabled {
  color: #1b98e0;
  background-color: transparent;
}

.btn-outline-info:not(:disabled):not(.disabled):active,
.btn-outline-info:not(:disabled):not(.disabled).active,
.show > .btn-outline-info.dropdown-toggle {
  color: #fff;
  background-color: #1b98e0;
  border-color: #1b98e0;
}

.btn-outline-info:not(:disabled):not(.disabled):active:focus,
.btn-outline-info:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-info.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(27, 152, 224, 0.5);
}

.btn-outline-warning {
  color: #cca43b;
  border-color: #cca43b;
}

.btn-outline-warning:hover {
  color: #fff;
  background-color: #cca43b;
  border-color: #cca43b;
}

.btn-outline-warning:focus,
.btn-outline-warning.focus {
  box-shadow: 0 0 0 0.2rem rgba(204, 164, 59, 0.5);
}

.btn-outline-warning.disabled,
.btn-outline-warning:disabled {
  color: #cca43b;
  background-color: transparent;
}

.btn-outline-warning:not(:disabled):not(.disabled):active,
.btn-outline-warning:not(:disabled):not(.disabled).active,
.show > .btn-outline-warning.dropdown-toggle {
  color: #fff;
  background-color: #cca43b;
  border-color: #cca43b;
}

.btn-outline-warning:not(:disabled):not(.disabled):active:focus,
.btn-outline-warning:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-warning.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(204, 164, 59, 0.5);
}

.btn-outline-danger {
  color: #d75842;
  border-color: #d75842;
}

.btn-outline-danger:hover {
  color: #fff;
  background-color: #d75842;
  border-color: #d75842;
}

.btn-outline-danger:focus,
.btn-outline-danger.focus {
  box-shadow: 0 0 0 0.2rem rgba(215, 88, 66, 0.5);
}

.btn-outline-danger.disabled,
.btn-outline-danger:disabled {
  color: #d75842;
  background-color: transparent;
}

.btn-outline-danger:not(:disabled):not(.disabled):active,
.btn-outline-danger:not(:disabled):not(.disabled).active,
.show > .btn-outline-danger.dropdown-toggle {
  color: #fff;
  background-color: #d75842;
  border-color: #d75842;
}

.btn-outline-danger:not(:disabled):not(.disabled):active:focus,
.btn-outline-danger:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-danger.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(215, 88, 66, 0.5);
}

.btn-outline-light {
  color: #f6f8fb;
  border-color: #f6f8fb;
}

.btn-outline-light:hover {
  color: #212529;
  background-color: #f6f8fb;
  border-color: #f6f8fb;
}

.btn-outline-light:focus,
.btn-outline-light.focus {
  box-shadow: 0 0 0 0.2rem rgba(246, 248, 251, 0.5);
}

.btn-outline-light.disabled,
.btn-outline-light:disabled {
  color: #f6f8fb;
  background-color: transparent;
}

.btn-outline-light:not(:disabled):not(.disabled):active,
.btn-outline-light:not(:disabled):not(.disabled).active,
.show > .btn-outline-light.dropdown-toggle {
  color: #212529;
  background-color: #f6f8fb;
  border-color: #f6f8fb;
}

.btn-outline-light:not(:disabled):not(.disabled):active:focus,
.btn-outline-light:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-light.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(246, 248, 251, 0.5);
}

.btn-outline-dark {
  color: #01041b;
  border-color: #01041b;
}

.btn-outline-dark:hover {
  color: #fff;
  background-color: #01041b;
  border-color: #01041b;
}

.btn-outline-dark:focus,
.btn-outline-dark.focus {
  box-shadow: 0 0 0 0.2rem rgba(1, 4, 27, 0.5);
}

.btn-outline-dark.disabled,
.btn-outline-dark:disabled {
  color: #01041b;
  background-color: transparent;
}

.btn-outline-dark:not(:disabled):not(.disabled):active,
.btn-outline-dark:not(:disabled):not(.disabled).active,
.show > .btn-outline-dark.dropdown-toggle {
  color: #fff;
  background-color: #01041b;
  border-color: #01041b;
}

.btn-outline-dark:not(:disabled):not(.disabled):active:focus,
.btn-outline-dark:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-dark.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(1, 4, 27, 0.5);
}

.btn-outline-orange {
  color: #323c9c;
  border-color: #323c9c;
}

.btn-outline-orange:hover {
  color: #fff;
  background-color: #323c9c;
  border-color: #323c9c;
}

.btn-outline-orange:focus,
.btn-outline-orange.focus {
  box-shadow: 0 0 0 0.2rem rgba(50, 60, 156, 0.5);
}

.btn-outline-orange.disabled,
.btn-outline-orange:disabled {
  color: #323c9c;
  background-color: transparent;
}

.btn-outline-orange:not(:disabled):not(.disabled):active,
.btn-outline-orange:not(:disabled):not(.disabled).active,
.show > .btn-outline-orange.dropdown-toggle {
  color: #fff;
  background-color: #323c9c;
  border-color: #323c9c;
}

.btn-outline-orange:not(:disabled):not(.disabled):active:focus,
.btn-outline-orange:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-orange.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(50, 60, 156, 0.5);
}

.btn-outline-purple {
  color: #4731b6;
  border-color: #4731b6;
}

.btn-outline-purple:hover {
  color: #fff;
  background-color: #4731b6;
  border-color: #4731b6;
}

.btn-outline-purple:focus,
.btn-outline-purple.focus {
  box-shadow: 0 0 0 0.2rem rgba(71, 49, 182, 0.5);
}

.btn-outline-purple.disabled,
.btn-outline-purple:disabled {
  color: #4731b6;
  background-color: transparent;
}

.btn-outline-purple:not(:disabled):not(.disabled):active,
.btn-outline-purple:not(:disabled):not(.disabled).active,
.show > .btn-outline-purple.dropdown-toggle {
  color: #fff;
  background-color: #4731b6;
  border-color: #4731b6;
}

.btn-outline-purple:not(:disabled):not(.disabled):active:focus,
.btn-outline-purple:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-purple.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(71, 49, 182, 0.5);
}

.btn-outline-skyblue {
  color: #158df7;
  border-color: #158df7;
}

.btn-outline-skyblue:hover {
  color: #fff;
  background-color: #158df7;
  border-color: #158df7;
}

.btn-outline-skyblue:focus,
.btn-outline-skyblue.focus {
  box-shadow: 0 0 0 0.2rem rgba(21, 141, 247, 0.5);
}

.btn-outline-skyblue.disabled,
.btn-outline-skyblue:disabled {
  color: #158df7;
  background-color: transparent;
}

.btn-outline-skyblue:not(:disabled):not(.disabled):active,
.btn-outline-skyblue:not(:disabled):not(.disabled).active,
.show > .btn-outline-skyblue.dropdown-toggle {
  color: #fff;
  background-color: #158df7;
  border-color: #158df7;
}

.btn-outline-skyblue:not(:disabled):not(.disabled):active:focus,
.btn-outline-skyblue:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-skyblue.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(21, 141, 247, 0.5);
}

.btn-outline-light-gray {
  color: #f4f5fa;
  border-color: #f4f5fa;
}

.btn-outline-light-gray:hover {
  color: #212529;
  background-color: #f4f5fa;
  border-color: #f4f5fa;
}

.btn-outline-light-gray:focus,
.btn-outline-light-gray.focus {
  box-shadow: 0 0 0 0.2rem rgba(244, 245, 250, 0.5);
}

.btn-outline-light-gray.disabled,
.btn-outline-light-gray:disabled {
  color: #f4f5fa;
  background-color: transparent;
}

.btn-outline-light-gray:not(:disabled):not(.disabled):active,
.btn-outline-light-gray:not(:disabled):not(.disabled).active,
.show > .btn-outline-light-gray.dropdown-toggle {
  color: #212529;
  background-color: #f4f5fa;
  border-color: #f4f5fa;
}

.btn-outline-light-gray:not(:disabled):not(.disabled):active:focus,
.btn-outline-light-gray:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-light-gray.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(244, 245, 250, 0.5);
}

.btn-outline-white {
  color: #fff;
  border-color: #fff;
}

.btn-outline-white:hover {
  color: #212529;
  background-color: #fff;
  border-color: #fff;
}

.btn-outline-white:focus,
.btn-outline-white.focus {
  box-shadow: 0 0 0 0.2rem rgba(255, 255, 255, 0.5);
}

.btn-outline-white.disabled,
.btn-outline-white:disabled {
  color: #fff;
  background-color: transparent;
}

.btn-outline-white:not(:disabled):not(.disabled):active,
.btn-outline-white:not(:disabled):not(.disabled).active,
.show > .btn-outline-white.dropdown-toggle {
  color: #212529;
  background-color: #fff;
  border-color: #fff;
}

.btn-outline-white:not(:disabled):not(.disabled):active:focus,
.btn-outline-white:not(:disabled):not(.disabled).active:focus,
.show > .btn-outline-white.dropdown-toggle:focus {
  box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125),
    0 0 0 0.2rem rgba(255, 255, 255, 0.5);
}

/*.screen_as ul
{
	position: absolute;
	margin: 0;
	padding: 0;
	bottom: 0;
	display: flex;
	z-index: 1;
	justify-content: space-around;
	width: 100%;
}
.screen_as ul li
{
	list-style: none;
	color: #fff;
	font-size: 1.5em;
	padding-bottom: 10px;
	cursor: pointer;
	transition: 0.5s;
	opacity: 0;
	transform: translateY(20px);
}*/

.screen_as.active ul li {
  opacity: 1;
  transform: translateY(0px);
  transition-delay: 0.5s;
}

.screen_as.active ul li:nth-child(2) {
  transition-delay: 0.7s;
}

.screen_as.active ul li:nth-child(3) {
  transition-delay: 0.9s;
}

.screen_as.active ul li:nth-child(4) {
  transition-delay: 1.1s;
}

.screen_as.active ul li .fa {
  transition: 0.5s;
}

.screen_as.active ul li:hover .fa {
  transform: translateY(-10px);
}

.youtube {
  position: fixed;
  bottom: 10px;
  right: 10px;
  background: #f00;
  font-family: verdana;
  padding: 5px;
  border-radius: 5px;
  animation: youtube 0.5s linear infinite;
}

.youtube a {
  text-decoration: none;
  color: #fff;
}

@keyframes youtube {
  0% {
    transform: scaleX(1);
  }
  50% {
    transform: scaleX(0.95);
  }
  100% {
    transform: scaleX(1);
  }
}

.fileUpload {
  position: relative;
  overflow: hidden;
  margin: 10px;
}

.fileUpload input.upload {
  position: absolute;
  top: 0;
  right: 0;
  margin: 0;
  padding: 0;
  font-size: 20px;
  cursor: pointer;
  opacity: 0;
  filter: alpha(opacity=0);
}

.btn-outline-primary {
  color: #47b4ac !important;
  border-color: #47b4ac;
}

.btn-outline-primary:hover {
  color: #fff !important;
  background-color: #47b4ac;
  border-color: #47b4ac;
}

.custom-control {
  position: relative;
  display: block;
  min-height: 21;
  padding-left: 1.5rem;
}

.custom-control-inline {
  display: inline-flex;
  margin-right: 0px;
}

.text-left {
  text-align: left;
}

.text-right {
  text-align: right;
}

.custom-control-input {
  position: absolute;
  left: 0;
  z-index: -1;
  width: 1rem;
  height: 11rem;
  opacity: 0;
}

.custom-control-input:checked ~ .custom-control-label::before {
  color: #fff;
  border-color: #47b4ac;
  background-color: #47b4ac;
  box-shadow: none;
}

.custom-control-input:focus ~ .custom-control-label::before {
  box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075),
    0 0 0 0.2rem rgba(71, 180, 172, 0.25);
}

.custom-control-input:focus:not(:checked) ~ .custom-control-label::before {
  border-color: #a1dad6;
}

.custom-control-input:not(:disabled):active ~ .custom-control-label::before {
  color: #fff;
  background-color: #c5e8e6;
  border-color: #c5e8e6;
  box-shadow: none;
}

.custom-control-input[disabled] ~ .custom-control-label,
.custom-control-input:disabled ~ .custom-control-label {
  color: #6c757d;
}

.custom-control-input[disabled] ~ .custom-control-label::before,
.custom-control-input:disabled ~ .custom-control-label::before {
  background-color: #e9ecef;
}

.custom-control-label {
  position: relative;
  margin-bottom: 0;
  vertical-align: top;
}

.custom-control-label::before {
  position: absolute;
  left: -1.5rem;
  display: block;
  width: 1rem;
  height: 1rem;
  pointer-events: none;
  content: "";
  background-color: #fff;
  border: #adb5bd solid 1px;
  box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
}

.custom-control-label::after {
  position: absolute;
  left: -1.5rem;
  top: 3px;
  display: block;
  width: 1rem;
  height: 1rem;
  content: "";
  background: no-repeat 50% / 50% 50%;
}

.custom-checkbox .custom-control-label::before {
  border-radius: 10px 10px 0 10px;
}

.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3e%3c/svg%3e");
}

/*  .non_right .custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
background-image:none !important;
  }
*/

.custom-checkbox
  .custom-control-input:indeterminate
  ~ .custom-control-label::before {
  border-color: #47b4ac;
  background-color: #47b4ac;
  box-shadow: none;
}

.custom-checkbox
  .custom-control-input:indeterminate
  ~ .custom-control-label::after {
  /*  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='4' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e");*/
}

.custom-control-label {
  color: #000;
}

.custom-checkbox
  .custom-control-input:disabled:checked
  ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5);
}

.custom-checkbox
  .custom-control-input:disabled:indeterminate
  ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5);
}

.custom-radio .custom-control-label::before {
  border-radius: 50%;
}

.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e");
}

.custom-radio
  .custom-control-input:disabled:checked
  ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5);
}

.custom-switch {
  padding-left: 2.25rem;
}

.custom-switch .custom-control-label::before {
  left: -2.25rem;
  width: 1.75rem;
  pointer-events: all;
  border-radius: 0.5rem;
}

.custom-switch .custom-control-label::after {
  top: calc(10rem + 2px);
  left: calc(-2.25rem + 2px);
  width: calc(1rem - 4px);
  height: calc(1rem - 4px);
  background-color: #adb5bd;
  border-radius: 0.5rem;
  transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out,
    border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}

@media (prefers-reduced-motion: reduce) {
  .custom-switch .custom-control-label::after {
    transition: none;
  }
}

.custom-switch .custom-control-input:checked ~ .custom-control-label::after {
  background-color: #fff;
  transform: translateX(0.75rem);
}

.custom-switch
  .custom-control-input:disabled:checked
  ~ .custom-control-label::before {
  background-color: rgba(71, 180, 172, 0.5);
}

.custom-select {
  display: inline-block;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  padding: 0.625rem 1.938rem 0.625rem 0.938rem;
  font-size: 0.875rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  vertical-align: middle;
  background: #fff
    url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2301041b' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e")
    no-repeat right 0.938rem center/8px 10px;
  border: 1px solid #ced4da;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075);
  appearance: none;
}

.custom-select:focus {
  border-color: #a1dad6;
  outline: 0;
  box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075),
    0 0 0 0.2rem rgba(71, 180, 172, 0.25);
}

.custom-select:focus::-ms-value {
  color: #495057;
  background-color: #fff;
}

.custom-select[multiple],
.custom-select[size]:not([size="1"]) {
  height: auto;
  padding-right: 0.938rem;
  background-image: none;
}

.custom-select:disabled {
  color: #6c757d;
  background-color: #e9ecef;
}

.custom-select::-ms-expand {
  display: none;
}

.custom-select:-moz-focusring {
  color: transparent;
  text-shadow: 0 0 0 #495057;
}

.custom-select-sm {
  height: calc(1.5em + 0.626rem + 2px);
  padding-top: 0.313rem;
  padding-bottom: 0.313rem;
  padding-left: 0.625rem;
  font-size: 0.75rem;
}

.custom-select-lg {
  height: calc(1.5em + 1.876rem + 2px);
  padding-top: 0.938rem;
  padding-bottom: 0.938rem;
  padding-left: 1.25rem;
  font-size: 1.25rem;
}

.custom-file {
  position: relative;
  display: inline-block;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  margin-bottom: 0;
}

.custom-file-input {
  position: relative;
  z-index: 2;
  width: 100%;
  height: calc(1.5em + 1.25rem + 2px);
  margin: 0;
  opacity: 0;
}

.custom-file-input:focus ~ .custom-file-label {
  border-color: #a1dad6;
  box-shadow: 0 0 0 0.2rem rgba(71, 180, 172, 0.25);
}

.custom-file-input[disabled] ~ .custom-file-label,
.custom-file-input:disabled ~ .custom-file-label {
  background-color: #e9ecef;
}

.custom-file-input:lang(en) ~ .custom-file-label::after {
  content: "Browse";
}

.custom-file-input ~ .custom-file-label[data-browse]::after {
  content: attr(data-browse);
}

.custom-file-label {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1;
  height: calc(1.5em + 1.25rem + 2px);
  padding: 0.625rem 0.938rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  background-color: #fff;
  border: 1px solid #ced4da;
  border-radius: 10px 10px 0 10px;
  box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
}

.custom-file-label::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  z-index: 3;
  display: block;
  height: calc(1.5em + 1.25rem);
  padding: 0.625rem 0.938rem;
  line-height: 1.5;
  color: #495057;
  content: "Browse";
  background-color: #e9ecef;
  border-left: inherit;
  border-radius: 0 10px 10px 0 10px 10px 10px 0 10px 0;
}

.custom-range {
  width: 100%;
  height: 1.4rem;
  padding: 0;
  background-color: transparent;
  appearance: none;
}

.custom-range:focus {
  outline: none;
}

.custom-range:focus::-webkit-slider-thumb {
  box-shadow: 0 0 0 1px #ffffff, 0 0 0 0.2rem rgba(71, 180, 172, 0.25);
}

.custom-range:focus::-moz-range-thumb {
  box-shadow: 0 0 0 1px #ffffff, 0 0 0 0.2rem rgba(71, 180, 172, 0.25);
}

.custom-range:focus::-ms-thumb {
  box-shadow: 0 0 0 1px #ffffff, 0 0 0 0.2rem rgba(71, 180, 172, 0.25);
}

.custom-range::-moz-focus-outer {
  border: 0;
}

.custom-range::-webkit-slider-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: -0.25rem;
  background-color: #47b4ac;
  border: 0;
  border-radius: 1rem;
  box-shadow: 0 0.1rem 0.25rem rgba(0, 0, 0, 0.1);
  -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
  appearance: none;
}

@media (prefers-reduced-motion: reduce) {
  .custom-range::-webkit-slider-thumb {
    -webkit-transition: none;
    transition: none;
  }
}

.custom-range::-webkit-slider-thumb:active {
  background-color: #c5e8e6;
}

.custom-range::-webkit-slider-runnable-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: #ccced2;
  border-color: transparent;
  border-radius: 1rem;
  box-shadow: inset 0 0.25rem 0.25rem rgba(0, 0, 0, 0.1);
}

.custom-range::-moz-range-thumb {
  width: 1rem;
  height: 1rem;
  background-color: #47b4ac;
  border: 0;
  border-radius: 1rem;
  box-shadow: 0 0.1rem 0.25rem rgba(0, 0, 0, 0.1);
  -moz-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
  appearance: none;
}

@media (prefers-reduced-motion: reduce) {
  .custom-range::-moz-range-thumb {
    -moz-transition: none;
    transition: none;
  }
}

.custom-range::-moz-range-thumb:active {
  background-color: #c5e8e6;
}

.custom-range::-moz-range-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: #ccced2;
  border-color: transparent;
  border-radius: 1rem;
  box-shadow: inset 0 0.25rem 0.25rem rgba(0, 0, 0, 0.1);
}

.custom-range::-ms-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: 0;
  margin-right: 0.2rem;
  margin-left: 0.2rem;
  background-color: #47b4ac;
  border: 0;
  border-radius: 1rem;
  box-shadow: 0 0.1rem 0.25rem rgba(0, 0, 0, 0.1);
  -ms-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
  appearance: none;
}

@media (prefers-reduced-motion: reduce) {
  .custom-range::-ms-thumb {
    -ms-transition: none;
    transition: none;
  }
}

.custom-range::-ms-thumb:active {
  background-color: #c5e8e6;
}

.custom-range::-ms-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: transparent;
  border-color: transparent;
  border-width: 0.5rem;
  box-shadow: inset 0 0.25rem 0.25rem rgba(0, 0, 0, 0.1);
}

.custom-range::-ms-fill-lower {
  background-color: #ccced2;
  border-radius: 1rem;
}

.custom-range::-ms-fill-upper {
  margin-right: 15px;
  background-color: #ccced2;
  border-radius: 1rem;
}

.custom-range:disabled::-webkit-slider-thumb {
  background-color: #adb5bd;
}

.custom-range:disabled::-webkit-slider-runnable-track {
  cursor: default;
}

.custom-range:disabled::-moz-range-thumb {
  background-color: #adb5bd;
}

.custom-range:disabled::-moz-range-track {
  cursor: default;
}

.custom-range:disabled::-ms-thumb {
  background-color: #adb5bd;
}

.custom-control-label::before,
.custom-file-label,
.custom-select {
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out,
    box-shadow 0.15s ease-in-out;
}

@media (prefers-reduced-motion: reduce) {
  .custom-control-label::before,
  .custom-file-label,
  .custom-select {
    transition: none;
  }
}

/*New send SMS form*/

.mobile_no_box_new textarea {
  width: 100%;
  background-color: #ebebeb;
  border: none;
  font-weight: bold;
  padding: 10px;
}

.footer_mod_10 {
  padding: 10px 20px;
  border: none;
}

.DRAFT_list_all ul {
  margin: 0px;
  padding: 0px;
}

.DRAFT_list_all li {
  background-color: #fff;
  margin: 15px 0px;
  padding: 10px;
  border-radius: 5px;
  border: 1px solid #eee;
  list-style: none;
}

.DRAFT_list ul {
  margin: 0px;
  padding: 0px;
}

.DRAFT_list li {
  border: none;
  margin: 0px;
  padding: 0px;
  list-style: none;
}

.DRAFT_list span {
  font-weight: bold;
}

.scroll_box {
  height: 400px;
  overflow-y: scroll;
  scrollbar-width: thin;
  width: 100%;
  padding: 0px 10px 0px 0px;
}

.Template_list_all li {
  background-color: #fff;
  margin: 15px 0px;
  padding: 10px;
  border-radius: 5px;
  border: 1px solid #eee;
  list-style: none;
}

.Template_list_all ul {
  margin: 0px;
  padding: 0px;
}

.mod_head_bg {
  background-color: #425270 !important;
  color: #fff !important;
  padding: 10px 20px;
}

.mod_head_bg h5 {
  color: #fff !important;
}

.mod_head_bg span {
  color: #fff !important;
}

.mod_bg {
  background-color: #ebebeb !important;
}

.inpu_color input {
  background-color: #ebebeb;
  border: none;
}

.icon_input_bg {
  background-color: #fff !important;
  border: none !important;
}

.btn-outline-primary2 {
  color: #7b8294;
  border-color: #7b8294;
}

.table-responsive {
  height: 100%;
  overflow: auto;
  max-height: 590px;
  margin-bottom: 10px;
}

.mobile_no_box_new p {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 5px;
}

.mobile_no_box_new i {
  font-size: 26px;
  font-weight: 600;
  color: #47b4ac;
  vertical-align: middle !important;
}

.Pending_color {
  background-color: #ffe6b0 !important;
  border: 1px solid #e2a31b;
  color: #e2a31b;
}

.mobile_no_box_new {
  background-color: #fff;
  margin: 5px 0px;
}

.phone_book_box p {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 5px;
}

.tab_menu_top i {
  text-align: center;
  width: 100%;
  margin: 0px auto;
  font-size: 23px;
}

.btn_color {
  background-color: #355f81 !important;
  -webkit-background-color: #355f81 !important;
  border-left: 3px solid #47b4ac !important;
  /*	
	background-color: #7B8294 !important;*/
  color: #fff !important;
}

.btn_color:hover {
  background-image: linear-gradient(
    to right top,
    #008f7a,
    #219c87,
    #35aa94,
    #45b8a1,
    #55c6ae
  ) !important;
}

.phone_book_box h5 {
  text-align: left;
}

.send_sms_i i {
  font-size: 20px;
  vertical-align: middle;
}

.Schedule_SMS_i i {
  font-size: 20px;
  vertical-align: middle;
}

.Custom_Field {
  background-color: #fff;
  display: inline-block;
  width: 100%;
  padding: 10px 10px;
  margin: 15px 0px;
}

.meassage_box_new {
  background-color: #fff;
  margin: 5px 0px 15px;
}

.send_box_new ul {
  padding: 0px;
  margin: 0px;
}

.header_top_new {
  background-color: #f6f8fb !important;
}

.phone_book_box {
  background-color: #fff;
  display: inline-block;
  width: 100%;
  padding: 10px 10px;
}

.Campaign_Name {
  background-color: #f6f8fb;
}

.Sender_ID {
  background-color: #f6f8fb;
}

.send_box_new2 {
  position: relative;
  bottom: 50px;
}

.send_box_new {
  text-align: center;
  margin-top: 0px;
}

.send_box_new h4 {
  margin-bottom: 5px;
  font-weight: 600;
  color: #000;
}

.avatar-25 {
  height: 25px;
  width: 25px;
  line-height: 25px;
  min-width: 25px;
}

.chat-profile img {
  border-radius: 10px 10px 0 10px;
}

.chat-status {
  position: absolute;
  bottom: 0px;
  top: 0;
  bottom: auto;
  left: auto;
  right: -8px;
  border: 3px solid #f6f8fb;
  border-radius: 50%;
  line-height: 9px;
  background: #fff;
}

.chat-status.chat-status-warning i {
  color: #cca43b;
}

.chat-list-title {
  margin-bottom: 12px;
}

.iq-search-bar .search-input {
  width: 100%;
  height: 40px;
  padding: 10px 40px 10px 20px;
  border-radius: 10px 10px 0 10px;
  border: 1px solid transparent;
  background-color: #ffffff;
}

.chat-profile {
  position: relative;
}

.chat-list li.chat-list-title .chat-user-box {
  padding: 0px;
  border-radius: 10px 10px 0 10px;
}

.justify-content-between {
  justify-content: space-between !important;
}

.rounded {
  border-radius: 10px 10px 0 10px !important;
}

.media {
  display: flex;
  align-items: flex-start;
}

.media-body.chat-text {
  width: 100%;
  vertical-align: middle !important;
  padding-top: 8px;
}

.badge {
  padding: 0.3em 0.6em;
  line-height: 1.3;
  text-transform: capitalize;
  border-radius: 10px 10px 0 10px;
}

.text-primary_new {
  color: #47b4ac !important;
}

.border-primary_as {
  border-color: #47b4ac !important;
  color: #47b4ac !important;
  font-size: 13px;
  font-weight: bold;
}

.border_as {
  border: 1px solid #47b4ac !important;
}

.badge_as {
  padding: 0.3em 0.6em;
  line-height: 1.3;
  text-transform: capitalize;
  border-radius: 10px 10px 0 10px;
}

.b_r {
  border-right: 1px solid #ccc;
}

.meg_top_box {
  background-color: #fff;
  border-top: none;
  border-right: none;
  border-left: none;
  padding: 5px;
}

.insert i {
  font-size: 17px;
  color: #333;
  vertical-align: middle;
}

.b_left {
  border-left: 3px solid #47b4ac;
}

.Campaign_Name {
  background-color: #fff;
  display: inline-block;
  width: 100%;
  padding: 5px 5px;
}

.phone_book_box i {
  font-size: 26px;
  font-weight: 300;
  color: #47b4ac;
  vertical-align: middle !important;
}

.phone_book_box_btn i {
  font-size: 20px;
  font-weight: 600;
  color: #fff;
  vertical-align: middle !important;
}

.Sender_ID {
  background-color: #fff;
  display: inline-block;
  width: 100%;
  padding: 5px 10px;
}

.custom-control input {
  height: auto !important;
}

.Custom_Field i {
  font-size: 26px;
  font-weight: 300;
  color: #47b4ac;
  vertical-align: middle !important;
}

.Custom_Field p {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 5px;
}

.insert a {
  font-size: 14px;
  color: #333 !important;
  vertical-align: middle;
  font-weight: 500;
}

.Templates_a i {
  font-size: 17px;
  color: #333;
  vertical-align: middle;
}

.Templates_a a {
  font-size: 14px;
  color: #333 !important;
  vertical-align: middle;
  font-weight: 500;
}

.msg i {
  font-size: 17px;
  color: #333;
  vertical-align: middle;
}

.msg a {
  font-size: 14px;
  color: #333;
  vertical-align: middle;
  font-weight: 500;
}

.sender-id-select {
  position: relative;
  margin-bottom: 8px;
  text-align: left;
  background-color: #ebebeb;
  padding: 0px 10px;
  margin-top: 6px;
}

.sender-id-select img {
  float: right;
  margin-top: 13px;
}

.sender-id-select > a {
  font-family: "Heebo", sans-serif;
  font-size: 14px;
  color: #6d8aae;
  font-weight: 600;
  line-height: 44px;
}

.send_box_new li {
  list-style: none;
}

.sender-id-select .dropdown-menu {
  background: #ffffff;
  border: 1px solid #f3f4f8;
  box-shadow: 0px 2px 6px rgba(0, 0, 0, 0.07);
  border-radius: 3px;
  width: 225px;
  height: 220px;
  padding: 10px;
}

.sender-list input {
  height: 40px !important;
  margin-bottom: 10px;
  color: #000 !important;
  width: 100%;
}

.sender-list ul {
  max-height: 120px;
  overflow: auto;
}

.sender-list ul li.selected {
  background: #edf3fa;
}

.sender-list ul li {
  font-family: "Open Sans", sans-serif;
  font-size: 12px;
  color: black;
  font-weight: 400;
  padding: 5px 5px 5px 24px;
  cursor: pointer;
  border-bottom: 1px solid #f2f2f2;
  position: relative;
}

.sender-list ul li img {
  position: absolute;
  left: 3px;
  top: 0px;
}

.sender-id-select .dropdown-menu .link {
  font-size: 14px;
  line-height: 19px;
  position: absolute;
  bottom: 10px;
  width: 95%;
}

.Campaign_Name p {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 0px;
}

.meassage_box_new p {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 5px;
}

.meassage_box_new i {
  font-size: 26px;
  font-weight: 600;
  color: #47b4ac;
  vertical-align: middle !important;
}

::placeholder {
  font-family: "Heebo", sans-serif;
  font-size: 14px;
  color: #6d8aae;
  font-weight: 600;
  line-height: 41px;
}

.Campaign_Name input {
  border: none;
  width: 100%;
  height: 45px;
  font-family: "Heebo", sans-serif;
  font-size: 14px;
  color: #6d8aae;
  font-weight: 600;
  line-height: 41px;
  position: relative;
  text-align: left;
  background-color: #ebebeb;
  padding: 0px 10px;
}

.Send_to p {
  text-align: left;
}

.Template_ID input {
  border-top: none;
  border-right: none;
  border-left: none;
  width: 100%;
  height: 45px;
  padding: 5px;
  font-size: 14px;
  background-color: #ebebeb;
}

.Custom_Field ul {
  margin: 0px;
  padding: 0px;
}

.Sender_ID p {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 5px;
}

.Send_to p {
  text-align: left;
  font-weight: bold;
  color: #47b4ac;
  margin-bottom: 5px;
}

.send_box_new {
  display: inline-block;
  border-radius: 4px;
  padding: 15px 0px;
  background-color: #f6f8fb;
  color: #f9f9f9;
  width: 100%;
  margin-top: 50px;
  text-align: center;
  font-size: 14px;
  box-shadow: 0px 4px 12px 0px rgba(71, 180, 172, 0.5);
}

.Campaign_Name i {
  font-size: 26px;
  font-weight: 300;
  color: #47b4ac;
  vertical-align: middle !important;
}

.Sender_ID i {
  font-size: 26px;
  font-weight: 300;
  color: #47b4ac;
  vertical-align: middle !important;
}

.Send_to i {
  font-size: 26px;
  font-weight: 300;
  vertical-align: middle !important;
}

.custam_box.mt_65 h5 {
  text-align: left;
  font-weight: bold;
  color: #35405a;
  margin-bottom: 5px;
  font-size: 14px;
}

.send_box_new::after {
  display: inline-block;
  width: 0;
  height: 0;
  border-left: 50px solid transparent;
  border-right: 50px solid transparent;
  border-top: 50px solid #f6f8fb;
  position: absolute;
  /*   bottom: 60px;
*/
  content: "";
  left: 70%;
  transform: translate(-50%, 0);
}

.rout ul {
  margin: 0px;
  padding: 0px;
  float: left;
}

.rout ul li {
  display: inline-block;
}

.Campaign_Name h5 {
  text-align: left;
}

.box_top_header {
  margin-bottom: 20px;
}

.meassage_box_new textarea {
  width: 100%;
  background-color: #ebebeb;
  border: none;
  font-weight: bold;
  padding: 10px;
}

.insert {
  text-align: left;
}

.re_non input {
  border-radius: 0px !important;
  border: none !important;
}

.msg {
  text-align: left;
}

.send_top_pop {
  background-color: #fff;
  height: 140px;
}

.tab_menu_top {
  text-align: center;
  margin: 15px auto;
  width: 100%;
  background-color: #f6f8fb;
  padding: 5px;
  border-top: 1px solid #47b4ac;
}

.tab_menu_top a {
  font-size: 13px;
  text-transform: capitalize;
  font-weight: bold;
}

.send_top_pop_menu ul li {
  list-style: none;
}

.border-primary1 {
  border: 1px solid #47b4ac !important;
}

.text-primary1 {
  color: #47b4ac !important;
  font-weight: 600 !important;
}

.table > :not(:first-child) {
  border: none !important;
}

.domain_logo_img {
  text-align: center;
}

.domain_logo_img img {
  width: 60px;
  margin-bottom: 20px;
  margin-top: 20px;
}

.reseller_name_bold h6 {
  font-weight: bold;
  margin: 0px;
}

.Domain_list_hover:hover {
  background-color: #e8e9ea;
  transition: 1s ease;
  cursor: pointer;
}

.pl-10 {
  padding-left: 100px;
}

.cm_name h6 {
  font-weight: bold;
  text-transform: capitalize;
}

.cm_name_dom h6 {
  font-weight: 100;
  font-size: 14px;
}

.don_btn a {
  font-weight: 100;
  font-size: 14px;
  color: #35405a;
}

.add_box {
  padding: 78px 0px;
  text-align: center;
}

.Templates_a i {
  font-size: 26px;
  font-weight: 600;
  color: #47b4ac !important;
}

.Templates_a a {
  font-size: 14px;
  cursor: pointer;
  color: #000 !important;
}

.w-25 {
  width: 25% !important;
}

.w-50 {
  width: 50% !important;
}

.w-75 {
  width: 75% !important;
}

.w-100 {
  width: 100% !important;
}

.w-auto {
  width: auto !important;
}

.h-25 {
  height: 25% !important;
}

.h-50 {
  height: 50% !important;
}

.h-75 {
  height: 75% !important;
}

.h-100 {
  height: 100% !important;
}

.h-auto {
  height: auto !important;
}

.mw-100 {
  max-width: 100% !important;
}

.mh-100 {
  max-height: 100% !important;
}

.min-vw-100 {
  min-width: 100vw !important;
}

.min-vh-100 {
  min-height: 100vh !important;
}

.vw-100 {
  width: 100vw !important;
}

.vh-100 {
  height: 100vh !important;
}

.m-0 {
  margin: 0 !important;
}

.mt-0,
.my-0 {
  margin-top: 0 !important;
}

.mr-0,
.mx-0 {
  margin-right: 0 !important;
}

.mb-0,
.my-0 {
  margin-bottom: 0 !important;
}

.ml-0,
.mx-0 {
  margin-left: 0 !important;
}

.m-1 {
  margin: 0.3125rem !important;
}

.mt-1,
.my-1 {
  margin-top: 0.3125rem !important;
}

.mr-1,
.mx-1 {
  margin-right: 0.3125rem !important;
}

.mb-1,
.my-1 {
  margin-bottom: 0.3125rem !important;
}

.ml-1,
.mx-1 {
  margin-left: 0.3125rem !important;
}

.m-2 {
  margin: 0.625rem !important;
}

.mt-2,
.my-2 {
  margin-top: 0.625rem !important;
}

.mr-2,
.mx-2 {
  margin-right: 0.625rem !important;
}

.mb-2,
.my-2 {
  margin-bottom: 0.625rem !important;
}

.ml-2,
.mx-2 {
  margin-left: 0.625rem !important;
}

.m-3 {
  margin: 1.25rem !important;
}

.mt-3,
.my-3 {
  margin-top: 1.25rem !important;
}

.mr-3,
.mx-3 {
  margin-right: 1.25rem !important;
}

.mb-3,
.my-3 {
  margin-bottom: 1.25rem !important;
}

.ml-3,
.mx-3 {
  margin-left: 1.25rem !important;
}

.m-4 {
  margin: 1.875rem !important;
}

.mt-4,
.my-4 {
  margin-top: 1.875rem !important;
}

.mr-4,
.mx-4 {
  margin-right: 1.875rem !important;
}

.mb-4,
.my-4 {
  margin-bottom: 1.875rem !important;
}

.ml-4,
.mx-4 {
  margin-left: 1.875rem !important;
}

.m-5 {
  margin: 2.5rem !important;
}

.mt-5,
.my-5 {
  margin-top: 2.5rem !important;
}

.mr-5,
.mx-5 {
  margin-right: 2.5rem !important;
}

.mb-5,
.my-5 {
  margin-bottom: 2.5rem !important;
}

.ml-5,
.mx-5 {
  margin-left: 2.5rem !important;
}

.p-0 {
  padding: 0 !important;
}

.pt-0,
.py-0 {
  padding-top: 0 !important;
}

.pr-0,
.px-0 {
  padding-right: 0 !important;
}

.pb-0,
.py-0 {
  padding-bottom: 0 !important;
}

.pl-0,
.px-0 {
  padding-left: 0 !important;
}

.p-1 {
  padding: 0.3125rem !important;
}

.pt-1,
.py-1 {
  padding-top: 0.3125rem !important;
}

.pr-1,
.px-1 {
  padding-right: 0.3125rem !important;
}

.pb-1,
.py-1 {
  padding-bottom: 0.3125rem !important;
}

.pl-1,
.px-1 {
  padding-left: 0.3125rem !important;
}

.p-2 {
  padding: 0.625rem !important;
}

.pt-2,
.py-2 {
  padding-top: 0.625rem !important;
}

.pr-2,
.px-2 {
  padding-right: 0.625rem !important;
}

.pb-2,
.py-2 {
  padding-bottom: 0.625rem !important;
}

.pl-2,
.px-2 {
  padding-left: 0.625rem !important;
}

.p-3 {
  padding: 1.25rem !important;
}

.pt-3,
.py-3 {
  padding-top: 1.25rem !important;
}

.pr-3,
.px-3 {
  padding-right: 1.25rem !important;
}

.pb-3,
.py-3 {
  padding-bottom: 1.25rem !important;
}

.pl-3,
.px-3 {
  padding-left: 1.25rem !important;
}

.p-4 {
  padding: 1.875rem !important;
}

.pt-4,
.py-4 {
  padding-top: 1.875rem !important;
}

.pr-4,
.px-4 {
  padding-right: 1.875rem !important;
}

.pb-4,
.py-4 {
  padding-bottom: 1.875rem !important;
}

.pl-4,
.px-4 {
  padding-left: 1.875rem !important;
}

.p-5 {
  padding: 2.5rem !important;
}

.pt-5,
.py-5 {
  padding-top: 2.5rem !important;
}

.pr-5,
.px-5 {
  padding-right: 2.5rem !important;
}

.pb-5,
.py-5 {
  padding-bottom: 2.5rem !important;
}

.pl-5,
.px-5 {
  padding-left: 2.5rem !important;
}

.m-n1 {
  margin: -0.3125rem !important;
}

.mt-n1,
.my-n1 {
  margin-top: -0.3125rem !important;
}

.mr-n1,
.mx-n1 {
  margin-right: -0.3125rem !important;
}

.mb-n1,
.my-n1 {
  margin-bottom: -0.3125rem !important;
}

.ml-n1,
.mx-n1 {
  margin-left: -0.3125rem !important;
}

.m-n2 {
  margin: -0.625rem !important;
}

.mt-n2,
.my-n2 {
  margin-top: -0.625rem !important;
}

.mr-n2,
.mx-n2 {
  margin-right: -0.625rem !important;
}

.mb-n2,
.my-n2 {
  margin-bottom: -0.625rem !important;
}

.ml-n2,
.mx-n2 {
  margin-left: -0.625rem !important;
}

.m-n3 {
  margin: -1.25rem !important;
}

.mt-n3,
.my-n3 {
  margin-top: -1.25rem !important;
}

.mr-n3,
.mx-n3 {
  margin-right: -1.25rem !important;
}

.mb-n3,
.my-n3 {
  margin-bottom: -1.25rem !important;
}

.ml-n3,
.mx-n3 {
  margin-left: -1.25rem !important;
}

.m-n4 {
  margin: -1.875rem !important;
}

.mt-n4,
.my-n4 {
  margin-top: -1.875rem !important;
}

.mr-n4,
.mx-n4 {
  margin-right: -1.875rem !important;
}

.mb-n4,
.my-n4 {
  margin-bottom: -1.875rem !important;
}

.ml-n4,
.mx-n4 {
  margin-left: -1.875rem !important;
}

.m-n5 {
  margin: -2.5rem !important;
}

.mt-n5,
.my-n5 {
  margin-top: -2.5rem !important;
}

.mr-n5,
.mx-n5 {
  margin-right: -2.5rem !important;
}

.mb-n5,
.my-n5 {
  margin-bottom: -2.5rem !important;
}

.ml-n5,
.mx-n5 {
  margin-left: -2.5rem !important;
}

.m-auto {
  margin: auto !important;
}

.mt-auto,
.my-auto {
  margin-top: auto !important;
}

.mr-auto,
.mx-auto {
  margin-right: auto !important;
}

.mb-auto,
.my-auto {
  margin-bottom: auto !important;
}

.ml-auto,
.mx-auto {
  margin-left: auto !important;
}

.container-fluid,
.container-sm,
.container-md,
.container-lg,
.container-xl {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}

@media (min-width: 576px) {
  .container,
  .container-sm {
    max-width: 540px;
  }
}

@media (min-width: 768px) {
  .container,
  .container-sm,
  .container-md {
    max-width: 720px;
  }
}

@media (min-width: 992px) {
  .container,
  .container-sm,
  .container-md,
  .container-lg {
    max-width: 960px;
  }
}

@media (min-width: 1200px) {
  .container,
  .container-sm,
  .container-md,
  .container-lg,
  .container-xl {
    max-width: 1140px;
  }
}

@media (min-width: 511px) and (max-width: 768px) {
  .csv-file-chooser-section input {
    width: 100%;
  }
  .width-200_as input {
    z-index: 999999999999999;
    left: -670px;
    text-align: left;
    height: 25px;
    margin-left: 300px;
  }

  .Template_list_all .radio input {
    width: 600px;
    position: relative;
    z-index: 9999999999999;
    display: block;
    cursor: pointer;
    height: 23px;
    margin-left: -280px;
    margin-top: 5px;
  }
  .login {
    position: relative;
    padding: 0px !important;
    top: 20px;
    width: 68%;
  }
}

@media (min-width: 320px) and (max-width: 510px) {
  .header-info > ul > li a {
    margin: 5px 0px;
  }
  .esy_as {
    position: absolute;
    text-align: right;
    display: block;
    width: 20px;
    bottom: 30px;
    right: 0px !important;
  }
  .note_ashish h5 {
    font-size: 14px;
    text-align: center;
    text-align: center;
  }
  .width-200_as input {
    width: 800px;
    position: absolute;
    cursor: pointer;
    z-index: 999999999999999;
    left: -360px;
    text-align: left;
    height: 25px;
    width: 800px;
    position: absolute;
    cursor: pointer;
    z-index: 999999999999999;
    left: -660px;
    text-align: left;
    height: 25px;
    margin-left: 285px;
    bottom: 4px;
  }

  .login {
    position: relative;
    padding: 0px !important;
    top: 20px;
    width: 70%;
  }

  .social-login {
    margin-top: 85px;
    text-align: right;
    margin-right: 20px;
    width: 80%;
  }

  .mt_mob_10 {
    margin-top: 10px !important;
  }
}

/* Using a url */

body .user-detail-info-table .profile-text.a {
 background-color:#88b6ad
}

body .user-detail-info-table .profile-text.b {
 background-color:#9dcdcd
}

body .user-detail-info-table .profile-text.c {
 background-color:#48b9b6
}

body .user-detail-info-table .profile-text.d {
 background-color:#84bcd5
}

body .user-detail-info-table .profile-text.e {
 background-color:#30789d
}

body .user-detail-info-table .profile-text.f {
 background-color:#6588a9
}

body .user-detail-info-table .profile-text.g {
 background-color:#435168
}

body .user-detail-info-table .profile-text.h {
 background-color:#b24f60
}

body .user-detail-info-table .profile-text.i {
 background-color:#f49580
}

body .user-detail-info-table .profile-text.j {
 background-color:#ee825a
}

body .user-detail-info-table .profile-text.k {
 background-color:#d98e4d
}

body .user-detail-info-table .profile-text.l {
 background-color:#866a7d
}

body .user-detail-info-table .profile-text.m {
 background-color:#9a918d
}

body .user-detail-info-table .profile-text.n {
 background-color:#c0b9b4
}

body .user-detail-info-table .profile-text.o {
 background-color:#d0d1b8
}

body .user-detail-info-table .profile-text.p {
 background-color:#b1816c
}

body .user-detail-info-table .profile-text.q {
 background-color:#f4edda
}

body .user-detail-info-table .profile-text.r {
 background-color:#d8c7a9
}

body .user-detail-info-table .profile-text.s {
 background-color:#d0d1b8
}

body .user-detail-info-table .profile-text.t {
 background-color:#d3c28a
}

body .user-detail-info-table .profile-text.u {
 background-color:#c2cb93
}

body .user-detail-info-table .profile-text.v,
body .user-detail-info-table .profile-text.w,
body .user-detail-info-table .profile-text.x,
body .user-detail-info-table .profile-text.y,
body .user-detail-info-table .profile-text.z {
 background-color:#e4eaf0
}

body .table-wrapper {
  margin-bottom: 10px;
}

/* line 627, ../../scss/_settings_fl.scss */

body .table-wrapper table {
  width: 100%;
  table-layout: fixed;
}

/* line 632, ../../scss/_settings_fl.scss */

body .table-wrapper table.table-fixed thead th {
  position: sticky;
  top: 60px;
}

/* line 640, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th {
  padding: 14px 15px 13px;
  font-family: 'Heebo', sans-serif;
  font-size: 13px;
  color: #636C75;
  font-weight: 500;
  font-style: normal;
  z-index: 99;
  line-height: 14px;
  background: #FAFCFE;
}

/* line 647, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th:first-child {
  border-top-left-radius: 4px;
  border-bottom-left-radius: 4px;
}

/* line 651, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th:last-child {
  border-top-right-radius: 4px;
  border-bottom-right-radius: 4px;
}

/* line 656, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort span {
  position: relative;
}

/* line 658, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort span i {
  position: absolute;
  right: -12px;
  cursor: pointer;
  color: black;
}

/* line 663, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort span i.fa-caret-up {
  top: 2px;
  display: none;
}

/* line 667, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort span i.fa-caret-down {
  top: 4px;
}

/* line 674, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort.asc span .fa-caret-up {
  top: 2px;
  color: black;
  display: inline-block;
}

/* line 679, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort.asc span .fa-caret-down {
  top: 4px;
  color: rgba(95, 99, 104, 0.5);
  display: none;
}

/* line 688, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort.desc span .fa-caret-up {
  top: 2px;
  color: rgba(95, 99, 104, 0.5);
  display: none;
}

/* line 693, ../../scss/_settings_fl.scss */

body .table-wrapper table thead tr th.sort.desc span .fa-caret-down {
  top: 4px;
  color: black;
  display: inline-block;
}

/* line 704, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody {
  background-color: #FFFFFF;
  overflow: -moz-scrollbars-none;
  -ms-overflow-style: none;
}

/* line 708, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody::-webkit-scrollbar {
  width: 0 !important;
}

/* line 711, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr {
  border-top: 1px solid #E6EAED;
}

/* line 713, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr.no-top-border {
  border-top: 0px;
}

/* line 716, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td {
  padding: 15px;
}

/* line 718, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td.no-top-padding {
  padding: 0px;
}

/* line 721, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label {
  border-radius: 4px;
  padding: 4px 20px;
  display: inline-block;
  text-align: center;
  background-color: #F6FFED;
  font-size: 14px;
}

/* line 728, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label.green {
  background: rgba(11, 201, 132, 0.1);
  border: 1px solid rgba(11, 201, 132, 0.4);
  color: #0ABD7C;
}

/* line 733, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label.red {
  background-color: #FFF1F0;
  border: 1px solid #FFA39E;
  color: #F5222D;
}

/* line 738, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label.orange {
  background-color: #FFF7E6;
  border: 1px solid #FFD591;
  color: #FA8C16;
}

/* line 743, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label.blue {
  background-color: #EDF3FF;
  border: 1px solid #87AFFF;
  color: #0F5FFE;
}

/* line 748, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label.grey {
  background-color: #EFEFEF;
  border: 1px solid #BBBBBB;
  color: #5F6368;
}

/* line 753, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .status-label.purple {
  background-color: #e4e5fc99;
  border: 1px solid #6E73E3;
  color: #634FD3;
}

/* line 759, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .edit-menu {
  left: auto;
/*  right: 25px;*/
/*  bottom: 30%;*/
  min-width: 190px;
  padding: 13px;
  top: unset;
}

/* line 766, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .edit-menu a {
  display: block;
  padding: 5px;
  font-size: 14px;
  color: #212B36;
  font-weight: 400;
  line-height: 23px;
  border-bottom: 1px solid #EAEDF2;
  margin-bottom: 5px;
  padding-bottom: 5px;
}

/* line 776, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .edit-menu a:last-child {
  border-bottom: none;
  margin-bottom: 0;
  padding-bottom: 0;
}

/* line 784, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .edit-menu a img,
body .table-wrapper table tbody tr td .edit-menu a span, body .table-wrapper table tbody tr td .edit-menu a svg {
  vertical-align: middle;
}

/* line 788, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .edit-menu a i, body .table-wrapper table tbody tr td .edit-menu a svg {
  margin-right: 5px;
  position: relative;
  bottom: 1px;
  top: 5px;
}

/* line 793, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td .edit-menu a span {
  display: inline;
  text-align: left;
  padding: 0;
}

/* line 802, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr td.dropdown > a {
  padding: 10px;
}

/* line 806, ../../scss/_settings_fl.scss */

body .table-wrapper table tbody tr:first-child {
  border-top: none;
}

/* line 811, ../../scss/_settings_fl.scss */

body .table-wrapper table .table-label {
  margin-bottom: 10px;
}

/* line 825, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td h4.logs-status-info, body .table-wrapper.report-list-table table tbody td h4.logs-status-info {
  font-family: 'Open Sans', sans-serif;
  font-size: 18px;
  color: black;
  font-weight: 500;
}

/* line 829, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td h4.logs-status-info span, body .table-wrapper.report-list-table table tbody td h4.logs-status-info span {
  display: inline-block;
  margin-left: 4px;
}

/* line 833, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td h4.logs-status-info img, body .table-wrapper.report-list-table table tbody td h4.logs-status-info img {
  display: none;
}

/* line 837, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td h4.logs-status-info.open img, body .table-wrapper.report-list-table table tbody td h4.logs-status-info.open img {
  display: inline-block;
}

/* line 842, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .for-label, body .table-wrapper.report-list-table table tbody td .for-label {
  font-family: 'Open Sans', sans-serif;
  font-size: 13px;
  color: #767A7E;
  font-weight: 400;
}

/* line 847, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .for-title, body .table-wrapper.report-list-table table tbody td .for-title {
  font-family: 'Open Sans', sans-serif;
  font-size: 16px;
  color: black;
  font-weight: 400;
}

/* line 852, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .logs-desc, body .table-wrapper.report-list-table table tbody td .logs-desc {
  font-family: 'Open Sans', sans-serif;
  font-size: 14px;
  color: black;
  font-weight: 400;
  font-style: italic;
}

/* line 858, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .collapse-info, body .table-wrapper.report-list-table table tbody td .collapse-info {
  margin-top: 20px;
}

/* line 861, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .toggle-information, body .table-wrapper.report-list-table table tbody td .toggle-information {
  margin-top: 5px;
  display: none;
}

/* line 865, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .toggle-logs-row, body .table-wrapper.report-list-table table tbody td .toggle-logs-row {
  position: absolute;
  right: 15px;
  top: 50%;
  cursor: pointer;
  transform: translateY(-50%);
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
  -o-transform: translateY(-50%);
}

/* line 875, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .toggle-logs-row .open-icon, body .table-wrapper.report-list-table table tbody td .toggle-logs-row .open-icon {
  display: none;
}

/* line 878, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .toggle-logs-row .close-icon, body .table-wrapper.report-list-table table tbody td .toggle-logs-row .close-icon {
  display: inline-block;
}

/* line 882, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .toggle-logs-row.open .open-icon, body .table-wrapper.report-list-table table tbody td .toggle-logs-row.open .open-icon {
  display: inline-block;
}

/* line 885, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .toggle-logs-row.open .close-icon, body .table-wrapper.report-list-table table tbody td .toggle-logs-row.open .close-icon {
  display: inline-block;
  display: none;
}

/* line 891, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .log-msg-id, body .table-wrapper.report-list-table table tbody td .log-msg-id {
  font-family: 'Open Sans', sans-serif;
  font-size: 12px;
  color: #5F6368;
  font-weight: 400;
  background: #D3DFED;
  border-radius: 20px;
  padding: 6px 35px 6px 20px;
  position: relative;
}

/* line 899, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .log-msg-id span, body .table-wrapper.report-list-table table tbody td .log-msg-id span {
  font-weight: 700;
}

/* line 902, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .log-msg-id .clipboard-copy, body .table-wrapper.report-list-table table tbody td .log-msg-id .clipboard-copy {
  height: 18px;
  position: relative;
  right: 10px;
  bottom: 2px;
  cursor: pointer;
  position: absolute;
  top: 50%;
  right: 15px;
  transform: translateY(-50%);
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
}

/* line 916, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .log-msg-id .copied-text, body .table-wrapper.report-list-table table tbody td .log-msg-id .copied-text {
  position: absolute;
  top: 50%;
  right: 15px;
  transform: translateY(-50%);
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
  display: inline-block;
  white-space: nowrap;
}

/* line 927, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .log-msg-id .tooltip, body .table-wrapper.report-list-table table tbody td .log-msg-id .tooltip {
  width: 65px;
  right: 32px;
  left: auto !important;
}

/* line 934, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .user-detail-info img, body .table-wrapper.report-list-table table tbody td .user-detail-info img {
  width: 40px;
  height: 40px;
  border-radius: 50%;
  float: left;
}

/* line 940, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .user-detail-info .user-name, body .table-wrapper.report-list-table table tbody td .user-detail-info .user-name {
  margin-left: 50px;
  padding-top: 3px;
}

/* line 943, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .user-detail-info .user-name h5, body .table-wrapper.report-list-table table tbody td .user-detail-info .user-name h5 {
  font-family: 'Open Sans', sans-serif;
  font-size: 16px;
  color: black;
  font-weight: 400;
}

/* line 948, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td .user-detail-info .user-name p, body .table-wrapper.report-list-table table tbody td .user-detail-info .user-name p {
  font-family: 'Open Sans', sans-serif;
  font-size: 14px;
  color: #8D8D8D;
  font-weight: 400;
}

/* line 956, ../../scss/_settings_fl.scss */

body .table-wrapper.logs-list-table table tbody td:last-child, body .table-wrapper.report-list-table table tbody td:last-child {
  position: relative;
  padding-right: 40px;
}

/* line 965, ../../scss/_settings_fl.scss */

body .table-wrapper .open-icon, body .table-wrapper .close-icon {
  color: #8D9DB0;
  font-size: 12px;
}

/* line 970, ../../scss/_settings_fl.scss */

body .tfoot {
  display: block;
}

.user-detail-info-table .profile-text.a {
    background-color: #88b6ad;
}

.user-detail-info-table .profile-text.middle-cell {
    left: 0;
    top: 20px;
    position: relative;
}

.user-detail-info-table .profile-text {
    width: 40px;
    height: 40px;
    border-radius: 50%;
    margin-right: 10px;
    text-align: center;
    border: 1px solid #ededed;
    padding: 6px;
    display: inline-block;
    font-size: 24px;
    position: absolute;
    left: 31px;
    top: 35%;
    float: left;
    color: #333;
    text-transform: capitalize;
    transform: translateY(-50%);
    -webkit-transform: translateY(-50%);
    -moz-transform: translateY(-50%);
    -ms-transform: translateY(-50%);
    -o-transform: translateY(-50%);
    line-height: 29px;
}

.user-detail-info-table .user-name {
    margin-left: 50px;
    padding-top: 3px;
    padding-left: 12px;
}

.user-detail-info-table .user-name p.with-margin {
    font-size: 12px;
    margin-top: 5px;
}

.user-detail-info-table .user-name p {
    font-family: Heebo,sans-serif;
    font-size: 14px;
    color: #000;
    font-weight: 400;
}

.user-name span {
    font-weight: 600;
}

.table-wrapper table tbody tr td .status-label.green {
    background: rgba(11, 201, 132, 0.1);
    border: 1px solid rgba(11, 201, 132, 0.4);
    color: #0ABD7C;
}

.paragraph-sub {
    font-size: 13px;
    color: #8D9DB0;
    font-weight: normal;
    line-height: 13px;
}

.color_ashish {
    background-color: #fff;
}

.ul_as_0 ul{
	margin:0px;
	padding:0px;}

.dropdown_as {
  position: relative;
  display: inline-block;
}

.filter-list li {
    display: inline-block;
    width: auto;
    margin-right: 1px;
}

.sender-id-select > a {
    margin-right: 10px;
}

.mt_ashish.show {
    transform: translate3d(0px, 43px, 0px) !important;
}

.sender-id-select .dropdown-menu {
 height: 150px !important;
}

.brd {
  border: 1px solid #e2eded;
  border-color: #eaf1f1 #e4eded #dbe7e7 #e4eded;
}

/*#info {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  color: #2d3667;
  font-size: 16px;
  text-align: center;
  padding: 14px;
  background-color: #f3f9f9;
}
*/

.app-cover {
	margin: 0px auto;
  position: absolute;
  top: 15px;
  right: 0;
  left: 0;
  width:90%;
  height: 42px;
  z-index: 1;
}

#select-button {
  position: relative;
  padding: 12px 14px;
  background-color: #fff;
  border-radius: 4px;
  cursor: pointer;
}

#options-view-button {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  margin: 0;
  opacity: 0;
  cursor: pointer;
  z-index: 3;
}

#selected-value {
font-size: 14px;
margin-right: 19px;
letter-spacing: 0px;
font-weight: 600;
}

.option i {
  width: 16px;
/*  height: 16px;*/
}

.option,
.label {
  color: #2d3667;
  font-size: 14px;
}

#chevrons {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  width: 12px;
  padding: 9px 14px;
}

#chevrons i {
  display: block;
  height: 50%;
  color: #d1dede;
  font-size: 12px;
  text-align: right;
}

#options-view-button:checked + #select-button #chevrons i {
  color: #2d3667;
}

.options {
  position: absolute;
  left: 0;
  width: 250px;
}

#options {
  position: absolute;
  top: 42px;
  right: 0;
  left: 0;
width: 100%;
  margin: 0 auto;
  background-color: #fff;
  border-radius: 4px;
}

#options-view-button:checked ~ #options {
  border: 1px solid #e2eded;
  border-color: #eaf1f1 #e4eded #dbe7e7 #e4eded;
}

.option {
  position: relative;
  line-height: 1;
  transition: 0.3s ease all;
  z-index: 2;
}

.option i {
  position: absolute;
  left: 14px;
  padding: 0;
  display: none;
}

#options-view-button:checked ~ #options .option i {
  display: block;
  padding: 12px 0;
}

.label {
  display: none;
  padding: 0;

}

#options-view-button:checked ~ #options .label {
  display: block;
  padding: 13px 14px;
}

.s-c {
  position: absolute;
  left: 0;
  width: 100%;
  height: 50%;
}

.s-c.top {
  top: 0;
}

.s-c.bottom {
  bottom: 0;
}

.s-c:hover ~ i {
  color: #fff;
  opacity: 0;
}

.s-c:hover {
  height: 100%;
  z-index: 1;
}

.s-c.bottom:hover + i {
  bottom: -25px;
  animation: moveup 0.3s ease 0.1s forwards;
}

.s-c.top:hover ~ i {
  top: -25px;
  animation: movedown 0.3s ease 0.1s forwards;
}

@keyframes moveup {
  0% {
    bottom: -25px;
    opacity: 0;
  }
  100% {
    bottom: 0;
    opacity: 1;
  }
}

@keyframes movedown {
  0% {
    top: -25px;
    opacity: 0;
  }
  100% {
    top: 0;
    opacity: 1;
  }
}

.label {
  transition: 0.3s ease all;
}

.opt-val {
  position: absolute;
  left: 14px;
  width: 145px;
  height: 21px;
  opacity: 0;
  background-color: #fff;
  transform: scale(0);
}

.option input[type="radio"]:checked ~ .opt-val {
  opacity: 1;
  transform: scale(1);
}

.option input[type="radio"]:checked ~ i {
  top: 0;
  bottom: auto;
  opacity: 1;
  animation: unset;
}

.option input[type="radio"]:checked ~ i,
.option input[type="radio"]:checked ~ .label {
  color: #fff;
}

.option input[type="radio"]:checked ~ .label:before {
  content: "";
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: -1;
}

#options-view-button:not(:checked)
  ~ #options
  .option
  input[type="radio"]:checked
  ~ .opt-val {
  top: -30px;
}

.option:nth-child(1) input[type="radio"]:checked ~ .label:before {
  background-color: #47B4AC;
  border-radius: 4px 4px 0 0;
}

.option:nth-child(1) input[type="radio"]:checked ~ .opt-val {
  top: -31px;
}

.option:nth-child(2) input[type="radio"]:checked ~ .label:before {
  background-color: #ea4c89;
}

.option:nth-child(2) input[type="radio"]:checked ~ .opt-val {
  top: -71px;
}

.option:nth-child(3) input[type="radio"]:checked ~ .label:before {
  background-color: #0057ff;
}

.option:nth-child(3) input[type="radio"]:checked ~ .opt-val {
  top: -111px;
}

.option:nth-child(4) input[type="radio"]:checked ~ .label:before {
  background-color: #32c766;
}

.option:nth-child(4) input[type="radio"]:checked ~ .opt-val {
  top: -151px;
}

.option:nth-child(5) input[type="radio"]:checked ~ .label:before {
  background-color: #f48024;
}

.option:nth-child(5) input[type="radio"]:checked ~ .opt-val {
  top: -191px;
}

.option:nth-child(6) input[type="radio"]:checked ~ .label:before {
  background-color: #006400;
  border-radius: 0 0 4px 4px;
}

.option:nth-child(6) input[type="radio"]:checked ~ .opt-val {
  top: -231px;
}

.option .fa-codepen {
  color: #000;
}

.option .fa-dribbble {
  color: #ea4c89;
}

.option .fa-behance {
  color: #0057ff;
}

.option .fa-hackerrank {
  color: #32c766;
}

.option .fa-stack-overflow {
  color: #f48024;
}

.option .fa-free-code-camp {
  color: #006400;
}

#option-bg {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  height: 40px;
  transition: 0.3s ease all;
  z-index: 1;
  display: none;
}

#options-view-button:checked ~ #options #option-bg {
  display: block;
}

.option:hover .label {
  color: #fff;
}

.option:nth-child(1):hover ~ #option-bg {
  top: 0;
  background-color: #000;
  border-radius: 4px 4px 0 0;
}

.option:nth-child(2):hover ~ #option-bg {
  top: 40px;
  background-color: #ea4c89;
}

.option:nth-child(3):hover ~ #option-bg {
  top: 80px;
  background-color: #0057ff;
}

.option:nth-child(4):hover ~ #option-bg {
  top: 120px;
  background-color: #32c766;
}

.option:nth-child(5):hover ~ #option-bg {
  top: 160px;
  background-color: #f48024;
}

.option:nth-child(6):hover ~ #option-bg {
  top: 200px;
  background-color: #006400;
  border-radius: 0 0 4px 4px;
}

.select-box {
  position: relative;
  display: block;
  width: 100%;
  margin: 0 auto;
  font-family: "Open Sans", "Helvetica Neue", "Segoe UI", "Calibri", "Arial", sans-serif;
  font-size: 18px;
  color: #60666d;
}

@media (min-width: 768px) {
  .select-box {
    width: 70%;
  }
}

@media (min-width: 992px) {
  .select-box {
    width: 50%;
  }
}

@media (min-width: 1200px) {
  .select-box {
    width: 30%;
  }
}

.select-box__current {
  position: relative;
  box-shadow: 0 15px 30px -10px rgba(0, 0, 0, 0.1);
  cursor: pointer;
  outline: none;
}

.select-box__current:focus + .select-box__list {
  opacity: 1;
  animation-name: none;
}

.select-box__current:focus + .select-box__list .select-box__option {
  cursor: pointer;
}

.select-box__current:focus .select-box__icon {
  transform: translateY(-50%) rotate(180deg);
}

.select-box__icon {
  position: absolute;
  top: 50%;
  right: 15px;
  transform: translateY(-50%);
  width: 20px;
  opacity: 0.3;
  transition: 0.2s ease;
}

.select-box__value {
  display: flex;
}

.select-box__input {
  display: none;
}

.select-box__input:checked + .select-box__input-text {
  display: block;
}

.select-box__input-text {
  display: none;

  width: 100%;
  margin: 0;
  padding: 15px;
  background-color: #fff;
}

.select-box__list {
  position: absolute;
  width: 100%;
  padding: 0;
  list-style: none;
  opacity: 0;
  animation-name: HideList;
  animation-duration: 0.5s;
  animation-delay: 0.5s;
  animation-fill-mode: forwards;
  animation-timing-function: step-start;
  box-shadow: 0 15px 30px -10px rgba(0, 0, 0, 0.1);
}

.select-box__option {
  display: block;
  padding: 15px;
  background-color: #fff;
}

.select-box__option:hover, .select-box__option:focus {
  color: #546c84;
  background-color: #fbfbfb;
}

@keyframes HideList {
  from {
    transform: scaleY(1);
  }
  to {
    transform: scaleY(0);
  }
}

/* Using a url */

/*@import url("./assets/bulk-sms/css/sidbar.css");
@import url("./assets/bulk-sms/css/sidebar.css");*/

/*@import url("./assets/bulk-sms/css/backend-plugin.min.css"); */

.daterangepicker {
  position: absolute;
  color: inherit;
  background-color: #fff;
  border-radius: 4px;
  border: 1px solid #ddd;
  width: 278px;
  max-width: none;
  padding: 0;
  margin-top: 7px;
  top: 100px;
  left: 20px;
  z-index: 3001;
  display: none;
  font-family: arial;
  font-size: 15px;
  line-height: 1em;
}

.daterangepicker:before, .daterangepicker:after {
  position: absolute;
  display: inline-block;
  border-bottom-color: rgba(0, 0, 0, 0.2);
  content: '';
}

.daterangepicker:before {
  top: -7px;
  border-right: 7px solid transparent;
  border-left: 7px solid transparent;
  border-bottom: 7px solid #ccc;
}

.daterangepicker:after {
  top: -6px;
  border-right: 6px solid transparent;
  border-bottom: 6px solid #fff;
  border-left: 6px solid transparent;
}

.daterangepicker.opensleft:before {
  right: 9px;
}

.daterangepicker.opensleft:after {
  right: 10px;
}

.daterangepicker.openscenter:before {
  left: 0;
  right: 0;
  width: 0;
  margin-left: auto;
  margin-right: auto;
}

.daterangepicker.openscenter:after {
  left: 0;
  right: 0;
  width: 0;
  margin-left: auto;
  margin-right: auto;
}

.daterangepicker.opensright:before {
  left: 9px;
}

.daterangepicker.opensright:after {
  left: 10px;
}

.daterangepicker.drop-up {
  margin-top: -7px;
}

.daterangepicker.drop-up:before {
  top: initial;
  bottom: -7px;
  border-bottom: initial;
  border-top: 7px solid #ccc;
}

.daterangepicker.drop-up:after {
  top: initial;
  bottom: -6px;
  border-bottom: initial;
  border-top: 6px solid #fff;
}

.daterangepicker.single .daterangepicker .ranges, .daterangepicker.single .drp-calendar {
  float: none;
}

.daterangepicker.single .drp-selected {
  display: none;
}

.daterangepicker.show-calendar .drp-calendar {
  display: block;
}

.daterangepicker.show-calendar .drp-buttons {
  display: block;
}

.daterangepicker.auto-apply .drp-buttons {
  display: none;
}

.daterangepicker .drp-calendar {
  display: none;
  max-width: 270px;
}

.daterangepicker .drp-calendar.left {
  padding: 8px 0 8px 8px;
}

.daterangepicker .drp-calendar.right {
  padding: 8px;
}

.daterangepicker .drp-calendar.single .calendar-table {
  border: none;
}

.daterangepicker .calendar-table .next span, .daterangepicker .calendar-table .prev span {
  color: #fff;
  border: solid black;
  border-width: 0 2px 2px 0;
  border-radius: 0;
  display: inline-block;
  padding: 3px;
}

.daterangepicker .calendar-table .next span {
  transform: rotate(-45deg);
  -webkit-transform: rotate(-45deg);
}

.daterangepicker .calendar-table .prev span {
  transform: rotate(135deg);
  -webkit-transform: rotate(135deg);
}

.daterangepicker .calendar-table th, .daterangepicker .calendar-table td {
  white-space: nowrap;
  text-align: center;
  vertical-align: middle;
  min-width: 32px;
  width: 32px;
  height: 24px;
  line-height: 24px;
  font-size: 12px;
  border-radius: 4px;
  border: 1px solid transparent;
  white-space: nowrap;
  cursor: pointer;
}

.daterangepicker .calendar-table {
  border: 1px solid #fff;
  border-radius: 4px;
  background-color: #fff;
}

.daterangepicker .calendar-table table {
  width: 100%;
  margin: 0;
  border-spacing: 0;
  border-collapse: collapse;
}

.daterangepicker td.available:hover, .daterangepicker th.available:hover {
  background-color: #eee;
  border-color: transparent;
  color: inherit;
}

.daterangepicker td.week, .daterangepicker th.week {
  font-size: 80%;
  color: #ccc;
}

.daterangepicker td.off, .daterangepicker td.off.in-range, .daterangepicker td.off.start-date, .daterangepicker td.off.end-date {
  background-color: #fff;
  border-color: transparent;
  color: #999;
}

.daterangepicker td.in-range {
  background-color: #ebf4f8;
  border-color: transparent;
  color: #000;
  border-radius: 0;
}

.daterangepicker td.start-date {
  border-radius: 4px 0 0 4px;
}

.daterangepicker td.end-date {
  border-radius: 0 4px 4px 0;
}

.daterangepicker td.start-date.end-date {
  border-radius: 4px;
}

.daterangepicker td.active, .daterangepicker td.active:hover {
  background-color: #357ebd;
  border-color: transparent;
  color: #fff;
}

.daterangepicker th.month {
  width: auto;
}

.daterangepicker td.disabled, .daterangepicker option.disabled {
  color: #999;
  cursor: not-allowed;
  text-decoration: line-through;
}

.daterangepicker select.monthselect, .daterangepicker select.yearselect {
  font-size: 12px;
  padding: 1px;
  height: auto;
  margin: 0;
  cursor: default;
}

.daterangepicker select.monthselect {
  margin-right: 2%;
  width: 56%;
}

.daterangepicker select.yearselect {
  width: 40%;
}

.daterangepicker select.hourselect, .daterangepicker select.minuteselect, .daterangepicker select.secondselect, .daterangepicker select.ampmselect {
  width: 50px;
  margin: 0 auto;
  background: #eee;
  border: 1px solid #eee;
  padding: 2px;
  outline: 0;
  font-size: 12px;
}

.daterangepicker .calendar-time {
  text-align: center;
  margin: 4px auto 0 auto;
  line-height: 30px;
  position: relative;
}

.daterangepicker .calendar-time select.disabled {
  color: #ccc;
  cursor: not-allowed;
}

.daterangepicker .drp-buttons {
  clear: both;
  text-align: right;
  padding: 8px;
  border-top: 1px solid #ddd;
  display: none;
  line-height: 12px;
  vertical-align: middle;
}

.daterangepicker .drp-selected {
  display: inline-block;
  font-size: 12px;
  padding-right: 8px;
}

.daterangepicker .drp-buttons .btn {
  margin-left: 8px;
  font-size: 12px;
  font-weight: bold;
  padding: 4px 8px;
}

.daterangepicker.show-ranges.single.rtl .drp-calendar.left {
  border-right: 1px solid #ddd;
}

.daterangepicker.show-ranges.single.ltr .drp-calendar.left {
  border-left: 1px solid #ddd;
}

.daterangepicker.show-ranges.rtl .drp-calendar.right {
  border-right: 1px solid #ddd;
}

.daterangepicker.show-ranges.ltr .drp-calendar.left {
  border-left: 1px solid #ddd;
}

.daterangepicker .ranges {
  float: none;
  text-align: left;
  margin: 0;
}

.daterangepicker.show-calendar .ranges {
  margin-top: 8px;
}

.daterangepicker .ranges ul {
  list-style: none;
  margin: 0 auto;
  padding: 0;
  width: 100%;
}

.daterangepicker .ranges li {
  font-size: 12px;
  padding: 8px 12px;
  cursor: pointer;
}

.daterangepicker .ranges li:hover {
  background-color: #eee;
}

.daterangepicker .ranges li.active {
  background-color: #08c;
  color: #fff;
}

/*  Larger Screen Styling */

@media (min-width: 564px) {
  .daterangepicker {
    width: auto;
  }

  .daterangepicker .ranges ul {
    width: 140px;
  }

  .daterangepicker.single .ranges ul {
    width: 100%;
  }

  .daterangepicker.single .drp-calendar.left {
    clear: none;
  }

  .daterangepicker.single .ranges, .daterangepicker.single .drp-calendar {
    float: left;
  }

  .daterangepicker {
    direction: ltr;
    text-align: left;
  }

  .daterangepicker .drp-calendar.left {
    clear: left;
    margin-right: 0;
  }

  .daterangepicker .drp-calendar.left .calendar-table {
    border-right: none;
    border-top-right-radius: 0;
    border-bottom-right-radius: 0;
  }

  .daterangepicker .drp-calendar.right {
    margin-left: 0;
  }

  .daterangepicker .drp-calendar.right .calendar-table {
    border-left: none;
    border-top-left-radius: 0;
    border-bottom-left-radius: 0;
  }

  .daterangepicker .drp-calendar.left .calendar-table {
    padding-right: 8px;
  }

  .daterangepicker .ranges, .daterangepicker .drp-calendar {
    float: left;
  }
}

@media (min-width: 730px) {
  .daterangepicker .ranges {
    width: auto;
  }

  .daterangepicker .ranges {
    float: left;
  }

  .daterangepicker.rtl .ranges {
    float: right;
  }

  .daterangepicker .drp-calendar.left {
    clear: none !important;
  }
}

/* Using a url */

.chartBarsWrap {
  padding-left: 0px;
  margin: 0 30px 0 20px;
  overflow-x: hidden;
}

.list_to li {
    text-align: center;
    list-style: none;
	margin:0px;
	padding:0px;
}

.icon_b {
    font-weight: bold;
    font-size: 30px;
}

.icon_126 {
    font-size: 21px;
}

.icon_26 {
    font-size: 30px;
}

.chartBars {
  position: relative;
  max-width: 600px;
  height: 300px;
  margin: 15px auto 100px;
}

.chartBars .bars {
  display: flex;
  justify-content: space-around;
  border-left: 1px solid #bbb;
  border-bottom: 1px solid #bbb;
  width: 100%;
  height: 100%;
  padding: 0;
  padding: 0 1%;
  margin: 0;
}

.chartBars .bars li {
  display: inline-block;
  flex: 0 1 24%;
  height: 100%;
  margin: 0;
  text-align: center;
  position: relative;
  font-size: 16px;
}

.chartBars .bars li .bar {
  width: 90%;
  background: #49E;
  position: absolute;
  font-size: 1.5em;
  color: #fff;
  padding-top: 18px;
  bottom: 0;
  height: 0;
  overflow: hidden;
  font-weight: bold;
  outline: 2px solid transparent;
  transition: 1.5s height cubic-bezier(0.6, 0.4, 0.4, 1.1);
}

.chartBars .bars li .bar:after {
  content: '%';
  font-size: 22px !important;
  vertical-align: top;
  color: rgba(255, 255, 255, 0.8);
  margin-right: -8px;
}

.chartBars .bars li b {
  color: #333;
  font-size:12px;
  width: 100%;
  position: absolute;
  bottom: -2em;
  left: 0;
  text-align: center;
}

.chartBars .numbers {
  width: 50px;
  height: 100%;
  margin: 0;
  padding: 0;
  display: inline-block;
  position: absolute;
  left: -50px;
}

.chartBars .numbers li {
  text-align: right;
  padding-right: 1em;
  list-style: none;
  height: 55px;
  position: relative;
  font-size: 13px;
  bottom: 11px;
  right: -9px;
  color: #333;
}

.chartBars .numbers li:after {
  content: "\00af";
  position: relative;
  right: -5px;
  font-size: 20px;
  top: 7px;
  color: rgba(255, 255, 255, 0.34);
}

.chartBars .numbers li:first-of-type {
  height: 63px;
  margin-top: -1px;
}

.chartBars1 .bar {
  border-top-right-radius: 30px;
}

.chartBars2 {
  max-width: 350px;
}

.chartBars2 .bars {
  padding: 0;
}

.chartBars2 .bars li {
  flex: 0 1 25%;
}

.chartBars2 .bars li .bar {
  box-shadow: 0 0 20px #222;
}

.chartBars3 {
  background: rgba(255, 255, 255, 0.1);
  border-top: 1px solid #666;
  border-right: 1px solid #666;
}

.chartBars3 .bars {
  border-color: #666;
padding: 0px 5px;
}

.chartBars3 .bars li .bar {
  border-top-right-radius: 3px;
  border-top-left-radius: 3px;
  font-size: 22px !important;
}

.chartBars3 .bars li .bar:after {
  font-size: 0.6em !important;
}

.chartBarsWrap.chartBarsHorizontal {
  flex-direction: column;
  padding-left: 70px;
}

.chartBarsWrap.chartBarsHorizontal .bars b {
  color: #eee;
  width: 100%;
  position: absolute;
  bottom: initial;
  top: 1em;
  left: -102%;
  text-align: right;
}

.chartBarsWrap.chartBarsHorizontal .chartBars {
  height: 200px;
}

.chartBarsWrap.chartBarsHorizontal .chartBars .bars {
  border: 0;
}

.chartBarsWrap.chartBarsHorizontal .chartBars .bars .bar {
  width: 0;
  padding-top: 10px;
  height: 100% !important;
  text-align: right;
  font-size: 1.5em;
  transition: 2s width cubic-bezier(0.6, 0.4, 0.4, 1.1);
}

.chartBarsWrap.chartBarsHorizontal .chartBars .bars .bar:after {
  font-size: 0.6em !important;
  margin-right: 20px;
}

.bars li .bar.greenBar {
  background-color: #6B8E23;
  background: radial-gradient(#A7CAAA, #2D8654 );
}

.bars li .bar.greenBarFlat {
  background-color: #6B8E23;
}

.bars li .bar.blueBar {
  background-color: #49E;
  background: radial-gradient(#8abff4, #49E);
}

.bars li .bar.blueBarFlat {
  background-color: #49E;
}

.bars li .bar.orangeBar {
  background-color: orange;
  background: radial-gradient(#FDD22C, #E4B005);
}

.bars li .bar.orangeBarFlat {
  background-color: orange;
}

.bars li .bar.blck_as {
  background-color: orange;
  background: radial-gradient(#ddd, #000);
}

.bars li .bar.blck_as {
  background-color: black;
}

.bars li .bar.red_as {
  background-color: red;
  background: radial-gradient(#F70000, #BF1D38);
}

.bars li .bar.red_as {
  background-color: red;
}

.bars li .bar.Submitted {
  background-color: red;
  background: radial-gradient(#66B2B2, #004C4C);
}

.bars li .bar.Submitted {
  background-color: red;
}

.bars li .bar.Cancel_as {
  background-color: red;
  background: radial-gradient(#1D466E, #59798E);
}

.bars li .bar.Cancel_as {
  background-color: red;
}

.bars li .bar.purpleBar {
  background-color: #6e46af;
  background: radial-gradient(#9778c9, #6e46af);
}

.bars li .bar.purpleBarFlat {
  background-color: #6e46af;
}

.box-piesite {
  text-align: center;
  font-size: 22px;
}

.piesite {
  position: relative;
  width: 1em;
  height: 1em;
  font-size: 10em;
  cursor: default;
}

.piesite .percent {
  position: absolute;
  top: 1.1em;
  left: 0.1em;
  width: 100%;
  font-size: 0.3em;
  text-align: center;
  z-index: 2;
}

.piesite .percent .symbol {
  font-size: 0.5em;
  vertical-align: top;
  opacity: 0.5;
}

.piesite > #slice {
  position: absolute;
  width: 1em;
  height: 1em;
  clip: rect(0px, 1em, 1em, 0.5em);
}

.piesite > #slice.gt50 {
  clip: rect(auto, auto, auto, auto);
}

.piesite > #slice > .pie {
  position: absolute;
  border: 0.1em solid #444;
  width: 1em;
  height: 1em;
  clip: rect(0em, 0.5em, 1em, 0em);
  border-radius: 0.5em;
}

li.design .piesite > #slice > .pie {
  border-color: #49E;
}

li.usability .piesite > #slice > .pie {
  border-color: #FFA500;
}

li.creativity .piesite > #slice > .pie {
  border-color: #6B8E23;
}

.piesite > #slice > .pie.fill {
  transform: rotate(180deg) !important;
}

.piesite.fill > .percent {
  display: none;
}

.piesite:after {
  content: '';
  display: block;
  position: absolute;
  top: 0.1em;
  left: 0.1em;
  width: 0.8em;
  height: 0.8em;
  background: #30303A;
  border-radius: 100%;
  z-index: 1;
}

.piesite:before {
  content: '';
  display: block;
  position: absolute;
  width: 1em;
  height: 1em;
  border-radius: 0.5em;
  opacity: 0.5;
  z-index: 0;
}

.piesite:before {
  background: rgba(255, 255, 255, 0.1);
}

.box-piesite ul {
  padding: 0;
}

.box-piesite ul li {
  display: inline-block;
  margin: 10px 20px;
}

.chartBarsHorizontal .chartBars .bars {
  flex-direction: column;
}

@media screen and (min-width: 600px) {
  .bar:before {
    font-size: 2em !important;
  }
  .chartBars3 .bar:before {
    font-size: 1.5em !important;
  }
}

.tooltip > .tooltipContent {
  display: block;
  position: absolute;
  background: none repeat scroll 0 0 #222;
  color: #F0B015;
  font-family: 'Helvetica';
  font-size: 0.8em;
  font-weight: normal;
  line-height: 1.5em;
  padding: 16px 15px;
  min-width: 200px;
  max-width: 500px;
  top: 0;
  left: 50%;
  transform: translate(-50%, -110%);
  margin-left: 0;
  opacity: 0;
  filter: alpha(opacity=0);
  text-align: center;
  z-index: 2;
  text-transform: none;
  transition: all 0.3s ease-in-out;
}

.tooltip:hover > .tooltipContent {
  opacity: 1;
  filter: alpha(opacity=100);
  z-index: 99;
  transform: translate(-50%, -130%);
  transition: all 0.2s ease;
}

.tooltip .tooltipContent:after {
  border-color: #222 rgba(0, 0, 0, 0);
  border-style: solid;
  border-width: 15px 15px 0;
  bottom: -15px;
  content: "";
  display: block;
  left: 50%;
  transform: translate(-50%, 0);
  position: absolute;
  width: 0;
}

/* Using a url */

@font-face {
	font-family: Flaticon;
	src: url('Flaticon.bcd247b893326382.eot');
	src: url('Flaticond41d.bcd247b893326382.eot?#iefix') format("embedded-opentype"), url('Flaticon.61bb0379242ed2e5.woff') format("woff"), url('Flaticon.a9f42741df869303.ttf') format("truetype"), url('Flaticon.e0b4751c9613224d.svg#Flaticon') format("svg");
	font-weight: 400;
	font-style: normal
}

@media screen and (-webkit-min-device-pixel-ratio:0) {
@font-face {
	font-family: Flaticon;
	src: url('Flaticon.e0b4751c9613224d.svg#Flaticon') format("svg")
}
}

[class*=" flaticon-"]:after, [class*=" flaticon-"]:before, [class^=flaticon-]:after, [class^=flaticon-]:before {
	font-family: Flaticon;
	font-style: normal
}

.flaticon-381-add:before {
	content: "\f100"
}

.flaticon-381-add-1:before {
	content: "\f101"
}

.flaticon-381-add-2:before {
	content: "\f102"
}

.flaticon-381-add-3:before {
	content: "\f103"
}

.flaticon-381-alarm-clock:before {
	content: "\f104"
}

.flaticon-381-alarm-clock-1:before {
	content: "\f105"
}

.flaticon-381-album:before {
	content: "\f106"
}

.flaticon-381-album-1:before {
	content: "\f107"
}

.flaticon-381-album-2:before {
	content: "\f108"
}

.flaticon-381-album-3:before {
	content: "\f109"
}

.flaticon-381-app:before {
	content: "\f10a"
}

.flaticon-381-archive:before {
	content: "\f10b"
}

.flaticon-381-back:before {
	content: "\f10c"
}

.flaticon-381-back-1:before {
	content: "\f10d"
}

.flaticon-381-back-2:before {
	content: "\f10e"
}

.flaticon-381-background:before {
	content: "\f10f"
}

.flaticon-381-background-1:before {
	content: "\f110"
}

.flaticon-381-battery:before {
	content: "\f111"
}

.flaticon-381-battery-1:before {
	content: "\f112"
}

.flaticon-381-battery-2:before {
	content: "\f113"
}

.flaticon-381-battery-3:before {
	content: "\f114"
}

.flaticon-381-battery-4:before {
	content: "\f115"
}

.flaticon-381-battery-5:before {
	content: "\f116"
}

.flaticon-381-battery-6:before {
	content: "\f117"
}

.flaticon-381-battery-7:before {
	content: "\f118"
}

.flaticon-381-battery-8:before {
	content: "\f119"
}

.flaticon-381-battery-9:before {
	content: "\f11a"
}

.flaticon-381-binoculars:before {
	content: "\f11b"
}

.flaticon-381-blueprint:before {
	content: "\f11c"
}

.flaticon-381-bluetooth:before {
	content: "\f11d"
}

.flaticon-381-bluetooth-1:before {
	content: "\f11e"
}

.flaticon-381-book:before {
	content: "\f11f"
}

.flaticon-381-bookmark:before {
	content: "\f120"
}

.flaticon-381-bookmark-1:before {
	content: "\f121"
}

.flaticon-381-box:before {
	content: "\f122"
}

.flaticon-381-box-1:before {
	content: "\f123"
}

.flaticon-381-box-2:before {
	content: "\f124"
}

.flaticon-381-briefcase:before {
	content: "\f125"
}

.flaticon-381-broken-heart:before {
	content: "\f126"
}

.flaticon-381-broken-link:before {
	content: "\f127"
}

.flaticon-381-calculator:before {
	content: "\f128"
}

.flaticon-381-calculator-1:before {
	content: "\f129"
}

.flaticon-381-calendar:before {
	content: "\f12a"
}

.flaticon-381-calendar-1:before {
	content: "\f12b"
}

.flaticon-381-calendar-2:before {
	content: "\f12c"
}

.flaticon-381-calendar-3:before {
	content: "\f12d"
}

.flaticon-381-calendar-4:before {
	content: "\f12e"
}

.flaticon-381-calendar-5:before {
	content: "\f12f"
}

.flaticon-381-calendar-6:before {
	content: "\f130"
}

.flaticon-381-calendar-7:before {
	content: "\f131"
}

.flaticon-381-clock:before {
	content: "\f132"
}

.flaticon-381-clock-1:before {
	content: "\f133"
}

.flaticon-381-clock-2:before {
	content: "\f134"
}

.flaticon-381-close:before {
	content: "\f135"
}

.flaticon-381-cloud:before {
	content: "\f136"
}

.flaticon-381-cloud-computing:before {
	content: "\f137"
}

.flaticon-381-command:before {
	content: "\f138"
}

.flaticon-381-compact-disc:before {
	content: "\f139"
}

.flaticon-381-compact-disc-1:before {
	content: "\f13a"
}

.flaticon-381-compact-disc-2:before {
	content: "\f13b"
}

.flaticon-381-compass:before {
	content: "\f13c"
}

.flaticon-381-compass-1:before {
	content: "\f13d"
}

.flaticon-381-compass-2:before {
	content: "\f13e"
}

.flaticon-381-controls:before {
	content: "\f13f"
}

.flaticon-381-controls-1:before {
	content: "\f140"
}

.flaticon-381-controls-2:before {
	content: "\f141"
}

.flaticon-381-controls-3:before {
	content: "\f142"
}

.flaticon-381-controls-4:before {
	content: "\f143"
}

.flaticon-381-controls-5:before {
	content: "\f144"
}

.flaticon-381-controls-6:before {
	content: "\f145"
}

.flaticon-381-controls-7:before {
	content: "\f146"
}

.flaticon-381-controls-8:before {
	content: "\f147"
}

.flaticon-381-controls-9:before {
	content: "\f148"
}

.flaticon-381-database:before {
	content: "\f149"
}

.flaticon-381-database-1:before {
	content: "\f14a"
}

.flaticon-381-database-2:before {
	content: "\f14b"
}

.flaticon-381-diamond:before {
	content: "\f14c"
}

.flaticon-381-diploma:before {
	content: "\f14d"
}

.flaticon-381-dislike:before {
	content: "\f14e"
}

.flaticon-381-divide:before {
	content: "\f14f"
}

.flaticon-381-division:before {
	content: "\f150"
}

.flaticon-381-division-1:before {
	content: "\f151"
}

.flaticon-381-download:before {
	content: "\f152"
}

.flaticon-381-earth-globe:before {
	content: "\f153"
}

.flaticon-381-earth-globe-1:before {
	content: "\f154"
}

.flaticon-381-edit:before {
	content: "\f155"
}

.flaticon-381-edit-1:before {
	content: "\f156"
}

.flaticon-381-eject:before {
	content: "\f157"
}

.flaticon-381-eject-1:before {
	content: "\f158"
}

.flaticon-381-enter:before {
	content: "\f159"
}

.flaticon-381-equal:before {
	content: "\f15a"
}

.flaticon-381-equal-1:before {
	content: "\f15b"
}

.flaticon-381-equal-2:before {
	content: "\f15c"
}

.flaticon-381-error:before {
	content: "\f15d"
}

.flaticon-381-exit:before {
	content: "\f15e"
}

.flaticon-381-exit-1:before {
	content: "\f15f"
}

.flaticon-381-exit-2:before {
	content: "\f160"
}

.flaticon-381-fast-forward:before {
	content: "\f161"
}

.flaticon-381-fast-forward-1:before {
	content: "\f162"
}

.flaticon-381-file:before {
	content: "\f163"
}

.flaticon-381-file-1:before {
	content: "\f164"
}

.flaticon-381-file-2:before {
	content: "\f165"
}

.flaticon-381-film-strip:before {
	content: "\f166"
}

.flaticon-381-film-strip-1:before {
	content: "\f167"
}

.flaticon-381-fingerprint:before {
	content: "\f168"
}

.flaticon-381-flag:before {
	content: "\f169"
}

.flaticon-381-flag-1:before {
	content: "\f16a"
}

.flaticon-381-flag-2:before {
	content: "\f16b"
}

.flaticon-381-flag-3:before {
	content: "\f16c"
}

.flaticon-381-flag-4:before {
	content: "\f16d"
}

.flaticon-381-focus:before {
	content: "\f16e"
}

.flaticon-381-folder:before {
	content: "\f16f"
}

.flaticon-381-folder-1:before {
	content: "\f170"
}

.flaticon-381-folder-10:before {
	content: "\f171"
}

.flaticon-381-folder-11:before {
	content: "\f172"
}

.flaticon-381-folder-12:before {
	content: "\f173"
}

.flaticon-381-folder-13:before {
	content: "\f174"
}

.flaticon-381-folder-14:before {
	content: "\f175"
}

.flaticon-381-folder-15:before {
	content: "\f176"
}

.flaticon-381-folder-16:before {
	content: "\f177"
}

.flaticon-381-folder-17:before {
	content: "\f178"
}

.flaticon-381-folder-18:before {
	content: "\f179"
}

.flaticon-381-folder-19:before {
	content: "\f17a"
}

.flaticon-381-folder-2:before {
	content: "\f17b"
}

.flaticon-381-folder-3:before {
	content: "\f17c"
}

.flaticon-381-folder-4:before {
	content: "\f17d"
}

.flaticon-381-folder-5:before {
	content: "\f17e"
}

.flaticon-381-folder-6:before {
	content: "\f17f"
}

.flaticon-381-folder-7:before {
	content: "\f180"
}

.flaticon-381-folder-8:before {
	content: "\f181"
}

.flaticon-381-folder-9:before {
	content: "\f182"
}

.flaticon-381-forbidden:before {
	content: "\f183"
}

.flaticon-381-funnel:before {
	content: "\f184"
}

.flaticon-381-gift:before {
	content: "\f185"
}

.flaticon-381-heart:before {
	content: "\f186"
}

.flaticon-381-heart-1:before {
	content: "\f187"
}

.flaticon-381-help:before {
	content: "\f188"
}

.flaticon-381-help-1:before {
	content: "\f189"
}

.flaticon-381-hide:before {
	content: "\f18a"
}

.flaticon-381-high-volume:before {
	content: "\f18b"
}

.flaticon-381-home:before {
	content: "\f18c"
}

.flaticon-381-home-1:before {
	content: "\f18d"
}

.flaticon-381-home-2:before {
	content: "\f18e"
}

.flaticon-381-home-3:before {
	content: "\f18f"
}

.flaticon-381-hourglass:before {
	content: "\f190"
}

.flaticon-381-hourglass-1:before {
	content: "\f191"
}

.flaticon-381-hourglass-2:before {
	content: "\f192"
}

.flaticon-381-id-card:before {
	content: "\f193"
}

.flaticon-381-id-card-1:before {
	content: "\f194"
}

.flaticon-381-id-card-2:before {
	content: "\f195"
}

.flaticon-381-id-card-3:before {
	content: "\f196"
}

.flaticon-381-id-card-4:before {
	content: "\f197"
}

.flaticon-381-id-card-5:before {
	content: "\f198"
}

.flaticon-381-idea:before {
	content: "\f199"
}

.flaticon-381-incoming-call:before {
	content: "\f19a"
}

.flaticon-381-infinity:before {
	content: "\f19b"
}

.flaticon-381-internet:before {
	content: "\f19c"
}

.flaticon-381-key:before {
	content: "\f19d"
}

.flaticon-381-knob:before {
	content: "\f19e"
}

.flaticon-381-knob-1:before {
	content: "\f19f"
}

.flaticon-381-layer:before {
	content: "\f1a0"
}

.flaticon-381-layer-1:before {
	content: "\f1a1"
}

.flaticon-381-like:before {
	content: "\f1a2"
}

.flaticon-381-link:before {
	content: "\f1a3"
}

.flaticon-381-link-1:before {
	content: "\f1a4"
}

.flaticon-381-list:before {
	content: "\f1a5"
}

.flaticon-381-list-1:before {
	content: "\f1a6"
}

.flaticon-381-location:before {
	content: "\f1a7"
}

.flaticon-381-location-1:before {
	content: "\f1a8"
}

.flaticon-381-location-2:before {
	content: "\f1a9"
}

.flaticon-381-location-3:before {
	content: "\f1aa"
}

.flaticon-381-location-4:before {
	content: "\f1ab"
}

.flaticon-381-locations:before {
	content: "\f1ac"
}

.flaticon-381-lock:before {
	content: "\f1ad"
}

.flaticon-381-lock-1:before {
	content: "\f1ae"
}

.flaticon-381-lock-2:before {
	content: "\f1af"
}

.flaticon-381-lock-3:before {
	content: "\f1b0"
}

.flaticon-381-low-volume:before {
	content: "\f1b1"
}

.flaticon-381-low-volume-1:before {
	content: "\f1b2"
}

.flaticon-381-low-volume-2:before {
	content: "\f1b3"
}

.flaticon-381-low-volume-3:before {
	content: "\f1b4"
}

.flaticon-381-magic-wand:before {
	content: "\f1b5"
}

.flaticon-381-magnet:before {
	content: "\f1b6"
}

.flaticon-381-magnet-1:before {
	content: "\f1b7"
}

.flaticon-381-magnet-2:before {
	content: "\f1b8"
}

.flaticon-381-map:before {
	content: "\f1b9"
}

.flaticon-381-map-1:before {
	content: "\f1ba"
}

.flaticon-381-map-2:before {
	content: "\f1bb"
}

.flaticon-381-menu:before {
	content: "\f1bc"
}

.flaticon-381-menu-1:before {
	content: "\f1bd"
}

.flaticon-381-menu-2:before {
	content: "\f1be"
}

.flaticon-381-menu-3:before {
	content: "\f1bf"
}

.flaticon-381-microphone:before {
	content: "\f1c0"
}

.flaticon-381-microphone-1:before {
	content: "\f1c1"
}

.flaticon-381-more:before {
	content: "\f1c2"
}

.flaticon-381-more-1:before {
	content: "\f1c3"
}

.flaticon-381-more-2:before {
	content: "\f1c4"
}

.flaticon-381-multiply:before {
	content: "\f1c5"
}

.flaticon-381-multiply-1:before {
	content: "\f1c6"
}

.flaticon-381-music-album:before {
	content: "\f1c7"
}

.flaticon-381-mute:before {
	content: "\f1c8"
}

.flaticon-381-mute-1:before {
	content: "\f1c9"
}

.flaticon-381-mute-2:before {
	content: "\f1ca"
}

.flaticon-381-network:before {
	content: "\f1cb"
}

.flaticon-381-network-1:before {
	content: "\f1cc"
}

.flaticon-381-network-2:before {
	content: "\f1cd"
}

.flaticon-381-network-3:before {
	content: "\f1ce"
}

.flaticon-381-networking:before {
	content: "\f1cf"
}

.flaticon-381-networking-1:before {
	content: "\f1d0"
}

.flaticon-381-news:before {
	content: "\f1d1"
}

.flaticon-381-newspaper:before {
	content: "\f1d2"
}

.flaticon-381-next:before {
	content: "\f1d3"
}

.flaticon-381-next-1:before {
	content: "\f1d4"
}

.flaticon-381-note:before {
	content: "\f1d5"
}

.flaticon-381-notebook:before {
	content: "\f1d6"
}

.flaticon-381-notebook-1:before {
	content: "\f1d7"
}

.flaticon-381-notebook-2:before {
	content: "\f1d8"
}

.flaticon-381-notebook-3:before {
	content: "\f1d9"
}

.flaticon-381-notebook-4:before {
	content: "\f1da"
}

.flaticon-381-notebook-5:before {
	content: "\f1db"
}

.flaticon-381-notepad:before {
	content: "\f1dc"
}

.flaticon-381-notepad-1:before {
	content: "\f1dd"
}

.flaticon-381-notepad-2:before {
	content: "\f1de"
}

.flaticon-381-notification:before {
	content: "\f1df"
}

.flaticon-381-off:before {
	content: "\f1e0"
}

.flaticon-381-on:before {
	content: "\f1e1"
}

.flaticon-381-pad:before {
	content: "\f1e2"
}

.flaticon-381-padlock:before {
	content: "\f1e3"
}

.flaticon-381-padlock-1:before {
	content: "\f1e4"
}

.flaticon-381-padlock-2:before {
	content: "\f1e5"
}

.flaticon-381-panel:before {
	content: "\f1e6"
}

.flaticon-381-panel-1:before {
	content: "\f1e7"
}

.flaticon-381-panel-2:before {
	content: "\f1e8"
}

.flaticon-381-panel-3:before {
	content: "\f1e9"
}

.flaticon-381-paperclip:before {
	content: "\f1ea"
}

.flaticon-381-pause:before {
	content: "\f1eb"
}

.flaticon-381-pause-1:before {
	content: "\f1ec"
}

.flaticon-381-pencil:before {
	content: "\f1ed"
}

.flaticon-381-percentage:before {
	content: "\f1ee"
}

.flaticon-381-percentage-1:before {
	content: "\f1ef"
}

.flaticon-381-perspective:before {
	content: "\f1f0"
}

.flaticon-381-phone-call:before {
	content: "\f1f1"
}

.flaticon-381-photo:before {
	content: "\f1f2"
}

.flaticon-381-photo-camera:before {
	content: "\f1f3"
}

.flaticon-381-photo-camera-1:before {
	content: "\f1f4"
}

.flaticon-381-picture:before {
	content: "\f1f5"
}

.flaticon-381-picture-1:before {
	content: "\f1f6"
}

.flaticon-381-picture-2:before {
	content: "\f1f7"
}

.flaticon-381-pin:before {
	content: "\f1f8"
}

.flaticon-381-play-button:before {
	content: "\f1f9"
}

.flaticon-381-play-button-1:before {
	content: "\f1fa"
}

.flaticon-381-plus:before {
	content: "\f1fb"
}

.flaticon-381-presentation:before {
	content: "\f1fc"
}

.flaticon-381-price-tag:before {
	content: "\f1fd"
}

.flaticon-381-print:before {
	content: "\f1fe"
}

.flaticon-381-print-1:before {
	content: "\f1ff"
}

.flaticon-381-privacy:before {
	content: "\f200"
}

.flaticon-381-promotion:before {
	content: "\f201"
}

.flaticon-381-promotion-1:before {
	content: "\f202"
}

.flaticon-381-push-pin:before {
	content: "\f203"
}

.flaticon-381-quaver:before {
	content: "\f204"
}

.flaticon-381-quaver-1:before {
	content: "\f205"
}

.flaticon-381-radar:before {
	content: "\f206"
}

.flaticon-381-reading:before {
	content: "\f207"
}

.flaticon-381-receive:before {
	content: "\f208"
}

.flaticon-381-record:before {
	content: "\f209"
}

.flaticon-381-repeat:before {
	content: "\f20a"
}

.flaticon-381-repeat-1:before {
	content: "\f20b"
}

.flaticon-381-resume:before {
	content: "\f20c"
}

.flaticon-381-rewind:before {
	content: "\f20d"
}

.flaticon-381-rewind-1:before {
	content: "\f20e"
}

.flaticon-381-ring:before {
	content: "\f20f"
}

.flaticon-381-ring-1:before {
	content: "\f210"
}

.flaticon-381-rotate:before {
	content: "\f211"
}

.flaticon-381-rotate-1:before {
	content: "\f212"
}

.flaticon-381-route:before {
	content: "\f213"
}

.flaticon-381-save:before {
	content: "\f214"
}

.flaticon-381-search:before {
	content: "\f215"
}

.flaticon-381-search-1:before {
	content: "\f216"
}

.flaticon-381-search-2:before {
	content: "\f217"
}

.flaticon-381-search-3:before {
	content: "\f218"
}

.flaticon-381-send:before {
	content: "\f219"
}

.flaticon-381-send-1:before {
	content: "\f21a"
}

.flaticon-381-send-2:before {
	content: "\f21b"
}

.flaticon-381-settings:before {
	content: "\f21c"
}

.flaticon-381-settings-1:before {
	content: "\f21d"
}

.flaticon-381-settings-2:before {
	content: "\f21e"
}

.flaticon-381-settings-3:before {
	content: "\f21f"
}

.flaticon-381-settings-4:before {
	content: "\f220"
}

.flaticon-381-settings-5:before {
	content: "\f221"
}

.flaticon-381-settings-6:before {
	content: "\f222"
}

.flaticon-381-settings-7:before {
	content: "\f223"
}

.flaticon-381-settings-8:before {
	content: "\f224"
}

.flaticon-381-settings-9:before {
	content: "\f225"
}

.flaticon-381-share:before {
	content: "\f226"
}

.flaticon-381-share-1:before {
	content: "\f227"
}

.flaticon-381-share-2:before {
	content: "\f228"
}

.flaticon-381-shuffle:before {
	content: "\f229"
}

.flaticon-381-shuffle-1:before {
	content: "\f22a"
}

.flaticon-381-shut-down:before {
	content: "\f22b"
}

.flaticon-381-silence:before {
	content: "\f22c"
}

.flaticon-381-silent:before {
	content: "\f22d"
}

.flaticon-381-smartphone:before {
	content: "\f22e"
}

.flaticon-381-smartphone-1:before {
	content: "\f22f"
}

.flaticon-381-smartphone-2:before {
	content: "\f230"
}

.flaticon-381-smartphone-3:before {
	content: "\f231"
}

.flaticon-381-smartphone-4:before {
	content: "\f232"
}

.flaticon-381-smartphone-5:before {
	content: "\f233"
}

.flaticon-381-smartphone-6:before {
	content: "\f234"
}

.flaticon-381-smartphone-7:before {
	content: "\f235"
}

.flaticon-381-speaker:before {
	content: "\f236"
}

.flaticon-381-speedometer:before {
	content: "\f237"
}

.flaticon-381-spotlight:before {
	content: "\f238"
}

.flaticon-381-star:before {
	content: "\f239"
}

.flaticon-381-star-1:before {
	content: "\f23a"
}

.flaticon-381-stop:before {
	content: "\f23b"
}

.flaticon-381-stop-1:before {
	content: "\f23c"
}

.flaticon-381-stopclock:before {
	content: "\f23d"
}

.flaticon-381-stopwatch:before {
	content: "\f23e"
}

.flaticon-381-stopwatch-1:before {
	content: "\f23f"
}

.flaticon-381-stopwatch-2:before {
	content: "\f240"
}

.flaticon-381-substract:before {
	content: "\f241"
}

.flaticon-381-substract-1:before {
	content: "\f242"
}

.flaticon-381-substract-2:before {
	content: "\f243"
}

.flaticon-381-success:before {
	content: "\f244"
}

.flaticon-381-success-1:before {
	content: "\f245"
}

.flaticon-381-success-2:before {
	content: "\f246"
}

.flaticon-381-sunglasses:before {
	content: "\f247"
}

.flaticon-381-switch:before {
	content: "\f248"
}

.flaticon-381-switch-1:before {
	content: "\f249"
}

.flaticon-381-switch-2:before {
	content: "\f24a"
}

.flaticon-381-switch-3:before {
	content: "\f24b"
}

.flaticon-381-switch-4:before {
	content: "\f24c"
}

.flaticon-381-switch-5:before {
	content: "\f24d"
}

.flaticon-381-sync:before {
	content: "\f24e"
}

.flaticon-381-tab:before {
	content: "\f24f"
}

.flaticon-381-target:before {
	content: "\f250"
}

.flaticon-381-television:before {
	content: "\f251"
}

.flaticon-381-time:before {
	content: "\f252"
}

.flaticon-381-transfer:before {
	content: "\f253"
}

.flaticon-381-trash:before {
	content: "\f254"
}

.flaticon-381-trash-1:before {
	content: "\f255"
}

.flaticon-381-trash-2:before {
	content: "\f256"
}

.flaticon-381-trash-3:before {
	content: "\f257"
}

.flaticon-381-turn-off:before {
	content: "\f258"
}

.flaticon-381-umbrella:before {
	content: "\f259"
}

.flaticon-381-unlocked:before {
	content: "\f25a"
}

.flaticon-381-unlocked-1:before {
	content: "\f25b"
}

.flaticon-381-unlocked-2:before {
	content: "\f25c"
}

.flaticon-381-unlocked-3:before {
	content: "\f25d"
}

.flaticon-381-unlocked-4:before {
	content: "\f25e"
}

.flaticon-381-upload:before {
	content: "\f25f"
}

.flaticon-381-upload-1:before {
	content: "\f260"
}

.flaticon-381-user:before {
	content: "\f261"
}

.flaticon-381-user-1:before {
	content: "\f262"
}

.flaticon-381-user-2:before {
	content: "\f263"
}

.flaticon-381-user-3:before {
	content: "\f264"
}

.flaticon-381-user-4:before {
	content: "\f265"
}

.flaticon-381-user-5:before {
	content: "\f266"
}

.flaticon-381-user-6:before {
	content: "\f267"
}

.flaticon-381-user-7:before {
	content: "\f268"
}

.flaticon-381-user-8:before {
	content: "\f269"
}

.flaticon-381-user-9:before {
	content: "\f26a"
}

.flaticon-381-video-camera:before {
	content: "\f26b"
}

.flaticon-381-video-clip:before {
	content: "\f26c"
}

.flaticon-381-video-player:before {
	content: "\f26d"
}

.flaticon-381-video-player-1:before {
	content: "\f26e"
}

.flaticon-381-view:before {
	content: "\f26f"
}

.flaticon-381-view-1:before {
	content: "\f270"
}

.flaticon-381-view-2:before {
	content: "\f271"
}

.flaticon-381-volume:before {
	content: "\f272"
}

.flaticon-381-warning:before {
	content: "\f273"
}

.flaticon-381-warning-1:before {
	content: "\f274"
}

.flaticon-381-wifi:before {
	content: "\f275"
}

.flaticon-381-wifi-1:before {
	content: "\f276"
}

.flaticon-381-wifi-2:before {
	content: "\f277"
}

.flaticon-381-windows:before {
	content: "\f278"
}

.flaticon-381-windows-1:before {
	content: "\f279"
}

.flaticon-381-zoom-in:before {
	content: "\f27a"
}

.flaticon-381-zoom-out:before {
	content: "\f27b"
}

/* Using a url */

body {
  margin: 0;
  padding: 0px;
  background-color: #eeeeee;
}

/* ==================== BAR GRAPH  ==================== */

/* ------ container ------ */

div.css_bar_graph {
  width: 490px;
  height: 320px;
  padding: 40px 20px 10px 70px;
  /* --- font --- */
  font-size: 13px;
  font-family: arial, sans-serif;
  font-weight: normal;
  color: #444444;
  background-color: #ffffff;
  position: relative;
  margin-left: auto;
  margin-right: auto;
  border: 1px solid #d5d5d5;
  /* --- css3 --- */
  border-radius: 10px;
  -webkit-border-radius: 10px;
  -moz-border-radius: 10px;
}

/* ------ hyperlinks ------ */

div.css_bar_graph a {
  color: #444444;
  text-decoration: none;
}

/* ------ lists ------ */

div.css_bar_graph ul {
  margin: 0px;
  padding: 0px;
  list-style-type: none;
}

div.css_bar_graph li {
  margin: 0px;
  padding: 0px;
}

/* ==================== Y-AXIS LABELS ==================== */

/* ------ base ------ */

div.css_bar_graph ul.y_axis {
  width: 50px;
  position: absolute;
  top: 40px;
  left: 10px;
  text-align: right;
}

/* ------ labels ------ */

div.css_bar_graph ul.y_axis li {
  width: 100%;
  height: 49px;	/* 50px including border */
  float: left;
  color: #888888;
  /* --- alignment correction --- */
  border-top: 1px solid transparent;
  position: relative;
  top: -13px;	/* value = font height */
}

/* ==================== X-AXIS LABELS  ==================== */

/* ------ base ------ */

div.css_bar_graph ul.x_axis {
  width: 100%;
  height: 50px;
  position: absolute;
  bottom: 0px;
  left: 90px;
  text-align: center;
}

/* ------ labels ------ */

div.css_bar_graph ul.x_axis li {
  display: inline;
  width: 90px;
  float: left;
}

/* ==================== GRAPH LABEL  ==================== */

/* ------ base ------ */

div.css_bar_graph div.label {
  width: 100%;
  height: 50px;
  float: left;
  margin-top: 20px;
  text-align: center;
}

div.css_bar_graph div.label span { font-weight: bold; }

/* ==================== GRAPH  ==================== */

/* ------ base ------ */

div.css_bar_graph div.graph {
  width: 100%;
  height: 100%;
  float: left;
}

/* ------ grid ------ */

div.css_bar_graph div.graph ul.grid { width: 100%; }

/* ------ IE grid ------ */

div.css_bar_graph div.graph li {
  width: 100%;
  height: 49px;	/* 50px including border */
  float: left;
  border-top: 1px solid #e5e5e5;
}

/* ------ other browsers grid ------ */

div.css_bar_graph div.graph li:nth-child(odd) {
  width: 100%;
  height: 49px;	/* 50px including border */
  float: left;
  border-top: 1px solid #e5e5e5;
  background-color: #f8f8f8;
}

div.css_bar_graph div.graph li:nth-child(even) {
  width: 100%;
  height: 49px;	/* 50px including border */
  float: left;
  border-top: 1px solid #e5e5e5;
}

/* ------ bottom grid element ------ */

div.css_bar_graph div.graph li.bottom {
  border-top: 1px solid #d5d5d5;
  background-color: #eeeeee;
  height: 19px;
}

/* ==================== BARS COMMON  ==================== */

/* ------ common styles ------ */

div.css_bar_graph div.graph li.bar {
  width: 50px;
  float: left;
  position: absolute;
  bottom: 70px;
  text-align: center;
  /* --- css3 --- */
	/* --- transitions --- */
  transition: all 0.15s ease-in-out;
}

/* ------ bar top circle ------ */

div.css_bar_graph div.graph li.bar div.top {
  width: 100%;
  height: 20px;
  margin-top: -10px;
  /* --- css3 --- */
  border-radius: 50px/20px;
  /* --- transitions --- */
  transition: all 0.15s ease-in-out;
}

/* ------ bar bottom circle ------ */

div.css_bar_graph div.graph li.bar div.bottom {
  width: 100%;
  height: 20px;
  position: absolute;
  bottom: -10px;
  left: 0px;
  /* --- css3 --- */
  border-radius: 50px/20px;
  /* --- transitions --- */
  transition: all 0.15s ease-in-out;
}

/* ------ bar top label ------ */

div.css_bar_graph div.graph li.bar span {
  position: relative;
  top: -50px;
  padding: 3px 5px 3px 5px;
  z-index: 100;
  background-color: #eeeeee;
  border: 1px solid #bebebe;
  /* --- css3 --- */
  border-radius: 3px;
  -webkit-border-radius: 3px;
  -moz-border-radius: 3px;
  /* --- gradient --- */
  background-image: linear-gradient(top, #ffffff, #f1f1f1 1px, #ebebeb); /* W3C */
 filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#f1f1f1', endColorstr='#ebebeb'); /* IE5.5 - 7 */
 -ms-filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#f1f1f1', endColorstr='#ebebeb'); /* IE8 */ /* IE9 */ /* Firefox */ /* Opera 11  */
  background: -webkit-linear-gradient(top, #ffffff, #f1f1f1 1px, #ebebeb); /* Chrome 11  */
  background: -webkit-gradient(linear, left top, left bottom, color-stop(0, #ffffff), color-stop(0.05, #f1f1f1), color-stop(1, #ebebeb)); /* Chrome 10, Safari */
  /* --- shadow --- */
  text-shadow: 0px 1px 0px rgba(255,255,255,1);
  box-shadow: 0px 1px 0px rgba(0,0,0,0.1);
  -webkit-box-shadow: 0px 1px 0px rgba(0,0,0,0.1);
  -moz-box-shadow: 0px 1px 0px rgba(0,0,0,0.1);
  /* --- transitions --- */
  transition: all 0.15s ease-in-out;
}

/* ------ bars positions ------ */

div.css_bar_graph div.graph li.nr_1 { left: 110px; }

div.css_bar_graph div.graph li.nr_2 { left: 200px; }

div.css_bar_graph div.graph li.nr_3 { left: 290px; }

div.css_bar_graph div.graph li.nr_4 { left: 380px; }

div.css_bar_graph div.graph li.nr_5 { left: 470px; }

div.css_bar_graph div.graph li.nr_6 { left: 560px; }

div.css_bar_graph div.graph li.nr_7 { left: 650px; }

div.css_bar_graph div.graph li.nr_8 { left: 740px; }

/* ==================== BLUE BAR  ==================== */

/* ------ base ------ */

div.css_bar_graph div.graph li.blue {
  background: #208faf;	/* --- IE --- */
  background: rgba(32,143,175,0.8);
}

/* ------ top ------ */

div.css_bar_graph div.graph li.blue div.top { background: #72b8cc; }

/* ------ bottom ------ */

div.css_bar_graph div.graph li.blue div.bottom { background: #208faf; }

/* ==================== GREEN BAR  ==================== */

/* ------ base ------ */

div.css_bar_graph div.graph li.green {
  background: #608d00;	/* --- IE --- */
  background: rgba(96,141,0,0.8);
}

/* ------ top ------ */

div.css_bar_graph div.graph li.green div.top { background: #a2c656; }

/* ------ bottom ------ */

div.css_bar_graph div.graph li.green div.bottom { background: #608d00; }

/* ==================== ORANGE BAR  ==================== */

/* ------ base ------ */

div.css_bar_graph div.graph li.orange {
  background: #ff9000;	/* --- IE --- */
  background: rgba(255,144,0,0.8);
}

/* ------ top ------ */

div.css_bar_graph div.graph li.orange div.top { background: #ffc24c; }

/* ------ bottom ------ */

div.css_bar_graph div.graph li.orange div.bottom { background: #ff9000; }

/* ==================== PURPLE BAR  ==================== */

/* ------ base ------ */

div.css_bar_graph div.graph li.purple {
  background: #7d47ba;	/* --- IE --- */
  background: rgba(125,71,186,0.8);
}

/* ------ top ------ */

div.css_bar_graph div.graph li.purple div.top { background: #b592dd; }

/* ------ bottom ------ */

div.css_bar_graph div.graph li.purple div.bottom { background: #7d47ba; }

/* ==================== RED BAR  ==================== */

/* ------ base ------ */

div.css_bar_graph div.graph li.red {
  background: #d23648;	/* --- IE --- */
  background: rgba(210,54,72,0.8);
}

/* ------ top ------ */

div.css_bar_graph div.graph li.red div.top { background: #ea828e; }

/* ------ bottom ------ */

div.css_bar_graph div.graph li.red div.bottom { background: #d23648; }

/* ==================== HOVERS  ==================== */

div.css_bar_graph div.graph li.blue:hover {
  cursor: pointer;
  background: #208faf;
}

div.css_bar_graph div.graph li.green:hover {
  cursor: pointer;
  background: #608d00;
}

div.css_bar_graph div.graph li.orange:hover {
  cursor: pointer;
  background: #ff9000;
}

div.css_bar_graph div.graph li.purple:hover {
  cursor: pointer;
  background: #7d47ba;
}

div.css_bar_graph div.graph li.red:hover {
  cursor: pointer;
  background: #d23648;
}

div.css_bar_graph div.graph li.bar:hover span {
  cursor: pointer;
  top: -60px;
  padding: 10px;
  margin: 0px;
}

/* Using a url */

/* Using a url */

@font-face{font-family:simple-line-icons;src:url('Simple-Line-Icons4c824c82.9ee443f00212728a.eot?-i3a2kk');src:url('Simple-Line-Iconsd41dd41d.9ee443f00212728a.eot?#iefix-i3a2kk') format('embedded-opentype'),url('Simple-Line-Icons4c824c82.004a90b4592bfbc5.ttf?-i3a2kk') format('truetype'),url('Simple-Line-Icons4c824c82.8a97a31aee0c8114.woff2?-i3a2kk') format('woff2'),url('Simple-Line-Icons4c824c82.1d7349a09cec60c7.woff?-i3a2kk') format('woff'),url('Simple-Line-Icons4c824c82.cdf5ddcea7ca889d.svg?-i3a2kk#simple-line-icons') format('svg');font-weight:400;font-style:normal}

.icon-action-redo,.icon-action-undo,.icon-anchor,.icon-arrow-down,.icon-arrow-down-circle,.icon-arrow-left,.icon-arrow-left-circle,.icon-arrow-right,.icon-arrow-right-circle,.icon-arrow-up,.icon-arrow-up-circle,.icon-badge,.icon-bag,.icon-ban,.icon-basket,.icon-basket-loaded,.icon-bell,.icon-book-open,.icon-briefcase,.icon-bubble,.icon-bubbles,.icon-bulb,.icon-calculator,.icon-calender,.icon-call-end,.icon-call-in,.icon-call-out,.icon-camera,.icon-camrecorder,.icon-chart,.icon-check,.icon-chemistry,.icon-clock,.icon-close,.icon-cloud-download,.icon-cloud-upload,.icon-compass,.icon-control-end,.icon-control-forward,.icon-control-pause,.icon-control-play,.icon-control-rewind,.icon-control-start,.icon-credit-card,.icon-crop,.icon-cup,.icon-cursor,.icon-cursor-move,.icon-diamond,.icon-direction,.icon-directions,.icon-disc,.icon-dislike,.icon-doc,.icon-docs,.icon-drawar,.icon-drop,.icon-earphones,.icon-earphones-alt,.icon-emotsmile,.icon-energy,.icon-envelope,.icon-envelope-letter,.icon-envelope-open,.icon-equalizer,.icon-eye,.icon-eyeglass,.icon-feed,.icon-film,.icon-fire,.icon-flag,.icon-folder,.icon-folder-alt,.icon-frame,.icon-game-controller,.icon-ghost,.icon-globe,.icon-globe-alt,.icon-graduation,.icon-graph,.icon-grid,.icon-handbag,.icon-heart,.icon-home,.icon-hourglass,.icon-info,.icon-key,.icon-layers,.icon-like,.icon-link,.icon-list,.icon-location-pin,.icon-lock,.icon-lock-open,.icon-login,.icon-logout,.icon-loop,.icon-magic-wand,.icon-magnet,.icon-magnifier,.icon-magnifier-add,.icon-magnifier-remove,.icon-map,.icon-menu,.icon-microphone,.icon-mouse,.icon-music-tone,.icon-music-tone-alt,.icon-mustache,.icon-note,.icon-notebook,.icon-options,.icon-options-vertical,.icon-paper-clip,.icon-paper-plane,.icon-paypal,.icon-pencil,.icon-people,.icon-phone,.icon-picture,.icon-pie-chart,.icon-pin,.icon-plane,.icon-playlist,.icon-plus,.icon-power,.icon-present,.icon-printer,.icon-puzzle,.icon-question,.icon-refresh,.icon-reload,.icon-rocket,.icon-screen-desktop,.icon-screen-smartphone,.icon-screen-tablet,.icon-settings,.icon-share,.icon-share-alt,.icon-shield,.icon-shuffle,.icon-size-actual,.icon-size-fullscreen,.icon-social-behance,.icon-social-dribbble,.icon-social-dropbox,.icon-social-facebook,.icon-social-foursqare,.icon-social-github,.icon-social-gplus,.icon-social-instagram,.icon-social-linkedin,.icon-social-pintarest,.icon-social-reddit,.icon-social-skype,.icon-social-soundcloud,.icon-social-spotify,.icon-social-stumbleupon,.icon-social-tumblr,.icon-social-twitter,.icon-social-youtube,.icon-speech,.icon-speedometer,.icon-star,.icon-support,.icon-symble-female,.icon-symbol-male,.icon-tag,.icon-target,.icon-trash,.icon-trophy,.icon-umbrella,.icon-user,.icon-user-female,.icon-user-follow,.icon-user-following,.icon-user-unfollow,.icon-vector,.icon-volume-1,.icon-volume-2,.icon-volume-off,.icon-wallet,.icon-wrench{font-family:simple-line-icons;speak:none;font-style:normal;font-weight:400;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}

.icon-user:before{content:"\e005"}

.icon-people:before{content:"\e001"}

.icon-user-female:before{content:"\e000"}

.icon-user-follow:before{content:"\e002"}

.icon-user-following:before{content:"\e003"}

.icon-user-unfollow:before{content:"\e004"}

.icon-login:before{content:"\e066"}

.icon-logout:before{content:"\e065"}

.icon-emotsmile:before{content:"\e021"}

.icon-phone:before{content:"\e600"}

.icon-call-end:before{content:"\e048"}

.icon-call-in:before{content:"\e047"}

.icon-call-out:before{content:"\e046"}

.icon-map:before{content:"\e033"}

.icon-location-pin:before{content:"\e096"}

.icon-direction:before{content:"\e042"}

.icon-directions:before{content:"\e041"}

.icon-compass:before{content:"\e045"}

.icon-layers:before{content:"\e034"}

.icon-menu:before{content:"\e601"}

.icon-list:before{content:"\e067"}

.icon-options-vertical:before{content:"\e602"}

.icon-options:before{content:"\e603"}

.icon-arrow-down:before{content:"\e604"}

.icon-arrow-left:before{content:"\e605"}

.icon-arrow-right:before{content:"\e606"}

.icon-arrow-up:before{content:"\e607"}

.icon-arrow-up-circle:before{content:"\e078"}

.icon-arrow-left-circle:before{content:"\e07a"}

.icon-arrow-right-circle:before{content:"\e079"}

.icon-arrow-down-circle:before{content:"\e07b"}

.icon-check:before{content:"\e080"}

.icon-clock:before{content:"\e081"}

.icon-plus:before{content:"\e095"}

.icon-close:before{content:"\e082"}

.icon-trophy:before{content:"\e006"}

.icon-screen-smartphone:before{content:"\e010"}

.icon-screen-desktop:before{content:"\e011"}

.icon-plane:before{content:"\e012"}

.icon-notebook:before{content:"\e013"}

.icon-mustache:before{content:"\e014"}

.icon-mouse:before{content:"\e015"}

.icon-magnet:before{content:"\e016"}

.icon-energy:before{content:"\e020"}

.icon-disc:before{content:"\e022"}

.icon-cursor:before{content:"\e06e"}

.icon-cursor-move:before{content:"\e023"}

.icon-crop:before{content:"\e024"}

.icon-chemistry:before{content:"\e026"}

.icon-speedometer:before{content:"\e007"}

.icon-shield:before{content:"\e00e"}

.icon-screen-tablet:before{content:"\e00f"}

.icon-magic-wand:before{content:"\e017"}

.icon-hourglass:before{content:"\e018"}

.icon-graduation:before{content:"\e019"}

.icon-ghost:before{content:"\e01a"}

.icon-game-controller:before{content:"\e01b"}

.icon-fire:before{content:"\e01c"}

.icon-eyeglass:before{content:"\e01d"}

.icon-envelope-open:before{content:"\e01e"}

.icon-envelope-letter:before{content:"\e01f"}

.icon-bell:before{content:"\e027"}

.icon-badge:before{content:"\e028"}

.icon-anchor:before{content:"\e029"}

.icon-wallet:before{content:"\e02a"}

.icon-vector:before{content:"\e02b"}

.icon-speech:before{content:"\e02c"}

.icon-puzzle:before{content:"\e02d"}

.icon-printer:before{content:"\e02e"}

.icon-present:before{content:"\e02f"}

.icon-playlist:before{content:"\e030"}

.icon-pin:before{content:"\e031"}

.icon-picture:before{content:"\e032"}

.icon-handbag:before{content:"\e035"}

.icon-globe-alt:before{content:"\e036"}

.icon-globe:before{content:"\e037"}

.icon-folder-alt:before{content:"\e039"}

.icon-folder:before{content:"\e089"}

.icon-film:before{content:"\e03a"}

.icon-feed:before{content:"\e03b"}

.icon-drop:before{content:"\e03e"}

.icon-drawar:before{content:"\e03f"}

.icon-docs:before{content:"\e040"}

.icon-doc:before{content:"\e085"}

.icon-diamond:before{content:"\e043"}

.icon-cup:before{content:"\e044"}

.icon-calculator:before{content:"\e049"}

.icon-bubbles:before{content:"\e04a"}

.icon-briefcase:before{content:"\e04b"}

.icon-book-open:before{content:"\e04c"}

.icon-basket-loaded:before{content:"\e04d"}

.icon-basket:before{content:"\e04e"}

.icon-bag:before{content:"\e04f"}

.icon-action-undo:before{content:"\e050"}

.icon-action-redo:before{content:"\e051"}

.icon-wrench:before{content:"\e052"}

.icon-umbrella:before{content:"\e053"}

.icon-trash:before{content:"\e054"}

.icon-tag:before{content:"\e055"}

.icon-support:before{content:"\e056"}

.icon-frame:before{content:"\e038"}

.icon-size-fullscreen:before{content:"\e057"}

.icon-size-actual:before{content:"\e058"}

.icon-shuffle:before{content:"\e059"}

.icon-share-alt:before{content:"\e05a"}

.icon-share:before{content:"\e05b"}

.icon-rocket:before{content:"\e05c"}

.icon-question:before{content:"\e05d"}

.icon-pie-chart:before{content:"\e05e"}

.icon-pencil:before{content:"\e05f"}

.icon-note:before{content:"\e060"}

.icon-loop:before{content:"\e064"}

.icon-home:before{content:"\e069"}

.icon-grid:before{content:"\e06a"}

.icon-graph:before{content:"\e06b"}

.icon-microphone:before{content:"\e063"}

.icon-music-tone-alt:before{content:"\e061"}

.icon-music-tone:before{content:"\e062"}

.icon-earphones-alt:before{content:"\e03c"}

.icon-earphones:before{content:"\e03d"}

.icon-equalizer:before{content:"\e06c"}

.icon-like:before{content:"\e068"}

.icon-dislike:before{content:"\e06d"}

.icon-control-start:before{content:"\e06f"}

.icon-control-rewind:before{content:"\e070"}

.icon-control-play:before{content:"\e071"}

.icon-control-pause:before{content:"\e072"}

.icon-control-forward:before{content:"\e073"}

.icon-control-end:before{content:"\e074"}

.icon-volume-1:before{content:"\e09f"}

.icon-volume-2:before{content:"\e0a0"}

.icon-volume-off:before{content:"\e0a1"}

.icon-calender:before{content:"\e075"}

.icon-bulb:before{content:"\e076"}

.icon-chart:before{content:"\e077"}

.icon-ban:before{content:"\e07c"}

.icon-bubble:before{content:"\e07d"}

.icon-camrecorder:before{content:"\e07e"}

.icon-camera:before{content:"\e07f"}

.icon-cloud-download:before{content:"\e083"}

.icon-cloud-upload:before{content:"\e084"}

.icon-envelope:before{content:"\e086"}

.icon-eye:before{content:"\e087"}

.icon-flag:before{content:"\e088"}

.icon-heart:before{content:"\e08a"}

.icon-info:before{content:"\e08b"}

.icon-key:before{content:"\e08c"}

.icon-link:before{content:"\e08d"}

.icon-lock:before{content:"\e08e"}

.icon-lock-open:before{content:"\e08f"}

.icon-magnifier:before{content:"\e090"}

.icon-magnifier-add:before{content:"\e091"}

.icon-magnifier-remove:before{content:"\e092"}

.icon-paper-clip:before{content:"\e093"}

.icon-paper-plane:before{content:"\e094"}

.icon-power:before{content:"\e097"}

.icon-refresh:before{content:"\e098"}

.icon-reload:before{content:"\e099"}

.icon-settings:before{content:"\e09a"}

.icon-star:before{content:"\e09b"}

.icon-symble-female:before{content:"\e09c"}

.icon-symbol-male:before{content:"\e09d"}

.icon-target:before{content:"\e09e"}

.icon-credit-card:before{content:"\e025"}

.icon-paypal:before{content:"\e608"}

.icon-social-tumblr:before{content:"\e00a"}

.icon-social-twitter:before{content:"\e009"}

.icon-social-facebook:before{content:"\e00b"}

.icon-social-instagram:before{content:"\e609"}

.icon-social-linkedin:before{content:"\e60a"}

.icon-social-pintarest:before{content:"\e60b"}

.icon-social-github:before{content:"\e60c"}

.icon-social-gplus:before{content:"\e60d"}

.icon-social-reddit:before{content:"\e60e"}

.icon-social-skype:before{content:"\e60f"}

.icon-social-dribbble:before{content:"\e00d"}

.icon-social-behance:before{content:"\e610"}

.icon-social-foursqare:before{content:"\e611"}

.icon-social-soundcloud:before{content:"\e612"}

.icon-social-spotify:before{content:"\e613"}

.icon-social-stumbleupon:before{content:"\e614"}

.icon-social-youtube:before{content:"\e008"}

.icon-social-dropbox:before{content:"\e00c"}

/* Using a url */

/*!
 *  Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome
 *  License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
 */

@font-face{font-family:'FontAwesome';src:url('fontawesome-webfont3e6e3e6e.2b13baa7dd4f54c9.eot?v=4.7.0');src:url('fontawesome-webfontd41dd41d.2b13baa7dd4f54c9.eot?#iefix&v=4.7.0') format('embedded-opentype'),url('fontawesome-webfont3e6e3e6e.e9955780856cf8aa.woff2?v=4.7.0') format('woff2'),url('fontawesome-webfont3e6e3e6e.cf011583fb81df9f.woff?v=4.7.0') format('woff'),url('fontawesome-webfont3e6e3e6e.8a7cb27d142e3e19.ttf?v=4.7.0') format('truetype'),url('fontawesome-webfont3e6e3e6e.da909aa098b0ee2d.svg?v=4.7.0#fontawesomeregular') format('svg');font-weight:normal;font-style:normal}

.fa{display:inline-block;font:normal normal normal 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}

.fa-lg{font-size:1.33333333em;line-height:.75em;vertical-align:-15%}

.fa-2x{font-size:2em}

.fa-3x{font-size:3em}

.fa-4x{font-size:4em}

.fa-5x{font-size:5em}

.fa-fw{width:1.28571429em;text-align:center}

.fa-ul{padding-left:0;margin-left:2.14285714em;list-style-type:none}

.fa-ul>li{position:relative}

.fa-li{position:absolute;left:-2.14285714em;width:2.14285714em;top:.14285714em;text-align:center}

.fa-li.fa-lg{left:-1.85714286em}

.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}

.fa-pull-left{float:left}

.fa-pull-right{float:right}

.fa.fa-pull-left{margin-right:.3em}

.fa.fa-pull-right{margin-left:.3em}

.pull-right{float:right}

.pull-left{float:left}

.fa.pull-left{margin-right:.3em}

.fa.pull-right{margin-left:.3em}

.fa-spin{animation:fa-spin 2s infinite linear}

.fa-pulse{animation:fa-spin 1s infinite steps(8)}

@keyframes fa-spin{0%{transform:rotate(0deg)}100%{transform:rotate(359deg)}}

.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";transform:rotate(90deg)}

.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";transform:rotate(180deg)}

.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";transform:rotate(270deg)}

.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";transform:scale(-1, 1)}

.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";transform:scale(1, -1)}

:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}

.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}

.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}

.fa-stack-1x{line-height:inherit}

.fa-stack-2x{font-size:2em}

.fa-inverse{color:#fff}

.fa-glass:before{content:"\f000"}

.fa-music:before{content:"\f001"}

.fa-search:before{content:"\f002"}

.fa-envelope-o:before{content:"\f003"}

.fa-heart:before{content:"\f004"}

.fa-star:before{content:"\f005"}

.fa-star-o:before{content:"\f006"}

.fa-user:before{content:"\f007"}

.fa-film:before{content:"\f008"}

.fa-th-large:before{content:"\f009"}

.fa-th:before{content:"\f00a"}

.fa-th-list:before{content:"\f00b"}

.fa-check:before{content:"\f00c"}

.fa-remove:before,.fa-close:before,.fa-times:before{content:"\f00d"}

.fa-search-plus:before{content:"\f00e"}

.fa-search-minus:before{content:"\f010"}

.fa-power-off:before{content:"\f011"}

.fa-signal:before{content:"\f012"}

.fa-gear:before,.fa-cog:before{content:"\f013"}

.fa-trash-o:before{content:"\f014"}

.fa-home:before{content:"\f015"}

.fa-file-o:before{content:"\f016"}

.fa-clock-o:before{content:"\f017"}

.fa-road:before{content:"\f018"}

.fa-download:before{content:"\f019"}

.fa-arrow-circle-o-down:before{content:"\f01a"}

.fa-arrow-circle-o-up:before{content:"\f01b"}

.fa-inbox:before{content:"\f01c"}

.fa-play-circle-o:before{content:"\f01d"}

.fa-rotate-right:before,.fa-repeat:before{content:"\f01e"}

.fa-refresh:before{content:"\f021"}

.fa-list-alt:before{content:"\f022"}

.fa-lock:before{content:"\f023"}

.fa-flag:before{content:"\f024"}

.fa-headphones:before{content:"\f025"}

.fa-volume-off:before{content:"\f026"}

.fa-volume-down:before{content:"\f027"}

.fa-volume-up:before{content:"\f028"}

.fa-qrcode:before{content:"\f029"}

.fa-barcode:before{content:"\f02a"}

.fa-tag:before{content:"\f02b"}

.fa-tags:before{content:"\f02c"}

.fa-book:before{content:"\f02d"}

.fa-bookmark:before{content:"\f02e"}

.fa-print:before{content:"\f02f"}

.fa-camera:before{content:"\f030"}

.fa-font:before{content:"\f031"}

.fa-bold:before{content:"\f032"}

.fa-italic:before{content:"\f033"}

.fa-text-height:before{content:"\f034"}

.fa-text-width:before{content:"\f035"}

.fa-align-left:before{content:"\f036"}

.fa-align-center:before{content:"\f037"}

.fa-align-right:before{content:"\f038"}

.fa-align-justify:before{content:"\f039"}

.fa-list:before{content:"\f03a"}

.fa-dedent:before,.fa-outdent:before{content:"\f03b"}

.fa-indent:before{content:"\f03c"}

.fa-video-camera:before{content:"\f03d"}

.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:"\f03e"}

.fa-pencil:before{content:"\f040"}

.fa-map-marker:before{content:"\f041"}

.fa-adjust:before{content:"\f042"}

.fa-tint:before{content:"\f043"}

.fa-edit:before,.fa-pencil-square-o:before{content:"\f044"}

.fa-share-square-o:before{content:"\f045"}

.fa-check-square-o:before{content:"\f046"}

.fa-arrows:before{content:"\f047"}

.fa-step-backward:before{content:"\f048"}

.fa-fast-backward:before{content:"\f049"}

.fa-backward:before{content:"\f04a"}

.fa-play:before{content:"\f04b"}

.fa-pause:before{content:"\f04c"}

.fa-stop:before{content:"\f04d"}

.fa-forward:before{content:"\f04e"}

.fa-fast-forward:before{content:"\f050"}

.fa-step-forward:before{content:"\f051"}

.fa-eject:before{content:"\f052"}

.fa-chevron-left:before{content:"\f053"}

.fa-chevron-right:before{content:"\f054"}

.fa-plus-circle:before{content:"\f055"}

.fa-minus-circle:before{content:"\f056"}

.fa-times-circle:before{content:"\f057"}

.fa-check-circle:before{content:"\f058"}

.fa-question-circle:before{content:"\f059"}

.fa-info-circle:before{content:"\f05a"}

.fa-crosshairs:before{content:"\f05b"}

.fa-times-circle-o:before{content:"\f05c"}

.fa-check-circle-o:before{content:"\f05d"}

.fa-ban:before{content:"\f05e"}

.fa-arrow-left:before{content:"\f060"}

.fa-arrow-right:before{content:"\f061"}

.fa-arrow-up:before{content:"\f062"}

.fa-arrow-down:before{content:"\f063"}

.fa-mail-forward:before,.fa-share:before{content:"\f064"}

.fa-expand:before{content:"\f065"}

.fa-compress:before{content:"\f066"}

.fa-plus:before{content:"\f067"}

.fa-minus:before{content:"\f068"}

.fa-asterisk:before{content:"\f069"}

.fa-exclamation-circle:before{content:"\f06a"}

.fa-gift:before{content:"\f06b"}

.fa-leaf:before{content:"\f06c"}

.fa-fire:before{content:"\f06d"}

.fa-eye:before{content:"\f06e"}

.fa-eye-slash:before{content:"\f070"}

.fa-warning:before,.fa-exclamation-triangle:before{content:"\f071"}

.fa-plane:before{content:"\f072"}

.fa-calendar:before{content:"\f073"}

.fa-random:before{content:"\f074"}

.fa-comment:before{content:"\f075"}

.fa-magnet:before{content:"\f076"}

.fa-chevron-up:before{content:"\f077"}

.fa-chevron-down:before{content:"\f078"}

.fa-retweet:before{content:"\f079"}

.fa-shopping-cart:before{content:"\f07a"}

.fa-folder:before{content:"\f07b"}

.fa-folder-open:before{content:"\f07c"}

.fa-arrows-v:before{content:"\f07d"}

.fa-arrows-h:before{content:"\f07e"}

.fa-bar-chart-o:before,.fa-bar-chart:before{content:"\f080"}

.fa-twitter-square:before{content:"\f081"}

.fa-facebook-square:before{content:"\f082"}

.fa-camera-retro:before{content:"\f083"}

.fa-key:before{content:"\f084"}

.fa-gears:before,.fa-cogs:before{content:"\f085"}

.fa-comments:before{content:"\f086"}

.fa-thumbs-o-up:before{content:"\f087"}

.fa-thumbs-o-down:before{content:"\f088"}

.fa-star-half:before{content:"\f089"}

.fa-heart-o:before{content:"\f08a"}

.fa-sign-out:before{content:"\f08b"}

.fa-linkedin-square:before{content:"\f08c"}

.fa-thumb-tack:before{content:"\f08d"}

.fa-external-link:before{content:"\f08e"}

.fa-sign-in:before{content:"\f090"}

.fa-trophy:before{content:"\f091"}

.fa-github-square:before{content:"\f092"}

.fa-upload:before{content:"\f093"}

.fa-lemon-o:before{content:"\f094"}

.fa-phone:before{content:"\f095"}

.fa-square-o:before{content:"\f096"}

.fa-bookmark-o:before{content:"\f097"}

.fa-phone-square:before{content:"\f098"}

.fa-twitter:before{content:"\f099"}

.fa-facebook-f:before,.fa-facebook:before{content:"\f09a"}

.fa-github:before{content:"\f09b"}

.fa-unlock:before{content:"\f09c"}

.fa-credit-card:before{content:"\f09d"}

.fa-feed:before,.fa-rss:before{content:"\f09e"}

.fa-hdd-o:before{content:"\f0a0"}

.fa-bullhorn:before{content:"\f0a1"}

.fa-bell:before{content:"\f0f3"}

.fa-certificate:before{content:"\f0a3"}

.fa-hand-o-right:before{content:"\f0a4"}

.fa-hand-o-left:before{content:"\f0a5"}

.fa-hand-o-up:before{content:"\f0a6"}

.fa-hand-o-down:before{content:"\f0a7"}

.fa-arrow-circle-left:before{content:"\f0a8"}

.fa-arrow-circle-right:before{content:"\f0a9"}

.fa-arrow-circle-up:before{content:"\f0aa"}

.fa-arrow-circle-down:before{content:"\f0ab"}

.fa-globe:before{content:"\f0ac"}

.fa-wrench:before{content:"\f0ad"}

.fa-tasks:before{content:"\f0ae"}

.fa-filter:before{content:"\f0b0"}

.fa-briefcase:before{content:"\f0b1"}

.fa-arrows-alt:before{content:"\f0b2"}

.fa-group:before,.fa-users:before{content:"\f0c0"}

.fa-chain:before,.fa-link:before{content:"\f0c1"}

.fa-cloud:before{content:"\f0c2"}

.fa-flask:before{content:"\f0c3"}

.fa-cut:before,.fa-scissors:before{content:"\f0c4"}

.fa-copy:before,.fa-files-o:before{content:"\f0c5"}

.fa-paperclip:before{content:"\f0c6"}

.fa-save:before,.fa-floppy-o:before{content:"\f0c7"}

.fa-square:before{content:"\f0c8"}

.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:"\f0c9"}

.fa-list-ul:before{content:"\f0ca"}

.fa-list-ol:before{content:"\f0cb"}

.fa-strikethrough:before{content:"\f0cc"}

.fa-underline:before{content:"\f0cd"}

.fa-table:before{content:"\f0ce"}

.fa-magic:before{content:"\f0d0"}

.fa-truck:before{content:"\f0d1"}

.fa-pinterest:before{content:"\f0d2"}

.fa-pinterest-square:before{content:"\f0d3"}

.fa-google-plus-square:before{content:"\f0d4"}

.fa-google-plus:before{content:"\f0d5"}

.fa-money:before{content:"\f0d6"}

.fa-caret-down:before{content:"\f0d7"}

.fa-caret-up:before{content:"\f0d8"}

.fa-caret-left:before{content:"\f0d9"}

.fa-caret-right:before{content:"\f0da"}

.fa-columns:before{content:"\f0db"}

.fa-unsorted:before,.fa-sort:before{content:"\f0dc"}

.fa-sort-down:before,.fa-sort-desc:before{content:"\f0dd"}

.fa-sort-up:before,.fa-sort-asc:before{content:"\f0de"}

.fa-envelope:before{content:"\f0e0"}

.fa-linkedin:before{content:"\f0e1"}

.fa-rotate-left:before,.fa-undo:before{content:"\f0e2"}

.fa-legal:before,.fa-gavel:before{content:"\f0e3"}

.fa-dashboard:before,.fa-tachometer:before{content:"\f0e4"}

.fa-comment-o:before{content:"\f0e5"}

.fa-comments-o:before{content:"\f0e6"}

.fa-flash:before,.fa-bolt:before{content:"\f0e7"}

.fa-sitemap:before{content:"\f0e8"}

.fa-umbrella:before{content:"\f0e9"}

.fa-paste:before,.fa-clipboard:before{content:"\f0ea"}

.fa-lightbulb-o:before{content:"\f0eb"}

.fa-exchange:before{content:"\f0ec"}

.fa-cloud-download:before{content:"\f0ed"}

.fa-cloud-upload:before{content:"\f0ee"}

.fa-user-md:before{content:"\f0f0"}

.fa-stethoscope:before{content:"\f0f1"}

.fa-suitcase:before{content:"\f0f2"}

.fa-bell-o:before{content:"\f0a2"}

.fa-coffee:before{content:"\f0f4"}

.fa-cutlery:before{content:"\f0f5"}

.fa-file-text-o:before{content:"\f0f6"}

.fa-building-o:before{content:"\f0f7"}

.fa-hospital-o:before{content:"\f0f8"}

.fa-ambulance:before{content:"\f0f9"}

.fa-medkit:before{content:"\f0fa"}

.fa-fighter-jet:before{content:"\f0fb"}

.fa-beer:before{content:"\f0fc"}

.fa-h-square:before{content:"\f0fd"}

.fa-plus-square:before{content:"\f0fe"}

.fa-angle-double-left:before{content:"\f100"}

.fa-angle-double-right:before{content:"\f101"}

.fa-angle-double-up:before{content:"\f102"}

.fa-angle-double-down:before{content:"\f103"}

.fa-angle-left:before{content:"\f104"}

.fa-angle-right:before{content:"\f105"}

.fa-angle-up:before{content:"\f106"}

.fa-angle-down:before{content:"\f107"}

.fa-desktop:before{content:"\f108"}

.fa-laptop:before{content:"\f109"}

.fa-tablet:before{content:"\f10a"}

.fa-mobile-phone:before,.fa-mobile:before{content:"\f10b"}

.fa-circle-o:before{content:"\f10c"}

.fa-quote-left:before{content:"\f10d"}

.fa-quote-right:before{content:"\f10e"}

.fa-spinner:before{content:"\f110"}

.fa-circle:before{content:"\f111"}

.fa-mail-reply:before,.fa-reply:before{content:"\f112"}

.fa-github-alt:before{content:"\f113"}

.fa-folder-o:before{content:"\f114"}

.fa-folder-open-o:before{content:"\f115"}

.fa-smile-o:before{content:"\f118"}

.fa-frown-o:before{content:"\f119"}

.fa-meh-o:before{content:"\f11a"}

.fa-gamepad:before{content:"\f11b"}

.fa-keyboard-o:before{content:"\f11c"}

.fa-flag-o:before{content:"\f11d"}

.fa-flag-checkered:before{content:"\f11e"}

.fa-terminal:before{content:"\f120"}

.fa-code:before{content:"\f121"}

.fa-mail-reply-all:before,.fa-reply-all:before{content:"\f122"}

.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:"\f123"}

.fa-location-arrow:before{content:"\f124"}

.fa-crop:before{content:"\f125"}

.fa-code-fork:before{content:"\f126"}

.fa-unlink:before,.fa-chain-broken:before{content:"\f127"}

.fa-question:before{content:"\f128"}

.fa-info:before{content:"\f129"}

.fa-exclamation:before{content:"\f12a"}

.fa-superscript:before{content:"\f12b"}

.fa-subscript:before{content:"\f12c"}

.fa-eraser:before{content:"\f12d"}

.fa-puzzle-piece:before{content:"\f12e"}

.fa-microphone:before{content:"\f130"}

.fa-microphone-slash:before{content:"\f131"}

.fa-shield:before{content:"\f132"}

.fa-calendar-o:before{content:"\f133"}

.fa-fire-extinguisher:before{content:"\f134"}

.fa-rocket:before{content:"\f135"}

.fa-maxcdn:before{content:"\f136"}

.fa-chevron-circle-left:before{content:"\f137"}

.fa-chevron-circle-right:before{content:"\f138"}

.fa-chevron-circle-up:before{content:"\f139"}

.fa-chevron-circle-down:before{content:"\f13a"}

.fa-html5:before{content:"\f13b"}

.fa-css3:before{content:"\f13c"}

.fa-anchor:before{content:"\f13d"}

.fa-unlock-alt:before{content:"\f13e"}

.fa-bullseye:before{content:"\f140"}

.fa-ellipsis-h:before{content:"\f141"}

.fa-ellipsis-v:before{content:"\f142"}

.fa-rss-square:before{content:"\f143"}

.fa-play-circle:before{content:"\f144"}

.fa-ticket:before{content:"\f145"}

.fa-minus-square:before{content:"\f146"}

.fa-minus-square-o:before{content:"\f147"}

.fa-level-up:before{content:"\f148"}

.fa-level-down:before{content:"\f149"}

.fa-check-square:before{content:"\f14a"}

.fa-pencil-square:before{content:"\f14b"}

.fa-external-link-square:before{content:"\f14c"}

.fa-share-square:before{content:"\f14d"}

.fa-compass:before{content:"\f14e"}

.fa-toggle-down:before,.fa-caret-square-o-down:before{content:"\f150"}

.fa-toggle-up:before,.fa-caret-square-o-up:before{content:"\f151"}

.fa-toggle-right:before,.fa-caret-square-o-right:before{content:"\f152"}

.fa-euro:before,.fa-eur:before{content:"\f153"}

.fa-gbp:before{content:"\f154"}

.fa-dollar:before,.fa-usd:before{content:"\f155"}

.fa-rupee:before,.fa-inr:before{content:"\f156"}

.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:"\f157"}

.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:"\f158"}

.fa-won:before,.fa-krw:before{content:"\f159"}

.fa-bitcoin:before,.fa-btc:before{content:"\f15a"}

.fa-file:before{content:"\f15b"}

.fa-file-text:before{content:"\f15c"}

.fa-sort-alpha-asc:before{content:"\f15d"}

.fa-sort-alpha-desc:before{content:"\f15e"}

.fa-sort-amount-asc:before{content:"\f160"}

.fa-sort-amount-desc:before{content:"\f161"}

.fa-sort-numeric-asc:before{content:"\f162"}

.fa-sort-numeric-desc:before{content:"\f163"}

.fa-thumbs-up:before{content:"\f164"}

.fa-thumbs-down:before{content:"\f165"}

.fa-youtube-square:before{content:"\f166"}

.fa-youtube:before{content:"\f167"}

.fa-xing:before{content:"\f168"}

.fa-xing-square:before{content:"\f169"}

.fa-youtube-play:before{content:"\f16a"}

.fa-dropbox:before{content:"\f16b"}

.fa-stack-overflow:before{content:"\f16c"}

.fa-instagram:before{content:"\f16d"}

.fa-flickr:before{content:"\f16e"}

.fa-adn:before{content:"\f170"}

.fa-bitbucket:before{content:"\f171"}

.fa-bitbucket-square:before{content:"\f172"}

.fa-tumblr:before{content:"\f173"}

.fa-tumblr-square:before{content:"\f174"}

.fa-long-arrow-down:before{content:"\f175"}

.fa-long-arrow-up:before{content:"\f176"}

.fa-long-arrow-left:before{content:"\f177"}

.fa-long-arrow-right:before{content:"\f178"}

.fa-apple:before{content:"\f179"}

.fa-windows:before{content:"\f17a"}

.fa-android:before{content:"\f17b"}

.fa-linux:before{content:"\f17c"}

.fa-dribbble:before{content:"\f17d"}

.fa-skype:before{content:"\f17e"}

.fa-foursquare:before{content:"\f180"}

.fa-trello:before{content:"\f181"}

.fa-female:before{content:"\f182"}

.fa-male:before{content:"\f183"}

.fa-gittip:before,.fa-gratipay:before{content:"\f184"}

.fa-sun-o:before{content:"\f185"}

.fa-moon-o:before{content:"\f186"}

.fa-archive:before{content:"\f187"}

.fa-bug:before{content:"\f188"}

.fa-vk:before{content:"\f189"}

.fa-weibo:before{content:"\f18a"}

.fa-renren:before{content:"\f18b"}

.fa-pagelines:before{content:"\f18c"}

.fa-stack-exchange:before{content:"\f18d"}

.fa-arrow-circle-o-right:before{content:"\f18e"}

.fa-arrow-circle-o-left:before{content:"\f190"}

.fa-toggle-left:before,.fa-caret-square-o-left:before{content:"\f191"}

.fa-dot-circle-o:before{content:"\f192"}

.fa-wheelchair:before{content:"\f193"}

.fa-vimeo-square:before{content:"\f194"}

.fa-turkish-lira:before,.fa-try:before{content:"\f195"}

.fa-plus-square-o:before{content:"\f196"}

.fa-space-shuttle:before{content:"\f197"}

.fa-slack:before{content:"\f198"}

.fa-envelope-square:before{content:"\f199"}

.fa-wordpress:before{content:"\f19a"}

.fa-openid:before{content:"\f19b"}

.fa-institution:before,.fa-bank:before,.fa-university:before{content:"\f19c"}

.fa-mortar-board:before,.fa-graduation-cap:before{content:"\f19d"}

.fa-yahoo:before{content:"\f19e"}

.fa-google:before{content:"\f1a0"}

.fa-reddit:before{content:"\f1a1"}

.fa-reddit-square:before{content:"\f1a2"}

.fa-stumbleupon-circle:before{content:"\f1a3"}

.fa-stumbleupon:before{content:"\f1a4"}

.fa-delicious:before{content:"\f1a5"}

.fa-digg:before{content:"\f1a6"}

.fa-pied-piper-pp:before{content:"\f1a7"}

.fa-pied-piper-alt:before{content:"\f1a8"}

.fa-drupal:before{content:"\f1a9"}

.fa-joomla:before{content:"\f1aa"}

.fa-language:before{content:"\f1ab"}

.fa-fax:before{content:"\f1ac"}

.fa-building:before{content:"\f1ad"}

.fa-child:before{content:"\f1ae"}

.fa-paw:before{content:"\f1b0"}

.fa-spoon:before{content:"\f1b1"}

.fa-cube:before{content:"\f1b2"}

.fa-cubes:before{content:"\f1b3"}

.fa-behance:before{content:"\f1b4"}

.fa-behance-square:before{content:"\f1b5"}

.fa-steam:before{content:"\f1b6"}

.fa-steam-square:before{content:"\f1b7"}

.fa-recycle:before{content:"\f1b8"}

.fa-automobile:before,.fa-car:before{content:"\f1b9"}

.fa-cab:before,.fa-taxi:before{content:"\f1ba"}

.fa-tree:before{content:"\f1bb"}

.fa-spotify:before{content:"\f1bc"}

.fa-deviantart:before{content:"\f1bd"}

.fa-soundcloud:before{content:"\f1be"}

.fa-database:before{content:"\f1c0"}

.fa-file-pdf-o:before{content:"\f1c1"}

.fa-file-word-o:before{content:"\f1c2"}

.fa-file-excel-o:before{content:"\f1c3"}

.fa-file-powerpoint-o:before{content:"\f1c4"}

.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:"\f1c5"}

.fa-file-zip-o:before,.fa-file-archive-o:before{content:"\f1c6"}

.fa-file-sound-o:before,.fa-file-audio-o:before{content:"\f1c7"}

.fa-file-movie-o:before,.fa-file-video-o:before{content:"\f1c8"}

.fa-file-code-o:before{content:"\f1c9"}

.fa-vine:before{content:"\f1ca"}

.fa-codepen:before{content:"\f1cb"}

.fa-jsfiddle:before{content:"\f1cc"}

.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:"\f1cd"}

.fa-circle-o-notch:before{content:"\f1ce"}

.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:"\f1d0"}

.fa-ge:before,.fa-empire:before{content:"\f1d1"}

.fa-git-square:before{content:"\f1d2"}

.fa-git:before{content:"\f1d3"}

.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:"\f1d4"}

.fa-tencent-weibo:before{content:"\f1d5"}

.fa-qq:before{content:"\f1d6"}

.fa-wechat:before,.fa-weixin:before{content:"\f1d7"}

.fa-send:before,.fa-paper-plane:before{content:"\f1d8"}

.fa-send-o:before,.fa-paper-plane-o:before{content:"\f1d9"}

.fa-history:before{content:"\f1da"}

.fa-circle-thin:before{content:"\f1db"}

.fa-header:before{content:"\f1dc"}

.fa-paragraph:before{content:"\f1dd"}

.fa-sliders:before{content:"\f1de"}

.fa-share-alt:before{content:"\f1e0"}

.fa-share-alt-square:before{content:"\f1e1"}

.fa-bomb:before{content:"\f1e2"}

.fa-soccer-ball-o:before,.fa-futbol-o:before{content:"\f1e3"}

.fa-tty:before{content:"\f1e4"}

.fa-binoculars:before{content:"\f1e5"}

.fa-plug:before{content:"\f1e6"}

.fa-slideshare:before{content:"\f1e7"}

.fa-twitch:before{content:"\f1e8"}

.fa-yelp:before{content:"\f1e9"}

.fa-newspaper-o:before{content:"\f1ea"}

.fa-wifi:before{content:"\f1eb"}

.fa-calculator:before{content:"\f1ec"}

.fa-paypal:before{content:"\f1ed"}

.fa-google-wallet:before{content:"\f1ee"}

.fa-cc-visa:before{content:"\f1f0"}

.fa-cc-mastercard:before{content:"\f1f1"}

.fa-cc-discover:before{content:"\f1f2"}

.fa-cc-amex:before{content:"\f1f3"}

.fa-cc-paypal:before{content:"\f1f4"}

.fa-cc-stripe:before{content:"\f1f5"}

.fa-bell-slash:before{content:"\f1f6"}

.fa-bell-slash-o:before{content:"\f1f7"}

.fa-trash:before{content:"\f1f8"}

.fa-copyright:before{content:"\f1f9"}

.fa-at:before{content:"\f1fa"}

.fa-eyedropper:before{content:"\f1fb"}

.fa-paint-brush:before{content:"\f1fc"}

.fa-birthday-cake:before{content:"\f1fd"}

.fa-area-chart:before{content:"\f1fe"}

.fa-pie-chart:before{content:"\f200"}

.fa-line-chart:before{content:"\f201"}

.fa-lastfm:before{content:"\f202"}

.fa-lastfm-square:before{content:"\f203"}

.fa-toggle-off:before{content:"\f204"}

.fa-toggle-on:before{content:"\f205"}

.fa-bicycle:before{content:"\f206"}

.fa-bus:before{content:"\f207"}

.fa-ioxhost:before{content:"\f208"}

.fa-angellist:before{content:"\f209"}

.fa-cc:before{content:"\f20a"}

.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:"\f20b"}

.fa-meanpath:before{content:"\f20c"}

.fa-buysellads:before{content:"\f20d"}

.fa-connectdevelop:before{content:"\f20e"}

.fa-dashcube:before{content:"\f210"}

.fa-forumbee:before{content:"\f211"}

.fa-leanpub:before{content:"\f212"}

.fa-sellsy:before{content:"\f213"}

.fa-shirtsinbulk:before{content:"\f214"}

.fa-simplybuilt:before{content:"\f215"}

.fa-skyatlas:before{content:"\f216"}

.fa-cart-plus:before{content:"\f217"}

.fa-cart-arrow-down:before{content:"\f218"}

.fa-diamond:before{content:"\f219"}

.fa-ship:before{content:"\f21a"}

.fa-user-secret:before{content:"\f21b"}

.fa-motorcycle:before{content:"\f21c"}

.fa-street-view:before{content:"\f21d"}

.fa-heartbeat:before{content:"\f21e"}

.fa-venus:before{content:"\f221"}

.fa-mars:before{content:"\f222"}

.fa-mercury:before{content:"\f223"}

.fa-intersex:before,.fa-transgender:before{content:"\f224"}

.fa-transgender-alt:before{content:"\f225"}

.fa-venus-double:before{content:"\f226"}

.fa-mars-double:before{content:"\f227"}

.fa-venus-mars:before{content:"\f228"}

.fa-mars-stroke:before{content:"\f229"}

.fa-mars-stroke-v:before{content:"\f22a"}

.fa-mars-stroke-h:before{content:"\f22b"}

.fa-neuter:before{content:"\f22c"}

.fa-genderless:before{content:"\f22d"}

.fa-facebook-official:before{content:"\f230"}

.fa-pinterest-p:before{content:"\f231"}

.fa-whatsapp:before{content:"\f232"}

.fa-server:before{content:"\f233"}

.fa-user-plus:before{content:"\f234"}

.fa-user-times:before{content:"\f235"}

.fa-hotel:before,.fa-bed:before{content:"\f236"}

.fa-viacoin:before{content:"\f237"}

.fa-train:before{content:"\f238"}

.fa-subway:before{content:"\f239"}

.fa-medium:before{content:"\f23a"}

.fa-yc:before,.fa-y-combinator:before{content:"\f23b"}

.fa-optin-monster:before{content:"\f23c"}

.fa-opencart:before{content:"\f23d"}

.fa-expeditedssl:before{content:"\f23e"}

.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:"\f240"}

.fa-battery-3:before,.fa-battery-three-quarters:before{content:"\f241"}

.fa-battery-2:before,.fa-battery-half:before{content:"\f242"}

.fa-battery-1:before,.fa-battery-quarter:before{content:"\f243"}

.fa-battery-0:before,.fa-battery-empty:before{content:"\f244"}

.fa-mouse-pointer:before{content:"\f245"}

.fa-i-cursor:before{content:"\f246"}

.fa-object-group:before{content:"\f247"}

.fa-object-ungroup:before{content:"\f248"}

.fa-sticky-note:before{content:"\f249"}

.fa-sticky-note-o:before{content:"\f24a"}

.fa-cc-jcb:before{content:"\f24b"}

.fa-cc-diners-club:before{content:"\f24c"}

.fa-clone:before{content:"\f24d"}

.fa-balance-scale:before{content:"\f24e"}

.fa-hourglass-o:before{content:"\f250"}

.fa-hourglass-1:before,.fa-hourglass-start:before{content:"\f251"}

.fa-hourglass-2:before,.fa-hourglass-half:before{content:"\f252"}

.fa-hourglass-3:before,.fa-hourglass-end:before{content:"\f253"}

.fa-hourglass:before{content:"\f254"}

.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:"\f255"}

.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:"\f256"}

.fa-hand-scissors-o:before{content:"\f257"}

.fa-hand-lizard-o:before{content:"\f258"}

.fa-hand-spock-o:before{content:"\f259"}

.fa-hand-pointer-o:before{content:"\f25a"}

.fa-hand-peace-o:before{content:"\f25b"}

.fa-trademark:before{content:"\f25c"}

.fa-registered:before{content:"\f25d"}

.fa-creative-commons:before{content:"\f25e"}

.fa-gg:before{content:"\f260"}

.fa-gg-circle:before{content:"\f261"}

.fa-tripadvisor:before{content:"\f262"}

.fa-odnoklassniki:before{content:"\f263"}

.fa-odnoklassniki-square:before{content:"\f264"}

.fa-get-pocket:before{content:"\f265"}

.fa-wikipedia-w:before{content:"\f266"}

.fa-safari:before{content:"\f267"}

.fa-chrome:before{content:"\f268"}

.fa-firefox:before{content:"\f269"}

.fa-opera:before{content:"\f26a"}

.fa-internet-explorer:before{content:"\f26b"}

.fa-tv:before,.fa-television:before{content:"\f26c"}

.fa-contao:before{content:"\f26d"}

.fa-500px:before{content:"\f26e"}

.fa-amazon:before{content:"\f270"}

.fa-calendar-plus-o:before{content:"\f271"}

.fa-calendar-minus-o:before{content:"\f272"}

.fa-calendar-times-o:before{content:"\f273"}

.fa-calendar-check-o:before{content:"\f274"}

.fa-industry:before{content:"\f275"}

.fa-map-pin:before{content:"\f276"}

.fa-map-signs:before{content:"\f277"}

.fa-map-o:before{content:"\f278"}

.fa-map:before{content:"\f279"}

.fa-commenting:before{content:"\f27a"}

.fa-commenting-o:before{content:"\f27b"}

.fa-houzz:before{content:"\f27c"}

.fa-vimeo:before{content:"\f27d"}

.fa-black-tie:before{content:"\f27e"}

.fa-fonticons:before{content:"\f280"}

.fa-reddit-alien:before{content:"\f281"}

.fa-edge:before{content:"\f282"}

.fa-credit-card-alt:before{content:"\f283"}

.fa-codiepie:before{content:"\f284"}

.fa-modx:before{content:"\f285"}

.fa-fort-awesome:before{content:"\f286"}

.fa-usb:before{content:"\f287"}

.fa-product-hunt:before{content:"\f288"}

.fa-mixcloud:before{content:"\f289"}

.fa-scribd:before{content:"\f28a"}

.fa-pause-circle:before{content:"\f28b"}

.fa-pause-circle-o:before{content:"\f28c"}

.fa-stop-circle:before{content:"\f28d"}

.fa-stop-circle-o:before{content:"\f28e"}

.fa-shopping-bag:before{content:"\f290"}

.fa-shopping-basket:before{content:"\f291"}

.fa-hashtag:before{content:"\f292"}

.fa-bluetooth:before{content:"\f293"}

.fa-bluetooth-b:before{content:"\f294"}

.fa-percent:before{content:"\f295"}

.fa-gitlab:before{content:"\f296"}

.fa-wpbeginner:before{content:"\f297"}

.fa-wpforms:before{content:"\f298"}

.fa-envira:before{content:"\f299"}

.fa-universal-access:before{content:"\f29a"}

.fa-wheelchair-alt:before{content:"\f29b"}

.fa-question-circle-o:before{content:"\f29c"}

.fa-blind:before{content:"\f29d"}

.fa-audio-description:before{content:"\f29e"}

.fa-volume-control-phone:before{content:"\f2a0"}

.fa-braille:before{content:"\f2a1"}

.fa-assistive-listening-systems:before{content:"\f2a2"}

.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:"\f2a3"}

.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:"\f2a4"}

.fa-glide:before{content:"\f2a5"}

.fa-glide-g:before{content:"\f2a6"}

.fa-signing:before,.fa-sign-language:before{content:"\f2a7"}

.fa-low-vision:before{content:"\f2a8"}

.fa-viadeo:before{content:"\f2a9"}

.fa-viadeo-square:before{content:"\f2aa"}

.fa-snapchat:before{content:"\f2ab"}

.fa-snapchat-ghost:before{content:"\f2ac"}

.fa-snapchat-square:before{content:"\f2ad"}

.fa-pied-piper:before{content:"\f2ae"}

.fa-first-order:before{content:"\f2b0"}

.fa-yoast:before{content:"\f2b1"}

.fa-themeisle:before{content:"\f2b2"}

.fa-google-plus-circle:before,.fa-google-plus-official:before{content:"\f2b3"}

.fa-fa:before,.fa-font-awesome:before{content:"\f2b4"}

.fa-handshake-o:before{content:"\f2b5"}

.fa-envelope-open:before{content:"\f2b6"}

.fa-envelope-open-o:before{content:"\f2b7"}

.fa-linode:before{content:"\f2b8"}

.fa-address-book:before{content:"\f2b9"}

.fa-address-book-o:before{content:"\f2ba"}

.fa-vcard:before,.fa-address-card:before{content:"\f2bb"}

.fa-vcard-o:before,.fa-address-card-o:before{content:"\f2bc"}

.fa-user-circle:before{content:"\f2bd"}

.fa-user-circle-o:before{content:"\f2be"}

.fa-user-o:before{content:"\f2c0"}

.fa-id-badge:before{content:"\f2c1"}

.fa-drivers-license:before,.fa-id-card:before{content:"\f2c2"}

.fa-drivers-license-o:before,.fa-id-card-o:before{content:"\f2c3"}

.fa-quora:before{content:"\f2c4"}

.fa-free-code-camp:before{content:"\f2c5"}

.fa-telegram:before{content:"\f2c6"}

.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:"\f2c7"}

.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:"\f2c8"}

.fa-thermometer-2:before,.fa-thermometer-half:before{content:"\f2c9"}

.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:"\f2ca"}

.fa-thermometer-0:before,.fa-thermometer-empty:before{content:"\f2cb"}

.fa-shower:before{content:"\f2cc"}

.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:"\f2cd"}

.fa-podcast:before{content:"\f2ce"}

.fa-window-maximize:before{content:"\f2d0"}

.fa-window-minimize:before{content:"\f2d1"}

.fa-window-restore:before{content:"\f2d2"}

.fa-times-rectangle:before,.fa-window-close:before{content:"\f2d3"}

.fa-times-rectangle-o:before,.fa-window-close-o:before{content:"\f2d4"}

.fa-bandcamp:before{content:"\f2d5"}

.fa-grav:before{content:"\f2d6"}

.fa-etsy:before{content:"\f2d7"}

.fa-imdb:before{content:"\f2d8"}

.fa-ravelry:before{content:"\f2d9"}

.fa-eercast:before{content:"\f2da"}

.fa-microchip:before{content:"\f2db"}

.fa-snowflake-o:before{content:"\f2dc"}

.fa-superpowers:before{content:"\f2dd"}

.fa-wpexplorer:before{content:"\f2de"}

.fa-meetup:before{content:"\f2e0"}

.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);border:0}

.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}

/* Using a url */

@font-face{font-family:"Material Design Icons";src:url('materialdesignicons-webfont683c.62ee68453eda5ee7.eot?v=2.4.85');src:url('materialdesignicons-webfontd41d.62ee68453eda5ee7.eot?#iefix&v=2.4.85') format("embedded-opentype"),url('materialdesignicons-webfont683c.28ae3f17150e32ea.woff2?v=2.4.85') format("woff2"),url('materialdesignicons-webfont683c.7116dd3883233b52.woff?v=2.4.85') format("woff"),url('materialdesignicons-webfont683c.d12d66c7cf20a293.ttf?v=2.4.85') format("truetype"),url('materialdesignicons-webfont683c.e25bacd4e52430d8.svg?v=2.4.85#materialdesigniconsregular') format("svg");font-weight:400;font-style:normal}

.mdi-set,.mdi:before{display:inline-block;font:normal normal normal 24px/1 "Material Design Icons";font-size:inherit;text-rendering:auto;line-height:inherit;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}

.mdi-access-point:before{content:"\F002"}

.mdi-access-point-network:before{content:"\F003"}

.mdi-account:before{content:"\F004"}

.mdi-account-alert:before{content:"\F005"}

.mdi-account-box:before{content:"\F006"}

.mdi-account-box-multiple:before{content:"\F933"}

.mdi-account-box-outline:before{content:"\F007"}

.mdi-account-card-details:before{content:"\F5D2"}

.mdi-account-check:before{content:"\F008"}

.mdi-account-circle:before{content:"\F009"}

.mdi-account-convert:before{content:"\F00A"}

.mdi-account-edit:before{content:"\F6BB"}

.mdi-account-group:before{content:"\F848"}

.mdi-account-heart:before{content:"\F898"}

.mdi-account-key:before{content:"\F00B"}

.mdi-account-location:before{content:"\F00C"}

.mdi-account-minus:before{content:"\F00D"}

.mdi-account-multiple:before{content:"\F00E"}

.mdi-account-multiple-check:before{content:"\F8C4"}

.mdi-account-multiple-minus:before{content:"\F5D3"}

.mdi-account-multiple-outline:before{content:"\F00F"}

.mdi-account-multiple-plus:before{content:"\F010"}

.mdi-account-multiple-plus-outline:before{content:"\F7FF"}

.mdi-account-network:before{content:"\F011"}

.mdi-account-off:before{content:"\F012"}

.mdi-account-outline:before{content:"\F013"}

.mdi-account-plus:before{content:"\F014"}

.mdi-account-plus-outline:before{content:"\F800"}

.mdi-account-remove:before{content:"\F015"}

.mdi-account-search:before{content:"\F016"}

.mdi-account-search-outline:before{content:"\F934"}

.mdi-account-settings:before{content:"\F630"}

.mdi-account-settings-variant:before{content:"\F631"}

.mdi-account-star:before{content:"\F017"}

.mdi-account-switch:before{content:"\F019"}

.mdi-accusoft:before{content:"\F849"}

.mdi-adjust:before{content:"\F01A"}

.mdi-adobe:before{content:"\F935"}

.mdi-air-conditioner:before{content:"\F01B"}

.mdi-airballoon:before{content:"\F01C"}

.mdi-airplane:before{content:"\F01D"}

.mdi-airplane-landing:before{content:"\F5D4"}

.mdi-airplane-off:before{content:"\F01E"}

.mdi-airplane-takeoff:before{content:"\F5D5"}

.mdi-airplay:before{content:"\F01F"}

.mdi-airport:before{content:"\F84A"}

.mdi-alarm:before{content:"\F020"}

.mdi-alarm-bell:before{content:"\F78D"}

.mdi-alarm-check:before{content:"\F021"}

.mdi-alarm-light:before{content:"\F78E"}

.mdi-alarm-multiple:before{content:"\F022"}

.mdi-alarm-off:before{content:"\F023"}

.mdi-alarm-plus:before{content:"\F024"}

.mdi-alarm-snooze:before{content:"\F68D"}

.mdi-album:before{content:"\F025"}

.mdi-alert:before{content:"\F026"}

.mdi-alert-box:before{content:"\F027"}

.mdi-alert-circle:before{content:"\F028"}

.mdi-alert-circle-outline:before{content:"\F5D6"}

.mdi-alert-decagram:before{content:"\F6BC"}

.mdi-alert-octagon:before{content:"\F029"}

.mdi-alert-octagram:before{content:"\F766"}

.mdi-alert-outline:before{content:"\F02A"}

.mdi-alien:before{content:"\F899"}

.mdi-all-inclusive:before{content:"\F6BD"}

.mdi-alpha:before{content:"\F02B"}

.mdi-alphabetical:before{content:"\F02C"}

.mdi-altimeter:before{content:"\F5D7"}

.mdi-amazon:before{content:"\F02D"}

.mdi-amazon-alexa:before{content:"\F8C5"}

.mdi-amazon-drive:before{content:"\F02E"}

.mdi-ambulance:before{content:"\F02F"}

.mdi-amplifier:before{content:"\F030"}

.mdi-anchor:before{content:"\F031"}

.mdi-android:before{content:"\F032"}

.mdi-android-debug-bridge:before{content:"\F033"}

.mdi-android-head:before{content:"\F78F"}

.mdi-android-studio:before{content:"\F034"}

.mdi-angle-acute:before{content:"\F936"}

.mdi-angle-obtuse:before{content:"\F937"}

.mdi-angle-right:before{content:"\F938"}

.mdi-angular:before{content:"\F6B1"}

.mdi-angularjs:before{content:"\F6BE"}

.mdi-animation:before{content:"\F5D8"}

.mdi-animation-play:before{content:"\F939"}

.mdi-anvil:before{content:"\F89A"}

.mdi-apple:before{content:"\F035"}

.mdi-apple-finder:before{content:"\F036"}

.mdi-apple-icloud:before{content:"\F038"}

.mdi-apple-ios:before{content:"\F037"}

.mdi-apple-keyboard-caps:before{content:"\F632"}

.mdi-apple-keyboard-command:before{content:"\F633"}

.mdi-apple-keyboard-control:before{content:"\F634"}

.mdi-apple-keyboard-option:before{content:"\F635"}

.mdi-apple-keyboard-shift:before{content:"\F636"}

.mdi-apple-safari:before{content:"\F039"}

.mdi-application:before{content:"\F614"}

.mdi-approval:before{content:"\F790"}

.mdi-apps:before{content:"\F03B"}

.mdi-arch:before{content:"\F8C6"}

.mdi-archive:before{content:"\F03C"}

.mdi-arrange-bring-forward:before{content:"\F03D"}

.mdi-arrange-bring-to-front:before{content:"\F03E"}

.mdi-arrange-send-backward:before{content:"\F03F"}

.mdi-arrange-send-to-back:before{content:"\F040"}

.mdi-arrow-all:before{content:"\F041"}

.mdi-arrow-bottom-left:before{content:"\F042"}

.mdi-arrow-bottom-right:before{content:"\F043"}

.mdi-arrow-collapse:before{content:"\F615"}

.mdi-arrow-collapse-all:before{content:"\F044"}

.mdi-arrow-collapse-down:before{content:"\F791"}

.mdi-arrow-collapse-horizontal:before{content:"\F84B"}

.mdi-arrow-collapse-left:before{content:"\F792"}

.mdi-arrow-collapse-right:before{content:"\F793"}

.mdi-arrow-collapse-up:before{content:"\F794"}

.mdi-arrow-collapse-vertical:before{content:"\F84C"}

.mdi-arrow-down:before{content:"\F045"}

.mdi-arrow-down-bold:before{content:"\F72D"}

.mdi-arrow-down-bold-box:before{content:"\F72E"}

.mdi-arrow-down-bold-box-outline:before{content:"\F72F"}

.mdi-arrow-down-bold-circle:before{content:"\F047"}

.mdi-arrow-down-bold-circle-outline:before{content:"\F048"}

.mdi-arrow-down-bold-hexagon-outline:before{content:"\F049"}

.mdi-arrow-down-box:before{content:"\F6BF"}

.mdi-arrow-down-drop-circle:before{content:"\F04A"}

.mdi-arrow-down-drop-circle-outline:before{content:"\F04B"}

.mdi-arrow-down-thick:before{content:"\F046"}

.mdi-arrow-expand:before{content:"\F616"}

.mdi-arrow-expand-all:before{content:"\F04C"}

.mdi-arrow-expand-down:before{content:"\F795"}

.mdi-arrow-expand-horizontal:before{content:"\F84D"}

.mdi-arrow-expand-left:before{content:"\F796"}

.mdi-arrow-expand-right:before{content:"\F797"}

.mdi-arrow-expand-up:before{content:"\F798"}

.mdi-arrow-expand-vertical:before{content:"\F84E"}

.mdi-arrow-left:before{content:"\F04D"}

.mdi-arrow-left-bold:before{content:"\F730"}

.mdi-arrow-left-bold-box:before{content:"\F731"}

.mdi-arrow-left-bold-box-outline:before{content:"\F732"}

.mdi-arrow-left-bold-circle:before{content:"\F04F"}

.mdi-arrow-left-bold-circle-outline:before{content:"\F050"}

.mdi-arrow-left-bold-hexagon-outline:before{content:"\F051"}

.mdi-arrow-left-box:before{content:"\F6C0"}

.mdi-arrow-left-drop-circle:before{content:"\F052"}

.mdi-arrow-left-drop-circle-outline:before{content:"\F053"}

.mdi-arrow-left-thick:before{content:"\F04E"}

.mdi-arrow-right:before{content:"\F054"}

.mdi-arrow-right-bold:before{content:"\F733"}

.mdi-arrow-right-bold-box:before{content:"\F734"}

.mdi-arrow-right-bold-box-outline:before{content:"\F735"}

.mdi-arrow-right-bold-circle:before{content:"\F056"}

.mdi-arrow-right-bold-circle-outline:before{content:"\F057"}

.mdi-arrow-right-bold-hexagon-outline:before{content:"\F058"}

.mdi-arrow-right-box:before{content:"\F6C1"}

.mdi-arrow-right-drop-circle:before{content:"\F059"}

.mdi-arrow-right-drop-circle-outline:before{content:"\F05A"}

.mdi-arrow-right-thick:before{content:"\F055"}

.mdi-arrow-split-horizontal:before{content:"\F93A"}

.mdi-arrow-split-vertical:before{content:"\F93B"}

.mdi-arrow-top-left:before{content:"\F05B"}

.mdi-arrow-top-right:before{content:"\F05C"}

.mdi-arrow-up:before{content:"\F05D"}

.mdi-arrow-up-bold:before{content:"\F736"}

.mdi-arrow-up-bold-box:before{content:"\F737"}

.mdi-arrow-up-bold-box-outline:before{content:"\F738"}

.mdi-arrow-up-bold-circle:before{content:"\F05F"}

.mdi-arrow-up-bold-circle-outline:before{content:"\F060"}

.mdi-arrow-up-bold-hexagon-outline:before{content:"\F061"}

.mdi-arrow-up-box:before{content:"\F6C2"}

.mdi-arrow-up-drop-circle:before{content:"\F062"}

.mdi-arrow-up-drop-circle-outline:before{content:"\F063"}

.mdi-arrow-up-thick:before{content:"\F05E"}

.mdi-artist:before{content:"\F802"}

.mdi-assistant:before{content:"\F064"}

.mdi-asterisk:before{content:"\F6C3"}

.mdi-at:before{content:"\F065"}

.mdi-atlassian:before{content:"\F803"}

.mdi-atom:before{content:"\F767"}

.mdi-attachment:before{content:"\F066"}

.mdi-audio-video:before{content:"\F93C"}

.mdi-audiobook:before{content:"\F067"}

.mdi-augmented-reality:before{content:"\F84F"}

.mdi-auto-fix:before{content:"\F068"}

.mdi-auto-upload:before{content:"\F069"}

.mdi-autorenew:before{content:"\F06A"}

.mdi-av-timer:before{content:"\F06B"}

.mdi-axe:before{content:"\F8C7"}

.mdi-azure:before{content:"\F804"}

.mdi-baby:before{content:"\F06C"}

.mdi-baby-buggy:before{content:"\F68E"}

.mdi-backburger:before{content:"\F06D"}

.mdi-backspace:before{content:"\F06E"}

.mdi-backup-restore:before{content:"\F06F"}

.mdi-badminton:before{content:"\F850"}

.mdi-bandcamp:before{content:"\F674"}

.mdi-bank:before{content:"\F070"}

.mdi-barcode:before{content:"\F071"}

.mdi-barcode-scan:before{content:"\F072"}

.mdi-barley:before{content:"\F073"}

.mdi-barrel:before{content:"\F074"}

.mdi-baseball:before{content:"\F851"}

.mdi-baseball-bat:before{content:"\F852"}

.mdi-basecamp:before{content:"\F075"}

.mdi-basket:before{content:"\F076"}

.mdi-basket-fill:before{content:"\F077"}

.mdi-basket-unfill:before{content:"\F078"}

.mdi-basketball:before{content:"\F805"}

.mdi-battery:before{content:"\F079"}

.mdi-battery-10:before{content:"\F07A"}

.mdi-battery-10-bluetooth:before{content:"\F93D"}

.mdi-battery-20:before{content:"\F07B"}

.mdi-battery-20-bluetooth:before{content:"\F93E"}

.mdi-battery-30:before{content:"\F07C"}

.mdi-battery-30-bluetooth:before{content:"\F93F"}

.mdi-battery-40:before{content:"\F07D"}

.mdi-battery-40-bluetooth:before{content:"\F940"}

.mdi-battery-50:before{content:"\F07E"}

.mdi-battery-50-bluetooth:before{content:"\F941"}

.mdi-battery-60:before{content:"\F07F"}

.mdi-battery-60-bluetooth:before{content:"\F942"}

.mdi-battery-70:before{content:"\F080"}

.mdi-battery-70-bluetooth:before{content:"\F943"}

.mdi-battery-80:before{content:"\F081"}

.mdi-battery-80-bluetooth:before{content:"\F944"}

.mdi-battery-90:before{content:"\F082"}

.mdi-battery-90-bluetooth:before{content:"\F945"}

.mdi-battery-alert:before{content:"\F083"}

.mdi-battery-alert-bluetooth:before{content:"\F946"}

.mdi-battery-bluetooth:before{content:"\F947"}

.mdi-battery-bluetooth-variant:before{content:"\F948"}

.mdi-battery-charging:before{content:"\F084"}

.mdi-battery-charging-10:before{content:"\F89B"}

.mdi-battery-charging-100:before{content:"\F085"}

.mdi-battery-charging-20:before{content:"\F086"}

.mdi-battery-charging-30:before{content:"\F087"}

.mdi-battery-charging-40:before{content:"\F088"}

.mdi-battery-charging-50:before{content:"\F89C"}

.mdi-battery-charging-60:before{content:"\F089"}

.mdi-battery-charging-70:before{content:"\F89D"}

.mdi-battery-charging-80:before{content:"\F08A"}

.mdi-battery-charging-90:before{content:"\F08B"}

.mdi-battery-charging-outline:before{content:"\F89E"}

.mdi-battery-charging-wireless:before{content:"\F806"}

.mdi-battery-charging-wireless-10:before{content:"\F807"}

.mdi-battery-charging-wireless-20:before{content:"\F808"}

.mdi-battery-charging-wireless-30:before{content:"\F809"}

.mdi-battery-charging-wireless-40:before{content:"\F80A"}

.mdi-battery-charging-wireless-50:before{content:"\F80B"}

.mdi-battery-charging-wireless-60:before{content:"\F80C"}

.mdi-battery-charging-wireless-70:before{content:"\F80D"}

.mdi-battery-charging-wireless-80:before{content:"\F80E"}

.mdi-battery-charging-wireless-90:before{content:"\F80F"}

.mdi-battery-charging-wireless-alert:before{content:"\F810"}

.mdi-battery-charging-wireless-outline:before{content:"\F811"}

.mdi-battery-minus:before{content:"\F08C"}

.mdi-battery-negative:before{content:"\F08D"}

.mdi-battery-outline:before{content:"\F08E"}

.mdi-battery-plus:before{content:"\F08F"}

.mdi-battery-positive:before{content:"\F090"}

.mdi-battery-unknown:before{content:"\F091"}

.mdi-battery-unknown-bluetooth:before{content:"\F949"}

.mdi-beach:before{content:"\F092"}

.mdi-beaker:before{content:"\F68F"}

.mdi-beats:before{content:"\F097"}

.mdi-bed-empty:before{content:"\F89F"}

.mdi-beer:before{content:"\F098"}

.mdi-behance:before{content:"\F099"}

.mdi-bell:before{content:"\F09A"}

.mdi-bell-off:before{content:"\F09B"}

.mdi-bell-outline:before{content:"\F09C"}

.mdi-bell-plus:before{content:"\F09D"}

.mdi-bell-ring:before{content:"\F09E"}

.mdi-bell-ring-outline:before{content:"\F09F"}

.mdi-bell-sleep:before{content:"\F0A0"}

.mdi-beta:before{content:"\F0A1"}

.mdi-bible:before{content:"\F0A2"}

.mdi-bike:before{content:"\F0A3"}

.mdi-bing:before{content:"\F0A4"}

.mdi-binoculars:before{content:"\F0A5"}

.mdi-bio:before{content:"\F0A6"}

.mdi-biohazard:before{content:"\F0A7"}

.mdi-bitbucket:before{content:"\F0A8"}

.mdi-bitcoin:before{content:"\F812"}

.mdi-black-mesa:before{content:"\F0A9"}

.mdi-blackberry:before{content:"\F0AA"}

.mdi-blender:before{content:"\F0AB"}

.mdi-blinds:before{content:"\F0AC"}

.mdi-block-helper:before{content:"\F0AD"}

.mdi-blogger:before{content:"\F0AE"}

.mdi-bluetooth:before{content:"\F0AF"}

.mdi-bluetooth-audio:before{content:"\F0B0"}

.mdi-bluetooth-connect:before{content:"\F0B1"}

.mdi-bluetooth-off:before{content:"\F0B2"}

.mdi-bluetooth-settings:before{content:"\F0B3"}

.mdi-bluetooth-transfer:before{content:"\F0B4"}

.mdi-blur:before{content:"\F0B5"}

.mdi-blur-linear:before{content:"\F0B6"}

.mdi-blur-off:before{content:"\F0B7"}

.mdi-blur-radial:before{content:"\F0B8"}

.mdi-bomb:before{content:"\F690"}

.mdi-bomb-off:before{content:"\F6C4"}

.mdi-bone:before{content:"\F0B9"}

.mdi-book:before{content:"\F0BA"}

.mdi-book-minus:before{content:"\F5D9"}

.mdi-book-multiple:before{content:"\F0BB"}

.mdi-book-multiple-variant:before{content:"\F0BC"}

.mdi-book-open:before{content:"\F0BD"}

.mdi-book-open-page-variant:before{content:"\F5DA"}

.mdi-book-open-variant:before{content:"\F0BE"}

.mdi-book-plus:before{content:"\F5DB"}

.mdi-book-secure:before{content:"\F799"}

.mdi-book-unsecure:before{content:"\F79A"}

.mdi-book-variant:before{content:"\F0BF"}

.mdi-bookmark:before{content:"\F0C0"}

.mdi-bookmark-check:before{content:"\F0C1"}

.mdi-bookmark-music:before{content:"\F0C2"}

.mdi-bookmark-outline:before{content:"\F0C3"}

.mdi-bookmark-plus:before{content:"\F0C5"}

.mdi-bookmark-plus-outline:before{content:"\F0C4"}

.mdi-bookmark-remove:before{content:"\F0C6"}

.mdi-boombox:before{content:"\F5DC"}

.mdi-bootstrap:before{content:"\F6C5"}

.mdi-border-all:before{content:"\F0C7"}

.mdi-border-all-variant:before{content:"\F8A0"}

.mdi-border-bottom:before{content:"\F0C8"}

.mdi-border-bottom-variant:before{content:"\F8A1"}

.mdi-border-color:before{content:"\F0C9"}

.mdi-border-horizontal:before{content:"\F0CA"}

.mdi-border-inside:before{content:"\F0CB"}

.mdi-border-left:before{content:"\F0CC"}

.mdi-border-left-variant:before{content:"\F8A2"}

.mdi-border-none:before{content:"\F0CD"}

.mdi-border-none-variant:before{content:"\F8A3"}

.mdi-border-outside:before{content:"\F0CE"}

.mdi-border-right:before{content:"\F0CF"}

.mdi-border-right-variant:before{content:"\F8A4"}

.mdi-border-style:before{content:"\F0D0"}

.mdi-border-top:before{content:"\F0D1"}

.mdi-border-top-variant:before{content:"\F8A5"}

.mdi-border-vertical:before{content:"\F0D2"}

.mdi-bottle-wine:before{content:"\F853"}

.mdi-bow-tie:before{content:"\F677"}

.mdi-bowl:before{content:"\F617"}

.mdi-bowling:before{content:"\F0D3"}

.mdi-box:before{content:"\F0D4"}

.mdi-box-cutter:before{content:"\F0D5"}

.mdi-box-shadow:before{content:"\F637"}

.mdi-bridge:before{content:"\F618"}

.mdi-briefcase:before{content:"\F0D6"}

.mdi-briefcase-check:before{content:"\F0D7"}

.mdi-briefcase-download:before{content:"\F0D8"}

.mdi-briefcase-outline:before{content:"\F813"}

.mdi-briefcase-upload:before{content:"\F0D9"}

.mdi-brightness-1:before{content:"\F0DA"}

.mdi-brightness-2:before{content:"\F0DB"}

.mdi-brightness-3:before{content:"\F0DC"}

.mdi-brightness-4:before{content:"\F0DD"}

.mdi-brightness-5:before{content:"\F0DE"}

.mdi-brightness-6:before{content:"\F0DF"}

.mdi-brightness-7:before{content:"\F0E0"}

.mdi-brightness-auto:before{content:"\F0E1"}

.mdi-broom:before{content:"\F0E2"}

.mdi-brush:before{content:"\F0E3"}

.mdi-buddhism:before{content:"\F94A"}

.mdi-buffer:before{content:"\F619"}

.mdi-bug:before{content:"\F0E4"}

.mdi-bulletin-board:before{content:"\F0E5"}

.mdi-bullhorn:before{content:"\F0E6"}

.mdi-bullseye:before{content:"\F5DD"}

.mdi-bullseye-arrow:before{content:"\F8C8"}

.mdi-bus:before{content:"\F0E7"}

.mdi-bus-articulated-end:before{content:"\F79B"}

.mdi-bus-articulated-front:before{content:"\F79C"}

.mdi-bus-clock:before{content:"\F8C9"}

.mdi-bus-double-decker:before{content:"\F79D"}

.mdi-bus-school:before{content:"\F79E"}

.mdi-bus-side:before{content:"\F79F"}

.mdi-cached:before{content:"\F0E8"}

.mdi-cake:before{content:"\F0E9"}

.mdi-cake-layered:before{content:"\F0EA"}

.mdi-cake-variant:before{content:"\F0EB"}

.mdi-calculator:before{content:"\F0EC"}

.mdi-calendar:before{content:"\F0ED"}

.mdi-calendar-blank:before{content:"\F0EE"}

.mdi-calendar-check:before{content:"\F0EF"}

.mdi-calendar-clock:before{content:"\F0F0"}

.mdi-calendar-edit:before{content:"\F8A6"}

.mdi-calendar-multiple:before{content:"\F0F1"}

.mdi-calendar-multiple-check:before{content:"\F0F2"}

.mdi-calendar-plus:before{content:"\F0F3"}

.mdi-calendar-question:before{content:"\F691"}

.mdi-calendar-range:before{content:"\F678"}

.mdi-calendar-remove:before{content:"\F0F4"}

.mdi-calendar-search:before{content:"\F94B"}

.mdi-calendar-text:before{content:"\F0F5"}

.mdi-calendar-today:before{content:"\F0F6"}

.mdi-call-made:before{content:"\F0F7"}

.mdi-call-merge:before{content:"\F0F8"}

.mdi-call-missed:before{content:"\F0F9"}

.mdi-call-received:before{content:"\F0FA"}

.mdi-call-split:before{content:"\F0FB"}

.mdi-camcorder:before{content:"\F0FC"}

.mdi-camcorder-box:before{content:"\F0FD"}

.mdi-camcorder-box-off:before{content:"\F0FE"}

.mdi-camcorder-off:before{content:"\F0FF"}

.mdi-camera:before{content:"\F100"}

.mdi-camera-account:before{content:"\F8CA"}

.mdi-camera-burst:before{content:"\F692"}

.mdi-camera-enhance:before{content:"\F101"}

.mdi-camera-front:before{content:"\F102"}

.mdi-camera-front-variant:before{content:"\F103"}

.mdi-camera-gopro:before{content:"\F7A0"}

.mdi-camera-image:before{content:"\F8CB"}

.mdi-camera-iris:before{content:"\F104"}

.mdi-camera-metering-center:before{content:"\F7A1"}

.mdi-camera-metering-matrix:before{content:"\F7A2"}

.mdi-camera-metering-partial:before{content:"\F7A3"}

.mdi-camera-metering-spot:before{content:"\F7A4"}

.mdi-camera-off:before{content:"\F5DF"}

.mdi-camera-party-mode:before{content:"\F105"}

.mdi-camera-rear:before{content:"\F106"}

.mdi-camera-rear-variant:before{content:"\F107"}

.mdi-camera-switch:before{content:"\F108"}

.mdi-camera-timer:before{content:"\F109"}

.mdi-cancel:before{content:"\F739"}

.mdi-candle:before{content:"\F5E2"}

.mdi-candycane:before{content:"\F10A"}

.mdi-cannabis:before{content:"\F7A5"}

.mdi-car:before{content:"\F10B"}

.mdi-car-battery:before{content:"\F10C"}

.mdi-car-connected:before{content:"\F10D"}

.mdi-car-convertible:before{content:"\F7A6"}

.mdi-car-estate:before{content:"\F7A7"}

.mdi-car-hatchback:before{content:"\F7A8"}

.mdi-car-limousine:before{content:"\F8CC"}

.mdi-car-pickup:before{content:"\F7A9"}

.mdi-car-side:before{content:"\F7AA"}

.mdi-car-sports:before{content:"\F7AB"}

.mdi-car-wash:before{content:"\F10E"}

.mdi-caravan:before{content:"\F7AC"}

.mdi-cards:before{content:"\F638"}

.mdi-cards-club:before{content:"\F8CD"}

.mdi-cards-diamond:before{content:"\F8CE"}

.mdi-cards-heart:before{content:"\F8CF"}

.mdi-cards-outline:before{content:"\F639"}

.mdi-cards-playing-outline:before{content:"\F63A"}

.mdi-cards-spade:before{content:"\F8D0"}

.mdi-cards-variant:before{content:"\F6C6"}

.mdi-carrot:before{content:"\F10F"}

.mdi-cart:before{content:"\F110"}

.mdi-cart-off:before{content:"\F66B"}

.mdi-cart-outline:before{content:"\F111"}

.mdi-cart-plus:before{content:"\F112"}

.mdi-case-sensitive-alt:before{content:"\F113"}

.mdi-cash:before{content:"\F114"}

.mdi-cash-100:before{content:"\F115"}

.mdi-cash-multiple:before{content:"\F116"}

.mdi-cash-usd:before{content:"\F117"}

.mdi-cast:before{content:"\F118"}

.mdi-cast-connected:before{content:"\F119"}

.mdi-cast-off:before{content:"\F789"}

.mdi-castle:before{content:"\F11A"}

.mdi-cat:before{content:"\F11B"}

.mdi-cctv:before{content:"\F7AD"}

.mdi-ceiling-light:before{content:"\F768"}

.mdi-cellphone:before{content:"\F11C"}

.mdi-cellphone-android:before{content:"\F11D"}

.mdi-cellphone-basic:before{content:"\F11E"}

.mdi-cellphone-dock:before{content:"\F11F"}

.mdi-cellphone-erase:before{content:"\F94C"}

.mdi-cellphone-iphone:before{content:"\F120"}

.mdi-cellphone-key:before{content:"\F94D"}

.mdi-cellphone-link:before{content:"\F121"}

.mdi-cellphone-link-off:before{content:"\F122"}

.mdi-cellphone-lock:before{content:"\F94E"}

.mdi-cellphone-message:before{content:"\F8D2"}

.mdi-cellphone-off:before{content:"\F94F"}

.mdi-cellphone-settings:before{content:"\F123"}

.mdi-cellphone-settings-variant:before{content:"\F950"}

.mdi-cellphone-sound:before{content:"\F951"}

.mdi-cellphone-text:before{content:"\F8D1"}

.mdi-cellphone-wireless:before{content:"\F814"}

.mdi-certificate:before{content:"\F124"}

.mdi-chair-school:before{content:"\F125"}

.mdi-chart-arc:before{content:"\F126"}

.mdi-chart-areaspline:before{content:"\F127"}

.mdi-chart-bar:before{content:"\F128"}

.mdi-chart-bar-stacked:before{content:"\F769"}

.mdi-chart-bubble:before{content:"\F5E3"}

.mdi-chart-donut:before{content:"\F7AE"}

.mdi-chart-donut-variant:before{content:"\F7AF"}

.mdi-chart-gantt:before{content:"\F66C"}

.mdi-chart-histogram:before{content:"\F129"}

.mdi-chart-line:before{content:"\F12A"}

.mdi-chart-line-stacked:before{content:"\F76A"}

.mdi-chart-line-variant:before{content:"\F7B0"}

.mdi-chart-multiline:before{content:"\F8D3"}

.mdi-chart-pie:before{content:"\F12B"}

.mdi-chart-scatterplot-hexbin:before{content:"\F66D"}

.mdi-chart-timeline:before{content:"\F66E"}

.mdi-check:before{content:"\F12C"}

.mdi-check-all:before{content:"\F12D"}

.mdi-check-circle:before{content:"\F5E0"}

.mdi-check-circle-outline:before{content:"\F5E1"}

.mdi-check-outline:before{content:"\F854"}

.mdi-checkbox-blank:before{content:"\F12E"}

.mdi-checkbox-blank-circle:before{content:"\F12F"}

.mdi-checkbox-blank-circle-outline:before{content:"\F130"}

.mdi-checkbox-blank-outline:before{content:"\F131"}

.mdi-checkbox-intermediate:before{content:"\F855"}

.mdi-checkbox-marked:before{content:"\F132"}

.mdi-checkbox-marked-circle:before{content:"\F133"}

.mdi-checkbox-marked-circle-outline:before{content:"\F134"}

.mdi-checkbox-marked-outline:before{content:"\F135"}

.mdi-checkbox-multiple-blank:before{content:"\F136"}

.mdi-checkbox-multiple-blank-circle:before{content:"\F63B"}

.mdi-checkbox-multiple-blank-circle-outline:before{content:"\F63C"}

.mdi-checkbox-multiple-blank-outline:before{content:"\F137"}

.mdi-checkbox-multiple-marked:before{content:"\F138"}

.mdi-checkbox-multiple-marked-circle:before{content:"\F63D"}

.mdi-checkbox-multiple-marked-circle-outline:before{content:"\F63E"}

.mdi-checkbox-multiple-marked-outline:before{content:"\F139"}

.mdi-checkerboard:before{content:"\F13A"}

.mdi-chemical-weapon:before{content:"\F13B"}

.mdi-chess-bishop:before{content:"\F85B"}

.mdi-chess-king:before{content:"\F856"}

.mdi-chess-knight:before{content:"\F857"}

.mdi-chess-pawn:before{content:"\F858"}

.mdi-chess-queen:before{content:"\F859"}

.mdi-chess-rook:before{content:"\F85A"}

.mdi-chevron-double-down:before{content:"\F13C"}

.mdi-chevron-double-left:before{content:"\F13D"}

.mdi-chevron-double-right:before{content:"\F13E"}

.mdi-chevron-double-up:before{content:"\F13F"}

.mdi-chevron-down:before{content:"\F140"}

.mdi-chevron-left:before{content:"\F141"}

.mdi-chevron-right:before{content:"\F142"}

.mdi-chevron-up:before{content:"\F143"}

.mdi-chili-hot:before{content:"\F7B1"}

.mdi-chili-medium:before{content:"\F7B2"}

.mdi-chili-mild:before{content:"\F7B3"}

.mdi-chip:before{content:"\F61A"}

.mdi-christiantiy:before{content:"\F952"}

.mdi-church:before{content:"\F144"}

.mdi-circle:before{content:"\F764"}

.mdi-circle-edit-outline:before{content:"\F8D4"}

.mdi-circle-outline:before{content:"\F765"}

.mdi-cisco-webex:before{content:"\F145"}

.mdi-city:before{content:"\F146"}

.mdi-clipboard:before{content:"\F147"}

.mdi-clipboard-account:before{content:"\F148"}

.mdi-clipboard-alert:before{content:"\F149"}

.mdi-clipboard-arrow-down:before{content:"\F14A"}

.mdi-clipboard-arrow-left:before{content:"\F14B"}

.mdi-clipboard-check:before{content:"\F14C"}

.mdi-clipboard-check-outline:before{content:"\F8A7"}

.mdi-clipboard-flow:before{content:"\F6C7"}

.mdi-clipboard-outline:before{content:"\F14D"}

.mdi-clipboard-plus:before{content:"\F750"}

.mdi-clipboard-pulse:before{content:"\F85C"}

.mdi-clipboard-pulse-outline:before{content:"\F85D"}

.mdi-clipboard-text:before{content:"\F14E"}

.mdi-clippy:before{content:"\F14F"}

.mdi-clock:before{content:"\F953"}

.mdi-clock-alert:before{content:"\F954"}

.mdi-clock-alert-outline:before{content:"\F5CE"}

.mdi-clock-end:before{content:"\F151"}

.mdi-clock-fast:before{content:"\F152"}

.mdi-clock-in:before{content:"\F153"}

.mdi-clock-out:before{content:"\F154"}

.mdi-clock-outline:before{content:"\F150"}

.mdi-clock-start:before{content:"\F155"}

.mdi-close:before{content:"\F156"}

.mdi-close-box:before{content:"\F157"}

.mdi-close-box-outline:before{content:"\F158"}

.mdi-close-circle:before{content:"\F159"}

.mdi-close-circle-outline:before{content:"\F15A"}

.mdi-close-network:before{content:"\F15B"}

.mdi-close-octagon:before{content:"\F15C"}

.mdi-close-octagon-outline:before{content:"\F15D"}

.mdi-close-outline:before{content:"\F6C8"}

.mdi-closed-caption:before{content:"\F15E"}

.mdi-cloud:before{content:"\F15F"}

.mdi-cloud-braces:before{content:"\F7B4"}

.mdi-cloud-check:before{content:"\F160"}

.mdi-cloud-circle:before{content:"\F161"}

.mdi-cloud-download:before{content:"\F162"}

.mdi-cloud-off-outline:before{content:"\F164"}

.mdi-cloud-outline:before{content:"\F163"}

.mdi-cloud-print:before{content:"\F165"}

.mdi-cloud-print-outline:before{content:"\F166"}

.mdi-cloud-search:before{content:"\F955"}

.mdi-cloud-search-outline:before{content:"\F956"}

.mdi-cloud-sync:before{content:"\F63F"}

.mdi-cloud-tags:before{content:"\F7B5"}

.mdi-cloud-upload:before{content:"\F167"}

.mdi-clover:before{content:"\F815"}

.mdi-code-array:before{content:"\F168"}

.mdi-code-braces:before{content:"\F169"}

.mdi-code-brackets:before{content:"\F16A"}

.mdi-code-equal:before{content:"\F16B"}

.mdi-code-greater-than:before{content:"\F16C"}

.mdi-code-greater-than-or-equal:before{content:"\F16D"}

.mdi-code-less-than:before{content:"\F16E"}

.mdi-code-less-than-or-equal:before{content:"\F16F"}

.mdi-code-not-equal:before{content:"\F170"}

.mdi-code-not-equal-variant:before{content:"\F171"}

.mdi-code-parentheses:before{content:"\F172"}

.mdi-code-string:before{content:"\F173"}

.mdi-code-tags:before{content:"\F174"}

.mdi-code-tags-check:before{content:"\F693"}

.mdi-codepen:before{content:"\F175"}

.mdi-coffee:before{content:"\F176"}

.mdi-coffee-outline:before{content:"\F6C9"}

.mdi-coffee-to-go:before{content:"\F177"}

.mdi-cogs:before{content:"\F8D5"}

.mdi-coin:before{content:"\F178"}

.mdi-coins:before{content:"\F694"}

.mdi-collage:before{content:"\F640"}

.mdi-color-helper:before{content:"\F179"}

.mdi-comment:before{content:"\F17A"}

.mdi-comment-account:before{content:"\F17B"}

.mdi-comment-account-outline:before{content:"\F17C"}

.mdi-comment-alert:before{content:"\F17D"}

.mdi-comment-alert-outline:before{content:"\F17E"}

.mdi-comment-check:before{content:"\F17F"}

.mdi-comment-check-outline:before{content:"\F180"}

.mdi-comment-multiple:before{content:"\F85E"}

.mdi-comment-multiple-outline:before{content:"\F181"}

.mdi-comment-outline:before{content:"\F182"}

.mdi-comment-plus-outline:before{content:"\F183"}

.mdi-comment-processing:before{content:"\F184"}

.mdi-comment-processing-outline:before{content:"\F185"}

.mdi-comment-question:before{content:"\F816"}

.mdi-comment-question-outline:before{content:"\F186"}

.mdi-comment-remove:before{content:"\F5DE"}

.mdi-comment-remove-outline:before{content:"\F187"}

.mdi-comment-text:before{content:"\F188"}

.mdi-comment-text-multiple:before{content:"\F85F"}

.mdi-comment-text-multiple-outline:before{content:"\F860"}

.mdi-comment-text-outline:before{content:"\F189"}

.mdi-compare:before{content:"\F18A"}

.mdi-compass:before{content:"\F18B"}

.mdi-compass-outline:before{content:"\F18C"}

.mdi-console:before{content:"\F18D"}

.mdi-console-line:before{content:"\F7B6"}

.mdi-console-network:before{content:"\F8A8"}

.mdi-contact-mail:before{content:"\F18E"}

.mdi-contacts:before{content:"\F6CA"}

.mdi-content-copy:before{content:"\F18F"}

.mdi-content-cut:before{content:"\F190"}

.mdi-content-duplicate:before{content:"\F191"}

.mdi-content-paste:before{content:"\F192"}

.mdi-content-save:before{content:"\F193"}

.mdi-content-save-all:before{content:"\F194"}

.mdi-content-save-outline:before{content:"\F817"}

.mdi-content-save-settings:before{content:"\F61B"}

.mdi-contrast:before{content:"\F195"}

.mdi-contrast-box:before{content:"\F196"}

.mdi-contrast-circle:before{content:"\F197"}

.mdi-cookie:before{content:"\F198"}

.mdi-copyright:before{content:"\F5E6"}

.mdi-cordova:before{content:"\F957"}

.mdi-corn:before{content:"\F7B7"}

.mdi-counter:before{content:"\F199"}

.mdi-cow:before{content:"\F19A"}

.mdi-crane:before{content:"\F861"}

.mdi-creation:before{content:"\F1C9"}

.mdi-credit-card:before{content:"\F19B"}

.mdi-credit-card-multiple:before{content:"\F19C"}

.mdi-credit-card-off:before{content:"\F5E4"}

.mdi-credit-card-plus:before{content:"\F675"}

.mdi-credit-card-scan:before{content:"\F19D"}

.mdi-credit-card-settings:before{content:"\F8D6"}

.mdi-crop:before{content:"\F19E"}

.mdi-crop-free:before{content:"\F19F"}

.mdi-crop-landscape:before{content:"\F1A0"}

.mdi-crop-portrait:before{content:"\F1A1"}

.mdi-crop-rotate:before{content:"\F695"}

.mdi-crop-square:before{content:"\F1A2"}

.mdi-crosshairs:before{content:"\F1A3"}

.mdi-crosshairs-gps:before{content:"\F1A4"}

.mdi-crown:before{content:"\F1A5"}

.mdi-cryengine:before{content:"\F958"}

.mdi-cube:before{content:"\F1A6"}

.mdi-cube-outline:before{content:"\F1A7"}

.mdi-cube-send:before{content:"\F1A8"}

.mdi-cube-unfolded:before{content:"\F1A9"}

.mdi-cup:before{content:"\F1AA"}

.mdi-cup-off:before{content:"\F5E5"}

.mdi-cup-water:before{content:"\F1AB"}

.mdi-cupcake:before{content:"\F959"}

.mdi-curling:before{content:"\F862"}

.mdi-currency-bdt:before{content:"\F863"}

.mdi-currency-btc:before{content:"\F1AC"}

.mdi-currency-chf:before{content:"\F7B8"}

.mdi-currency-cny:before{content:"\F7B9"}

.mdi-currency-eth:before{content:"\F7BA"}

.mdi-currency-eur:before{content:"\F1AD"}

.mdi-currency-gbp:before{content:"\F1AE"}

.mdi-currency-inr:before{content:"\F1AF"}

.mdi-currency-jpy:before{content:"\F7BB"}

.mdi-currency-krw:before{content:"\F7BC"}

.mdi-currency-kzt:before{content:"\F864"}

.mdi-currency-ngn:before{content:"\F1B0"}

.mdi-currency-rub:before{content:"\F1B1"}

.mdi-currency-sign:before{content:"\F7BD"}

.mdi-currency-try:before{content:"\F1B2"}

.mdi-currency-twd:before{content:"\F7BE"}

.mdi-currency-usd:before{content:"\F1B3"}

.mdi-currency-usd-off:before{content:"\F679"}

.mdi-current-ac:before{content:"\F95A"}

.mdi-current-dc:before{content:"\F95B"}

.mdi-cursor-default:before{content:"\F1B4"}

.mdi-cursor-default-outline:before{content:"\F1B5"}

.mdi-cursor-move:before{content:"\F1B6"}

.mdi-cursor-pointer:before{content:"\F1B7"}

.mdi-cursor-text:before{content:"\F5E7"}

.mdi-database:before{content:"\F1B8"}

.mdi-database-export:before{content:"\F95D"}

.mdi-database-import:before{content:"\F95C"}

.mdi-database-minus:before{content:"\F1B9"}

.mdi-database-plus:before{content:"\F1BA"}

.mdi-database-search:before{content:"\F865"}

.mdi-death-star:before{content:"\F8D7"}

.mdi-death-star-variant:before{content:"\F8D8"}

.mdi-debian:before{content:"\F8D9"}

.mdi-debug-step-into:before{content:"\F1BB"}

.mdi-debug-step-out:before{content:"\F1BC"}

.mdi-debug-step-over:before{content:"\F1BD"}

.mdi-decagram:before{content:"\F76B"}

.mdi-decagram-outline:before{content:"\F76C"}

.mdi-decimal-decrease:before{content:"\F1BE"}

.mdi-decimal-increase:before{content:"\F1BF"}

.mdi-delete:before{content:"\F1C0"}

.mdi-delete-circle:before{content:"\F682"}

.mdi-delete-empty:before{content:"\F6CB"}

.mdi-delete-forever:before{content:"\F5E8"}

.mdi-delete-restore:before{content:"\F818"}

.mdi-delete-sweep:before{content:"\F5E9"}

.mdi-delete-variant:before{content:"\F1C1"}

.mdi-delta:before{content:"\F1C2"}

.mdi-desk-lamp:before{content:"\F95E"}

.mdi-deskphone:before{content:"\F1C3"}

.mdi-desktop-classic:before{content:"\F7BF"}

.mdi-desktop-mac:before{content:"\F1C4"}

.mdi-desktop-tower:before{content:"\F1C5"}

.mdi-details:before{content:"\F1C6"}

.mdi-developer-board:before{content:"\F696"}

.mdi-deviantart:before{content:"\F1C7"}

.mdi-dialpad:before{content:"\F61C"}

.mdi-diamond:before{content:"\F1C8"}

.mdi-dice-1:before{content:"\F1CA"}

.mdi-dice-2:before{content:"\F1CB"}

.mdi-dice-3:before{content:"\F1CC"}

.mdi-dice-4:before{content:"\F1CD"}

.mdi-dice-5:before{content:"\F1CE"}

.mdi-dice-6:before{content:"\F1CF"}

.mdi-dice-d10:before{content:"\F76E"}

.mdi-dice-d12:before{content:"\F866"}

.mdi-dice-d20:before{content:"\F5EA"}

.mdi-dice-d4:before{content:"\F5EB"}

.mdi-dice-d6:before{content:"\F5EC"}

.mdi-dice-d8:before{content:"\F5ED"}

.mdi-dice-multiple:before{content:"\F76D"}

.mdi-dictionary:before{content:"\F61D"}

.mdi-dip-switch:before{content:"\F7C0"}

.mdi-directions:before{content:"\F1D0"}

.mdi-directions-fork:before{content:"\F641"}

.mdi-discord:before{content:"\F66F"}

.mdi-disk:before{content:"\F5EE"}

.mdi-disk-alert:before{content:"\F1D1"}

.mdi-disk-player:before{content:"\F95F"}

.mdi-disqus:before{content:"\F1D2"}

.mdi-disqus-outline:before{content:"\F1D3"}

.mdi-division:before{content:"\F1D4"}

.mdi-division-box:before{content:"\F1D5"}

.mdi-dna:before{content:"\F683"}

.mdi-dns:before{content:"\F1D6"}

.mdi-do-not-disturb:before{content:"\F697"}

.mdi-do-not-disturb-off:before{content:"\F698"}

.mdi-docker:before{content:"\F867"}

.mdi-dolby:before{content:"\F6B2"}

.mdi-domain:before{content:"\F1D7"}

.mdi-donkey:before{content:"\F7C1"}

.mdi-door:before{content:"\F819"}

.mdi-door-closed:before{content:"\F81A"}

.mdi-door-open:before{content:"\F81B"}

.mdi-doorbell-video:before{content:"\F868"}

.mdi-dots-horizontal:before{content:"\F1D8"}

.mdi-dots-horizontal-circle:before{content:"\F7C2"}

.mdi-dots-vertical:before{content:"\F1D9"}

.mdi-dots-vertical-circle:before{content:"\F7C3"}

.mdi-douban:before{content:"\F699"}

.mdi-download:before{content:"\F1DA"}

.mdi-download-network:before{content:"\F6F3"}

.mdi-drag:before{content:"\F1DB"}

.mdi-drag-horizontal:before{content:"\F1DC"}

.mdi-drag-vertical:before{content:"\F1DD"}

.mdi-drawing:before{content:"\F1DE"}

.mdi-drawing-box:before{content:"\F1DF"}

.mdi-dribbble:before{content:"\F1E0"}

.mdi-dribbble-box:before{content:"\F1E1"}

.mdi-drone:before{content:"\F1E2"}

.mdi-dropbox:before{content:"\F1E3"}

.mdi-drupal:before{content:"\F1E4"}

.mdi-duck:before{content:"\F1E5"}

.mdi-dumbbell:before{content:"\F1E6"}

.mdi-ear-hearing:before{content:"\F7C4"}

.mdi-earth:before{content:"\F1E7"}

.mdi-earth-box:before{content:"\F6CC"}

.mdi-earth-box-off:before{content:"\F6CD"}

.mdi-earth-off:before{content:"\F1E8"}

.mdi-edge:before{content:"\F1E9"}

.mdi-eject:before{content:"\F1EA"}

.mdi-elephant:before{content:"\F7C5"}

.mdi-elevation-decline:before{content:"\F1EB"}

.mdi-elevation-rise:before{content:"\F1EC"}

.mdi-elevator:before{content:"\F1ED"}

.mdi-email:before{content:"\F1EE"}

.mdi-email-alert:before{content:"\F6CE"}

.mdi-email-open:before{content:"\F1EF"}

.mdi-email-open-outline:before{content:"\F5EF"}

.mdi-email-outline:before{content:"\F1F0"}

.mdi-email-search:before{content:"\F960"}

.mdi-email-search-outline:before{content:"\F961"}

.mdi-email-secure:before{content:"\F1F1"}

.mdi-email-variant:before{content:"\F5F0"}

.mdi-emby:before{content:"\F6B3"}

.mdi-emoticon:before{content:"\F1F2"}

.mdi-emoticon-cool:before{content:"\F1F3"}

.mdi-emoticon-dead:before{content:"\F69A"}

.mdi-emoticon-devil:before{content:"\F1F4"}

.mdi-emoticon-excited:before{content:"\F69B"}

.mdi-emoticon-happy:before{content:"\F1F5"}

.mdi-emoticon-neutral:before{content:"\F1F6"}

.mdi-emoticon-poop:before{content:"\F1F7"}

.mdi-emoticon-sad:before{content:"\F1F8"}

.mdi-emoticon-tongue:before{content:"\F1F9"}

.mdi-engine:before{content:"\F1FA"}

.mdi-engine-outline:before{content:"\F1FB"}

.mdi-equal:before{content:"\F1FC"}

.mdi-equal-box:before{content:"\F1FD"}

.mdi-eraser:before{content:"\F1FE"}

.mdi-eraser-variant:before{content:"\F642"}

.mdi-escalator:before{content:"\F1FF"}

.mdi-ethereum:before{content:"\F869"}

.mdi-ethernet:before{content:"\F200"}

.mdi-ethernet-cable:before{content:"\F201"}

.mdi-ethernet-cable-off:before{content:"\F202"}

.mdi-etsy:before{content:"\F203"}

.mdi-ev-station:before{content:"\F5F1"}

.mdi-eventbrite:before{content:"\F7C6"}

.mdi-evernote:before{content:"\F204"}

.mdi-exclamation:before{content:"\F205"}

.mdi-exit-to-app:before{content:"\F206"}

.mdi-exponent:before{content:"\F962"}

.mdi-exponent-box:before{content:"\F963"}

.mdi-export:before{content:"\F207"}

.mdi-eye:before{content:"\F208"}

.mdi-eye-off:before{content:"\F209"}

.mdi-eye-off-outline:before{content:"\F6D0"}

.mdi-eye-outline:before{content:"\F6CF"}

.mdi-eye-plus:before{content:"\F86A"}

.mdi-eye-plus-outline:before{content:"\F86B"}

.mdi-eye-settings:before{content:"\F86C"}

.mdi-eye-settings-outline:before{content:"\F86D"}

.mdi-eyedropper:before{content:"\F20A"}

.mdi-eyedropper-variant:before{content:"\F20B"}

.mdi-face:before{content:"\F643"}

.mdi-face-profile:before{content:"\F644"}

.mdi-facebook:before{content:"\F20C"}

.mdi-facebook-box:before{content:"\F20D"}

.mdi-facebook-messenger:before{content:"\F20E"}

.mdi-factory:before{content:"\F20F"}

.mdi-fan:before{content:"\F210"}

.mdi-fan-off:before{content:"\F81C"}

.mdi-fast-forward:before{content:"\F211"}

.mdi-fast-forward-outline:before{content:"\F6D1"}

.mdi-fax:before{content:"\F212"}

.mdi-feather:before{content:"\F6D2"}

.mdi-fedora:before{content:"\F8DA"}

.mdi-ferry:before{content:"\F213"}

.mdi-file:before{content:"\F214"}

.mdi-file-account:before{content:"\F73A"}

.mdi-file-chart:before{content:"\F215"}

.mdi-file-check:before{content:"\F216"}

.mdi-file-cloud:before{content:"\F217"}

.mdi-file-compare:before{content:"\F8A9"}

.mdi-file-delimited:before{content:"\F218"}

.mdi-file-document:before{content:"\F219"}

.mdi-file-document-box:before{content:"\F21A"}

.mdi-file-download:before{content:"\F964"}

.mdi-file-download-outline:before{content:"\F965"}

.mdi-file-excel:before{content:"\F21B"}

.mdi-file-excel-box:before{content:"\F21C"}

.mdi-file-export:before{content:"\F21D"}

.mdi-file-find:before{content:"\F21E"}

.mdi-file-hidden:before{content:"\F613"}

.mdi-file-image:before{content:"\F21F"}

.mdi-file-import:before{content:"\F220"}

.mdi-file-lock:before{content:"\F221"}

.mdi-file-multiple:before{content:"\F222"}

.mdi-file-music:before{content:"\F223"}

.mdi-file-outline:before{content:"\F224"}

.mdi-file-pdf:before{content:"\F225"}

.mdi-file-pdf-box:before{content:"\F226"}

.mdi-file-percent:before{content:"\F81D"}

.mdi-file-plus:before{content:"\F751"}

.mdi-file-powerpoint:before{content:"\F227"}

.mdi-file-powerpoint-box:before{content:"\F228"}

.mdi-file-presentation-box:before{content:"\F229"}

.mdi-file-question:before{content:"\F86E"}

.mdi-file-restore:before{content:"\F670"}

.mdi-file-send:before{content:"\F22A"}

.mdi-file-tree:before{content:"\F645"}

.mdi-file-undo:before{content:"\F8DB"}

.mdi-file-video:before{content:"\F22B"}

.mdi-file-word:before{content:"\F22C"}

.mdi-file-word-box:before{content:"\F22D"}

.mdi-file-xml:before{content:"\F22E"}

.mdi-film:before{content:"\F22F"}

.mdi-filmstrip:before{content:"\F230"}

.mdi-filmstrip-off:before{content:"\F231"}

.mdi-filter:before{content:"\F232"}

.mdi-filter-outline:before{content:"\F233"}

.mdi-filter-remove:before{content:"\F234"}

.mdi-filter-remove-outline:before{content:"\F235"}

.mdi-filter-variant:before{content:"\F236"}

.mdi-finance:before{content:"\F81E"}

.mdi-find-replace:before{content:"\F6D3"}

.mdi-fingerprint:before{content:"\F237"}

.mdi-fire:before{content:"\F238"}

.mdi-fire-truck:before{content:"\F8AA"}

.mdi-firebase:before{content:"\F966"}

.mdi-firefox:before{content:"\F239"}

.mdi-fish:before{content:"\F23A"}

.mdi-flag:before{content:"\F23B"}

.mdi-flag-checkered:before{content:"\F23C"}

.mdi-flag-outline:before{content:"\F23D"}

.mdi-flag-triangle:before{content:"\F23F"}

.mdi-flag-variant:before{content:"\F240"}

.mdi-flag-variant-outline:before{content:"\F23E"}

.mdi-flash:before{content:"\F241"}

.mdi-flash-auto:before{content:"\F242"}

.mdi-flash-circle:before{content:"\F81F"}

.mdi-flash-off:before{content:"\F243"}

.mdi-flash-outline:before{content:"\F6D4"}

.mdi-flash-red-eye:before{content:"\F67A"}

.mdi-flashlight:before{content:"\F244"}

.mdi-flashlight-off:before{content:"\F245"}

.mdi-flask:before{content:"\F093"}

.mdi-flask-empty:before{content:"\F094"}

.mdi-flask-empty-outline:before{content:"\F095"}

.mdi-flask-outline:before{content:"\F096"}

.mdi-flattr:before{content:"\F246"}

.mdi-flip-to-back:before{content:"\F247"}

.mdi-flip-to-front:before{content:"\F248"}

.mdi-floor-lamp:before{content:"\F8DC"}

.mdi-floor-plan:before{content:"\F820"}

.mdi-floppy:before{content:"\F249"}

.mdi-flower:before{content:"\F24A"}

.mdi-folder:before{content:"\F24B"}

.mdi-folder-account:before{content:"\F24C"}

.mdi-folder-download:before{content:"\F24D"}

.mdi-folder-edit:before{content:"\F8DD"}

.mdi-folder-google-drive:before{content:"\F24E"}

.mdi-folder-image:before{content:"\F24F"}

.mdi-folder-key:before{content:"\F8AB"}

.mdi-folder-key-network:before{content:"\F8AC"}

.mdi-folder-lock:before{content:"\F250"}

.mdi-folder-lock-open:before{content:"\F251"}

.mdi-folder-move:before{content:"\F252"}

.mdi-folder-multiple:before{content:"\F253"}

.mdi-folder-multiple-image:before{content:"\F254"}

.mdi-folder-multiple-outline:before{content:"\F255"}

.mdi-folder-network:before{content:"\F86F"}

.mdi-folder-open:before{content:"\F76F"}

.mdi-folder-outline:before{content:"\F256"}

.mdi-folder-plus:before{content:"\F257"}

.mdi-folder-remove:before{content:"\F258"}

.mdi-folder-search:before{content:"\F967"}

.mdi-folder-search-outline:before{content:"\F968"}

.mdi-folder-star:before{content:"\F69C"}

.mdi-folder-upload:before{content:"\F259"}

.mdi-font-awesome:before{content:"\F03A"}

.mdi-food:before{content:"\F25A"}

.mdi-food-apple:before{content:"\F25B"}

.mdi-food-croissant:before{content:"\F7C7"}

.mdi-food-fork-drink:before{content:"\F5F2"}

.mdi-food-off:before{content:"\F5F3"}

.mdi-food-variant:before{content:"\F25C"}

.mdi-football:before{content:"\F25D"}

.mdi-football-australian:before{content:"\F25E"}

.mdi-football-helmet:before{content:"\F25F"}

.mdi-forklift:before{content:"\F7C8"}

.mdi-format-align-bottom:before{content:"\F752"}

.mdi-format-align-center:before{content:"\F260"}

.mdi-format-align-justify:before{content:"\F261"}

.mdi-format-align-left:before{content:"\F262"}

.mdi-format-align-middle:before{content:"\F753"}

.mdi-format-align-right:before{content:"\F263"}

.mdi-format-align-top:before{content:"\F754"}

.mdi-format-annotation-plus:before{content:"\F646"}

.mdi-format-bold:before{content:"\F264"}

.mdi-format-clear:before{content:"\F265"}

.mdi-format-color-fill:before{content:"\F266"}

.mdi-format-color-text:before{content:"\F69D"}

.mdi-format-columns:before{content:"\F8DE"}

.mdi-format-float-center:before{content:"\F267"}

.mdi-format-float-left:before{content:"\F268"}

.mdi-format-float-none:before{content:"\F269"}

.mdi-format-float-right:before{content:"\F26A"}

.mdi-format-font:before{content:"\F6D5"}

.mdi-format-header-1:before{content:"\F26B"}

.mdi-format-header-2:before{content:"\F26C"}

.mdi-format-header-3:before{content:"\F26D"}

.mdi-format-header-4:before{content:"\F26E"}

.mdi-format-header-5:before{content:"\F26F"}

.mdi-format-header-6:before{content:"\F270"}

.mdi-format-header-decrease:before{content:"\F271"}

.mdi-format-header-equal:before{content:"\F272"}

.mdi-format-header-increase:before{content:"\F273"}

.mdi-format-header-pound:before{content:"\F274"}

.mdi-format-horizontal-align-center:before{content:"\F61E"}

.mdi-format-horizontal-align-left:before{content:"\F61F"}

.mdi-format-horizontal-align-right:before{content:"\F620"}

.mdi-format-indent-decrease:before{content:"\F275"}

.mdi-format-indent-increase:before{content:"\F276"}

.mdi-format-italic:before{content:"\F277"}

.mdi-format-line-spacing:before{content:"\F278"}

.mdi-format-line-style:before{content:"\F5C8"}

.mdi-format-line-weight:before{content:"\F5C9"}

.mdi-format-list-bulleted:before{content:"\F279"}

.mdi-format-list-bulleted-type:before{content:"\F27A"}

.mdi-format-list-checkbox:before{content:"\F969"}

.mdi-format-list-checks:before{content:"\F755"}

.mdi-format-list-numbers:before{content:"\F27B"}

.mdi-format-page-break:before{content:"\F6D6"}

.mdi-format-paint:before{content:"\F27C"}

.mdi-format-paragraph:before{content:"\F27D"}

.mdi-format-pilcrow:before{content:"\F6D7"}

.mdi-format-quote-close:before{content:"\F27E"}

.mdi-format-quote-open:before{content:"\F756"}

.mdi-format-rotate-90:before{content:"\F6A9"}

.mdi-format-section:before{content:"\F69E"}

.mdi-format-size:before{content:"\F27F"}

.mdi-format-strikethrough:before{content:"\F280"}

.mdi-format-strikethrough-variant:before{content:"\F281"}

.mdi-format-subscript:before{content:"\F282"}

.mdi-format-superscript:before{content:"\F283"}

.mdi-format-text:before{content:"\F284"}

.mdi-format-textdirection-l-to-r:before{content:"\F285"}

.mdi-format-textdirection-r-to-l:before{content:"\F286"}

.mdi-format-title:before{content:"\F5F4"}

.mdi-format-underline:before{content:"\F287"}

.mdi-format-vertical-align-bottom:before{content:"\F621"}

.mdi-format-vertical-align-center:before{content:"\F622"}

.mdi-format-vertical-align-top:before{content:"\F623"}

.mdi-format-wrap-inline:before{content:"\F288"}

.mdi-format-wrap-square:before{content:"\F289"}

.mdi-format-wrap-tight:before{content:"\F28A"}

.mdi-format-wrap-top-bottom:before{content:"\F28B"}

.mdi-forum:before{content:"\F28C"}

.mdi-forum-outline:before{content:"\F821"}

.mdi-forward:before{content:"\F28D"}

.mdi-fountain:before{content:"\F96A"}

.mdi-foursquare:before{content:"\F28E"}

.mdi-freebsd:before{content:"\F8DF"}

.mdi-fridge:before{content:"\F28F"}

.mdi-fridge-filled:before{content:"\F290"}

.mdi-fridge-filled-bottom:before{content:"\F291"}

.mdi-fridge-filled-top:before{content:"\F292"}

.mdi-fuel:before{content:"\F7C9"}

.mdi-fullscreen:before{content:"\F293"}

.mdi-fullscreen-exit:before{content:"\F294"}

.mdi-function:before{content:"\F295"}

.mdi-function-variant:before{content:"\F870"}

.mdi-gamepad:before{content:"\F296"}

.mdi-gamepad-variant:before{content:"\F297"}

.mdi-garage:before{content:"\F6D8"}

.mdi-garage-alert:before{content:"\F871"}

.mdi-garage-open:before{content:"\F6D9"}

.mdi-gas-cylinder:before{content:"\F647"}

.mdi-gas-station:before{content:"\F298"}

.mdi-gate:before{content:"\F299"}

.mdi-gate-and:before{content:"\F8E0"}

.mdi-gate-nand:before{content:"\F8E1"}

.mdi-gate-nor:before{content:"\F8E2"}

.mdi-gate-not:before{content:"\F8E3"}

.mdi-gate-or:before{content:"\F8E4"}

.mdi-gate-xnor:before{content:"\F8E5"}

.mdi-gate-xor:before{content:"\F8E6"}

.mdi-gauge:before{content:"\F29A"}

.mdi-gauge-empty:before{content:"\F872"}

.mdi-gauge-full:before{content:"\F873"}

.mdi-gauge-low:before{content:"\F874"}

.mdi-gavel:before{content:"\F29B"}

.mdi-gender-female:before{content:"\F29C"}

.mdi-gender-male:before{content:"\F29D"}

.mdi-gender-male-female:before{content:"\F29E"}

.mdi-gender-transgender:before{content:"\F29F"}

.mdi-gentoo:before{content:"\F8E7"}

.mdi-gesture:before{content:"\F7CA"}

.mdi-gesture-double-tap:before{content:"\F73B"}

.mdi-gesture-swipe-down:before{content:"\F73C"}

.mdi-gesture-swipe-left:before{content:"\F73D"}

.mdi-gesture-swipe-right:before{content:"\F73E"}

.mdi-gesture-swipe-up:before{content:"\F73F"}

.mdi-gesture-tap:before{content:"\F740"}

.mdi-gesture-two-double-tap:before{content:"\F741"}

.mdi-gesture-two-tap:before{content:"\F742"}

.mdi-ghost:before{content:"\F2A0"}

.mdi-gift:before{content:"\F2A1"}

.mdi-git:before{content:"\F2A2"}

.mdi-github-box:before{content:"\F2A3"}

.mdi-github-circle:before{content:"\F2A4"}

.mdi-github-face:before{content:"\F6DA"}

.mdi-glass-cocktail:before{content:"\F356"}

.mdi-glass-flute:before{content:"\F2A5"}

.mdi-glass-mug:before{content:"\F2A6"}

.mdi-glass-stange:before{content:"\F2A7"}

.mdi-glass-tulip:before{content:"\F2A8"}

.mdi-glass-wine:before{content:"\F875"}

.mdi-glassdoor:before{content:"\F2A9"}

.mdi-glasses:before{content:"\F2AA"}

.mdi-globe-model:before{content:"\F8E8"}

.mdi-gmail:before{content:"\F2AB"}

.mdi-gnome:before{content:"\F2AC"}

.mdi-golf:before{content:"\F822"}

.mdi-gondola:before{content:"\F685"}

.mdi-google:before{content:"\F2AD"}

.mdi-google-allo:before{content:"\F801"}

.mdi-google-analytics:before{content:"\F7CB"}

.mdi-google-assistant:before{content:"\F7CC"}

.mdi-google-cardboard:before{content:"\F2AE"}

.mdi-google-chrome:before{content:"\F2AF"}

.mdi-google-circles:before{content:"\F2B0"}

.mdi-google-circles-communities:before{content:"\F2B1"}

.mdi-google-circles-extended:before{content:"\F2B2"}

.mdi-google-circles-group:before{content:"\F2B3"}

.mdi-google-controller:before{content:"\F2B4"}

.mdi-google-controller-off:before{content:"\F2B5"}

.mdi-google-drive:before{content:"\F2B6"}

.mdi-google-earth:before{content:"\F2B7"}

.mdi-google-fit:before{content:"\F96B"}

.mdi-google-glass:before{content:"\F2B8"}

.mdi-google-hangouts:before{content:"\F2C9"}

.mdi-google-home:before{content:"\F823"}

.mdi-google-keep:before{content:"\F6DB"}

.mdi-google-maps:before{content:"\F5F5"}

.mdi-google-nearby:before{content:"\F2B9"}

.mdi-google-pages:before{content:"\F2BA"}

.mdi-google-photos:before{content:"\F6DC"}

.mdi-google-physical-web:before{content:"\F2BB"}

.mdi-google-play:before{content:"\F2BC"}

.mdi-google-plus:before{content:"\F2BD"}

.mdi-google-plus-box:before{content:"\F2BE"}

.mdi-google-translate:before{content:"\F2BF"}

.mdi-google-wallet:before{content:"\F2C0"}

.mdi-gpu:before{content:"\F8AD"}

.mdi-gradient:before{content:"\F69F"}

.mdi-graphql:before{content:"\F876"}

.mdi-grease-pencil:before{content:"\F648"}

.mdi-greater-than:before{content:"\F96C"}

.mdi-greater-than-or-equal:before{content:"\F96D"}

.mdi-grid:before{content:"\F2C1"}

.mdi-grid-large:before{content:"\F757"}

.mdi-grid-off:before{content:"\F2C2"}

.mdi-group:before{content:"\F2C3"}

.mdi-guitar-acoustic:before{content:"\F770"}

.mdi-guitar-electric:before{content:"\F2C4"}

.mdi-guitar-pick:before{content:"\F2C5"}

.mdi-guitar-pick-outline:before{content:"\F2C6"}

.mdi-guy-fawkes-mask:before{content:"\F824"}

.mdi-hackernews:before{content:"\F624"}

.mdi-hamburger:before{content:"\F684"}

.mdi-hammer:before{content:"\F8E9"}

.mdi-hand-pointing-right:before{content:"\F2C7"}

.mdi-hanger:before{content:"\F2C8"}

.mdi-hard-hat:before{content:"\F96E"}

.mdi-harddisk:before{content:"\F2CA"}

.mdi-headphones:before{content:"\F2CB"}

.mdi-headphones-bluetooth:before{content:"\F96F"}

.mdi-headphones-box:before{content:"\F2CC"}

.mdi-headphones-off:before{content:"\F7CD"}

.mdi-headphones-settings:before{content:"\F2CD"}

.mdi-headset:before{content:"\F2CE"}

.mdi-headset-dock:before{content:"\F2CF"}

.mdi-headset-off:before{content:"\F2D0"}

.mdi-heart:before{content:"\F2D1"}

.mdi-heart-box:before{content:"\F2D2"}

.mdi-heart-box-outline:before{content:"\F2D3"}

.mdi-heart-broken:before{content:"\F2D4"}

.mdi-heart-circle:before{content:"\F970"}

.mdi-heart-circle-outline:before{content:"\F971"}

.mdi-heart-half:before{content:"\F6DE"}

.mdi-heart-half-full:before{content:"\F6DD"}

.mdi-heart-half-outline:before{content:"\F6DF"}

.mdi-heart-off:before{content:"\F758"}

.mdi-heart-outline:before{content:"\F2D5"}

.mdi-heart-pulse:before{content:"\F5F6"}

.mdi-help:before{content:"\F2D6"}

.mdi-help-box:before{content:"\F78A"}

.mdi-help-circle:before{content:"\F2D7"}

.mdi-help-circle-outline:before{content:"\F625"}

.mdi-help-network:before{content:"\F6F4"}

.mdi-hexagon:before{content:"\F2D8"}

.mdi-hexagon-multiple:before{content:"\F6E0"}

.mdi-hexagon-outline:before{content:"\F2D9"}

.mdi-high-definition:before{content:"\F7CE"}

.mdi-high-definition-box:before{content:"\F877"}

.mdi-highway:before{content:"\F5F7"}

.mdi-hinduism:before{content:"\F972"}

.mdi-history:before{content:"\F2DA"}

.mdi-hockey-puck:before{content:"\F878"}

.mdi-hockey-sticks:before{content:"\F879"}

.mdi-hololens:before{content:"\F2DB"}

.mdi-home:before{content:"\F2DC"}

.mdi-home-account:before{content:"\F825"}

.mdi-home-alert:before{content:"\F87A"}

.mdi-home-assistant:before{content:"\F7CF"}

.mdi-home-automation:before{content:"\F7D0"}

.mdi-home-circle:before{content:"\F7D1"}

.mdi-home-currency-usd:before{content:"\F8AE"}

.mdi-home-heart:before{content:"\F826"}

.mdi-home-lock:before{content:"\F8EA"}

.mdi-home-lock-open:before{content:"\F8EB"}

.mdi-home-map-marker:before{content:"\F5F8"}

.mdi-home-minus:before{content:"\F973"}

.mdi-home-modern:before{content:"\F2DD"}

.mdi-home-outline:before{content:"\F6A0"}

.mdi-home-plus:before{content:"\F974"}

.mdi-home-variant:before{content:"\F2DE"}

.mdi-hook:before{content:"\F6E1"}

.mdi-hook-off:before{content:"\F6E2"}

.mdi-hops:before{content:"\F2DF"}

.mdi-hospital:before{content:"\F2E0"}

.mdi-hospital-building:before{content:"\F2E1"}

.mdi-hospital-marker:before{content:"\F2E2"}

.mdi-hot-tub:before{content:"\F827"}

.mdi-hotel:before{content:"\F2E3"}

.mdi-houzz:before{content:"\F2E4"}

.mdi-houzz-box:before{content:"\F2E5"}

.mdi-hulu:before{content:"\F828"}

.mdi-human:before{content:"\F2E6"}

.mdi-human-child:before{content:"\F2E7"}

.mdi-human-female:before{content:"\F649"}

.mdi-human-greeting:before{content:"\F64A"}

.mdi-human-handsdown:before{content:"\F64B"}

.mdi-human-handsup:before{content:"\F64C"}

.mdi-human-male:before{content:"\F64D"}

.mdi-human-male-female:before{content:"\F2E8"}

.mdi-human-pregnant:before{content:"\F5CF"}

.mdi-humble-bundle:before{content:"\F743"}

.mdi-ice-cream:before{content:"\F829"}

.mdi-image:before{content:"\F2E9"}

.mdi-image-album:before{content:"\F2EA"}

.mdi-image-area:before{content:"\F2EB"}

.mdi-image-area-close:before{content:"\F2EC"}

.mdi-image-broken:before{content:"\F2ED"}

.mdi-image-broken-variant:before{content:"\F2EE"}

.mdi-image-filter:before{content:"\F2EF"}

.mdi-image-filter-black-white:before{content:"\F2F0"}

.mdi-image-filter-center-focus:before{content:"\F2F1"}

.mdi-image-filter-center-focus-weak:before{content:"\F2F2"}

.mdi-image-filter-drama:before{content:"\F2F3"}

.mdi-image-filter-frames:before{content:"\F2F4"}

.mdi-image-filter-hdr:before{content:"\F2F5"}

.mdi-image-filter-none:before{content:"\F2F6"}

.mdi-image-filter-tilt-shift:before{content:"\F2F7"}

.mdi-image-filter-vintage:before{content:"\F2F8"}

.mdi-image-multiple:before{content:"\F2F9"}

.mdi-image-off:before{content:"\F82A"}

.mdi-image-outline:before{content:"\F975"}

.mdi-image-plus:before{content:"\F87B"}

.mdi-image-search:before{content:"\F976"}

.mdi-image-search-outline:before{content:"\F977"}

.mdi-import:before{content:"\F2FA"}

.mdi-inbox:before{content:"\F686"}

.mdi-inbox-arrow-down:before{content:"\F2FB"}

.mdi-inbox-arrow-up:before{content:"\F3D1"}

.mdi-inbox-multiple:before{content:"\F8AF"}

.mdi-incognito:before{content:"\F5F9"}

.mdi-infinity:before{content:"\F6E3"}

.mdi-information:before{content:"\F2FC"}

.mdi-information-outline:before{content:"\F2FD"}

.mdi-information-variant:before{content:"\F64E"}

.mdi-instagram:before{content:"\F2FE"}

.mdi-instapaper:before{content:"\F2FF"}

.mdi-internet-explorer:before{content:"\F300"}

.mdi-invert-colors:before{content:"\F301"}

.mdi-islam:before{content:"\F978"}

.mdi-itunes:before{content:"\F676"}

.mdi-jeepney:before{content:"\F302"}

.mdi-jira:before{content:"\F303"}

.mdi-jquery:before{content:"\F87C"}

.mdi-jsfiddle:before{content:"\F304"}

.mdi-json:before{content:"\F626"}

.mdi-judaism:before{content:"\F979"}

.mdi-karate:before{content:"\F82B"}

.mdi-keg:before{content:"\F305"}

.mdi-kettle:before{content:"\F5FA"}

.mdi-key:before{content:"\F306"}

.mdi-key-change:before{content:"\F307"}

.mdi-key-minus:before{content:"\F308"}

.mdi-key-plus:before{content:"\F309"}

.mdi-key-remove:before{content:"\F30A"}

.mdi-key-variant:before{content:"\F30B"}

.mdi-keyboard:before{content:"\F30C"}

.mdi-keyboard-backspace:before{content:"\F30D"}

.mdi-keyboard-caps:before{content:"\F30E"}

.mdi-keyboard-close:before{content:"\F30F"}

.mdi-keyboard-off:before{content:"\F310"}

.mdi-keyboard-outline:before{content:"\F97A"}

.mdi-keyboard-return:before{content:"\F311"}

.mdi-keyboard-tab:before{content:"\F312"}

.mdi-keyboard-variant:before{content:"\F313"}

.mdi-kickstarter:before{content:"\F744"}

.mdi-kodi:before{content:"\F314"}

.mdi-label:before{content:"\F315"}

.mdi-label-outline:before{content:"\F316"}

.mdi-ladybug:before{content:"\F82C"}

.mdi-lambda:before{content:"\F627"}

.mdi-lamp:before{content:"\F6B4"}

.mdi-lan:before{content:"\F317"}

.mdi-lan-connect:before{content:"\F318"}

.mdi-lan-disconnect:before{content:"\F319"}

.mdi-lan-pending:before{content:"\F31A"}

.mdi-language-c:before{content:"\F671"}

.mdi-language-cpp:before{content:"\F672"}

.mdi-language-csharp:before{content:"\F31B"}

.mdi-language-css3:before{content:"\F31C"}

.mdi-language-go:before{content:"\F7D2"}

.mdi-language-html5:before{content:"\F31D"}

.mdi-language-javascript:before{content:"\F31E"}

.mdi-language-lua:before{content:"\F8B0"}

.mdi-language-php:before{content:"\F31F"}

.mdi-language-python:before{content:"\F320"}

.mdi-language-python-text:before{content:"\F321"}

.mdi-language-r:before{content:"\F7D3"}

.mdi-language-swift:before{content:"\F6E4"}

.mdi-language-typescript:before{content:"\F6E5"}

.mdi-laptop:before{content:"\F322"}

.mdi-laptop-chromebook:before{content:"\F323"}

.mdi-laptop-mac:before{content:"\F324"}

.mdi-laptop-off:before{content:"\F6E6"}

.mdi-laptop-windows:before{content:"\F325"}

.mdi-lastfm:before{content:"\F326"}

.mdi-lastpass:before{content:"\F446"}

.mdi-launch:before{content:"\F327"}

.mdi-lava-lamp:before{content:"\F7D4"}

.mdi-layers:before{content:"\F328"}

.mdi-layers-off:before{content:"\F329"}

.mdi-lead-pencil:before{content:"\F64F"}

.mdi-leaf:before{content:"\F32A"}

.mdi-led-off:before{content:"\F32B"}

.mdi-led-on:before{content:"\F32C"}

.mdi-led-outline:before{content:"\F32D"}

.mdi-led-strip:before{content:"\F7D5"}

.mdi-led-variant-off:before{content:"\F32E"}

.mdi-led-variant-on:before{content:"\F32F"}

.mdi-led-variant-outline:before{content:"\F330"}

.mdi-less-than:before{content:"\F97B"}

.mdi-less-than-or-equal:before{content:"\F97C"}

.mdi-library:before{content:"\F331"}

.mdi-library-books:before{content:"\F332"}

.mdi-library-music:before{content:"\F333"}

.mdi-library-plus:before{content:"\F334"}

.mdi-lifebuoy:before{content:"\F87D"}

.mdi-light-switch:before{content:"\F97D"}

.mdi-lightbulb:before{content:"\F335"}

.mdi-lightbulb-on:before{content:"\F6E7"}

.mdi-lightbulb-on-outline:before{content:"\F6E8"}

.mdi-lightbulb-outline:before{content:"\F336"}

.mdi-link:before{content:"\F337"}

.mdi-link-off:before{content:"\F338"}

.mdi-link-variant:before{content:"\F339"}

.mdi-link-variant-off:before{content:"\F33A"}

.mdi-linkedin:before{content:"\F33B"}

.mdi-linkedin-box:before{content:"\F33C"}

.mdi-linux:before{content:"\F33D"}

.mdi-linux-mint:before{content:"\F8EC"}

.mdi-loading:before{content:"\F771"}

.mdi-lock:before{content:"\F33E"}

.mdi-lock-alert:before{content:"\F8ED"}

.mdi-lock-clock:before{content:"\F97E"}

.mdi-lock-open:before{content:"\F33F"}

.mdi-lock-open-outline:before{content:"\F340"}

.mdi-lock-outline:before{content:"\F341"}

.mdi-lock-pattern:before{content:"\F6E9"}

.mdi-lock-plus:before{content:"\F5FB"}

.mdi-lock-question:before{content:"\F8EE"}

.mdi-lock-reset:before{content:"\F772"}

.mdi-lock-smart:before{content:"\F8B1"}

.mdi-locker:before{content:"\F7D6"}

.mdi-locker-multiple:before{content:"\F7D7"}

.mdi-login:before{content:"\F342"}

.mdi-login-variant:before{content:"\F5FC"}

.mdi-logout:before{content:"\F343"}

.mdi-logout-variant:before{content:"\F5FD"}

.mdi-looks:before{content:"\F344"}

.mdi-loop:before{content:"\F6EA"}

.mdi-loupe:before{content:"\F345"}

.mdi-lumx:before{content:"\F346"}

.mdi-magnet:before{content:"\F347"}

.mdi-magnet-on:before{content:"\F348"}

.mdi-magnify:before{content:"\F349"}

.mdi-magnify-close:before{content:"\F97F"}

.mdi-magnify-minus:before{content:"\F34A"}

.mdi-magnify-minus-outline:before{content:"\F6EB"}

.mdi-magnify-plus:before{content:"\F34B"}

.mdi-magnify-plus-outline:before{content:"\F6EC"}

.mdi-mail-ru:before{content:"\F34C"}

.mdi-mailbox:before{content:"\F6ED"}

.mdi-map:before{content:"\F34D"}

.mdi-map-marker:before{content:"\F34E"}

.mdi-map-marker-circle:before{content:"\F34F"}

.mdi-map-marker-distance:before{content:"\F8EF"}

.mdi-map-marker-minus:before{content:"\F650"}

.mdi-map-marker-multiple:before{content:"\F350"}

.mdi-map-marker-off:before{content:"\F351"}

.mdi-map-marker-outline:before{content:"\F7D8"}

.mdi-map-marker-plus:before{content:"\F651"}

.mdi-map-marker-radius:before{content:"\F352"}

.mdi-map-minus:before{content:"\F980"}

.mdi-map-outline:before{content:"\F981"}

.mdi-map-plus:before{content:"\F982"}

.mdi-map-search:before{content:"\F983"}

.mdi-map-search-outline:before{content:"\F984"}

.mdi-margin:before{content:"\F353"}

.mdi-markdown:before{content:"\F354"}

.mdi-marker:before{content:"\F652"}

.mdi-marker-check:before{content:"\F355"}

.mdi-material-design:before{content:"\F985"}

.mdi-material-ui:before{content:"\F357"}

.mdi-math-compass:before{content:"\F358"}

.mdi-matrix:before{content:"\F628"}

.mdi-maxcdn:before{content:"\F359"}

.mdi-medal:before{content:"\F986"}

.mdi-medical-bag:before{content:"\F6EE"}

.mdi-medium:before{content:"\F35A"}

.mdi-memory:before{content:"\F35B"}

.mdi-menu:before{content:"\F35C"}

.mdi-menu-down:before{content:"\F35D"}

.mdi-menu-down-outline:before{content:"\F6B5"}

.mdi-menu-left:before{content:"\F35E"}

.mdi-menu-right:before{content:"\F35F"}

.mdi-menu-up:before{content:"\F360"}

.mdi-menu-up-outline:before{content:"\F6B6"}

.mdi-message:before{content:"\F361"}

.mdi-message-alert:before{content:"\F362"}

.mdi-message-bulleted:before{content:"\F6A1"}

.mdi-message-bulleted-off:before{content:"\F6A2"}

.mdi-message-draw:before{content:"\F363"}

.mdi-message-image:before{content:"\F364"}

.mdi-message-outline:before{content:"\F365"}

.mdi-message-plus:before{content:"\F653"}

.mdi-message-processing:before{content:"\F366"}

.mdi-message-reply:before{content:"\F367"}

.mdi-message-reply-text:before{content:"\F368"}

.mdi-message-settings:before{content:"\F6EF"}

.mdi-message-settings-variant:before{content:"\F6F0"}

.mdi-message-text:before{content:"\F369"}

.mdi-message-text-outline:before{content:"\F36A"}

.mdi-message-video:before{content:"\F36B"}

.mdi-meteor:before{content:"\F629"}

.mdi-metronome:before{content:"\F7D9"}

.mdi-metronome-tick:before{content:"\F7DA"}

.mdi-micro-sd:before{content:"\F7DB"}

.mdi-microphone:before{content:"\F36C"}

.mdi-microphone-minus:before{content:"\F8B2"}

.mdi-microphone-off:before{content:"\F36D"}

.mdi-microphone-outline:before{content:"\F36E"}

.mdi-microphone-plus:before{content:"\F8B3"}

.mdi-microphone-settings:before{content:"\F36F"}

.mdi-microphone-variant:before{content:"\F370"}

.mdi-microphone-variant-off:before{content:"\F371"}

.mdi-microscope:before{content:"\F654"}

.mdi-microsoft:before{content:"\F372"}

.mdi-microsoft-dynamics:before{content:"\F987"}

.mdi-midi:before{content:"\F8F0"}

.mdi-midi-port:before{content:"\F8F1"}

.mdi-minecraft:before{content:"\F373"}

.mdi-minus:before{content:"\F374"}

.mdi-minus-box:before{content:"\F375"}

.mdi-minus-box-outline:before{content:"\F6F1"}

.mdi-minus-circle:before{content:"\F376"}

.mdi-minus-circle-outline:before{content:"\F377"}

.mdi-minus-network:before{content:"\F378"}

.mdi-mixcloud:before{content:"\F62A"}

.mdi-mixed-reality:before{content:"\F87E"}

.mdi-mixer:before{content:"\F7DC"}

.mdi-monitor:before{content:"\F379"}

.mdi-monitor-cellphone:before{content:"\F988"}

.mdi-monitor-cellphone-star:before{content:"\F989"}

.mdi-monitor-multiple:before{content:"\F37A"}

.mdi-more:before{content:"\F37B"}

.mdi-motorbike:before{content:"\F37C"}

.mdi-mouse:before{content:"\F37D"}

.mdi-mouse-bluetooth:before{content:"\F98A"}

.mdi-mouse-off:before{content:"\F37E"}

.mdi-mouse-variant:before{content:"\F37F"}

.mdi-mouse-variant-off:before{content:"\F380"}

.mdi-move-resize:before{content:"\F655"}

.mdi-move-resize-variant:before{content:"\F656"}

.mdi-movie:before{content:"\F381"}

.mdi-movie-roll:before{content:"\F7DD"}

.mdi-muffin:before{content:"\F98B"}

.mdi-multiplication:before{content:"\F382"}

.mdi-multiplication-box:before{content:"\F383"}

.mdi-mushroom:before{content:"\F7DE"}

.mdi-mushroom-outline:before{content:"\F7DF"}

.mdi-music:before{content:"\F759"}

.mdi-music-box:before{content:"\F384"}

.mdi-music-box-outline:before{content:"\F385"}

.mdi-music-circle:before{content:"\F386"}

.mdi-music-note:before{content:"\F387"}

.mdi-music-note-bluetooth:before{content:"\F5FE"}

.mdi-music-note-bluetooth-off:before{content:"\F5FF"}

.mdi-music-note-eighth:before{content:"\F388"}

.mdi-music-note-half:before{content:"\F389"}

.mdi-music-note-off:before{content:"\F38A"}

.mdi-music-note-quarter:before{content:"\F38B"}

.mdi-music-note-sixteenth:before{content:"\F38C"}

.mdi-music-note-whole:before{content:"\F38D"}

.mdi-music-off:before{content:"\F75A"}

.mdi-nas:before{content:"\F8F2"}

.mdi-nativescript:before{content:"\F87F"}

.mdi-nature:before{content:"\F38E"}

.mdi-nature-people:before{content:"\F38F"}

.mdi-navigation:before{content:"\F390"}

.mdi-near-me:before{content:"\F5CD"}

.mdi-needle:before{content:"\F391"}

.mdi-netflix:before{content:"\F745"}

.mdi-network:before{content:"\F6F2"}

.mdi-network-strength-1:before{content:"\F8F3"}

.mdi-network-strength-1-alert:before{content:"\F8F4"}

.mdi-network-strength-2:before{content:"\F8F5"}

.mdi-network-strength-2-alert:before{content:"\F8F6"}

.mdi-network-strength-3:before{content:"\F8F7"}

.mdi-network-strength-3-alert:before{content:"\F8F8"}

.mdi-network-strength-4:before{content:"\F8F9"}

.mdi-network-strength-4-alert:before{content:"\F8FA"}

.mdi-network-strength-off:before{content:"\F8FB"}

.mdi-network-strength-off-outline:before{content:"\F8FC"}

.mdi-network-strength-outline:before{content:"\F8FD"}

.mdi-new-box:before{content:"\F394"}

.mdi-newspaper:before{content:"\F395"}

.mdi-nfc:before{content:"\F396"}

.mdi-nfc-tap:before{content:"\F397"}

.mdi-nfc-variant:before{content:"\F398"}

.mdi-ninja:before{content:"\F773"}

.mdi-nintendo-switch:before{content:"\F7E0"}

.mdi-nodejs:before{content:"\F399"}

.mdi-not-equal:before{content:"\F98C"}

.mdi-not-equal-variant:before{content:"\F98D"}

.mdi-note:before{content:"\F39A"}

.mdi-note-multiple:before{content:"\F6B7"}

.mdi-note-multiple-outline:before{content:"\F6B8"}

.mdi-note-outline:before{content:"\F39B"}

.mdi-note-plus:before{content:"\F39C"}

.mdi-note-plus-outline:before{content:"\F39D"}

.mdi-note-text:before{content:"\F39E"}

.mdi-notebook:before{content:"\F82D"}

.mdi-notification-clear-all:before{content:"\F39F"}

.mdi-npm:before{content:"\F6F6"}

.mdi-npm-variant:before{content:"\F98E"}

.mdi-npm-variant-outline:before{content:"\F98F"}

.mdi-nuke:before{content:"\F6A3"}

.mdi-null:before{content:"\F7E1"}

.mdi-numeric:before{content:"\F3A0"}

.mdi-numeric-0-box:before{content:"\F3A1"}

.mdi-numeric-0-box-multiple-outline:before{content:"\F3A2"}

.mdi-numeric-0-box-outline:before{content:"\F3A3"}

.mdi-numeric-1-box:before{content:"\F3A4"}

.mdi-numeric-1-box-multiple-outline:before{content:"\F3A5"}

.mdi-numeric-1-box-outline:before{content:"\F3A6"}

.mdi-numeric-2-box:before{content:"\F3A7"}

.mdi-numeric-2-box-multiple-outline:before{content:"\F3A8"}

.mdi-numeric-2-box-outline:before{content:"\F3A9"}

.mdi-numeric-3-box:before{content:"\F3AA"}

.mdi-numeric-3-box-multiple-outline:before{content:"\F3AB"}

.mdi-numeric-3-box-outline:before{content:"\F3AC"}

.mdi-numeric-4-box:before{content:"\F3AD"}

.mdi-numeric-4-box-multiple-outline:before{content:"\F3AE"}

.mdi-numeric-4-box-outline:before{content:"\F3AF"}

.mdi-numeric-5-box:before{content:"\F3B0"}

.mdi-numeric-5-box-multiple-outline:before{content:"\F3B1"}

.mdi-numeric-5-box-outline:before{content:"\F3B2"}

.mdi-numeric-6-box:before{content:"\F3B3"}

.mdi-numeric-6-box-multiple-outline:before{content:"\F3B4"}

.mdi-numeric-6-box-outline:before{content:"\F3B5"}

.mdi-numeric-7-box:before{content:"\F3B6"}

.mdi-numeric-7-box-multiple-outline:before{content:"\F3B7"}

.mdi-numeric-7-box-outline:before{content:"\F3B8"}

.mdi-numeric-8-box:before{content:"\F3B9"}

.mdi-numeric-8-box-multiple-outline:before{content:"\F3BA"}

.mdi-numeric-8-box-outline:before{content:"\F3BB"}

.mdi-numeric-9-box:before{content:"\F3BC"}

.mdi-numeric-9-box-multiple-outline:before{content:"\F3BD"}

.mdi-numeric-9-box-outline:before{content:"\F3BE"}

.mdi-numeric-9-plus-box:before{content:"\F3BF"}

.mdi-numeric-9-plus-box-multiple-outline:before{content:"\F3C0"}

.mdi-numeric-9-plus-box-outline:before{content:"\F3C1"}

.mdi-nut:before{content:"\F6F7"}

.mdi-nutrition:before{content:"\F3C2"}

.mdi-oar:before{content:"\F67B"}

.mdi-octagon:before{content:"\F3C3"}

.mdi-octagon-outline:before{content:"\F3C4"}

.mdi-octagram:before{content:"\F6F8"}

.mdi-octagram-outline:before{content:"\F774"}

.mdi-odnoklassniki:before{content:"\F3C5"}

.mdi-office:before{content:"\F3C6"}

.mdi-office-building:before{content:"\F990"}

.mdi-oil:before{content:"\F3C7"}

.mdi-oil-temperature:before{content:"\F3C8"}

.mdi-omega:before{content:"\F3C9"}

.mdi-onedrive:before{content:"\F3CA"}

.mdi-onenote:before{content:"\F746"}

.mdi-onepassword:before{content:"\F880"}

.mdi-opacity:before{content:"\F5CC"}

.mdi-open-in-app:before{content:"\F3CB"}

.mdi-open-in-new:before{content:"\F3CC"}

.mdi-openid:before{content:"\F3CD"}

.mdi-opera:before{content:"\F3CE"}

.mdi-orbit:before{content:"\F018"}

.mdi-ornament:before{content:"\F3CF"}

.mdi-ornament-variant:before{content:"\F3D0"}

.mdi-owl:before{content:"\F3D2"}

.mdi-package:before{content:"\F3D3"}

.mdi-package-down:before{content:"\F3D4"}

.mdi-package-up:before{content:"\F3D5"}

.mdi-package-variant:before{content:"\F3D6"}

.mdi-package-variant-closed:before{content:"\F3D7"}

.mdi-page-first:before{content:"\F600"}

.mdi-page-last:before{content:"\F601"}

.mdi-page-layout-body:before{content:"\F6F9"}

.mdi-page-layout-footer:before{content:"\F6FA"}

.mdi-page-layout-header:before{content:"\F6FB"}

.mdi-page-layout-sidebar-left:before{content:"\F6FC"}

.mdi-page-layout-sidebar-right:before{content:"\F6FD"}

.mdi-palette:before{content:"\F3D8"}

.mdi-palette-advanced:before{content:"\F3D9"}

.mdi-palette-swatch:before{content:"\F8B4"}

.mdi-panda:before{content:"\F3DA"}

.mdi-pandora:before{content:"\F3DB"}

.mdi-panorama:before{content:"\F3DC"}

.mdi-panorama-fisheye:before{content:"\F3DD"}

.mdi-panorama-horizontal:before{content:"\F3DE"}

.mdi-panorama-vertical:before{content:"\F3DF"}

.mdi-panorama-wide-angle:before{content:"\F3E0"}

.mdi-paper-cut-vertical:before{content:"\F3E1"}

.mdi-paperclip:before{content:"\F3E2"}

.mdi-parking:before{content:"\F3E3"}

.mdi-passport:before{content:"\F7E2"}

.mdi-patreon:before{content:"\F881"}

.mdi-pause:before{content:"\F3E4"}

.mdi-pause-circle:before{content:"\F3E5"}

.mdi-pause-circle-outline:before{content:"\F3E6"}

.mdi-pause-octagon:before{content:"\F3E7"}

.mdi-pause-octagon-outline:before{content:"\F3E8"}

.mdi-paw:before{content:"\F3E9"}

.mdi-paw-off:before{content:"\F657"}

.mdi-paypal:before{content:"\F882"}

.mdi-peace:before{content:"\F883"}

.mdi-pen:before{content:"\F3EA"}

.mdi-pencil:before{content:"\F3EB"}

.mdi-pencil-box:before{content:"\F3EC"}

.mdi-pencil-box-outline:before{content:"\F3ED"}

.mdi-pencil-circle:before{content:"\F6FE"}

.mdi-pencil-circle-outline:before{content:"\F775"}

.mdi-pencil-lock:before{content:"\F3EE"}

.mdi-pencil-off:before{content:"\F3EF"}

.mdi-pentagon:before{content:"\F6FF"}

.mdi-pentagon-outline:before{content:"\F700"}

.mdi-percent:before{content:"\F3F0"}

.mdi-periodic-table:before{content:"\F8B5"}

.mdi-periodic-table-co2:before{content:"\F7E3"}

.mdi-periscope:before{content:"\F747"}

.mdi-pharmacy:before{content:"\F3F1"}

.mdi-phone:before{content:"\F3F2"}

.mdi-phone-bluetooth:before{content:"\F3F3"}

.mdi-phone-classic:before{content:"\F602"}

.mdi-phone-forward:before{content:"\F3F4"}

.mdi-phone-hangup:before{content:"\F3F5"}

.mdi-phone-in-talk:before{content:"\F3F6"}

.mdi-phone-incoming:before{content:"\F3F7"}

.mdi-phone-locked:before{content:"\F3F8"}

.mdi-phone-log:before{content:"\F3F9"}

.mdi-phone-minus:before{content:"\F658"}

.mdi-phone-missed:before{content:"\F3FA"}

.mdi-phone-outgoing:before{content:"\F3FB"}

.mdi-phone-paused:before{content:"\F3FC"}

.mdi-phone-plus:before{content:"\F659"}

.mdi-phone-return:before{content:"\F82E"}

.mdi-phone-rotate-landscape:before{content:"\F884"}

.mdi-phone-rotate-portrait:before{content:"\F885"}

.mdi-phone-settings:before{content:"\F3FD"}

.mdi-phone-voip:before{content:"\F3FE"}

.mdi-pi:before{content:"\F3FF"}

.mdi-pi-box:before{content:"\F400"}

.mdi-piano:before{content:"\F67C"}

.mdi-pickaxe:before{content:"\F8B6"}

.mdi-pier:before{content:"\F886"}

.mdi-pier-crane:before{content:"\F887"}

.mdi-pig:before{content:"\F401"}

.mdi-pill:before{content:"\F402"}

.mdi-pillar:before{content:"\F701"}

.mdi-pin:before{content:"\F403"}

.mdi-pin-off:before{content:"\F404"}

.mdi-pin-off-outline:before{content:"\F92F"}

.mdi-pin-outline:before{content:"\F930"}

.mdi-pine-tree:before{content:"\F405"}

.mdi-pine-tree-box:before{content:"\F406"}

.mdi-pinterest:before{content:"\F407"}

.mdi-pinterest-box:before{content:"\F408"}

.mdi-pipe:before{content:"\F7E4"}

.mdi-pipe-disconnected:before{content:"\F7E5"}

.mdi-pipe-leak:before{content:"\F888"}

.mdi-pistol:before{content:"\F702"}

.mdi-piston:before{content:"\F889"}

.mdi-pizza:before{content:"\F409"}

.mdi-plane-shield:before{content:"\F6BA"}

.mdi-play:before{content:"\F40A"}

.mdi-play-box-outline:before{content:"\F40B"}

.mdi-play-circle:before{content:"\F40C"}

.mdi-play-circle-outline:before{content:"\F40D"}

.mdi-play-network:before{content:"\F88A"}

.mdi-play-pause:before{content:"\F40E"}

.mdi-play-protected-content:before{content:"\F40F"}

.mdi-play-speed:before{content:"\F8FE"}

.mdi-playlist-check:before{content:"\F5C7"}

.mdi-playlist-edit:before{content:"\F8FF"}

.mdi-playlist-minus:before{content:"\F410"}

.mdi-playlist-play:before{content:"\F411"}

.mdi-playlist-plus:before{content:"\F412"}

.mdi-playlist-remove:before{content:"\F413"}

.mdi-playstation:before{content:"\F414"}

.mdi-plex:before{content:"\F6B9"}

.mdi-plus:before{content:"\F415"}

.mdi-plus-box:before{content:"\F416"}

.mdi-plus-box-outline:before{content:"\F703"}

.mdi-plus-circle:before{content:"\F417"}

.mdi-plus-circle-multiple-outline:before{content:"\F418"}

.mdi-plus-circle-outline:before{content:"\F419"}

.mdi-plus-minus:before{content:"\F991"}

.mdi-plus-minus-box:before{content:"\F992"}

.mdi-plus-network:before{content:"\F41A"}

.mdi-plus-one:before{content:"\F41B"}

.mdi-plus-outline:before{content:"\F704"}

.mdi-pocket:before{content:"\F41C"}

.mdi-podcast:before{content:"\F993"}

.mdi-pokeball:before{content:"\F41D"}

.mdi-poker-chip:before{content:"\F82F"}

.mdi-polaroid:before{content:"\F41E"}

.mdi-poll:before{content:"\F41F"}

.mdi-poll-box:before{content:"\F420"}

.mdi-polymer:before{content:"\F421"}

.mdi-pool:before{content:"\F606"}

.mdi-popcorn:before{content:"\F422"}

.mdi-pot:before{content:"\F65A"}

.mdi-pot-mix:before{content:"\F65B"}

.mdi-pound:before{content:"\F423"}

.mdi-pound-box:before{content:"\F424"}

.mdi-power:before{content:"\F425"}

.mdi-power-cycle:before{content:"\F900"}

.mdi-power-off:before{content:"\F901"}

.mdi-power-on:before{content:"\F902"}

.mdi-power-plug:before{content:"\F6A4"}

.mdi-power-plug-off:before{content:"\F6A5"}

.mdi-power-settings:before{content:"\F426"}

.mdi-power-sleep:before{content:"\F903"}

.mdi-power-socket:before{content:"\F427"}

.mdi-power-socket-au:before{content:"\F904"}

.mdi-power-socket-eu:before{content:"\F7E6"}

.mdi-power-socket-uk:before{content:"\F7E7"}

.mdi-power-socket-us:before{content:"\F7E8"}

.mdi-power-standby:before{content:"\F905"}

.mdi-prescription:before{content:"\F705"}

.mdi-presentation:before{content:"\F428"}

.mdi-presentation-play:before{content:"\F429"}

.mdi-printer:before{content:"\F42A"}

.mdi-printer-3d:before{content:"\F42B"}

.mdi-printer-alert:before{content:"\F42C"}

.mdi-printer-settings:before{content:"\F706"}

.mdi-priority-high:before{content:"\F603"}

.mdi-priority-low:before{content:"\F604"}

.mdi-professional-hexagon:before{content:"\F42D"}

.mdi-progress-check:before{content:"\F994"}

.mdi-progress-clock:before{content:"\F995"}

.mdi-progress-download:before{content:"\F996"}

.mdi-progress-upload:before{content:"\F997"}

.mdi-projector:before{content:"\F42E"}

.mdi-projector-screen:before{content:"\F42F"}

.mdi-publish:before{content:"\F6A6"}

.mdi-pulse:before{content:"\F430"}

.mdi-puzzle:before{content:"\F431"}

.mdi-qi:before{content:"\F998"}

.mdi-qqchat:before{content:"\F605"}

.mdi-qrcode:before{content:"\F432"}

.mdi-qrcode-edit:before{content:"\F8B7"}

.mdi-qrcode-scan:before{content:"\F433"}

.mdi-quadcopter:before{content:"\F434"}

.mdi-quality-high:before{content:"\F435"}

.mdi-quicktime:before{content:"\F436"}

.mdi-rabbit:before{content:"\F906"}

.mdi-radar:before{content:"\F437"}

.mdi-radiator:before{content:"\F438"}

.mdi-radio:before{content:"\F439"}

.mdi-radio-handheld:before{content:"\F43A"}

.mdi-radio-tower:before{content:"\F43B"}

.mdi-radioactive:before{content:"\F43C"}

.mdi-radiobox-blank:before{content:"\F43D"}

.mdi-radiobox-marked:before{content:"\F43E"}

.mdi-raspberrypi:before{content:"\F43F"}

.mdi-ray-end:before{content:"\F440"}

.mdi-ray-end-arrow:before{content:"\F441"}

.mdi-ray-start:before{content:"\F442"}

.mdi-ray-start-arrow:before{content:"\F443"}

.mdi-ray-start-end:before{content:"\F444"}

.mdi-ray-vertex:before{content:"\F445"}

.mdi-react:before{content:"\F707"}

.mdi-read:before{content:"\F447"}

.mdi-receipt:before{content:"\F449"}

.mdi-record:before{content:"\F44A"}

.mdi-record-player:before{content:"\F999"}

.mdi-record-rec:before{content:"\F44B"}

.mdi-recycle:before{content:"\F44C"}

.mdi-reddit:before{content:"\F44D"}

.mdi-redo:before{content:"\F44E"}

.mdi-redo-variant:before{content:"\F44F"}

.mdi-refresh:before{content:"\F450"}

.mdi-regex:before{content:"\F451"}

.mdi-relative-scale:before{content:"\F452"}

.mdi-reload:before{content:"\F453"}

.mdi-reminder:before{content:"\F88B"}

.mdi-remote:before{content:"\F454"}

.mdi-remote-desktop:before{content:"\F8B8"}

.mdi-rename-box:before{content:"\F455"}

.mdi-reorder-horizontal:before{content:"\F687"}

.mdi-reorder-vertical:before{content:"\F688"}

.mdi-repeat:before{content:"\F456"}

.mdi-repeat-off:before{content:"\F457"}

.mdi-repeat-once:before{content:"\F458"}

.mdi-replay:before{content:"\F459"}

.mdi-reply:before{content:"\F45A"}

.mdi-reply-all:before{content:"\F45B"}

.mdi-reproduction:before{content:"\F45C"}

.mdi-resize-bottom-right:before{content:"\F45D"}

.mdi-responsive:before{content:"\F45E"}

.mdi-restart:before{content:"\F708"}

.mdi-restore:before{content:"\F99A"}

.mdi-restore-clock:before{content:"\F6A7"}

.mdi-rewind:before{content:"\F45F"}

.mdi-rewind-outline:before{content:"\F709"}

.mdi-rhombus:before{content:"\F70A"}

.mdi-rhombus-outline:before{content:"\F70B"}

.mdi-ribbon:before{content:"\F460"}

.mdi-rice:before{content:"\F7E9"}

.mdi-ring:before{content:"\F7EA"}

.mdi-road:before{content:"\F461"}

.mdi-road-variant:before{content:"\F462"}

.mdi-robot:before{content:"\F6A8"}

.mdi-robot-vacuum:before{content:"\F70C"}

.mdi-robot-vacuum-variant:before{content:"\F907"}

.mdi-rocket:before{content:"\F463"}

.mdi-room-service:before{content:"\F88C"}

.mdi-rotate-3d:before{content:"\F464"}

.mdi-rotate-left:before{content:"\F465"}

.mdi-rotate-left-variant:before{content:"\F466"}

.mdi-rotate-right:before{content:"\F467"}

.mdi-rotate-right-variant:before{content:"\F468"}

.mdi-rounded-corner:before{content:"\F607"}

.mdi-router-wireless:before{content:"\F469"}

.mdi-routes:before{content:"\F46A"}

.mdi-rowing:before{content:"\F608"}

.mdi-rss:before{content:"\F46B"}

.mdi-rss-box:before{content:"\F46C"}

.mdi-ruler:before{content:"\F46D"}

.mdi-run:before{content:"\F70D"}

.mdi-run-fast:before{content:"\F46E"}

.mdi-sale:before{content:"\F46F"}

.mdi-salesforce:before{content:"\F88D"}

.mdi-sass:before{content:"\F7EB"}

.mdi-satellite:before{content:"\F470"}

.mdi-satellite-uplink:before{content:"\F908"}

.mdi-satellite-variant:before{content:"\F471"}

.mdi-sausage:before{content:"\F8B9"}

.mdi-saxophone:before{content:"\F609"}

.mdi-scale:before{content:"\F472"}

.mdi-scale-balance:before{content:"\F5D1"}

.mdi-scale-bathroom:before{content:"\F473"}

.mdi-scanner:before{content:"\F6AA"}

.mdi-scanner-off:before{content:"\F909"}

.mdi-school:before{content:"\F474"}

.mdi-screen-rotation:before{content:"\F475"}

.mdi-screen-rotation-lock:before{content:"\F476"}

.mdi-screwdriver:before{content:"\F477"}

.mdi-script:before{content:"\F478"}

.mdi-sd:before{content:"\F479"}

.mdi-seal:before{content:"\F47A"}

.mdi-search-web:before{content:"\F70E"}

.mdi-seat-flat:before{content:"\F47B"}

.mdi-seat-flat-angled:before{content:"\F47C"}

.mdi-seat-individual-suite:before{content:"\F47D"}

.mdi-seat-legroom-extra:before{content:"\F47E"}

.mdi-seat-legroom-normal:before{content:"\F47F"}

.mdi-seat-legroom-reduced:before{content:"\F480"}

.mdi-seat-recline-extra:before{content:"\F481"}

.mdi-seat-recline-normal:before{content:"\F482"}

.mdi-security:before{content:"\F483"}

.mdi-security-account:before{content:"\F88E"}

.mdi-security-close:before{content:"\F99B"}

.mdi-security-home:before{content:"\F689"}

.mdi-security-lock:before{content:"\F99C"}

.mdi-security-network:before{content:"\F484"}

.mdi-security-off:before{content:"\F99D"}

.mdi-select:before{content:"\F485"}

.mdi-select-all:before{content:"\F486"}

.mdi-select-inverse:before{content:"\F487"}

.mdi-select-off:before{content:"\F488"}

.mdi-selection:before{content:"\F489"}

.mdi-selection-off:before{content:"\F776"}

.mdi-send:before{content:"\F48A"}

.mdi-send-secure:before{content:"\F7EC"}

.mdi-serial-port:before{content:"\F65C"}

.mdi-server:before{content:"\F48B"}

.mdi-server-minus:before{content:"\F48C"}

.mdi-server-network:before{content:"\F48D"}

.mdi-server-network-off:before{content:"\F48E"}

.mdi-server-off:before{content:"\F48F"}

.mdi-server-plus:before{content:"\F490"}

.mdi-server-remove:before{content:"\F491"}

.mdi-server-security:before{content:"\F492"}

.mdi-set-all:before{content:"\F777"}

.mdi-set-center:before{content:"\F778"}

.mdi-set-center-right:before{content:"\F779"}

.mdi-set-left:before{content:"\F77A"}

.mdi-set-left-center:before{content:"\F77B"}

.mdi-set-left-right:before{content:"\F77C"}

.mdi-set-none:before{content:"\F77D"}

.mdi-set-right:before{content:"\F77E"}

.mdi-set-top-box:before{content:"\F99E"}

.mdi-settings:before{content:"\F493"}

.mdi-settings-box:before{content:"\F494"}

.mdi-settings-outline:before{content:"\F8BA"}

.mdi-shape:before{content:"\F830"}

.mdi-shape-circle-plus:before{content:"\F65D"}

.mdi-shape-outline:before{content:"\F831"}

.mdi-shape-plus:before{content:"\F495"}

.mdi-shape-polygon-plus:before{content:"\F65E"}

.mdi-shape-rectangle-plus:before{content:"\F65F"}

.mdi-shape-square-plus:before{content:"\F660"}

.mdi-share:before{content:"\F496"}

.mdi-share-outline:before{content:"\F931"}

.mdi-share-variant:before{content:"\F497"}

.mdi-shield:before{content:"\F498"}

.mdi-shield-half-full:before{content:"\F77F"}

.mdi-shield-outline:before{content:"\F499"}

.mdi-ship-wheel:before{content:"\F832"}

.mdi-shopping:before{content:"\F49A"}

.mdi-shopping-music:before{content:"\F49B"}

.mdi-shovel:before{content:"\F70F"}

.mdi-shovel-off:before{content:"\F710"}

.mdi-shower:before{content:"\F99F"}

.mdi-shower-head:before{content:"\F9A0"}

.mdi-shredder:before{content:"\F49C"}

.mdi-shuffle:before{content:"\F49D"}

.mdi-shuffle-disabled:before{content:"\F49E"}

.mdi-shuffle-variant:before{content:"\F49F"}

.mdi-sigma:before{content:"\F4A0"}

.mdi-sigma-lower:before{content:"\F62B"}

.mdi-sign-caution:before{content:"\F4A1"}

.mdi-sign-direction:before{content:"\F780"}

.mdi-sign-text:before{content:"\F781"}

.mdi-signal:before{content:"\F4A2"}

.mdi-signal-2g:before{content:"\F711"}

.mdi-signal-3g:before{content:"\F712"}

.mdi-signal-4g:before{content:"\F713"}

.mdi-signal-cellular-1:before{content:"\F8BB"}

.mdi-signal-cellular-2:before{content:"\F8BC"}

.mdi-signal-cellular-3:before{content:"\F8BD"}

.mdi-signal-cellular-outline:before{content:"\F8BE"}

.mdi-signal-hspa:before{content:"\F714"}

.mdi-signal-hspa-plus:before{content:"\F715"}

.mdi-signal-off:before{content:"\F782"}

.mdi-signal-variant:before{content:"\F60A"}

.mdi-silverware:before{content:"\F4A3"}

.mdi-silverware-fork:before{content:"\F4A4"}

.mdi-silverware-spoon:before{content:"\F4A5"}

.mdi-silverware-variant:before{content:"\F4A6"}

.mdi-sim:before{content:"\F4A7"}

.mdi-sim-alert:before{content:"\F4A8"}

.mdi-sim-off:before{content:"\F4A9"}

.mdi-sitemap:before{content:"\F4AA"}

.mdi-skip-backward:before{content:"\F4AB"}

.mdi-skip-forward:before{content:"\F4AC"}

.mdi-skip-next:before{content:"\F4AD"}

.mdi-skip-next-circle:before{content:"\F661"}

.mdi-skip-next-circle-outline:before{content:"\F662"}

.mdi-skip-previous:before{content:"\F4AE"}

.mdi-skip-previous-circle:before{content:"\F663"}

.mdi-skip-previous-circle-outline:before{content:"\F664"}

.mdi-skull:before{content:"\F68B"}

.mdi-skype:before{content:"\F4AF"}

.mdi-skype-business:before{content:"\F4B0"}

.mdi-slack:before{content:"\F4B1"}

.mdi-slackware:before{content:"\F90A"}

.mdi-sleep:before{content:"\F4B2"}

.mdi-sleep-off:before{content:"\F4B3"}

.mdi-smoke-detector:before{content:"\F392"}

.mdi-smoking:before{content:"\F4B4"}

.mdi-smoking-off:before{content:"\F4B5"}

.mdi-snapchat:before{content:"\F4B6"}

.mdi-snowflake:before{content:"\F716"}

.mdi-snowman:before{content:"\F4B7"}

.mdi-soccer:before{content:"\F4B8"}

.mdi-soccer-field:before{content:"\F833"}

.mdi-sofa:before{content:"\F4B9"}

.mdi-solid:before{content:"\F68C"}

.mdi-sort:before{content:"\F4BA"}

.mdi-sort-alphabetical:before{content:"\F4BB"}

.mdi-sort-ascending:before{content:"\F4BC"}

.mdi-sort-descending:before{content:"\F4BD"}

.mdi-sort-numeric:before{content:"\F4BE"}

.mdi-sort-variant:before{content:"\F4BF"}

.mdi-soundcloud:before{content:"\F4C0"}

.mdi-source-branch:before{content:"\F62C"}

.mdi-source-commit:before{content:"\F717"}

.mdi-source-commit-end:before{content:"\F718"}

.mdi-source-commit-end-local:before{content:"\F719"}

.mdi-source-commit-local:before{content:"\F71A"}

.mdi-source-commit-next-local:before{content:"\F71B"}

.mdi-source-commit-start:before{content:"\F71C"}

.mdi-source-commit-start-next-local:before{content:"\F71D"}

.mdi-source-fork:before{content:"\F4C1"}

.mdi-source-merge:before{content:"\F62D"}

.mdi-source-pull:before{content:"\F4C2"}

.mdi-soy-sauce:before{content:"\F7ED"}

.mdi-speaker:before{content:"\F4C3"}

.mdi-speaker-bluetooth:before{content:"\F9A1"}

.mdi-speaker-off:before{content:"\F4C4"}

.mdi-speaker-wireless:before{content:"\F71E"}

.mdi-speedometer:before{content:"\F4C5"}

.mdi-spellcheck:before{content:"\F4C6"}

.mdi-spotify:before{content:"\F4C7"}

.mdi-spotlight:before{content:"\F4C8"}

.mdi-spotlight-beam:before{content:"\F4C9"}

.mdi-spray:before{content:"\F665"}

.mdi-square:before{content:"\F763"}

.mdi-square-edit-outline:before{content:"\F90B"}

.mdi-square-inc:before{content:"\F4CA"}

.mdi-square-inc-cash:before{content:"\F4CB"}

.mdi-square-outline:before{content:"\F762"}

.mdi-square-root:before{content:"\F783"}

.mdi-square-root-box:before{content:"\F9A2"}

.mdi-ssh:before{content:"\F8BF"}

.mdi-stack-exchange:before{content:"\F60B"}

.mdi-stack-overflow:before{content:"\F4CC"}

.mdi-stadium:before{content:"\F71F"}

.mdi-stairs:before{content:"\F4CD"}

.mdi-standard-definition:before{content:"\F7EE"}

.mdi-star:before{content:"\F4CE"}

.mdi-star-circle:before{content:"\F4CF"}

.mdi-star-circle-outline:before{content:"\F9A3"}

.mdi-star-face:before{content:"\F9A4"}

.mdi-star-half:before{content:"\F4D0"}

.mdi-star-off:before{content:"\F4D1"}

.mdi-star-outline:before{content:"\F4D2"}

.mdi-steam:before{content:"\F4D3"}

.mdi-steam-box:before{content:"\F90C"}

.mdi-steering:before{content:"\F4D4"}

.mdi-steering-off:before{content:"\F90D"}

.mdi-step-backward:before{content:"\F4D5"}

.mdi-step-backward-2:before{content:"\F4D6"}

.mdi-step-forward:before{content:"\F4D7"}

.mdi-step-forward-2:before{content:"\F4D8"}

.mdi-stethoscope:before{content:"\F4D9"}

.mdi-sticker:before{content:"\F5D0"}

.mdi-sticker-emoji:before{content:"\F784"}

.mdi-stocking:before{content:"\F4DA"}

.mdi-stop:before{content:"\F4DB"}

.mdi-stop-circle:before{content:"\F666"}

.mdi-stop-circle-outline:before{content:"\F667"}

.mdi-store:before{content:"\F4DC"}

.mdi-store-24-hour:before{content:"\F4DD"}

.mdi-stove:before{content:"\F4DE"}

.mdi-subdirectory-arrow-left:before{content:"\F60C"}

.mdi-subdirectory-arrow-right:before{content:"\F60D"}

.mdi-subway:before{content:"\F6AB"}

.mdi-subway-variant:before{content:"\F4DF"}

.mdi-summit:before{content:"\F785"}

.mdi-sunglasses:before{content:"\F4E0"}

.mdi-surround-sound:before{content:"\F5C5"}

.mdi-surround-sound-2-0:before{content:"\F7EF"}

.mdi-surround-sound-3-1:before{content:"\F7F0"}

.mdi-surround-sound-5-1:before{content:"\F7F1"}

.mdi-surround-sound-7-1:before{content:"\F7F2"}

.mdi-svg:before{content:"\F720"}

.mdi-swap-horizontal:before{content:"\F4E1"}

.mdi-swap-horizontal-variant:before{content:"\F8C0"}

.mdi-swap-vertical:before{content:"\F4E2"}

.mdi-swap-vertical-variant:before{content:"\F8C1"}

.mdi-swim:before{content:"\F4E3"}

.mdi-switch:before{content:"\F4E4"}

.mdi-sword:before{content:"\F4E5"}

.mdi-sword-cross:before{content:"\F786"}

.mdi-sync:before{content:"\F4E6"}

.mdi-sync-alert:before{content:"\F4E7"}

.mdi-sync-off:before{content:"\F4E8"}

.mdi-tab:before{content:"\F4E9"}

.mdi-tab-plus:before{content:"\F75B"}

.mdi-tab-unselected:before{content:"\F4EA"}

.mdi-table:before{content:"\F4EB"}

.mdi-table-column:before{content:"\F834"}

.mdi-table-column-plus-after:before{content:"\F4EC"}

.mdi-table-column-plus-before:before{content:"\F4ED"}

.mdi-table-column-remove:before{content:"\F4EE"}

.mdi-table-column-width:before{content:"\F4EF"}

.mdi-table-edit:before{content:"\F4F0"}

.mdi-table-large:before{content:"\F4F1"}

.mdi-table-merge-cells:before{content:"\F9A5"}

.mdi-table-of-contents:before{content:"\F835"}

.mdi-table-row:before{content:"\F836"}

.mdi-table-row-height:before{content:"\F4F2"}

.mdi-table-row-plus-after:before{content:"\F4F3"}

.mdi-table-row-plus-before:before{content:"\F4F4"}

.mdi-table-row-remove:before{content:"\F4F5"}

.mdi-table-search:before{content:"\F90E"}

.mdi-table-settings:before{content:"\F837"}

.mdi-tablet:before{content:"\F4F6"}

.mdi-tablet-android:before{content:"\F4F7"}

.mdi-tablet-cellphone:before{content:"\F9A6"}

.mdi-tablet-ipad:before{content:"\F4F8"}

.mdi-taco:before{content:"\F761"}

.mdi-tag:before{content:"\F4F9"}

.mdi-tag-faces:before{content:"\F4FA"}

.mdi-tag-heart:before{content:"\F68A"}

.mdi-tag-minus:before{content:"\F90F"}

.mdi-tag-multiple:before{content:"\F4FB"}

.mdi-tag-outline:before{content:"\F4FC"}

.mdi-tag-plus:before{content:"\F721"}

.mdi-tag-remove:before{content:"\F722"}

.mdi-tag-text-outline:before{content:"\F4FD"}

.mdi-target:before{content:"\F4FE"}

.mdi-taxi:before{content:"\F4FF"}

.mdi-teach:before{content:"\F88F"}

.mdi-teamviewer:before{content:"\F500"}

.mdi-telegram:before{content:"\F501"}

.mdi-television:before{content:"\F502"}

.mdi-television-box:before{content:"\F838"}

.mdi-television-classic:before{content:"\F7F3"}

.mdi-television-classic-off:before{content:"\F839"}

.mdi-television-guide:before{content:"\F503"}

.mdi-television-off:before{content:"\F83A"}

.mdi-temperature-celsius:before{content:"\F504"}

.mdi-temperature-fahrenheit:before{content:"\F505"}

.mdi-temperature-kelvin:before{content:"\F506"}

.mdi-tennis:before{content:"\F507"}

.mdi-tent:before{content:"\F508"}

.mdi-terrain:before{content:"\F509"}

.mdi-test-tube:before{content:"\F668"}

.mdi-test-tube-empty:before{content:"\F910"}

.mdi-test-tube-off:before{content:"\F911"}

.mdi-text:before{content:"\F9A7"}

.mdi-text-shadow:before{content:"\F669"}

.mdi-text-short:before{content:"\F9A8"}

.mdi-text-subject:before{content:"\F9A9"}

.mdi-text-to-speech:before{content:"\F50A"}

.mdi-text-to-speech-off:before{content:"\F50B"}

.mdi-textbox:before{content:"\F60E"}

.mdi-textbox-password:before{content:"\F7F4"}

.mdi-texture:before{content:"\F50C"}

.mdi-theater:before{content:"\F50D"}

.mdi-theme-light-dark:before{content:"\F50E"}

.mdi-thermometer:before{content:"\F50F"}

.mdi-thermometer-lines:before{content:"\F510"}

.mdi-thermostat:before{content:"\F393"}

.mdi-thermostat-box:before{content:"\F890"}

.mdi-thought-bubble:before{content:"\F7F5"}

.mdi-thought-bubble-outline:before{content:"\F7F6"}

.mdi-thumb-down:before{content:"\F511"}

.mdi-thumb-down-outline:before{content:"\F512"}

.mdi-thumb-up:before{content:"\F513"}

.mdi-thumb-up-outline:before{content:"\F514"}

.mdi-thumbs-up-down:before{content:"\F515"}

.mdi-ticket:before{content:"\F516"}

.mdi-ticket-account:before{content:"\F517"}

.mdi-ticket-confirmation:before{content:"\F518"}

.mdi-ticket-outline:before{content:"\F912"}

.mdi-ticket-percent:before{content:"\F723"}

.mdi-tie:before{content:"\F519"}

.mdi-tilde:before{content:"\F724"}

.mdi-timelapse:before{content:"\F51A"}

.mdi-timer:before{content:"\F51B"}

.mdi-timer-10:before{content:"\F51C"}

.mdi-timer-3:before{content:"\F51D"}

.mdi-timer-off:before{content:"\F51E"}

.mdi-timer-sand:before{content:"\F51F"}

.mdi-timer-sand-empty:before{content:"\F6AC"}

.mdi-timer-sand-full:before{content:"\F78B"}

.mdi-timetable:before{content:"\F520"}

.mdi-toggle-switch:before{content:"\F521"}

.mdi-toggle-switch-off:before{content:"\F522"}

.mdi-toilet:before{content:"\F9AA"}

.mdi-toolbox:before{content:"\F9AB"}

.mdi-toolbox-outline:before{content:"\F9AC"}

.mdi-tooltip:before{content:"\F523"}

.mdi-tooltip-edit:before{content:"\F524"}

.mdi-tooltip-image:before{content:"\F525"}

.mdi-tooltip-outline:before{content:"\F526"}

.mdi-tooltip-outline-plus:before{content:"\F527"}

.mdi-tooltip-text:before{content:"\F528"}

.mdi-tooth:before{content:"\F8C2"}

.mdi-tooth-outline:before{content:"\F529"}

.mdi-tor:before{content:"\F52A"}

.mdi-tournament:before{content:"\F9AD"}

.mdi-tower-beach:before{content:"\F680"}

.mdi-tower-fire:before{content:"\F681"}

.mdi-towing:before{content:"\F83B"}

.mdi-track-light:before{content:"\F913"}

.mdi-trackpad:before{content:"\F7F7"}

.mdi-trackpad-lock:before{content:"\F932"}

.mdi-tractor:before{content:"\F891"}

.mdi-traffic-light:before{content:"\F52B"}

.mdi-train:before{content:"\F52C"}

.mdi-train-variant:before{content:"\F8C3"}

.mdi-tram:before{content:"\F52D"}

.mdi-transcribe:before{content:"\F52E"}

.mdi-transcribe-close:before{content:"\F52F"}

.mdi-transfer:before{content:"\F530"}

.mdi-transit-transfer:before{content:"\F6AD"}

.mdi-transition:before{content:"\F914"}

.mdi-transition-masked:before{content:"\F915"}

.mdi-translate:before{content:"\F5CA"}

.mdi-treasure-chest:before{content:"\F725"}

.mdi-tree:before{content:"\F531"}

.mdi-trello:before{content:"\F532"}

.mdi-trending-down:before{content:"\F533"}

.mdi-trending-neutral:before{content:"\F534"}

.mdi-trending-up:before{content:"\F535"}

.mdi-triangle:before{content:"\F536"}

.mdi-triangle-outline:before{content:"\F537"}

.mdi-trophy:before{content:"\F538"}

.mdi-trophy-award:before{content:"\F539"}

.mdi-trophy-outline:before{content:"\F53A"}

.mdi-trophy-variant:before{content:"\F53B"}

.mdi-trophy-variant-outline:before{content:"\F53C"}

.mdi-truck:before{content:"\F53D"}

.mdi-truck-delivery:before{content:"\F53E"}

.mdi-truck-fast:before{content:"\F787"}

.mdi-truck-trailer:before{content:"\F726"}

.mdi-tshirt-crew:before{content:"\F53F"}

.mdi-tshirt-v:before{content:"\F540"}

.mdi-tumble-dryer:before{content:"\F916"}

.mdi-tumblr:before{content:"\F541"}

.mdi-tumblr-box:before{content:"\F917"}

.mdi-tumblr-reblog:before{content:"\F542"}

.mdi-tune:before{content:"\F62E"}

.mdi-tune-vertical:before{content:"\F66A"}

.mdi-twitch:before{content:"\F543"}

.mdi-twitter:before{content:"\F544"}

.mdi-twitter-box:before{content:"\F545"}

.mdi-twitter-circle:before{content:"\F546"}

.mdi-twitter-retweet:before{content:"\F547"}

.mdi-two-factor-authentication:before{content:"\F9AE"}

.mdi-uber:before{content:"\F748"}

.mdi-ubuntu:before{content:"\F548"}

.mdi-ultra-high-definition:before{content:"\F7F8"}

.mdi-umbraco:before{content:"\F549"}

.mdi-umbrella:before{content:"\F54A"}

.mdi-umbrella-closed:before{content:"\F9AF"}

.mdi-umbrella-outline:before{content:"\F54B"}

.mdi-undo:before{content:"\F54C"}

.mdi-undo-variant:before{content:"\F54D"}

.mdi-unfold-less-horizontal:before{content:"\F54E"}

.mdi-unfold-less-vertical:before{content:"\F75F"}

.mdi-unfold-more-horizontal:before{content:"\F54F"}

.mdi-unfold-more-vertical:before{content:"\F760"}

.mdi-ungroup:before{content:"\F550"}

.mdi-unity:before{content:"\F6AE"}

.mdi-unreal:before{content:"\F9B0"}

.mdi-untappd:before{content:"\F551"}

.mdi-update:before{content:"\F6AF"}

.mdi-upload:before{content:"\F552"}

.mdi-upload-multiple:before{content:"\F83C"}

.mdi-upload-network:before{content:"\F6F5"}

.mdi-usb:before{content:"\F553"}

.mdi-van-passenger:before{content:"\F7F9"}

.mdi-van-utility:before{content:"\F7FA"}

.mdi-vanish:before{content:"\F7FB"}

.mdi-vector-arrange-above:before{content:"\F554"}

.mdi-vector-arrange-below:before{content:"\F555"}

.mdi-vector-circle:before{content:"\F556"}

.mdi-vector-circle-variant:before{content:"\F557"}

.mdi-vector-combine:before{content:"\F558"}

.mdi-vector-curve:before{content:"\F559"}

.mdi-vector-difference:before{content:"\F55A"}

.mdi-vector-difference-ab:before{content:"\F55B"}

.mdi-vector-difference-ba:before{content:"\F55C"}

.mdi-vector-ellipse:before{content:"\F892"}

.mdi-vector-intersection:before{content:"\F55D"}

.mdi-vector-line:before{content:"\F55E"}

.mdi-vector-point:before{content:"\F55F"}

.mdi-vector-polygon:before{content:"\F560"}

.mdi-vector-polyline:before{content:"\F561"}

.mdi-vector-radius:before{content:"\F749"}

.mdi-vector-rectangle:before{content:"\F5C6"}

.mdi-vector-selection:before{content:"\F562"}

.mdi-vector-square:before{content:"\F001"}

.mdi-vector-triangle:before{content:"\F563"}

.mdi-vector-union:before{content:"\F564"}

.mdi-venmo:before{content:"\F578"}

.mdi-verified:before{content:"\F565"}

.mdi-vibrate:before{content:"\F566"}

.mdi-video:before{content:"\F567"}

.mdi-video-3d:before{content:"\F7FC"}

.mdi-video-4k-box:before{content:"\F83D"}

.mdi-video-account:before{content:"\F918"}

.mdi-video-image:before{content:"\F919"}

.mdi-video-input-antenna:before{content:"\F83E"}

.mdi-video-input-component:before{content:"\F83F"}

.mdi-video-input-hdmi:before{content:"\F840"}

.mdi-video-input-svideo:before{content:"\F841"}

.mdi-video-minus:before{content:"\F9B1"}

.mdi-video-off:before{content:"\F568"}

.mdi-video-plus:before{content:"\F9B2"}

.mdi-video-stabilization:before{content:"\F91A"}

.mdi-video-switch:before{content:"\F569"}

.mdi-view-agenda:before{content:"\F56A"}

.mdi-view-array:before{content:"\F56B"}

.mdi-view-carousel:before{content:"\F56C"}

.mdi-view-column:before{content:"\F56D"}

.mdi-view-dashboard:before{content:"\F56E"}

.mdi-view-dashboard-variant:before{content:"\F842"}

.mdi-view-day:before{content:"\F56F"}

.mdi-view-grid:before{content:"\F570"}

.mdi-view-headline:before{content:"\F571"}

.mdi-view-list:before{content:"\F572"}

.mdi-view-module:before{content:"\F573"}

.mdi-view-parallel:before{content:"\F727"}

.mdi-view-quilt:before{content:"\F574"}

.mdi-view-sequential:before{content:"\F728"}

.mdi-view-stream:before{content:"\F575"}

.mdi-view-week:before{content:"\F576"}

.mdi-vimeo:before{content:"\F577"}

.mdi-violin:before{content:"\F60F"}

.mdi-virtual-reality:before{content:"\F893"}

.mdi-visualstudio:before{content:"\F610"}

.mdi-vk:before{content:"\F579"}

.mdi-vk-box:before{content:"\F57A"}

.mdi-vk-circle:before{content:"\F57B"}

.mdi-vlc:before{content:"\F57C"}

.mdi-voice:before{content:"\F5CB"}

.mdi-voicemail:before{content:"\F57D"}

.mdi-volleyball:before{content:"\F9B3"}

.mdi-volume-high:before{content:"\F57E"}

.mdi-volume-low:before{content:"\F57F"}

.mdi-volume-medium:before{content:"\F580"}

.mdi-volume-minus:before{content:"\F75D"}

.mdi-volume-mute:before{content:"\F75E"}

.mdi-volume-off:before{content:"\F581"}

.mdi-volume-plus:before{content:"\F75C"}

.mdi-vpn:before{content:"\F582"}

.mdi-vuejs:before{content:"\F843"}

.mdi-walk:before{content:"\F583"}

.mdi-wall:before{content:"\F7FD"}

.mdi-wall-sconce:before{content:"\F91B"}

.mdi-wall-sconce-flat:before{content:"\F91C"}

.mdi-wall-sconce-variant:before{content:"\F91D"}

.mdi-wallet:before{content:"\F584"}

.mdi-wallet-giftcard:before{content:"\F585"}

.mdi-wallet-membership:before{content:"\F586"}

.mdi-wallet-travel:before{content:"\F587"}

.mdi-wan:before{content:"\F588"}

.mdi-washing-machine:before{content:"\F729"}

.mdi-watch:before{content:"\F589"}

.mdi-watch-export:before{content:"\F58A"}

.mdi-watch-export-variant:before{content:"\F894"}

.mdi-watch-import:before{content:"\F58B"}

.mdi-watch-import-variant:before{content:"\F895"}

.mdi-watch-variant:before{content:"\F896"}

.mdi-watch-vibrate:before{content:"\F6B0"}

.mdi-water:before{content:"\F58C"}

.mdi-water-off:before{content:"\F58D"}

.mdi-water-percent:before{content:"\F58E"}

.mdi-water-pump:before{content:"\F58F"}

.mdi-watermark:before{content:"\F612"}

.mdi-waves:before{content:"\F78C"}

.mdi-weather-cloudy:before{content:"\F590"}

.mdi-weather-fog:before{content:"\F591"}

.mdi-weather-hail:before{content:"\F592"}

.mdi-weather-hurricane:before{content:"\F897"}

.mdi-weather-lightning:before{content:"\F593"}

.mdi-weather-lightning-rainy:before{content:"\F67D"}

.mdi-weather-night:before{content:"\F594"}

.mdi-weather-partlycloudy:before{content:"\F595"}

.mdi-weather-pouring:before{content:"\F596"}

.mdi-weather-rainy:before{content:"\F597"}

.mdi-weather-snowy:before{content:"\F598"}

.mdi-weather-snowy-rainy:before{content:"\F67E"}

.mdi-weather-sunny:before{content:"\F599"}

.mdi-weather-sunset:before{content:"\F59A"}

.mdi-weather-sunset-down:before{content:"\F59B"}

.mdi-weather-sunset-up:before{content:"\F59C"}

.mdi-weather-windy:before{content:"\F59D"}

.mdi-weather-windy-variant:before{content:"\F59E"}

.mdi-web:before{content:"\F59F"}

.mdi-webcam:before{content:"\F5A0"}

.mdi-webhook:before{content:"\F62F"}

.mdi-webpack:before{content:"\F72A"}

.mdi-wechat:before{content:"\F611"}

.mdi-weight:before{content:"\F5A1"}

.mdi-weight-kilogram:before{content:"\F5A2"}

.mdi-weight-pound:before{content:"\F9B4"}

.mdi-whatsapp:before{content:"\F5A3"}

.mdi-wheelchair-accessibility:before{content:"\F5A4"}

.mdi-whistle:before{content:"\F9B5"}

.mdi-white-balance-auto:before{content:"\F5A5"}

.mdi-white-balance-incandescent:before{content:"\F5A6"}

.mdi-white-balance-iridescent:before{content:"\F5A7"}

.mdi-white-balance-sunny:before{content:"\F5A8"}

.mdi-widgets:before{content:"\F72B"}

.mdi-wifi:before{content:"\F5A9"}

.mdi-wifi-off:before{content:"\F5AA"}

.mdi-wifi-strength-1:before{content:"\F91E"}

.mdi-wifi-strength-1-alert:before{content:"\F91F"}

.mdi-wifi-strength-1-lock:before{content:"\F920"}

.mdi-wifi-strength-2:before{content:"\F921"}

.mdi-wifi-strength-2-alert:before{content:"\F922"}

.mdi-wifi-strength-2-lock:before{content:"\F923"}

.mdi-wifi-strength-3:before{content:"\F924"}

.mdi-wifi-strength-3-alert:before{content:"\F925"}

.mdi-wifi-strength-3-lock:before{content:"\F926"}

.mdi-wifi-strength-4:before{content:"\F927"}

.mdi-wifi-strength-4-alert:before{content:"\F928"}

.mdi-wifi-strength-4-lock:before{content:"\F929"}

.mdi-wifi-strength-alert-outline:before{content:"\F92A"}

.mdi-wifi-strength-lock-outline:before{content:"\F92B"}

.mdi-wifi-strength-off:before{content:"\F92C"}

.mdi-wifi-strength-off-outline:before{content:"\F92D"}

.mdi-wifi-strength-outline:before{content:"\F92E"}

.mdi-wii:before{content:"\F5AB"}

.mdi-wiiu:before{content:"\F72C"}

.mdi-wikipedia:before{content:"\F5AC"}

.mdi-window-close:before{content:"\F5AD"}

.mdi-window-closed:before{content:"\F5AE"}

.mdi-window-maximize:before{content:"\F5AF"}

.mdi-window-minimize:before{content:"\F5B0"}

.mdi-window-open:before{content:"\F5B1"}

.mdi-window-restore:before{content:"\F5B2"}

.mdi-windows:before{content:"\F5B3"}

.mdi-wordpress:before{content:"\F5B4"}

.mdi-worker:before{content:"\F5B5"}

.mdi-wrap:before{content:"\F5B6"}

.mdi-wrench:before{content:"\F5B7"}

.mdi-wunderlist:before{content:"\F5B8"}

.mdi-xamarin:before{content:"\F844"}

.mdi-xamarin-outline:before{content:"\F845"}

.mdi-xaml:before{content:"\F673"}

.mdi-xbox:before{content:"\F5B9"}

.mdi-xbox-controller:before{content:"\F5BA"}

.mdi-xbox-controller-battery-alert:before{content:"\F74A"}

.mdi-xbox-controller-battery-empty:before{content:"\F74B"}

.mdi-xbox-controller-battery-full:before{content:"\F74C"}

.mdi-xbox-controller-battery-low:before{content:"\F74D"}

.mdi-xbox-controller-battery-medium:before{content:"\F74E"}

.mdi-xbox-controller-battery-unknown:before{content:"\F74F"}

.mdi-xbox-controller-off:before{content:"\F5BB"}

.mdi-xda:before{content:"\F5BC"}

.mdi-xing:before{content:"\F5BD"}

.mdi-xing-box:before{content:"\F5BE"}

.mdi-xing-circle:before{content:"\F5BF"}

.mdi-xml:before{content:"\F5C0"}

.mdi-xmpp:before{content:"\F7FE"}

.mdi-yammer:before{content:"\F788"}

.mdi-yeast:before{content:"\F5C1"}

.mdi-yelp:before{content:"\F5C2"}

.mdi-yin-yang:before{content:"\F67F"}

.mdi-youtube:before{content:"\F5C3"}

.mdi-youtube-creator-studio:before{content:"\F846"}

.mdi-youtube-gaming:before{content:"\F847"}

.mdi-youtube-tv:before{content:"\F448"}

.mdi-zip-box:before{content:"\F5C4"}

.mdi-blank:before{content:"\F68C";visibility:hidden}

.mdi-18px.mdi-set,.mdi-18px.mdi:before{font-size:18px}

.mdi-24px.mdi-set,.mdi-24px.mdi:before{font-size:24px}

.mdi-36px.mdi-set,.mdi-36px.mdi:before{font-size:36px}

.mdi-48px.mdi-set,.mdi-48px.mdi:before{font-size:48px}

.mdi-dark:before{color:rgba(0,0,0,.54)}

.mdi-dark.mdi-inactive:before{color:rgba(0,0,0,.26)}

.mdi-light:before{color:#fff}

.mdi-light.mdi-inactive:before{color:rgba(255,255,255,.3)}

.mdi-rotate-45:before{transform:rotate(45deg)}

.mdi-rotate-90:before{transform:rotate(90deg)}

.mdi-rotate-135:before{transform:rotate(135deg)}

.mdi-rotate-180:before{transform:rotate(180deg)}

.mdi-rotate-225:before{transform:rotate(225deg)}

.mdi-rotate-270:before{transform:rotate(270deg)}

.mdi-rotate-315:before{transform:rotate(315deg)}

.mdi-flip-h:before{transform:scaleX(-1);filter:FlipH;-ms-filter:FlipH}

.mdi-flip-v:before{transform:scaleY(-1);filter:FlipV;-ms-filter:FlipV}

.mdi-spin:before{animation:mdi-spin 2s infinite linear}

@keyframes mdi-spin{0%{transform:rotate(0)}100%{transform:rotate(359deg)}}

/* Using a url */

@font-face{font-family:themify;src:url('themify9f249f24.0504804445e9a55f.eot?-fvbane');src:url('themifyd41dd41d.0504804445e9a55f.eot?#iefix-fvbane') format('embedded-opentype'),url('themify.58ecddba064e63f7.woff') format('woff'),url('themify.6cb5a30a9518fb87.ttf') format('truetype'),url('themify9f249f24.e4c8d7716cc6d54d.svg?-fvbane#themify') format('svg');font-weight:400;font-style:normal}

[class*=" ti-"],[class^=ti-]{font-family:themify;speak:none;font-style:normal;font-weight:400;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}

.ti-wand:before{content:"\e600"}

.ti-volume:before{content:"\e601"}

.ti-user:before{content:"\e602"}

.ti-unlock:before{content:"\e603"}

.ti-unlink:before{content:"\e604"}

.ti-trash:before{content:"\e605"}

.ti-thought:before{content:"\e606"}

.ti-target:before{content:"\e607"}

.ti-tag:before{content:"\e608"}

.ti-tablet:before{content:"\e609"}

.ti-star:before{content:"\e60a"}

.ti-spray:before{content:"\e60b"}

.ti-signal:before{content:"\e60c"}

.ti-shopping-cart:before{content:"\e60d"}

.ti-shopping-cart-full:before{content:"\e60e"}

.ti-settings:before{content:"\e60f"}

.ti-search:before{content:"\e610"}

.ti-zoom-in:before{content:"\e611"}

.ti-zoom-out:before{content:"\e612"}

.ti-cut:before{content:"\e613"}

.ti-ruler:before{content:"\e614"}

.ti-ruler-pencil:before{content:"\e615"}

.ti-ruler-alt:before{content:"\e616"}

.ti-bookmark:before{content:"\e617"}

.ti-bookmark-alt:before{content:"\e618"}

.ti-reload:before{content:"\e619"}

.ti-plus:before{content:"\e61a"}

.ti-pin:before{content:"\e61b"}

.ti-pencil:before{content:"\e61c"}

.ti-pencil-alt:before{content:"\e61d"}

.ti-paint-roller:before{content:"\e61e"}

.ti-paint-bucket:before{content:"\e61f"}

.ti-na:before{content:"\e620"}

.ti-mobile:before{content:"\e621"}

.ti-minus:before{content:"\e622"}

.ti-medall:before{content:"\e623"}

.ti-medall-alt:before{content:"\e624"}

.ti-marker:before{content:"\e625"}

.ti-marker-alt:before{content:"\e626"}

.ti-arrow-up:before{content:"\e627"}

.ti-arrow-right:before{content:"\e628"}

.ti-arrow-left:before{content:"\e629"}

.ti-arrow-down:before{content:"\e62a"}

.ti-lock:before{content:"\e62b"}

.ti-location-arrow:before{content:"\e62c"}

.ti-link:before{content:"\e62d"}

.ti-layout:before{content:"\e62e"}

.ti-layers:before{content:"\e62f"}

.ti-layers-alt:before{content:"\e630"}

.ti-key:before{content:"\e631"}

.ti-import:before{content:"\e632"}

.ti-image:before{content:"\e633"}

.ti-heart:before{content:"\e634"}

.ti-heart-broken:before{content:"\e635"}

.ti-hand-stop:before{content:"\e636"}

.ti-hand-open:before{content:"\e637"}

.ti-hand-drag:before{content:"\e638"}

.ti-folder:before{content:"\e639"}

.ti-flag:before{content:"\e63a"}

.ti-flag-alt:before{content:"\e63b"}

.ti-flag-alt-2:before{content:"\e63c"}

.ti-eye:before{content:"\e63d"}

.ti-export:before{content:"\e63e"}

.ti-exchange-vertical:before{content:"\e63f"}

.ti-desktop:before{content:"\e640"}

.ti-cup:before{content:"\e641"}

.ti-crown:before{content:"\e642"}

.ti-comments:before{content:"\e643"}

.ti-comment:before{content:"\e644"}

.ti-comment-alt:before{content:"\e645"}

.ti-close:before{content:"\e646"}

.ti-clip:before{content:"\e647"}

.ti-angle-up:before{content:"\e648"}

.ti-angle-right:before{content:"\e649"}

.ti-angle-left:before{content:"\e64a"}

.ti-angle-down:before{content:"\e64b"}

.ti-check:before{content:"\e64c"}

.ti-check-box:before{content:"\e64d"}

.ti-camera:before{content:"\e64e"}

.ti-announcement:before{content:"\e64f"}

.ti-brush:before{content:"\e650"}

.ti-briefcase:before{content:"\e651"}

.ti-bolt:before{content:"\e652"}

.ti-bolt-alt:before{content:"\e653"}

.ti-blackboard:before{content:"\e654"}

.ti-bag:before{content:"\e655"}

.ti-move:before{content:"\e656"}

.ti-arrows-vertical:before{content:"\e657"}

.ti-arrows-horizontal:before{content:"\e658"}

.ti-fullscreen:before{content:"\e659"}

.ti-arrow-top-right:before{content:"\e65a"}

.ti-arrow-top-left:before{content:"\e65b"}

.ti-arrow-circle-up:before{content:"\e65c"}

.ti-arrow-circle-right:before{content:"\e65d"}

.ti-arrow-circle-left:before{content:"\e65e"}

.ti-arrow-circle-down:before{content:"\e65f"}

.ti-angle-double-up:before{content:"\e660"}

.ti-angle-double-right:before{content:"\e661"}

.ti-angle-double-left:before{content:"\e662"}

.ti-angle-double-down:before{content:"\e663"}

.ti-zip:before{content:"\e664"}

.ti-world:before{content:"\e665"}

.ti-wheelchair:before{content:"\e666"}

.ti-view-list:before{content:"\e667"}

.ti-view-list-alt:before{content:"\e668"}

.ti-view-grid:before{content:"\e669"}

.ti-uppercase:before{content:"\e66a"}

.ti-upload:before{content:"\e66b"}

.ti-underline:before{content:"\e66c"}

.ti-truck:before{content:"\e66d"}

.ti-timer:before{content:"\e66e"}

.ti-ticket:before{content:"\e66f"}

.ti-thumb-up:before{content:"\e670"}

.ti-thumb-down:before{content:"\e671"}

.ti-text:before{content:"\e672"}

.ti-stats-up:before{content:"\e673"}

.ti-stats-down:before{content:"\e674"}

.ti-split-v:before{content:"\e675"}

.ti-split-h:before{content:"\e676"}

.ti-smallcap:before{content:"\e677"}

.ti-shine:before{content:"\e678"}

.ti-shift-right:before{content:"\e679"}

.ti-shift-left:before{content:"\e67a"}

.ti-shield:before{content:"\e67b"}

.ti-notepad:before{content:"\e67c"}

.ti-server:before{content:"\e67d"}

.ti-quote-right:before{content:"\e67e"}

.ti-quote-left:before{content:"\e67f"}

.ti-pulse:before{content:"\e680"}

.ti-printer:before{content:"\e681"}

.ti-power-off:before{content:"\e682"}

.ti-plug:before{content:"\e683"}

.ti-pie-chart:before{content:"\e684"}

.ti-paragraph:before{content:"\e685"}

.ti-panel:before{content:"\e686"}

.ti-package:before{content:"\e687"}

.ti-music:before{content:"\e688"}

.ti-music-alt:before{content:"\e689"}

.ti-mouse:before{content:"\e68a"}

.ti-mouse-alt:before{content:"\e68b"}

.ti-money:before{content:"\e68c"}

.ti-microphone:before{content:"\e68d"}

.ti-menu:before{content:"\e68e"}

.ti-menu-alt:before{content:"\e68f"}

.ti-map:before{content:"\e690"}

.ti-map-alt:before{content:"\e691"}

.ti-loop:before{content:"\e692"}

.ti-location-pin:before{content:"\e693"}

.ti-list:before{content:"\e694"}

.ti-light-bulb:before{content:"\e695"}

.ti-Italic:before{content:"\e696"}

.ti-info:before{content:"\e697"}

.ti-infinite:before{content:"\e698"}

.ti-id-badge:before{content:"\e699"}

.ti-hummer:before{content:"\e69a"}

.ti-home:before{content:"\e69b"}

.ti-help:before{content:"\e69c"}

.ti-headphone:before{content:"\e69d"}

.ti-harddrives:before{content:"\e69e"}

.ti-harddrive:before{content:"\e69f"}

.ti-gift:before{content:"\e6a0"}

.ti-game:before{content:"\e6a1"}

.ti-filter:before{content:"\e6a2"}

.ti-files:before{content:"\e6a3"}

.ti-file:before{content:"\e6a4"}

.ti-eraser:before{content:"\e6a5"}

.ti-envelope:before{content:"\e6a6"}

.ti-download:before{content:"\e6a7"}

.ti-direction:before{content:"\e6a8"}

.ti-direction-alt:before{content:"\e6a9"}

.ti-dashboard:before{content:"\e6aa"}

.ti-control-stop:before{content:"\e6ab"}

.ti-control-shuffle:before{content:"\e6ac"}

.ti-control-play:before{content:"\e6ad"}

.ti-control-pause:before{content:"\e6ae"}

.ti-control-forward:before{content:"\e6af"}

.ti-control-backward:before{content:"\e6b0"}

.ti-cloud:before{content:"\e6b1"}

.ti-cloud-up:before{content:"\e6b2"}

.ti-cloud-down:before{content:"\e6b3"}

.ti-clipboard:before{content:"\e6b4"}

.ti-car:before{content:"\e6b5"}

.ti-calendar:before{content:"\e6b6"}

.ti-book:before{content:"\e6b7"}

.ti-bell:before{content:"\e6b8"}

.ti-basketball:before{content:"\e6b9"}

.ti-bar-chart:before{content:"\e6ba"}

.ti-bar-chart-alt:before{content:"\e6bb"}

.ti-back-right:before{content:"\e6bc"}

.ti-back-left:before{content:"\e6bd"}

.ti-arrows-corner:before{content:"\e6be"}

.ti-archive:before{content:"\e6bf"}

.ti-anchor:before{content:"\e6c0"}

.ti-align-right:before{content:"\e6c1"}

.ti-align-left:before{content:"\e6c2"}

.ti-align-justify:before{content:"\e6c3"}

.ti-align-center:before{content:"\e6c4"}

.ti-alert:before{content:"\e6c5"}

.ti-alarm-clock:before{content:"\e6c6"}

.ti-agenda:before{content:"\e6c7"}

.ti-write:before{content:"\e6c8"}

.ti-window:before{content:"\e6c9"}

.ti-widgetized:before{content:"\e6ca"}

.ti-widget:before{content:"\e6cb"}

.ti-widget-alt:before{content:"\e6cc"}

.ti-wallet:before{content:"\e6cd"}

.ti-video-clapper:before{content:"\e6ce"}

.ti-video-camera:before{content:"\e6cf"}

.ti-vector:before{content:"\e6d0"}

.ti-themify-logo:before{content:"\e6d1"}

.ti-themify-favicon:before{content:"\e6d2"}

.ti-themify-favicon-alt:before{content:"\e6d3"}

.ti-support:before{content:"\e6d4"}

.ti-stamp:before{content:"\e6d5"}

.ti-split-v-alt:before{content:"\e6d6"}

.ti-slice:before{content:"\e6d7"}

.ti-shortcode:before{content:"\e6d8"}

.ti-shift-right-alt:before{content:"\e6d9"}

.ti-shift-left-alt:before{content:"\e6da"}

.ti-ruler-alt-2:before{content:"\e6db"}

.ti-receipt:before{content:"\e6dc"}

.ti-pin2:before{content:"\e6dd"}

.ti-pin-alt:before{content:"\e6de"}

.ti-pencil-alt2:before{content:"\e6df"}

.ti-palette:before{content:"\e6e0"}

.ti-more:before{content:"\e6e1"}

.ti-more-alt:before{content:"\e6e2"}

.ti-microphone-alt:before{content:"\e6e3"}

.ti-magnet:before{content:"\e6e4"}

.ti-line-double:before{content:"\e6e5"}

.ti-line-dotted:before{content:"\e6e6"}

.ti-line-dashed:before{content:"\e6e7"}

.ti-layout-width-full:before{content:"\e6e8"}

.ti-layout-width-default:before{content:"\e6e9"}

.ti-layout-width-default-alt:before{content:"\e6ea"}

.ti-layout-tab:before{content:"\e6eb"}

.ti-layout-tab-window:before{content:"\e6ec"}

.ti-layout-tab-v:before{content:"\e6ed"}

.ti-layout-tab-min:before{content:"\e6ee"}

.ti-layout-slider:before{content:"\e6ef"}

.ti-layout-slider-alt:before{content:"\e6f0"}

.ti-layout-sidebar-right:before{content:"\e6f1"}

.ti-layout-sidebar-none:before{content:"\e6f2"}

.ti-layout-sidebar-left:before{content:"\e6f3"}

.ti-layout-placeholder:before{content:"\e6f4"}

.ti-layout-menu:before{content:"\e6f5"}

.ti-layout-menu-v:before{content:"\e6f6"}

.ti-layout-menu-separated:before{content:"\e6f7"}

.ti-layout-menu-full:before{content:"\e6f8"}

.ti-layout-media-right-alt:before{content:"\e6f9"}

.ti-layout-media-right:before{content:"\e6fa"}

.ti-layout-media-overlay:before{content:"\e6fb"}

.ti-layout-media-overlay-alt:before{content:"\e6fc"}

.ti-layout-media-overlay-alt-2:before{content:"\e6fd"}

.ti-layout-media-left-alt:before{content:"\e6fe"}

.ti-layout-media-left:before{content:"\e6ff"}

.ti-layout-media-center-alt:before{content:"\e700"}

.ti-layout-media-center:before{content:"\e701"}

.ti-layout-list-thumb:before{content:"\e702"}

.ti-layout-list-thumb-alt:before{content:"\e703"}

.ti-layout-list-post:before{content:"\e704"}

.ti-layout-list-large-image:before{content:"\e705"}

.ti-layout-line-solid:before{content:"\e706"}

.ti-layout-grid4:before{content:"\e707"}

.ti-layout-grid3:before{content:"\e708"}

.ti-layout-grid2:before{content:"\e709"}

.ti-layout-grid2-thumb:before{content:"\e70a"}

.ti-layout-cta-right:before{content:"\e70b"}

.ti-layout-cta-left:before{content:"\e70c"}

.ti-layout-cta-center:before{content:"\e70d"}

.ti-layout-cta-btn-right:before{content:"\e70e"}

.ti-layout-cta-btn-left:before{content:"\e70f"}

.ti-layout-column4:before{content:"\e710"}

.ti-layout-column3:before{content:"\e711"}

.ti-layout-column2:before{content:"\e712"}

.ti-layout-accordion-separated:before{content:"\e713"}

.ti-layout-accordion-merged:before{content:"\e714"}

.ti-layout-accordion-list:before{content:"\e715"}

.ti-ink-pen:before{content:"\e716"}

.ti-info-alt:before{content:"\e717"}

.ti-help-alt:before{content:"\e718"}

.ti-headphone-alt:before{content:"\e719"}

.ti-hand-point-up:before{content:"\e71a"}

.ti-hand-point-right:before{content:"\e71b"}

.ti-hand-point-left:before{content:"\e71c"}

.ti-hand-point-down:before{content:"\e71d"}

.ti-gallery:before{content:"\e71e"}

.ti-face-smile:before{content:"\e71f"}

.ti-face-sad:before{content:"\e720"}

.ti-credit-card:before{content:"\e721"}

.ti-control-skip-forward:before{content:"\e722"}

.ti-control-skip-backward:before{content:"\e723"}

.ti-control-record:before{content:"\e724"}

.ti-control-eject:before{content:"\e725"}

.ti-comments-smiley:before{content:"\e726"}

.ti-brush-alt:before{content:"\e727"}

.ti-youtube:before{content:"\e728"}

.ti-vimeo:before{content:"\e729"}

.ti-twitter:before{content:"\e72a"}

.ti-time:before{content:"\e72b"}

.ti-tumblr:before{content:"\e72c"}

.ti-skype:before{content:"\e72d"}

.ti-share:before{content:"\e72e"}

.ti-share-alt:before{content:"\e72f"}

.ti-rocket:before{content:"\e730"}

.ti-pinterest:before{content:"\e731"}

.ti-new-window:before{content:"\e732"}

.ti-microsoft:before{content:"\e733"}

.ti-list-ol:before{content:"\e734"}

.ti-linkedin:before{content:"\e735"}

.ti-layout-sidebar-2:before{content:"\e736"}

.ti-layout-grid4-alt:before{content:"\e737"}

.ti-layout-grid3-alt:before{content:"\e738"}

.ti-layout-grid2-alt:before{content:"\e739"}

.ti-layout-column4-alt:before{content:"\e73a"}

.ti-layout-column3-alt:before{content:"\e73b"}

.ti-layout-column2-alt:before{content:"\e73c"}

.ti-instagram:before{content:"\e73d"}

.ti-google:before{content:"\e73e"}

.ti-github:before{content:"\e73f"}

.ti-flickr:before{content:"\e740"}

.ti-facebook:before{content:"\e741"}

.ti-dropbox:before{content:"\e742"}

.ti-dribbble:before{content:"\e743"}

.ti-apple:before{content:"\e744"}

.ti-android:before{content:"\e745"}

.ti-save:before{content:"\e746"}

.ti-save-alt:before{content:"\e747"}

.ti-yahoo:before{content:"\e748"}

.ti-wordpress:before{content:"\e749"}

.ti-vimeo-alt:before{content:"\e74a"}

.ti-twitter-alt:before{content:"\e74b"}

.ti-tumblr-alt:before{content:"\e74c"}

.ti-trello:before{content:"\e74d"}

.ti-stack-overflow:before{content:"\e74e"}

.ti-soundcloud:before{content:"\e74f"}

.ti-sharethis:before{content:"\e750"}

.ti-sharethis-alt:before{content:"\e751"}

.ti-reddit:before{content:"\e752"}

.ti-pinterest-alt:before{content:"\e753"}

.ti-microsoft-alt:before{content:"\e754"}

.ti-linux:before{content:"\e755"}

.ti-jsfiddle:before{content:"\e756"}

.ti-joomla:before{content:"\e757"}

.ti-html5:before{content:"\e758"}

.ti-flickr-alt:before{content:"\e759"}

.ti-email:before{content:"\e75a"}

.ti-drupal:before{content:"\e75b"}

.ti-dropbox-alt:before{content:"\e75c"}

.ti-css3:before{content:"\e75d"}

.ti-rss:before{content:"\e75e"}

.ti-rss-alt:before{content:"\e75f"}

/* Using a url */

.la,.lab,.lad,.lal,.lar,.las{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;display:inline-block;font-style:normal;font-variant:normal;text-rendering:auto;line-height:1}

.la-lg{font-size:1.33333em;line-height:.75em;vertical-align:-.0667em}

.la-xs{font-size:.75em}

.la-sm{font-size:.875em}

.la-1x{font-size:1em}

.la-2x{font-size:2em}

.la-3x{font-size:3em}

.la-4x{font-size:4em}

.la-5x{font-size:5em}

.la-6x{font-size:6em}

.la-7x{font-size:7em}

.la-8x{font-size:8em}

.la-9x{font-size:9em}

.la-10x{font-size:10em}

.la-fw{text-align:center;width:1.25em}

.la-ul{list-style-type:none;margin-left:2.5em;padding-left:0}

.la-ul>li{position:relative}

.la-li{left:-2em;position:absolute;text-align:center;width:2em;line-height:inherit}

.la-border{border:solid .08em #eee;border-radius:.1em;padding:.2em .25em .15em}

.la-pull-left{float:left}

.la-pull-right{float:right}

.la.la-pull-left,.lab.la-pull-left,.lal.la-pull-left,.lar.la-pull-left,.las.la-pull-left{margin-right:.3em}

.la.la-pull-right,.lab.la-pull-right,.lal.la-pull-right,.lar.la-pull-right,.las.la-pull-right{margin-left:.3em}

.la-spin{animation:la-spin 2s infinite linear}

.la-pulse{animation:la-spin 1s infinite steps(8)}

@keyframes la-spin{0%{transform:rotate(0)}100%{transform:rotate(360deg)}}

.la-rotate-90{transform:rotate(90deg)}

.la-rotate-180{transform:rotate(180deg)}

.la-rotate-270{transform:rotate(270deg)}

.la-flip-horizontal{transform:scale(-1,1)}

.la-flip-vertical{transform:scale(1,-1)}

.la-flip-both,.la-flip-horizontal.la-flip-vertical{transform:scale(-1,-1)}

:root .la-flip-both,:root .la-flip-horizontal,:root .la-flip-vertical,:root .la-rotate-180,:root .la-rotate-270,:root .la-rotate-90{filter:none}

.la-stack{display:inline-block;height:2em;line-height:2em;position:relative;vertical-align:middle;width:2.5em}

.la-stack-1x,.la-stack-2x{left:0;position:absolute;text-align:center;width:100%}

.la-stack-1x{line-height:inherit}

.la-stack-2x{font-size:2em}

.la-inverse{color:#fff}

.la-500px:before{content:"\f26e"}

.la-accessible-icon:before{content:"\f368"}

.la-accusoft:before{content:"\f369"}

.la-acquisitions-incorporated:before{content:"\f6af"}

.la-ad:before{content:"\f641"}

.la-address-book:before{content:"\f2b9"}

.la-address-card:before{content:"\f2bb"}

.la-adjust:before{content:"\f042"}

.la-adn:before{content:"\f170"}

.la-adobe:before{content:"\f778"}

.la-adversal:before{content:"\f36a"}

.la-affiliatetheme:before{content:"\f36b"}

.la-air-freshener:before{content:"\f5d0"}

.la-airbnb:before{content:"\f834"}

.la-algolia:before{content:"\f36c"}

.la-align-center:before{content:"\f037"}

.la-align-justify:before{content:"\f039"}

.la-align-left:before{content:"\f036"}

.la-align-right:before{content:"\f038"}

.la-alipay:before{content:"\f642"}

.la-allergies:before{content:"\f461"}

.la-amazon:before{content:"\f270"}

.la-amazon-pay:before{content:"\f42c"}

.la-ambulance:before{content:"\f0f9"}

.la-american-sign-language-interpreting:before{content:"\f2a3"}

.la-amilia:before{content:"\f36d"}

.la-anchor:before{content:"\f13d"}

.la-android:before{content:"\f17b"}

.la-angellist:before{content:"\f209"}

.la-angle-double-down:before{content:"\f103"}

.la-angle-double-left:before{content:"\f100"}

.la-angle-double-right:before{content:"\f101"}

.la-angle-double-up:before{content:"\f102"}

.la-angle-down:before{content:"\f107"}

.la-angle-left:before{content:"\f104"}

.la-angle-right:before{content:"\f105"}

.la-angle-up:before{content:"\f106"}

.la-angry:before{content:"\f556"}

.la-angrycreative:before{content:"\f36e"}

.la-angular:before{content:"\f420"}

.la-ankh:before{content:"\f644"}

.la-app-store:before{content:"\f36f"}

.la-app-store-ios:before{content:"\f370"}

.la-apper:before{content:"\f371"}

.la-apple:before{content:"\f179"}

.la-apple-alt:before{content:"\f5d1"}

.la-apple-pay:before{content:"\f415"}

.la-archive:before{content:"\f187"}

.la-archway:before{content:"\f557"}

.la-arrow-alt-circle-down:before{content:"\f358"}

.la-arrow-alt-circle-left:before{content:"\f359"}

.la-arrow-alt-circle-right:before{content:"\f35a"}

.la-arrow-alt-circle-up:before{content:"\f35b"}

.la-arrow-circle-down:before{content:"\f0ab"}

.la-arrow-circle-left:before{content:"\f0a8"}

.la-arrow-circle-right:before{content:"\f0a9"}

.la-arrow-circle-up:before{content:"\f0aa"}

.la-arrow-down:before{content:"\f063"}

.la-arrow-left:before{content:"\f060"}

.la-arrow-right:before{content:"\f061"}

.la-arrow-up:before{content:"\f062"}

.la-arrows-alt:before{content:"\f0b2"}

.la-arrows-alt-h:before{content:"\f337"}

.la-arrows-alt-v:before{content:"\f338"}

.la-artstation:before{content:"\f77a"}

.la-assistive-listening-systems:before{content:"\f2a2"}

.la-asterisk:before{content:"\f069"}

.la-asymmetrik:before{content:"\f372"}

.la-at:before{content:"\f1fa"}

.la-atlas:before{content:"\f558"}

.la-atlassian:before{content:"\f77b"}

.la-atom:before{content:"\f5d2"}

.la-audible:before{content:"\f373"}

.la-audio-description:before{content:"\f29e"}

.la-autoprefixer:before{content:"\f41c"}

.la-avianex:before{content:"\f374"}

.la-aviato:before{content:"\f421"}

.la-award:before{content:"\f559"}

.la-aws:before{content:"\f375"}

.la-baby:before{content:"\f77c"}

.la-baby-carriage:before{content:"\f77d"}

.la-backspace:before{content:"\f55a"}

.la-backward:before{content:"\f04a"}

.la-bacon:before{content:"\f7e5"}

.la-balance-scale:before{content:"\f24e"}

.la-balance-scale-left:before{content:"\f515"}

.la-balance-scale-right:before{content:"\f516"}

.la-ban:before{content:"\f05e"}

.la-band-aid:before{content:"\f462"}

.la-bandcamp:before{content:"\f2d5"}

.la-barcode:before{content:"\f02a"}

.la-bars:before{content:"\f0c9"}

.la-baseball-ball:before{content:"\f433"}

.la-basketball-ball:before{content:"\f434"}

.la-bath:before{content:"\f2cd"}

.la-battery-empty:before{content:"\f244"}

.la-battery-full:before{content:"\f240"}

.la-battery-half:before{content:"\f242"}

.la-battery-quarter:before{content:"\f243"}

.la-battery-three-quarters:before{content:"\f241"}

.la-battle-net:before{content:"\f835"}

.la-bed:before{content:"\f236"}

.la-beer:before{content:"\f0fc"}

.la-behance:before{content:"\f1b4"}

.la-behance-square:before{content:"\f1b5"}

.la-bell:before{content:"\f0f3"}

.la-bell-slash:before{content:"\f1f6"}

.la-bezier-curve:before{content:"\f55b"}

.la-bible:before{content:"\f647"}

.la-bicycle:before{content:"\f206"}

.la-biking:before{content:"\f84a"}

.la-bimobject:before{content:"\f378"}

.la-binoculars:before{content:"\f1e5"}

.la-biohazard:before{content:"\f780"}

.la-birthday-cake:before{content:"\f1fd"}

.la-bitbucket:before{content:"\f171"}

.la-bitcoin:before{content:"\f379"}

.la-bity:before{content:"\f37a"}

.la-black-tie:before{content:"\f27e"}

.la-blackberry:before{content:"\f37b"}

.la-blender:before{content:"\f517"}

.la-blender-phone:before{content:"\f6b6"}

.la-blind:before{content:"\f29d"}

.la-blog:before{content:"\f781"}

.la-blogger:before{content:"\f37c"}

.la-blogger-b:before{content:"\f37d"}

.la-bluetooth:before{content:"\f293"}

.la-bluetooth-b:before{content:"\f294"}

.la-bold:before{content:"\f032"}

.la-bolt:before{content:"\f0e7"}

.la-bomb:before{content:"\f1e2"}

.la-bone:before{content:"\f5d7"}

.la-bong:before{content:"\f55c"}

.la-book:before{content:"\f02d"}

.la-book-dead:before{content:"\f6b7"}

.la-book-medical:before{content:"\f7e6"}

.la-book-open:before{content:"\f518"}

.la-book-reader:before{content:"\f5da"}

.la-bookmark:before{content:"\f02e"}

.la-bootstrap:before{content:"\f836"}

.la-border-all:before{content:"\f84c"}

.la-border-none:before{content:"\f850"}

.la-border-style:before{content:"\f853"}

.la-bowling-ball:before{content:"\f436"}

.la-box:before{content:"\f466"}

.la-box-open:before{content:"\f49e"}

.la-boxes:before{content:"\f468"}

.la-braille:before{content:"\f2a1"}

.la-brain:before{content:"\f5dc"}

.la-bread-slice:before{content:"\f7ec"}

.la-briefcase:before{content:"\f0b1"}

.la-briefcase-medical:before{content:"\f469"}

.la-broadcast-tower:before{content:"\f519"}

.la-broom:before{content:"\f51a"}

.la-brush:before{content:"\f55d"}

.la-btc:before{content:"\f15a"}

.la-buffer:before{content:"\f837"}

.la-bug:before{content:"\f188"}

.la-building:before{content:"\f1ad"}

.la-bullhorn:before{content:"\f0a1"}

.la-bullseye:before{content:"\f140"}

.la-burn:before{content:"\f46a"}

.la-buromobelexperte:before{content:"\f37f"}

.la-bus:before{content:"\f207"}

.la-bus-alt:before{content:"\f55e"}

.la-business-time:before{content:"\f64a"}

.la-buy-n-large:before{content:"\f8a6"}

.la-buysellads:before{content:"\f20d"}

.la-calculator:before{content:"\f1ec"}

.la-calendar:before{content:"\f133"}

.la-calendar-alt:before{content:"\f073"}

.la-calendar-check:before{content:"\f274"}

.la-calendar-day:before{content:"\f783"}

.la-calendar-minus:before{content:"\f272"}

.la-calendar-plus:before{content:"\f271"}

.la-calendar-times:before{content:"\f273"}

.la-calendar-week:before{content:"\f784"}

.la-camera:before{content:"\f030"}

.la-camera-retro:before{content:"\f083"}

.la-campground:before{content:"\f6bb"}

.la-canadian-maple-leaf:before{content:"\f785"}

.la-candy-cane:before{content:"\f786"}

.la-cannabis:before{content:"\f55f"}

.la-capsules:before{content:"\f46b"}

.la-car:before{content:"\f1b9"}

.la-car-alt:before{content:"\f5de"}

.la-car-battery:before{content:"\f5df"}

.la-car-crash:before{content:"\f5e1"}

.la-car-side:before{content:"\f5e4"}

.la-caret-down:before{content:"\f0d7"}

.la-caret-left:before{content:"\f0d9"}

.la-caret-right:before{content:"\f0da"}

.la-caret-square-down:before{content:"\f150"}

.la-caret-square-left:before{content:"\f191"}

.la-caret-square-right:before{content:"\f152"}

.la-caret-square-up:before{content:"\f151"}

.la-caret-up:before{content:"\f0d8"}

.la-carrot:before{content:"\f787"}

.la-cart-arrow-down:before{content:"\f218"}

.la-cart-plus:before{content:"\f217"}

.la-cash-register:before{content:"\f788"}

.la-cat:before{content:"\f6be"}

.la-cc-amazon-pay:before{content:"\f42d"}

.la-cc-amex:before{content:"\f1f3"}

.la-cc-apple-pay:before{content:"\f416"}

.la-cc-diners-club:before{content:"\f24c"}

.la-cc-discover:before{content:"\f1f2"}

.la-cc-jcb:before{content:"\f24b"}

.la-cc-mastercard:before{content:"\f1f1"}

.la-cc-paypal:before{content:"\f1f4"}

.la-cc-stripe:before{content:"\f1f5"}

.la-cc-visa:before{content:"\f1f0"}

.la-centercode:before{content:"\f380"}

.la-centos:before{content:"\f789"}

.la-certificate:before{content:"\f0a3"}

.la-chair:before{content:"\f6c0"}

.la-chalkboard:before{content:"\f51b"}

.la-chalkboard-teacher:before{content:"\f51c"}

.la-charging-station:before{content:"\f5e7"}

.la-chart-area:before{content:"\f1fe"}

.la-chart-bar:before{content:"\f080"}

.la-chart-line:before{content:"\f201"}

.la-chart-pie:before{content:"\f200"}

.la-check:before{content:"\f00c"}

.la-check-circle:before{content:"\f058"}

.la-check-double:before{content:"\f560"}

.la-check-square:before{content:"\f14a"}

.la-cheese:before{content:"\f7ef"}

.la-chess:before{content:"\f439"}

.la-chess-bishop:before{content:"\f43a"}

.la-chess-board:before{content:"\f43c"}

.la-chess-king:before{content:"\f43f"}

.la-chess-knight:before{content:"\f441"}

.la-chess-pawn:before{content:"\f443"}

.la-chess-queen:before{content:"\f445"}

.la-chess-rook:before{content:"\f447"}

.la-chevron-circle-down:before{content:"\f13a"}

.la-chevron-circle-left:before{content:"\f137"}

.la-chevron-circle-right:before{content:"\f138"}

.la-chevron-circle-up:before{content:"\f139"}

.la-chevron-down:before{content:"\f078"}

.la-chevron-left:before{content:"\f053"}

.la-chevron-right:before{content:"\f054"}

.la-chevron-up:before{content:"\f077"}

.la-child:before{content:"\f1ae"}

.la-chrome:before{content:"\f268"}

.la-chromecast:before{content:"\f838"}

.la-church:before{content:"\f51d"}

.la-circle:before{content:"\f111"}

.la-circle-notch:before{content:"\f1ce"}

.la-city:before{content:"\f64f"}

.la-clinic-medical:before{content:"\f7f2"}

.la-clipboard:before{content:"\f328"}

.la-clipboard-check:before{content:"\f46c"}

.la-clipboard-list:before{content:"\f46d"}

.la-clock:before{content:"\f017"}

.la-clone:before{content:"\f24d"}

.la-closed-captioning:before{content:"\f20a"}

.la-cloud:before{content:"\f0c2"}

.la-cloud-download-alt:before{content:"\f381"}

.la-cloud-meatball:before{content:"\f73b"}

.la-cloud-moon:before{content:"\f6c3"}

.la-cloud-moon-rain:before{content:"\f73c"}

.la-cloud-rain:before{content:"\f73d"}

.la-cloud-showers-heavy:before{content:"\f740"}

.la-cloud-sun:before{content:"\f6c4"}

.la-cloud-sun-rain:before{content:"\f743"}

.la-cloud-upload-alt:before{content:"\f382"}

.la-cloudscale:before{content:"\f383"}

.la-cloudsmith:before{content:"\f384"}

.la-cloudversify:before{content:"\f385"}

.la-cocktail:before{content:"\f561"}

.la-code:before{content:"\f121"}

.la-code-branch:before{content:"\f126"}

.la-codepen:before{content:"\f1cb"}

.la-codiepie:before{content:"\f284"}

.la-coffee:before{content:"\f0f4"}

.la-cog:before{content:"\f013"}

.la-cogs:before{content:"\f085"}

.la-coins:before{content:"\f51e"}

.la-columns:before{content:"\f0db"}

.la-comment:before{content:"\f075"}

.la-comment-alt:before{content:"\f27a"}

.la-comment-dollar:before{content:"\f651"}

.la-comment-dots:before{content:"\f4ad"}

.la-comment-medical:before{content:"\f7f5"}

.la-comment-slash:before{content:"\f4b3"}

.la-comments:before{content:"\f086"}

.la-comments-dollar:before{content:"\f653"}

.la-compact-disc:before{content:"\f51f"}

.la-compass:before{content:"\f14e"}

.la-compress:before{content:"\f066"}

.la-compress-arrows-alt:before{content:"\f78c"}

.la-concierge-bell:before{content:"\f562"}

.la-confluence:before{content:"\f78d"}

.la-connectdevelop:before{content:"\f20e"}

.la-contao:before{content:"\f26d"}

.la-cookie:before{content:"\f563"}

.la-cookie-bite:before{content:"\f564"}

.la-copy:before{content:"\f0c5"}

.la-copyright:before{content:"\f1f9"}

.la-cotton-bureau:before{content:"\f89e"}

.la-couch:before{content:"\f4b8"}

.la-cpanel:before{content:"\f388"}

.la-creative-commons:before{content:"\f25e"}

.la-creative-commons-by:before{content:"\f4e7"}

.la-creative-commons-nc:before{content:"\f4e8"}

.la-creative-commons-nc-eu:before{content:"\f4e9"}

.la-creative-commons-nc-jp:before{content:"\f4ea"}

.la-creative-commons-nd:before{content:"\f4eb"}

.la-creative-commons-pd:before{content:"\f4ec"}

.la-creative-commons-pd-alt:before{content:"\f4ed"}

.la-creative-commons-remix:before{content:"\f4ee"}

.la-creative-commons-sa:before{content:"\f4ef"}

.la-creative-commons-sampling:before{content:"\f4f0"}

.la-creative-commons-sampling-plus:before{content:"\f4f1"}

.la-creative-commons-share:before{content:"\f4f2"}

.la-creative-commons-zero:before{content:"\f4f3"}

.la-credit-card:before{content:"\f09d"}

.la-critical-role:before{content:"\f6c9"}

.la-crop:before{content:"\f125"}

.la-crop-alt:before{content:"\f565"}

.la-cross:before{content:"\f654"}

.la-crosshairs:before{content:"\f05b"}

.la-crow:before{content:"\f520"}

.la-crown:before{content:"\f521"}

.la-crutch:before{content:"\f7f7"}

.la-css3:before{content:"\f13c"}

.la-css3-alt:before{content:"\f38b"}

.la-cube:before{content:"\f1b2"}

.la-cubes:before{content:"\f1b3"}

.la-cut:before{content:"\f0c4"}

.la-cuttlefish:before{content:"\f38c"}

.la-d-and-d:before{content:"\f38d"}

.la-d-and-d-beyond:before{content:"\f6ca"}

.la-dashcube:before{content:"\f210"}

.la-database:before{content:"\f1c0"}

.la-deaf:before{content:"\f2a4"}

.la-delicious:before{content:"\f1a5"}

.la-democrat:before{content:"\f747"}

.la-deploydog:before{content:"\f38e"}

.la-deskpro:before{content:"\f38f"}

.la-desktop:before{content:"\f108"}

.la-dev:before{content:"\f6cc"}

.la-deviantart:before{content:"\f1bd"}

.la-dharmachakra:before{content:"\f655"}

.la-dhl:before{content:"\f790"}

.la-diagnoses:before{content:"\f470"}

.la-diaspora:before{content:"\f791"}

.la-dice:before{content:"\f522"}

.la-dice-d20:before{content:"\f6cf"}

.la-dice-d6:before{content:"\f6d1"}

.la-dice-five:before{content:"\f523"}

.la-dice-four:before{content:"\f524"}

.la-dice-one:before{content:"\f525"}

.la-dice-six:before{content:"\f526"}

.la-dice-three:before{content:"\f527"}

.la-dice-two:before{content:"\f528"}

.la-digg:before{content:"\f1a6"}

.la-digital-ocean:before{content:"\f391"}

.la-digital-tachograph:before{content:"\f566"}

.la-directions:before{content:"\f5eb"}

.la-discord:before{content:"\f392"}

.la-discourse:before{content:"\f393"}

.la-divide:before{content:"\f529"}

.la-dizzy:before{content:"\f567"}

.la-dna:before{content:"\f471"}

.la-dochub:before{content:"\f394"}

.la-docker:before{content:"\f395"}

.la-dog:before{content:"\f6d3"}

.la-dollar-sign:before{content:"\f155"}

.la-dolly:before{content:"\f472"}

.la-dolly-flatbed:before{content:"\f474"}

.la-donate:before{content:"\f4b9"}

.la-door-closed:before{content:"\f52a"}

.la-door-open:before{content:"\f52b"}

.la-dot-circle:before{content:"\f192"}

.la-dove:before{content:"\f4ba"}

.la-download:before{content:"\f019"}

.la-draft2digital:before{content:"\f396"}

.la-drafting-compass:before{content:"\f568"}

.la-dragon:before{content:"\f6d5"}

.la-draw-polygon:before{content:"\f5ee"}

.la-dribbble:before{content:"\f17d"}

.la-dribbble-square:before{content:"\f397"}

.la-dropbox:before{content:"\f16b"}

.la-drum:before{content:"\f569"}

.la-drum-steelpan:before{content:"\f56a"}

.la-drumstick-bite:before{content:"\f6d7"}

.la-drupal:before{content:"\f1a9"}

.la-dumbbell:before{content:"\f44b"}

.la-dumpster:before{content:"\f793"}

.la-dumpster-fire:before{content:"\f794"}

.la-dungeon:before{content:"\f6d9"}

.la-dyalog:before{content:"\f399"}

.la-earlybirds:before{content:"\f39a"}

.la-ebay:before{content:"\f4f4"}

.la-edge:before{content:"\f282"}

.la-edit:before{content:"\f044"}

.la-egg:before{content:"\f7fb"}

.la-eject:before{content:"\f052"}

.la-elementor:before{content:"\f430"}

.la-ellipsis-h:before{content:"\f141"}

.la-ellipsis-v:before{content:"\f142"}

.la-ello:before{content:"\f5f1"}

.la-ember:before{content:"\f423"}

.la-empire:before{content:"\f1d1"}

.la-envelope:before{content:"\f0e0"}

.la-envelope-open:before{content:"\f2b6"}

.la-envelope-open-text:before{content:"\f658"}

.la-envelope-square:before{content:"\f199"}

.la-envira:before{content:"\f299"}

.la-equals:before{content:"\f52c"}

.la-eraser:before{content:"\f12d"}

.la-erlang:before{content:"\f39d"}

.la-ethereum:before{content:"\f42e"}

.la-ethernet:before{content:"\f796"}

.la-etsy:before{content:"\f2d7"}

.la-euro-sign:before{content:"\f153"}

.la-evernote:before{content:"\f839"}

.la-exchange-alt:before{content:"\f362"}

.la-exclamation:before{content:"\f12a"}

.la-exclamation-circle:before{content:"\f06a"}

.la-exclamation-triangle:before{content:"\f071"}

.la-expand:before{content:"\f065"}

.la-expand-arrows-alt:before{content:"\f31e"}

.la-expeditedssl:before{content:"\f23e"}

.la-external-link-alt:before{content:"\f35d"}

.la-external-link-square-alt:before{content:"\f360"}

.la-eye:before{content:"\f06e"}

.la-eye-dropper:before{content:"\f1fb"}

.la-eye-slash:before{content:"\f070"}

.la-facebook:before{content:"\f09a"}

.la-facebook-f:before{content:"\f39e"}

.la-facebook-messenger:before{content:"\f39f"}

.la-facebook-square:before{content:"\f082"}

.la-fan:before{content:"\f863"}

.la-fantasy-flight-games:before{content:"\f6dc"}

.la-fast-backward:before{content:"\f049"}

.la-fast-forward:before{content:"\f050"}

.la-fax:before{content:"\f1ac"}

.la-feather:before{content:"\f52d"}

.la-feather-alt:before{content:"\f56b"}

.la-fedex:before{content:"\f797"}

.la-fedora:before{content:"\f798"}

.la-female:before{content:"\f182"}

.la-fighter-jet:before{content:"\f0fb"}

.la-figma:before{content:"\f799"}

.la-file:before{content:"\f15b"}

.la-file-alt:before{content:"\f15c"}

.la-file-archive:before{content:"\f1c6"}

.la-file-audio:before{content:"\f1c7"}

.la-file-code:before{content:"\f1c9"}

.la-file-contract:before{content:"\f56c"}

.la-file-csv:before{content:"\f6dd"}

.la-file-download:before{content:"\f56d"}

.la-file-excel:before{content:"\f1c3"}

.la-file-export:before{content:"\f56e"}

.la-file-image:before{content:"\f1c5"}

.la-file-import:before{content:"\f56f"}

.la-file-invoice:before{content:"\f570"}

.la-file-invoice-dollar:before{content:"\f571"}

.la-file-medical:before{content:"\f477"}

.la-file-medical-alt:before{content:"\f478"}

.la-file-pdf:before{content:"\f1c1"}

.la-file-powerpoint:before{content:"\f1c4"}

.la-file-prescription:before{content:"\f572"}

.la-file-signature:before{content:"\f573"}

.la-file-upload:before{content:"\f574"}

.la-file-video:before{content:"\f1c8"}

.la-file-word:before{content:"\f1c2"}

.la-fill:before{content:"\f575"}

.la-fill-drip:before{content:"\f576"}

.la-film:before{content:"\f008"}

.la-filter:before{content:"\f0b0"}

.la-fingerprint:before{content:"\f577"}

.la-fire:before{content:"\f06d"}

.la-fire-alt:before{content:"\f7e4"}

.la-fire-extinguisher:before{content:"\f134"}

.la-firefox:before{content:"\f269"}

.la-first-aid:before{content:"\f479"}

.la-first-order:before{content:"\f2b0"}

.la-first-order-alt:before{content:"\f50a"}

.la-firstdraft:before{content:"\f3a1"}

.la-fish:before{content:"\f578"}

.la-fist-raised:before{content:"\f6de"}

.la-flag:before{content:"\f024"}

.la-flag-checkered:before{content:"\f11e"}

.la-flag-usa:before{content:"\f74d"}

.la-flask:before{content:"\f0c3"}

.la-flickr:before{content:"\f16e"}

.la-flipboard:before{content:"\f44d"}

.la-flushed:before{content:"\f579"}

.la-fly:before{content:"\f417"}

.la-folder:before{content:"\f07b"}

.la-folder-minus:before{content:"\f65d"}

.la-folder-open:before{content:"\f07c"}

.la-folder-plus:before{content:"\f65e"}

.la-font:before{content:"\f031"}

.la-font-awesome:before{content:"\f2b4"}

.la-font-awesome-alt:before{content:"\f35c"}

.la-font-awesome-flag:before{content:"\f425"}

.la-font-awesome-logo-full:before{content:"\f4e6"}

.la-fonticons:before{content:"\f280"}

.la-fonticons-fi:before{content:"\f3a2"}

.la-football-ball:before{content:"\f44e"}

.la-fort-awesome:before{content:"\f286"}

.la-fort-awesome-alt:before{content:"\f3a3"}

.la-forumbee:before{content:"\f211"}

.la-forward:before{content:"\f04e"}

.la-foursquare:before{content:"\f180"}

.la-free-code-camp:before{content:"\f2c5"}

.la-freebsd:before{content:"\f3a4"}

.la-frog:before{content:"\f52e"}

.la-frown:before{content:"\f119"}

.la-frown-open:before{content:"\f57a"}

.la-fulcrum:before{content:"\f50b"}

.la-funnel-dollar:before{content:"\f662"}

.la-futbol:before{content:"\f1e3"}

.la-galactic-republic:before{content:"\f50c"}

.la-galactic-senate:before{content:"\f50d"}

.la-gamepad:before{content:"\f11b"}

.la-gas-pump:before{content:"\f52f"}

.la-gavel:before{content:"\f0e3"}

.la-gem:before{content:"\f3a5"}

.la-genderless:before{content:"\f22d"}

.la-get-pocket:before{content:"\f265"}

.la-gg:before{content:"\f260"}

.la-gg-circle:before{content:"\f261"}

.la-ghost:before{content:"\f6e2"}

.la-gift:before{content:"\f06b"}

.la-gifts:before{content:"\f79c"}

.la-git:before{content:"\f1d3"}

.la-git-alt:before{content:"\f841"}

.la-git-square:before{content:"\f1d2"}

.la-github:before{content:"\f09b"}

.la-github-alt:before{content:"\f113"}

.la-github-square:before{content:"\f092"}

.la-gitkraken:before{content:"\f3a6"}

.la-gitlab:before{content:"\f296"}

.la-gitter:before{content:"\f426"}

.la-glass-cheers:before{content:"\f79f"}

.la-glass-martini:before{content:"\f000"}

.la-glass-martini-alt:before{content:"\f57b"}

.la-glass-whiskey:before{content:"\f7a0"}

.la-glasses:before{content:"\f530"}

.la-glide:before{content:"\f2a5"}

.la-glide-g:before{content:"\f2a6"}

.la-globe:before{content:"\f0ac"}

.la-globe-africa:before{content:"\f57c"}

.la-globe-americas:before{content:"\f57d"}

.la-globe-asia:before{content:"\f57e"}

.la-globe-europe:before{content:"\f7a2"}

.la-gofore:before{content:"\f3a7"}

.la-golf-ball:before{content:"\f450"}

.la-goodreads:before{content:"\f3a8"}

.la-goodreads-g:before{content:"\f3a9"}

.la-google:before{content:"\f1a0"}

.la-google-drive:before{content:"\f3aa"}

.la-google-play:before{content:"\f3ab"}

.la-google-plus:before{content:"\f2b3"}

.la-google-plus-g:before{content:"\f0d5"}

.la-google-plus-square:before{content:"\f0d4"}

.la-google-wallet:before{content:"\f1ee"}

.la-gopuram:before{content:"\f664"}

.la-graduation-cap:before{content:"\f19d"}

.la-gratipay:before{content:"\f184"}

.la-grav:before{content:"\f2d6"}

.la-greater-than:before{content:"\f531"}

.la-greater-than-equal:before{content:"\f532"}

.la-grimace:before{content:"\f57f"}

.la-grin:before{content:"\f580"}

.la-grin-alt:before{content:"\f581"}

.la-grin-beam:before{content:"\f582"}

.la-grin-beam-sweat:before{content:"\f583"}

.la-grin-hearts:before{content:"\f584"}

.la-grin-squint:before{content:"\f585"}

.la-grin-squint-tears:before{content:"\f586"}

.la-grin-stars:before{content:"\f587"}

.la-grin-tears:before{content:"\f588"}

.la-grin-tongue:before{content:"\f589"}

.la-grin-tongue-squint:before{content:"\f58a"}

.la-grin-tongue-wink:before{content:"\f58b"}

.la-grin-wink:before{content:"\f58c"}

.la-grip-horizontal:before{content:"\f58d"}

.la-grip-lines:before{content:"\f7a4"}

.la-grip-lines-vertical:before{content:"\f7a5"}

.la-grip-vertical:before{content:"\f58e"}

.la-gripfire:before{content:"\f3ac"}

.la-grunt:before{content:"\f3ad"}

.la-guitar:before{content:"\f7a6"}

.la-gulp:before{content:"\f3ae"}

.la-h-square:before{content:"\f0fd"}

.la-hacker-news:before{content:"\f1d4"}

.la-hacker-news-square:before{content:"\f3af"}

.la-hackerrank:before{content:"\f5f7"}

.la-hamburger:before{content:"\f805"}

.la-hammer:before{content:"\f6e3"}

.la-hamsa:before{content:"\f665"}

.la-hand-holding:before{content:"\f4bd"}

.la-hand-holding-heart:before{content:"\f4be"}

.la-hand-holding-usd:before{content:"\f4c0"}

.la-hand-lizard:before{content:"\f258"}

.la-hand-middle-finger:before{content:"\f806"}

.la-hand-paper:before{content:"\f256"}

.la-hand-peace:before{content:"\f25b"}

.la-hand-point-down:before{content:"\f0a7"}

.la-hand-point-left:before{content:"\f0a5"}

.la-hand-point-right:before{content:"\f0a4"}

.la-hand-point-up:before{content:"\f0a6"}

.la-hand-pointer:before{content:"\f25a"}

.la-hand-rock:before{content:"\f255"}

.la-hand-scissors:before{content:"\f257"}

.la-hand-spock:before{content:"\f259"}

.la-hands:before{content:"\f4c2"}

.la-hands-helping:before{content:"\f4c4"}

.la-handshake:before{content:"\f2b5"}

.la-hanukiah:before{content:"\f6e6"}

.la-hard-hat:before{content:"\f807"}

.la-hashtag:before{content:"\f292"}

.la-hat-cowboy:before{content:"\f8c0"}

.la-hat-cowboy-side:before{content:"\f8c1"}

.la-hat-wizard:before{content:"\f6e8"}

.la-haykal:before{content:"\f666"}

.la-hdd:before{content:"\f0a0"}

.la-heading:before{content:"\f1dc"}

.la-headphones:before{content:"\f025"}

.la-headphones-alt:before{content:"\f58f"}

.la-headset:before{content:"\f590"}

.la-heart:before{content:"\f004"}

.la-heart-broken:before{content:"\f7a9"}

.la-heartbeat:before{content:"\f21e"}

.la-helicopter:before{content:"\f533"}

.la-highlighter:before{content:"\f591"}

.la-hiking:before{content:"\f6ec"}

.la-hippo:before{content:"\f6ed"}

.la-hips:before{content:"\f452"}

.la-hire-a-helper:before{content:"\f3b0"}

.la-history:before{content:"\f1da"}

.la-hockey-puck:before{content:"\f453"}

.la-holly-berry:before{content:"\f7aa"}

.la-home:before{content:"\f015"}

.la-hooli:before{content:"\f427"}

.la-hornbill:before{content:"\f592"}

.la-horse:before{content:"\f6f0"}

.la-horse-head:before{content:"\f7ab"}

.la-hospital:before{content:"\f0f8"}

.la-hospital-alt:before{content:"\f47d"}

.la-hospital-symbol:before{content:"\f47e"}

.la-hot-tub:before{content:"\f593"}

.la-hotdog:before{content:"\f80f"}

.la-hotel:before{content:"\f594"}

.la-hotjar:before{content:"\f3b1"}

.la-hourglass:before{content:"\f254"}

.la-hourglass-end:before{content:"\f253"}

.la-hourglass-half:before{content:"\f252"}

.la-hourglass-start:before{content:"\f251"}

.la-house-damage:before{content:"\f6f1"}

.la-houzz:before{content:"\f27c"}

.la-hryvnia:before{content:"\f6f2"}

.la-html5:before{content:"\f13b"}

.la-hubspot:before{content:"\f3b2"}

.la-i-cursor:before{content:"\f246"}

.la-ice-cream:before{content:"\f810"}

.la-icicles:before{content:"\f7ad"}

.la-icons:before{content:"\f86d"}

.la-id-badge:before{content:"\f2c1"}

.la-id-card:before{content:"\f2c2"}

.la-id-card-alt:before{content:"\f47f"}

.la-igloo:before{content:"\f7ae"}

.la-image:before{content:"\f03e"}

.la-images:before{content:"\f302"}

.la-imdb:before{content:"\f2d8"}

.la-inbox:before{content:"\f01c"}

.la-indent:before{content:"\f03c"}

.la-industry:before{content:"\f275"}

.la-infinity:before{content:"\f534"}

.la-info:before{content:"\f129"}

.la-info-circle:before{content:"\f05a"}

.la-instagram:before{content:"\f16d"}

.la-intercom:before{content:"\f7af"}

.la-internet-explorer:before{content:"\f26b"}

.la-invision:before{content:"\f7b0"}

.la-ioxhost:before{content:"\f208"}

.la-italic:before{content:"\f033"}

.la-itch-io:before{content:"\f83a"}

.la-itunes:before{content:"\f3b4"}

.la-itunes-note:before{content:"\f3b5"}

.la-java:before{content:"\f4e4"}

.la-jedi:before{content:"\f669"}

.la-jedi-order:before{content:"\f50e"}

.la-jenkins:before{content:"\f3b6"}

.la-jira:before{content:"\f7b1"}

.la-joget:before{content:"\f3b7"}

.la-joint:before{content:"\f595"}

.la-joomla:before{content:"\f1aa"}

.la-journal-whills:before{content:"\f66a"}

.la-js:before{content:"\f3b8"}

.la-js-square:before{content:"\f3b9"}

.la-jsfiddle:before{content:"\f1cc"}

.la-kaaba:before{content:"\f66b"}

.la-kaggle:before{content:"\f5fa"}

.la-key:before{content:"\f084"}

.la-keybase:before{content:"\f4f5"}

.la-keyboard:before{content:"\f11c"}

.la-keycdn:before{content:"\f3ba"}

.la-khanda:before{content:"\f66d"}

.la-kickstarter:before{content:"\f3bb"}

.la-kickstarter-k:before{content:"\f3bc"}

.la-kiss:before{content:"\f596"}

.la-kiss-beam:before{content:"\f597"}

.la-kiss-wink-heart:before{content:"\f598"}

.la-kiwi-bird:before{content:"\f535"}

.la-korvue:before{content:"\f42f"}

.la-landmark:before{content:"\f66f"}

.la-language:before{content:"\f1ab"}

.la-laptop:before{content:"\f109"}

.la-laptop-code:before{content:"\f5fc"}

.la-laptop-medical:before{content:"\f812"}

.la-laravel:before{content:"\f3bd"}

.la-lastfm:before{content:"\f202"}

.la-lastfm-square:before{content:"\f203"}

.la-laugh:before{content:"\f599"}

.la-laugh-beam:before{content:"\f59a"}

.la-laugh-squint:before{content:"\f59b"}

.la-laugh-wink:before{content:"\f59c"}

.la-layer-group:before{content:"\f5fd"}

.la-leaf:before{content:"\f06c"}

.la-leanpub:before{content:"\f212"}

.la-lemon:before{content:"\f094"}

.la-less:before{content:"\f41d"}

.la-less-than:before{content:"\f536"}

.la-less-than-equal:before{content:"\f537"}

.la-level-down-alt:before{content:"\f3be"}

.la-level-up-alt:before{content:"\f3bf"}

.la-life-ring:before{content:"\f1cd"}

.la-lightbulb:before{content:"\f0eb"}

.la-line:before{content:"\f3c0"}

.la-link:before{content:"\f0c1"}

.la-linkedin:before{content:"\f08c"}

.la-linkedin-in:before{content:"\f0e1"}

.la-linode:before{content:"\f2b8"}

.la-linux:before{content:"\f17c"}

.la-lira-sign:before{content:"\f195"}

.la-list:before{content:"\f03a"}

.la-list-alt:before{content:"\f022"}

.la-list-ol:before{content:"\f0cb"}

.la-list-ul:before{content:"\f0ca"}

.la-location-arrow:before{content:"\f124"}

.la-lock:before{content:"\f023"}

.la-lock-open:before{content:"\f3c1"}

.la-long-arrow-alt-down:before{content:"\f309"}

.la-long-arrow-alt-left:before{content:"\f30a"}

.la-long-arrow-alt-right:before{content:"\f30b"}

.la-long-arrow-alt-up:before{content:"\f30c"}

.la-low-vision:before{content:"\f2a8"}

.la-luggage-cart:before{content:"\f59d"}

.la-lyft:before{content:"\f3c3"}

.la-magento:before{content:"\f3c4"}

.la-magic:before{content:"\f0d0"}

.la-magnet:before{content:"\f076"}

.la-mail-bulk:before{content:"\f674"}

.la-mailchimp:before{content:"\f59e"}

.la-male:before{content:"\f183"}

.la-mandalorian:before{content:"\f50f"}

.la-map:before{content:"\f279"}

.la-map-marked:before{content:"\f59f"}

.la-map-marked-alt:before{content:"\f5a0"}

.la-map-marker:before{content:"\f041"}

.la-map-marker-alt:before{content:"\f3c5"}

.la-map-pin:before{content:"\f276"}

.la-map-signs:before{content:"\f277"}

.la-markdown:before{content:"\f60f"}

.la-marker:before{content:"\f5a1"}

.la-mars:before{content:"\f222"}

.la-mars-double:before{content:"\f227"}

.la-mars-stroke:before{content:"\f229"}

.la-mars-stroke-h:before{content:"\f22b"}

.la-mars-stroke-v:before{content:"\f22a"}

.la-mask:before{content:"\f6fa"}

.la-mastodon:before{content:"\f4f6"}

.la-maxcdn:before{content:"\f136"}

.la-mdb:before{content:"\f8ca"}

.la-medal:before{content:"\f5a2"}

.la-medapps:before{content:"\f3c6"}

.la-medium:before{content:"\f23a"}

.la-medium-m:before{content:"\f3c7"}

.la-medkit:before{content:"\f0fa"}

.la-medrt:before{content:"\f3c8"}

.la-meetup:before{content:"\f2e0"}

.la-megaport:before{content:"\f5a3"}

.la-meh:before{content:"\f11a"}

.la-meh-blank:before{content:"\f5a4"}

.la-meh-rolling-eyes:before{content:"\f5a5"}

.la-memory:before{content:"\f538"}

.la-mendeley:before{content:"\f7b3"}

.la-menorah:before{content:"\f676"}

.la-mercury:before{content:"\f223"}

.la-meteor:before{content:"\f753"}

.la-microchip:before{content:"\f2db"}

.la-microphone:before{content:"\f130"}

.la-microphone-alt:before{content:"\f3c9"}

.la-microphone-alt-slash:before{content:"\f539"}

.la-microphone-slash:before{content:"\f131"}

.la-microscope:before{content:"\f610"}

.la-microsoft:before{content:"\f3ca"}

.la-minus:before{content:"\f068"}

.la-minus-circle:before{content:"\f056"}

.la-minus-square:before{content:"\f146"}

.la-mitten:before{content:"\f7b5"}

.la-mix:before{content:"\f3cb"}

.la-mixcloud:before{content:"\f289"}

.la-mizuni:before{content:"\f3cc"}

.la-mobile:before{content:"\f10b"}

.la-mobile-alt:before{content:"\f3cd"}

.la-modx:before{content:"\f285"}

.la-monero:before{content:"\f3d0"}

.la-money-bill:before{content:"\f0d6"}

.la-money-bill-alt:before{content:"\f3d1"}

.la-money-bill-wave:before{content:"\f53a"}

.la-money-bill-wave-alt:before{content:"\f53b"}

.la-money-check:before{content:"\f53c"}

.la-money-check-alt:before{content:"\f53d"}

.la-monument:before{content:"\f5a6"}

.la-moon:before{content:"\f186"}

.la-mortar-pestle:before{content:"\f5a7"}

.la-mosque:before{content:"\f678"}

.la-motorcycle:before{content:"\f21c"}

.la-mountain:before{content:"\f6fc"}

.la-mouse:before{content:"\f8cc"}

.la-mouse-pointer:before{content:"\f245"}

.la-mug-hot:before{content:"\f7b6"}

.la-music:before{content:"\f001"}

.la-napster:before{content:"\f3d2"}

.la-neos:before{content:"\f612"}

.la-network-wired:before{content:"\f6ff"}

.la-neuter:before{content:"\f22c"}

.la-newspaper:before{content:"\f1ea"}

.la-nimblr:before{content:"\f5a8"}

.la-node:before{content:"\f419"}

.la-node-js:before{content:"\f3d3"}

.la-not-equal:before{content:"\f53e"}

.la-notes-medical:before{content:"\f481"}

.la-npm:before{content:"\f3d4"}

.la-ns8:before{content:"\f3d5"}

.la-nutritionix:before{content:"\f3d6"}

.la-object-group:before{content:"\f247"}

.la-object-ungroup:before{content:"\f248"}

.la-odnoklassniki:before{content:"\f263"}

.la-odnoklassniki-square:before{content:"\f264"}

.la-oil-can:before{content:"\f613"}

.la-old-republic:before{content:"\f510"}

.la-om:before{content:"\f679"}

.la-opencart:before{content:"\f23d"}

.la-openid:before{content:"\f19b"}

.la-opera:before{content:"\f26a"}

.la-optin-monster:before{content:"\f23c"}

.la-orcid:before{content:"\f8d2"}

.la-osi:before{content:"\f41a"}

.la-otter:before{content:"\f700"}

.la-outdent:before{content:"\f03b"}

.la-page4:before{content:"\f3d7"}

.la-pagelines:before{content:"\f18c"}

.la-pager:before{content:"\f815"}

.la-paint-brush:before{content:"\f1fc"}

.la-paint-roller:before{content:"\f5aa"}

.la-palette:before{content:"\f53f"}

.la-palfed:before{content:"\f3d8"}

.la-pallet:before{content:"\f482"}

.la-paper-plane:before{content:"\f1d8"}

.la-paperclip:before{content:"\f0c6"}

.la-parachute-box:before{content:"\f4cd"}

.la-paragraph:before{content:"\f1dd"}

.la-parking:before{content:"\f540"}

.la-passport:before{content:"\f5ab"}

.la-pastafarianism:before{content:"\f67b"}

.la-paste:before{content:"\f0ea"}

.la-patreon:before{content:"\f3d9"}

.la-pause:before{content:"\f04c"}

.la-pause-circle:before{content:"\f28b"}

.la-paw:before{content:"\f1b0"}

.la-paypal:before{content:"\f1ed"}

.la-peace:before{content:"\f67c"}

.la-pen:before{content:"\f304"}

.la-pen-alt:before{content:"\f305"}

.la-pen-fancy:before{content:"\f5ac"}

.la-pen-nib:before{content:"\f5ad"}

.la-pen-square:before{content:"\f14b"}

.la-pencil-alt:before{content:"\f303"}

.la-pencil-ruler:before{content:"\f5ae"}

.la-penny-arcade:before{content:"\f704"}

.la-people-carry:before{content:"\f4ce"}

.la-pepper-hot:before{content:"\f816"}

.la-percent:before{content:"\f295"}

.la-percentage:before{content:"\f541"}

.la-periscope:before{content:"\f3da"}

.la-person-booth:before{content:"\f756"}

.la-phabricator:before{content:"\f3db"}

.la-phoenix-framework:before{content:"\f3dc"}

.la-phoenix-squadron:before{content:"\f511"}

.la-phone:before{content:"\f095"}

.la-phone-alt:before{content:"\f879"}

.la-phone-slash:before{content:"\f3dd"}

.la-phone-square:before{content:"\f098"}

.la-phone-square-alt:before{content:"\f87b"}

.la-phone-volume:before{content:"\f2a0"}

.la-photo-video:before{content:"\f87c"}

.la-php:before{content:"\f457"}

.la-pied-piper:before{content:"\f2ae"}

.la-pied-piper-alt:before{content:"\f1a8"}

.la-pied-piper-hat:before{content:"\f4e5"}

.la-pied-piper-pp:before{content:"\f1a7"}

.la-piggy-bank:before{content:"\f4d3"}

.la-pills:before{content:"\f484"}

.la-pinterest:before{content:"\f0d2"}

.la-pinterest-p:before{content:"\f231"}

.la-pinterest-square:before{content:"\f0d3"}

.la-pizza-slice:before{content:"\f818"}

.la-place-of-worship:before{content:"\f67f"}

.la-plane:before{content:"\f072"}

.la-plane-arrival:before{content:"\f5af"}

.la-plane-departure:before{content:"\f5b0"}

.la-play:before{content:"\f04b"}

.la-play-circle:before{content:"\f144"}

.la-playstation:before{content:"\f3df"}

.la-plug:before{content:"\f1e6"}

.la-plus:before{content:"\f067"}

.la-plus-circle:before{content:"\f055"}

.la-plus-square:before{content:"\f0fe"}

.la-podcast:before{content:"\f2ce"}

.la-poll:before{content:"\f681"}

.la-poll-h:before{content:"\f682"}

.la-poo:before{content:"\f2fe"}

.la-poo-storm:before{content:"\f75a"}

.la-poop:before{content:"\f619"}

.la-portrait:before{content:"\f3e0"}

.la-pound-sign:before{content:"\f154"}

.la-power-off:before{content:"\f011"}

.la-pray:before{content:"\f683"}

.la-praying-hands:before{content:"\f684"}

.la-prescription:before{content:"\f5b1"}

.la-prescription-bottle:before{content:"\f485"}

.la-prescription-bottle-alt:before{content:"\f486"}

.la-print:before{content:"\f02f"}

.la-procedures:before{content:"\f487"}

.la-product-hunt:before{content:"\f288"}

.la-project-diagram:before{content:"\f542"}

.la-pushed:before{content:"\f3e1"}

.la-puzzle-piece:before{content:"\f12e"}

.la-python:before{content:"\f3e2"}

.la-qq:before{content:"\f1d6"}

.la-qrcode:before{content:"\f029"}

.la-question:before{content:"\f128"}

.la-question-circle:before{content:"\f059"}

.la-quidditch:before{content:"\f458"}

.la-quinscape:before{content:"\f459"}

.la-quora:before{content:"\f2c4"}

.la-quote-left:before{content:"\f10d"}

.la-quote-right:before{content:"\f10e"}

.la-quran:before{content:"\f687"}

.la-r-project:before{content:"\f4f7"}

.la-radiation:before{content:"\f7b9"}

.la-radiation-alt:before{content:"\f7ba"}

.la-rainbow:before{content:"\f75b"}

.la-random:before{content:"\f074"}

.la-raspberry-pi:before{content:"\f7bb"}

.la-ravelry:before{content:"\f2d9"}

.la-react:before{content:"\f41b"}

.la-reacteurope:before{content:"\f75d"}

.la-readme:before{content:"\f4d5"}

.la-rebel:before{content:"\f1d0"}

.la-receipt:before{content:"\f543"}

.la-record-vinyl:before{content:"\f8d9"}

.la-recycle:before{content:"\f1b8"}

.la-red-river:before{content:"\f3e3"}

.la-reddit:before{content:"\f1a1"}

.la-reddit-alien:before{content:"\f281"}

.la-reddit-square:before{content:"\f1a2"}

.la-redhat:before{content:"\f7bc"}

.la-redo:before{content:"\f01e"}

.la-redo-alt:before{content:"\f2f9"}

.la-registered:before{content:"\f25d"}

.la-remove-format:before{content:"\f87d"}

.la-renren:before{content:"\f18b"}

.la-reply:before{content:"\f3e5"}

.la-reply-all:before{content:"\f122"}

.la-replyd:before{content:"\f3e6"}

.la-republican:before{content:"\f75e"}

.la-researchgate:before{content:"\f4f8"}

.la-resolving:before{content:"\f3e7"}

.la-restroom:before{content:"\f7bd"}

.la-retweet:before{content:"\f079"}

.la-rev:before{content:"\f5b2"}

.la-ribbon:before{content:"\f4d6"}

.la-ring:before{content:"\f70b"}

.la-road:before{content:"\f018"}

.la-robot:before{content:"\f544"}

.la-rocket:before{content:"\f135"}

.la-rocketchat:before{content:"\f3e8"}

.la-rockrms:before{content:"\f3e9"}

.la-route:before{content:"\f4d7"}

.la-rss:before{content:"\f09e"}

.la-rss-square:before{content:"\f143"}

.la-ruble-sign:before{content:"\f158"}

.la-ruler:before{content:"\f545"}

.la-ruler-combined:before{content:"\f546"}

.la-ruler-horizontal:before{content:"\f547"}

.la-ruler-vertical:before{content:"\f548"}

.la-running:before{content:"\f70c"}

.la-rupee-sign:before{content:"\f156"}

.la-sad-cry:before{content:"\f5b3"}

.la-sad-tear:before{content:"\f5b4"}

.la-safari:before{content:"\f267"}

.la-salesforce:before{content:"\f83b"}

.la-sass:before{content:"\f41e"}

.la-satellite:before{content:"\f7bf"}

.la-satellite-dish:before{content:"\f7c0"}

.la-save:before{content:"\f0c7"}

.la-schlix:before{content:"\f3ea"}

.la-school:before{content:"\f549"}

.la-screwdriver:before{content:"\f54a"}

.la-scribd:before{content:"\f28a"}

.la-scroll:before{content:"\f70e"}

.la-sd-card:before{content:"\f7c2"}

.la-search:before{content:"\f002"}

.la-search-dollar:before{content:"\f688"}

.la-search-location:before{content:"\f689"}

.la-search-minus:before{content:"\f010"}

.la-search-plus:before{content:"\f00e"}

.la-searchengin:before{content:"\f3eb"}

.la-seedling:before{content:"\f4d8"}

.la-sellcast:before{content:"\f2da"}

.la-sellsy:before{content:"\f213"}

.la-server:before{content:"\f233"}

.la-servicestack:before{content:"\f3ec"}

.la-shapes:before{content:"\f61f"}

.la-share:before{content:"\f064"}

.la-share-alt:before{content:"\f1e0"}

.la-share-alt-square:before{content:"\f1e1"}

.la-share-square:before{content:"\f14d"}

.la-shekel-sign:before{content:"\f20b"}

.la-shield-alt:before{content:"\f3ed"}

.la-ship:before{content:"\f21a"}

.la-shipping-fast:before{content:"\f48b"}

.la-shirtsinbulk:before{content:"\f214"}

.la-shoe-prints:before{content:"\f54b"}

.la-shopping-bag:before{content:"\f290"}

.la-shopping-basket:before{content:"\f291"}

.la-shopping-cart:before{content:"\f07a"}

.la-shopware:before{content:"\f5b5"}

.la-shower:before{content:"\f2cc"}

.la-shuttle-van:before{content:"\f5b6"}

.la-sign:before{content:"\f4d9"}

.la-sign-in-alt:before{content:"\f2f6"}

.la-sign-language:before{content:"\f2a7"}

.la-sign-out-alt:before{content:"\f2f5"}

.la-signal:before{content:"\f012"}

.la-signature:before{content:"\f5b7"}

.la-sim-card:before{content:"\f7c4"}

.la-simplybuilt:before{content:"\f215"}

.la-sistrix:before{content:"\f3ee"}

.la-sitemap:before{content:"\f0e8"}

.la-sith:before{content:"\f512"}

.la-skating:before{content:"\f7c5"}

.la-sketch:before{content:"\f7c6"}

.la-skiing:before{content:"\f7c9"}

.la-skiing-nordic:before{content:"\f7ca"}

.la-skull:before{content:"\f54c"}

.la-skull-crossbones:before{content:"\f714"}

.la-skyatlas:before{content:"\f216"}

.la-skype:before{content:"\f17e"}

.la-slack:before{content:"\f198"}

.la-slack-hash:before{content:"\f3ef"}

.la-slash:before{content:"\f715"}

.la-sleigh:before{content:"\f7cc"}

.la-sliders-h:before{content:"\f1de"}

.la-slideshare:before{content:"\f1e7"}

.la-smile:before{content:"\f118"}

.la-smile-beam:before{content:"\f5b8"}

.la-smile-wink:before{content:"\f4da"}

.la-smog:before{content:"\f75f"}

.la-smoking:before{content:"\f48d"}

.la-smoking-ban:before{content:"\f54d"}

.la-sms:before{content:"\f7cd"}

.la-snapchat:before{content:"\f2ab"}

.la-snapchat-ghost:before{content:"\f2ac"}

.la-snapchat-square:before{content:"\f2ad"}

.la-snowboarding:before{content:"\f7ce"}

.la-snowflake:before{content:"\f2dc"}

.la-snowman:before{content:"\f7d0"}

.la-snowplow:before{content:"\f7d2"}

.la-socks:before{content:"\f696"}

.la-solar-panel:before{content:"\f5ba"}

.la-sort:before{content:"\f0dc"}

.la-sort-alpha-down:before{content:"\f15d"}

.la-sort-alpha-down-alt:before{content:"\f881"}

.la-sort-alpha-up:before{content:"\f15e"}

.la-sort-alpha-up-alt:before{content:"\f882"}

.la-sort-amount-down:before{content:"\f160"}

.la-sort-amount-down-alt:before{content:"\f884"}

.la-sort-amount-up:before{content:"\f161"}

.la-sort-amount-up-alt:before{content:"\f885"}

.la-sort-down:before{content:"\f0dd"}

.la-sort-numeric-down:before{content:"\f162"}

.la-sort-numeric-down-alt:before{content:"\f886"}

.la-sort-numeric-up:before{content:"\f163"}

.la-sort-numeric-up-alt:before{content:"\f887"}

.la-sort-up:before{content:"\f0de"}

.la-soundcloud:before{content:"\f1be"}

.la-sourcetree:before{content:"\f7d3"}

.la-spa:before{content:"\f5bb"}

.la-space-shuttle:before{content:"\f197"}

.la-speakap:before{content:"\f3f3"}

.la-speaker-deck:before{content:"\f83c"}

.la-spell-check:before{content:"\f891"}

.la-spider:before{content:"\f717"}

.la-spinner:before{content:"\f110"}

.la-splotch:before{content:"\f5bc"}

.la-spotify:before{content:"\f1bc"}

.la-spray-can:before{content:"\f5bd"}

.la-square:before{content:"\f0c8"}

.la-square-full:before{content:"\f45c"}

.la-square-root-alt:before{content:"\f698"}

.la-squarespace:before{content:"\f5be"}

.la-stack-exchange:before{content:"\f18d"}

.la-stack-overflow:before{content:"\f16c"}

.la-stackpath:before{content:"\f842"}

.la-stamp:before{content:"\f5bf"}

.la-star:before{content:"\f005"}

.la-star-and-crescent:before{content:"\f699"}

.la-star-half:before{content:"\f089"}

.la-star-half-alt:before{content:"\f5c0"}

.la-star-of-david:before{content:"\f69a"}

.la-star-of-life:before{content:"\f621"}

.la-staylinked:before{content:"\f3f5"}

.la-steam:before{content:"\f1b6"}

.la-steam-square:before{content:"\f1b7"}

.la-steam-symbol:before{content:"\f3f6"}

.la-step-backward:before{content:"\f048"}

.la-step-forward:before{content:"\f051"}

.la-stethoscope:before{content:"\f0f1"}

.la-sticker-mule:before{content:"\f3f7"}

.la-sticky-note:before{content:"\f249"}

.la-stop:before{content:"\f04d"}

.la-stop-circle:before{content:"\f28d"}

.la-stopwatch:before{content:"\f2f2"}

.la-store:before{content:"\f54e"}

.la-store-alt:before{content:"\f54f"}

.la-strava:before{content:"\f428"}

.la-stream:before{content:"\f550"}

.la-street-view:before{content:"\f21d"}

.la-strikethrough:before{content:"\f0cc"}

.la-stripe:before{content:"\f429"}

.la-stripe-s:before{content:"\f42a"}

.la-stroopwafel:before{content:"\f551"}

.la-studiovinari:before{content:"\f3f8"}

.la-stumbleupon:before{content:"\f1a4"}

.la-stumbleupon-circle:before{content:"\f1a3"}

.la-subscript:before{content:"\f12c"}

.la-subway:before{content:"\f239"}

.la-suitcase:before{content:"\f0f2"}

.la-suitcase-rolling:before{content:"\f5c1"}

.la-sun:before{content:"\f185"}

.la-superpowers:before{content:"\f2dd"}

.la-superscript:before{content:"\f12b"}

.la-supple:before{content:"\f3f9"}

.la-surprise:before{content:"\f5c2"}

.la-suse:before{content:"\f7d6"}

.la-swatchbook:before{content:"\f5c3"}

.la-swift:before{content:"\f8e1"}

.la-swimmer:before{content:"\f5c4"}

.la-swimming-pool:before{content:"\f5c5"}

.la-symfony:before{content:"\f83d"}

.la-synagogue:before{content:"\f69b"}

.la-sync:before{content:"\f021"}

.la-sync-alt:before{content:"\f2f1"}

.la-syringe:before{content:"\f48e"}

.la-table:before{content:"\f0ce"}

.la-table-tennis:before{content:"\f45d"}

.la-tablet:before{content:"\f10a"}

.la-tablet-alt:before{content:"\f3fa"}

.la-tablets:before{content:"\f490"}

.la-tachometer-alt:before{content:"\f3fd"}

.la-tag:before{content:"\f02b"}

.la-tags:before{content:"\f02c"}

.la-tape:before{content:"\f4db"}

.la-tasks:before{content:"\f0ae"}

.la-taxi:before{content:"\f1ba"}

.la-teamspeak:before{content:"\f4f9"}

.la-teeth:before{content:"\f62e"}

.la-teeth-open:before{content:"\f62f"}

.la-telegram:before{content:"\f2c6"}

.la-telegram-plane:before{content:"\f3fe"}

.la-temperature-high:before{content:"\f769"}

.la-temperature-low:before{content:"\f76b"}

.la-tencent-weibo:before{content:"\f1d5"}

.la-tenge:before{content:"\f7d7"}

.la-terminal:before{content:"\f120"}

.la-text-height:before{content:"\f034"}

.la-text-width:before{content:"\f035"}

.la-th:before{content:"\f00a"}

.la-th-large:before{content:"\f009"}

.la-th-list:before{content:"\f00b"}

.la-the-red-yeti:before{content:"\f69d"}

.la-theater-masks:before{content:"\f630"}

.la-themeco:before{content:"\f5c6"}

.la-themeisle:before{content:"\f2b2"}

.la-thermometer:before{content:"\f491"}

.la-thermometer-empty:before{content:"\f2cb"}

.la-thermometer-full:before{content:"\f2c7"}

.la-thermometer-half:before{content:"\f2c9"}

.la-thermometer-quarter:before{content:"\f2ca"}

.la-thermometer-three-quarters:before{content:"\f2c8"}

.la-think-peaks:before{content:"\f731"}

.la-thumbs-down:before{content:"\f165"}

.la-thumbs-up:before{content:"\f164"}

.la-thumbtack:before{content:"\f08d"}

.la-ticket-alt:before{content:"\f3ff"}

.la-times:before{content:"\f00d"}

.la-times-circle:before{content:"\f057"}

.la-tint:before{content:"\f043"}

.la-tint-slash:before{content:"\f5c7"}

.la-tired:before{content:"\f5c8"}

.la-toggle-off:before{content:"\f204"}

.la-toggle-on:before{content:"\f205"}

.la-toilet:before{content:"\f7d8"}

.la-toilet-paper:before{content:"\f71e"}

.la-toolbox:before{content:"\f552"}

.la-tools:before{content:"\f7d9"}

.la-tooth:before{content:"\f5c9"}

.la-torah:before{content:"\f6a0"}

.la-torii-gate:before{content:"\f6a1"}

.la-tractor:before{content:"\f722"}

.la-trade-federation:before{content:"\f513"}

.la-trademark:before{content:"\f25c"}

.la-traffic-light:before{content:"\f637"}

.la-train:before{content:"\f238"}

.la-tram:before{content:"\f7da"}

.la-transgender:before{content:"\f224"}

.la-transgender-alt:before{content:"\f225"}

.la-trash:before{content:"\f1f8"}

.la-trash-alt:before{content:"\f2ed"}

.la-trash-restore:before{content:"\f829"}

.la-trash-restore-alt:before{content:"\f82a"}

.la-tree:before{content:"\f1bb"}

.la-trello:before{content:"\f181"}

.la-tripadvisor:before{content:"\f262"}

.la-trophy:before{content:"\f091"}

.la-truck:before{content:"\f0d1"}

.la-truck-loading:before{content:"\f4de"}

.la-truck-monster:before{content:"\f63b"}

.la-truck-moving:before{content:"\f4df"}

.la-truck-pickup:before{content:"\f63c"}

.la-tshirt:before{content:"\f553"}

.la-tty:before{content:"\f1e4"}

.la-tumblr:before{content:"\f173"}

.la-tumblr-square:before{content:"\f174"}

.la-tv:before{content:"\f26c"}

.la-twitch:before{content:"\f1e8"}

.la-twitter:before{content:"\f099"}

.la-twitter-square:before{content:"\f081"}

.la-typo3:before{content:"\f42b"}

.la-uber:before{content:"\f402"}

.la-ubuntu:before{content:"\f7df"}

.la-uikit:before{content:"\f403"}

.la-umbraco:before{content:"\f8e8"}

.la-umbrella:before{content:"\f0e9"}

.la-umbrella-beach:before{content:"\f5ca"}

.la-underline:before{content:"\f0cd"}

.la-undo:before{content:"\f0e2"}

.la-undo-alt:before{content:"\f2ea"}

.la-uniregistry:before{content:"\f404"}

.la-universal-access:before{content:"\f29a"}

.la-university:before{content:"\f19c"}

.la-unlink:before{content:"\f127"}

.la-unlock:before{content:"\f09c"}

.la-unlock-alt:before{content:"\f13e"}

.la-untappd:before{content:"\f405"}

.la-upload:before{content:"\f093"}

.la-ups:before{content:"\f7e0"}

.la-usb:before{content:"\f287"}

.la-user:before{content:"\f007"}

.la-user-alt:before{content:"\f406"}

.la-user-alt-slash:before{content:"\f4fa"}

.la-user-astronaut:before{content:"\f4fb"}

.la-user-check:before{content:"\f4fc"}

.la-user-circle:before{content:"\f2bd"}

.la-user-clock:before{content:"\f4fd"}

.la-user-cog:before{content:"\f4fe"}

.la-user-edit:before{content:"\f4ff"}

.la-user-friends:before{content:"\f500"}

.la-user-graduate:before{content:"\f501"}

.la-user-injured:before{content:"\f728"}

.la-user-lock:before{content:"\f502"}

.la-user-md:before{content:"\f0f0"}

.la-user-minus:before{content:"\f503"}

.la-user-ninja:before{content:"\f504"}

.la-user-nurse:before{content:"\f82f"}

.la-user-plus:before{content:"\f234"}

.la-user-secret:before{content:"\f21b"}

.la-user-shield:before{content:"\f505"}

.la-user-slash:before{content:"\f506"}

.la-user-tag:before{content:"\f507"}

.la-user-tie:before{content:"\f508"}

.la-user-times:before{content:"\f235"}

.la-users:before{content:"\f0c0"}

.la-users-cog:before{content:"\f509"}

.la-usps:before{content:"\f7e1"}

.la-ussunnah:before{content:"\f407"}

.la-utensil-spoon:before{content:"\f2e5"}

.la-utensils:before{content:"\f2e7"}

.la-vaadin:before{content:"\f408"}

.la-vector-square:before{content:"\f5cb"}

.la-venus:before{content:"\f221"}

.la-venus-double:before{content:"\f226"}

.la-venus-mars:before{content:"\f228"}

.la-viacoin:before{content:"\f237"}

.la-viadeo:before{content:"\f2a9"}

.la-viadeo-square:before{content:"\f2aa"}

.la-vial:before{content:"\f492"}

.la-vials:before{content:"\f493"}

.la-viber:before{content:"\f409"}

.la-video:before{content:"\f03d"}

.la-video-slash:before{content:"\f4e2"}

.la-vihara:before{content:"\f6a7"}

.la-vimeo:before{content:"\f40a"}

.la-vimeo-square:before{content:"\f194"}

.la-vimeo-v:before{content:"\f27d"}

.la-vine:before{content:"\f1ca"}

.la-vk:before{content:"\f189"}

.la-vnv:before{content:"\f40b"}

.la-voicemail:before{content:"\f897"}

.la-volleyball-ball:before{content:"\f45f"}

.la-volume-down:before{content:"\f027"}

.la-volume-mute:before{content:"\f6a9"}

.la-volume-off:before{content:"\f026"}

.la-volume-up:before{content:"\f028"}

.la-vote-yea:before{content:"\f772"}

.la-vr-cardboard:before{content:"\f729"}

.la-vuejs:before{content:"\f41f"}

.la-walking:before{content:"\f554"}

.la-wallet:before{content:"\f555"}

.la-warehouse:before{content:"\f494"}

.la-water:before{content:"\f773"}

.la-wave-square:before{content:"\f83e"}

.la-waze:before{content:"\f83f"}

.la-weebly:before{content:"\f5cc"}

.la-weibo:before{content:"\f18a"}

.la-weight:before{content:"\f496"}

.la-weight-hanging:before{content:"\f5cd"}

.la-weixin:before{content:"\f1d7"}

.la-whatsapp:before{content:"\f232"}

.la-whatsapp-square:before{content:"\f40c"}

.la-wheelchair:before{content:"\f193"}

.la-whmcs:before{content:"\f40d"}

.la-wifi:before{content:"\f1eb"}

.la-wikipedia-w:before{content:"\f266"}

.la-wind:before{content:"\f72e"}

.la-window-close:before{content:"\f410"}

.la-window-maximize:before{content:"\f2d0"}

.la-window-minimize:before{content:"\f2d1"}

.la-window-restore:before{content:"\f2d2"}

.la-windows:before{content:"\f17a"}

.la-wine-bottle:before{content:"\f72f"}

.la-wine-glass:before{content:"\f4e3"}

.la-wine-glass-alt:before{content:"\f5ce"}

.la-wix:before{content:"\f5cf"}

.la-wizards-of-the-coast:before{content:"\f730"}

.la-wolf-pack-battalion:before{content:"\f514"}

.la-won-sign:before{content:"\f159"}

.la-wordpress:before{content:"\f19a"}

.la-wordpress-simple:before{content:"\f411"}

.la-wpbeginner:before{content:"\f297"}

.la-wpexplorer:before{content:"\f2de"}

.la-wpforms:before{content:"\f298"}

.la-wpressr:before{content:"\f3e4"}

.la-wrench:before{content:"\f0ad"}

.la-x-ray:before{content:"\f497"}

.la-xbox:before{content:"\f412"}

.la-xing:before{content:"\f168"}

.la-xing-square:before{content:"\f169"}

.la-y-combinator:before{content:"\f23b"}

.la-yahoo:before{content:"\f19e"}

.la-yammer:before{content:"\f840"}

.la-yandex:before{content:"\f413"}

.la-yandex-international:before{content:"\f414"}

.la-yarn:before{content:"\f7e3"}

.la-yelp:before{content:"\f1e9"}

.la-yen-sign:before{content:"\f157"}

.la-yin-yang:before{content:"\f6ad"}

.la-yoast:before{content:"\f2b1"}

.la-youtube:before{content:"\f167"}

.la-youtube-square:before{content:"\f431"}

.la-zhihu:before{content:"\f63f"}

.sr-only{border:0;clip:rect(0,0,0,0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}

.sr-only-focusable:active,.sr-only-focusable:focus{clip:auto;height:auto;margin:0;overflow:visible;position:static;width:auto}

@font-face{font-family:'Line Awesome Brands';font-style:normal;font-weight:400;font-display:auto;src:url('la-brands-400.48e899639c6bf6a0.eot');src:url('la-brands-400d41d.48e899639c6bf6a0.eot?#iefix') format("embedded-opentype"),url('la-brands-400.122c41372c4c30ef.woff2') format("woff2"),url('la-brands-400.1ec1f0f5e9b47729.woff') format("woff"),url('la-brands-400.4343d0c03a27309c.ttf') format("truetype"),url('la-brands-400.255e371cc11b00e7.svg#lineawesome') format("svg")}

.lab{font-family:'Line Awesome Brands'}

@font-face{font-family:'Line Awesome Free';font-style:normal;font-weight:400;font-display:auto;src:url('la-regular-400.7b67c53353bb145e.eot');src:url('la-regular-400d41d.7b67c53353bb145e.eot?#iefix') format("embedded-opentype"),url('la-regular-400.bfaaab46568c49b1.woff2') format("woff2"),url('la-regular-400.f45e994d16040925.woff') format("woff"),url('la-regular-400.df0ba4ff195ecd4d.ttf') format("truetype"),url('la-regular-400.441d624440764b03.svg#lineawesome') format("svg")}

.lar{font-family:'Line Awesome Free';font-weight:400}

@font-face{font-family:'Line Awesome Free';font-style:normal;font-weight:900;font-display:auto;src:url('la-solid-900.85692007dc7434ae.eot');src:url('la-solid-900d41d.85692007dc7434ae.eot?#iefix') format("embedded-opentype"),url('la-solid-900.8e5c796f7b2aed25.woff2') format("woff2"),url('la-solid-900.7dd8151283d9b172.woff') format("woff"),url('la-solid-900.582c3a0f88bd2b11.ttf') format("truetype"),url('la-solid-900.168040a9b57b3922.svg#lineawesome') format("svg")}

.la,.las{font-family:'Line Awesome Free';font-weight:900}

.la.la-glass:before{content:"\f000"}

.la.la-meetup{font-family:'Line Awesome Brands';font-weight:400}

.la.la-star-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-star-o:before{content:"\f005"}

.la.la-remove:before{content:"\f00d"}

.la.la-close:before{content:"\f00d"}

.la.la-gear:before{content:"\f013"}

.la.la-trash-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-trash-o:before{content:"\f2ed"}

.la.la-file-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-o:before{content:"\f15b"}

.la.la-clock-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-clock-o:before{content:"\f017"}

.la.la-arrow-circle-o-down{font-family:'Line Awesome Free';font-weight:400}

.la.la-arrow-circle-o-down:before{content:"\f358"}

.la.la-arrow-circle-o-up{font-family:'Line Awesome Free';font-weight:400}

.la.la-arrow-circle-o-up:before{content:"\f35b"}

.la.la-play-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-play-circle-o:before{content:"\f144"}

.la.la-repeat:before{content:"\f01e"}

.la.la-rotate-right:before{content:"\f01e"}

.la.la-refresh:before{content:"\f021"}

.la.la-list-alt{font-family:'Line Awesome Free';font-weight:400}

.la.la-dedent:before{content:"\f03b"}

.la.la-video-camera:before{content:"\f03d"}

.la.la-picture-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-picture-o:before{content:"\f03e"}

.la.la-photo{font-family:'Line Awesome Free';font-weight:400}

.la.la-photo:before{content:"\f03e"}

.la.la-image{font-family:'Line Awesome Free';font-weight:400}

.la.la-image:before{content:"\f03e"}

.la.la-pencil:before{content:"\f303"}

.la.la-map-marker:before{content:"\f3c5"}

.la.la-pencil-square-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-pencil-square-o:before{content:"\f044"}

.la.la-share-square-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-share-square-o:before{content:"\f14d"}

.la.la-check-square-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-check-square-o:before{content:"\f14a"}

.la.la-arrows:before{content:"\f0b2"}

.la.la-times-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-times-circle-o:before{content:"\f057"}

.la.la-check-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-check-circle-o:before{content:"\f058"}

.la.la-mail-forward:before{content:"\f064"}

.la.la-eye{font-family:'Line Awesome Free';font-weight:400}

.la.la-eye-slash{font-family:'Line Awesome Free';font-weight:400}

.la.la-warning:before{content:"\f071"}

.la.la-calendar:before{content:"\f073"}

.la.la-arrows-v:before{content:"\f338"}

.la.la-arrows-h:before{content:"\f337"}

.la.la-bar-chart{font-family:'Line Awesome Free';font-weight:400}

.la.la-bar-chart:before{content:"\f080"}

.la.la-bar-chart-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-bar-chart-o:before{content:"\f080"}

.la.la-twitter-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-facebook-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gears:before{content:"\f085"}

.la.la-thumbs-o-up{font-family:'Line Awesome Free';font-weight:400}

.la.la-thumbs-o-up:before{content:"\f164"}

.la.la-thumbs-o-down{font-family:'Line Awesome Free';font-weight:400}

.la.la-thumbs-o-down:before{content:"\f165"}

.la.la-heart-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-heart-o:before{content:"\f004"}

.la.la-sign-out:before{content:"\f2f5"}

.la.la-linkedin-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-linkedin-square:before{content:"\f08c"}

.la.la-thumb-tack:before{content:"\f08d"}

.la.la-external-link:before{content:"\f35d"}

.la.la-sign-in:before{content:"\f2f6"}

.la.la-github-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-lemon-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-lemon-o:before{content:"\f094"}

.la.la-square-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-square-o:before{content:"\f0c8"}

.la.la-bookmark-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-bookmark-o:before{content:"\f02e"}

.la.la-twitter{font-family:'Line Awesome Brands';font-weight:400}

.la.la-facebook{font-family:'Line Awesome Brands';font-weight:400}

.la.la-facebook:before{content:"\f39e"}

.la.la-facebook-f{font-family:'Line Awesome Brands';font-weight:400}

.la.la-facebook-f:before{content:"\f39e"}

.la.la-github{font-family:'Line Awesome Brands';font-weight:400}

.la.la-credit-card{font-family:'Line Awesome Free';font-weight:400}

.la.la-feed:before{content:"\f09e"}

.la.la-hdd-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hdd-o:before{content:"\f0a0"}

.la.la-hand-o-right{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-o-right:before{content:"\f0a4"}

.la.la-hand-o-left{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-o-left:before{content:"\f0a5"}

.la.la-hand-o-up{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-o-up:before{content:"\f0a6"}

.la.la-hand-o-down{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-o-down:before{content:"\f0a7"}

.la.la-arrows-alt:before{content:"\f31e"}

.la.la-group:before{content:"\f0c0"}

.la.la-chain:before{content:"\f0c1"}

.la.la-scissors:before{content:"\f0c4"}

.la.la-files-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-files-o:before{content:"\f0c5"}

.la.la-floppy-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-floppy-o:before{content:"\f0c7"}

.la.la-navicon:before{content:"\f0c9"}

.la.la-reorder:before{content:"\f0c9"}

.la.la-pinterest{font-family:'Line Awesome Brands';font-weight:400}

.la.la-pinterest-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-plus-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-plus{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-plus:before{content:"\f0d5"}

.la.la-money{font-family:'Line Awesome Free';font-weight:400}

.la.la-money:before{content:"\f3d1"}

.la.la-unsorted:before{content:"\f0dc"}

.la.la-sort-desc:before{content:"\f0dd"}

.la.la-sort-asc:before{content:"\f0de"}

.la.la-linkedin{font-family:'Line Awesome Brands';font-weight:400}

.la.la-linkedin:before{content:"\f0e1"}

.la.la-rotate-left:before{content:"\f0e2"}

.la.la-legal:before{content:"\f0e3"}

.la.la-tachometer:before{content:"\f3fd"}

.la.la-dashboard:before{content:"\f3fd"}

.la.la-comment-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-comment-o:before{content:"\f075"}

.la.la-comments-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-comments-o:before{content:"\f086"}

.la.la-flash:before{content:"\f0e7"}

.la.la-clipboard{font-family:'Line Awesome Free';font-weight:400}

.la.la-paste{font-family:'Line Awesome Free';font-weight:400}

.la.la-paste:before{content:"\f328"}

.la.la-lightbulb-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-lightbulb-o:before{content:"\f0eb"}

.la.la-exchange:before{content:"\f362"}

.la.la-cloud-download:before{content:"\f381"}

.la.la-cloud-upload:before{content:"\f382"}

.la.la-bell-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-bell-o:before{content:"\f0f3"}

.la.la-cutlery:before{content:"\f2e7"}

.la.la-file-text-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-text-o:before{content:"\f15c"}

.la.la-building-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-building-o:before{content:"\f1ad"}

.la.la-hospital-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hospital-o:before{content:"\f0f8"}

.la.la-tablet:before{content:"\f3fa"}

.la.la-mobile:before{content:"\f3cd"}

.la.la-mobile-phone:before{content:"\f3cd"}

.la.la-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-circle-o:before{content:"\f111"}

.la.la-mail-reply:before{content:"\f3e5"}

.la.la-github-alt{font-family:'Line Awesome Brands';font-weight:400}

.la.la-folder-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-folder-o:before{content:"\f07b"}

.la.la-folder-open-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-folder-open-o:before{content:"\f07c"}

.la.la-smile-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-smile-o:before{content:"\f118"}

.la.la-frown-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-frown-o:before{content:"\f119"}

.la.la-meh-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-meh-o:before{content:"\f11a"}

.la.la-keyboard-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-keyboard-o:before{content:"\f11c"}

.la.la-flag-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-flag-o:before{content:"\f024"}

.la.la-mail-reply-all:before{content:"\f122"}

.la.la-star-half-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-star-half-o:before{content:"\f089"}

.la.la-star-half-empty{font-family:'Line Awesome Free';font-weight:400}

.la.la-star-half-empty:before{content:"\f089"}

.la.la-star-half-full{font-family:'Line Awesome Free';font-weight:400}

.la.la-star-half-full:before{content:"\f089"}

.la.la-code-fork:before{content:"\f126"}

.la.la-chain-broken:before{content:"\f127"}

.la.la-shield:before{content:"\f3ed"}

.la.la-calendar-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-calendar-o:before{content:"\f133"}

.la.la-maxcdn{font-family:'Line Awesome Brands';font-weight:400}

.la.la-html5{font-family:'Line Awesome Brands';font-weight:400}

.la.la-css3{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ticket:before{content:"\f3ff"}

.la.la-minus-square-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-minus-square-o:before{content:"\f146"}

.la.la-level-up:before{content:"\f3bf"}

.la.la-level-down:before{content:"\f3be"}

.la.la-pencil-square:before{content:"\f14b"}

.la.la-external-link-square:before{content:"\f360"}

.la.la-compass{font-family:'Line Awesome Free';font-weight:400}

.la.la-caret-square-o-down{font-family:'Line Awesome Free';font-weight:400}

.la.la-caret-square-o-down:before{content:"\f150"}

.la.la-toggle-down{font-family:'Line Awesome Free';font-weight:400}

.la.la-toggle-down:before{content:"\f150"}

.la.la-caret-square-o-up{font-family:'Line Awesome Free';font-weight:400}

.la.la-caret-square-o-up:before{content:"\f151"}

.la.la-toggle-up{font-family:'Line Awesome Free';font-weight:400}

.la.la-toggle-up:before{content:"\f151"}

.la.la-caret-square-o-right{font-family:'Line Awesome Free';font-weight:400}

.la.la-caret-square-o-right:before{content:"\f152"}

.la.la-toggle-right{font-family:'Line Awesome Free';font-weight:400}

.la.la-toggle-right:before{content:"\f152"}

.la.la-eur:before{content:"\f153"}

.la.la-euro:before{content:"\f153"}

.la.la-gbp:before{content:"\f154"}

.la.la-usd:before{content:"\f155"}

.la.la-dollar:before{content:"\f155"}

.la.la-inr:before{content:"\f156"}

.la.la-rupee:before{content:"\f156"}

.la.la-jpy:before{content:"\f157"}

.la.la-cny:before{content:"\f157"}

.la.la-rmb:before{content:"\f157"}

.la.la-yen:before{content:"\f157"}

.la.la-rub:before{content:"\f158"}

.la.la-ruble:before{content:"\f158"}

.la.la-rouble:before{content:"\f158"}

.la.la-krw:before{content:"\f159"}

.la.la-won:before{content:"\f159"}

.la.la-btc{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bitcoin{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bitcoin:before{content:"\f15a"}

.la.la-file-text:before{content:"\f15c"}

.la.la-sort-alpha-asc:before{content:"\f15d"}

.la.la-sort-alpha-desc:before{content:"\f881"}

.la.la-sort-amount-asc:before{content:"\f160"}

.la.la-sort-amount-desc:before{content:"\f884"}

.la.la-sort-numeric-asc:before{content:"\f162"}

.la.la-sort-numeric-desc:before{content:"\f886"}

.la.la-youtube-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-youtube{font-family:'Line Awesome Brands';font-weight:400}

.la.la-xing{font-family:'Line Awesome Brands';font-weight:400}

.la.la-xing-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-youtube-play{font-family:'Line Awesome Brands';font-weight:400}

.la.la-youtube-play:before{content:"\f167"}

.la.la-dropbox{font-family:'Line Awesome Brands';font-weight:400}

.la.la-stack-overflow{font-family:'Line Awesome Brands';font-weight:400}

.la.la-instagram{font-family:'Line Awesome Brands';font-weight:400}

.la.la-flickr{font-family:'Line Awesome Brands';font-weight:400}

.la.la-adn{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bitbucket{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bitbucket-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bitbucket-square:before{content:"\f171"}

.la.la-tumblr{font-family:'Line Awesome Brands';font-weight:400}

.la.la-tumblr-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-long-arrow-down:before{content:"\f309"}

.la.la-long-arrow-up:before{content:"\f30c"}

.la.la-long-arrow-left:before{content:"\f30a"}

.la.la-long-arrow-right:before{content:"\f30b"}

.la.la-apple{font-family:'Line Awesome Brands';font-weight:400}

.la.la-windows{font-family:'Line Awesome Brands';font-weight:400}

.la.la-android{font-family:'Line Awesome Brands';font-weight:400}

.la.la-linux{font-family:'Line Awesome Brands';font-weight:400}

.la.la-dribbble{font-family:'Line Awesome Brands';font-weight:400}

.la.la-skype{font-family:'Line Awesome Brands';font-weight:400}

.la.la-foursquare{font-family:'Line Awesome Brands';font-weight:400}

.la.la-trello{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gratipay{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gittip{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gittip:before{content:"\f184"}

.la.la-sun-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-sun-o:before{content:"\f185"}

.la.la-moon-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-moon-o:before{content:"\f186"}

.la.la-vk{font-family:'Line Awesome Brands';font-weight:400}

.la.la-weibo{font-family:'Line Awesome Brands';font-weight:400}

.la.la-renren{font-family:'Line Awesome Brands';font-weight:400}

.la.la-pagelines{font-family:'Line Awesome Brands';font-weight:400}

.la.la-stack-exchange{font-family:'Line Awesome Brands';font-weight:400}

.la.la-arrow-circle-o-right{font-family:'Line Awesome Free';font-weight:400}

.la.la-arrow-circle-o-right:before{content:"\f35a"}

.la.la-arrow-circle-o-left{font-family:'Line Awesome Free';font-weight:400}

.la.la-arrow-circle-o-left:before{content:"\f359"}

.la.la-caret-square-o-left{font-family:'Line Awesome Free';font-weight:400}

.la.la-caret-square-o-left:before{content:"\f191"}

.la.la-toggle-left{font-family:'Line Awesome Free';font-weight:400}

.la.la-toggle-left:before{content:"\f191"}

.la.la-dot-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-dot-circle-o:before{content:"\f192"}

.la.la-vimeo-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-try:before{content:"\f195"}

.la.la-turkish-lira:before{content:"\f195"}

.la.la-plus-square-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-plus-square-o:before{content:"\f0fe"}

.la.la-slack{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wordpress{font-family:'Line Awesome Brands';font-weight:400}

.la.la-openid{font-family:'Line Awesome Brands';font-weight:400}

.la.la-institution:before{content:"\f19c"}

.la.la-bank:before{content:"\f19c"}

.la.la-mortar-board:before{content:"\f19d"}

.la.la-yahoo{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google{font-family:'Line Awesome Brands';font-weight:400}

.la.la-reddit{font-family:'Line Awesome Brands';font-weight:400}

.la.la-reddit-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-stumbleupon-circle{font-family:'Line Awesome Brands';font-weight:400}

.la.la-stumbleupon{font-family:'Line Awesome Brands';font-weight:400}

.la.la-delicious{font-family:'Line Awesome Brands';font-weight:400}

.la.la-digg{font-family:'Line Awesome Brands';font-weight:400}

.la.la-pied-piper-pp{font-family:'Line Awesome Brands';font-weight:400}

.la.la-pied-piper-alt{font-family:'Line Awesome Brands';font-weight:400}

.la.la-drupal{font-family:'Line Awesome Brands';font-weight:400}

.la.la-joomla{font-family:'Line Awesome Brands';font-weight:400}

.la.la-spoon:before{content:"\f2e5"}

.la.la-behance{font-family:'Line Awesome Brands';font-weight:400}

.la.la-behance-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-steam{font-family:'Line Awesome Brands';font-weight:400}

.la.la-steam-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-automobile:before{content:"\f1b9"}

.la.la-cab:before{content:"\f1ba"}

.la.la-envelope-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-envelope-o:before{content:"\f0e0"}

.la.la-deviantart{font-family:'Line Awesome Brands';font-weight:400}

.la.la-soundcloud{font-family:'Line Awesome Brands';font-weight:400}

.la.la-file-pdf-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-pdf-o:before{content:"\f1c1"}

.la.la-file-word-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-word-o:before{content:"\f1c2"}

.la.la-file-excel-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-excel-o:before{content:"\f1c3"}

.la.la-file-powerpoint-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-powerpoint-o:before{content:"\f1c4"}

.la.la-file-image-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-image-o:before{content:"\f1c5"}

.la.la-file-photo-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-photo-o:before{content:"\f1c5"}

.la.la-file-picture-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-picture-o:before{content:"\f1c5"}

.la.la-file-archive-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-archive-o:before{content:"\f1c6"}

.la.la-file-zip-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-zip-o:before{content:"\f1c6"}

.la.la-file-audio-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-audio-o:before{content:"\f1c7"}

.la.la-file-sound-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-sound-o:before{content:"\f1c7"}

.la.la-file-video-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-video-o:before{content:"\f1c8"}

.la.la-file-movie-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-movie-o:before{content:"\f1c8"}

.la.la-file-code-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-file-code-o:before{content:"\f1c9"}

.la.la-vine{font-family:'Line Awesome Brands';font-weight:400}

.la.la-codepen{font-family:'Line Awesome Brands';font-weight:400}

.la.la-jsfiddle{font-family:'Line Awesome Brands';font-weight:400}

.la.la-life-ring{font-family:'Line Awesome Free';font-weight:400}

.la.la-life-bouy{font-family:'Line Awesome Free';font-weight:400}

.la.la-life-bouy:before{content:"\f1cd"}

.la.la-life-buoy{font-family:'Line Awesome Free';font-weight:400}

.la.la-life-buoy:before{content:"\f1cd"}

.la.la-life-saver{font-family:'Line Awesome Free';font-weight:400}

.la.la-life-saver:before{content:"\f1cd"}

.la.la-support{font-family:'Line Awesome Free';font-weight:400}

.la.la-support:before{content:"\f1cd"}

.la.la-circle-o-notch:before{content:"\f1ce"}

.la.la-rebel{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ra{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ra:before{content:"\f1d0"}

.la.la-resistance{font-family:'Line Awesome Brands';font-weight:400}

.la.la-resistance:before{content:"\f1d0"}

.la.la-empire{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ge{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ge:before{content:"\f1d1"}

.la.la-git-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-git{font-family:'Line Awesome Brands';font-weight:400}

.la.la-hacker-news{font-family:'Line Awesome Brands';font-weight:400}

.la.la-y-combinator-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-y-combinator-square:before{content:"\f1d4"}

.la.la-yc-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-yc-square:before{content:"\f1d4"}

.la.la-tencent-weibo{font-family:'Line Awesome Brands';font-weight:400}

.la.la-qq{font-family:'Line Awesome Brands';font-weight:400}

.la.la-weixin{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wechat{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wechat:before{content:"\f1d7"}

.la.la-send:before{content:"\f1d8"}

.la.la-paper-plane-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-paper-plane-o:before{content:"\f1d8"}

.la.la-send-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-send-o:before{content:"\f1d8"}

.la.la-circle-thin{font-family:'Line Awesome Free';font-weight:400}

.la.la-circle-thin:before{content:"\f111"}

.la.la-header:before{content:"\f1dc"}

.la.la-sliders:before{content:"\f1de"}

.la.la-futbol-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-futbol-o:before{content:"\f1e3"}

.la.la-soccer-ball-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-soccer-ball-o:before{content:"\f1e3"}

.la.la-slideshare{font-family:'Line Awesome Brands';font-weight:400}

.la.la-twitch{font-family:'Line Awesome Brands';font-weight:400}

.la.la-yelp{font-family:'Line Awesome Brands';font-weight:400}

.la.la-newspaper-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-newspaper-o:before{content:"\f1ea"}

.la.la-paypal{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-wallet{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-visa{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-mastercard{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-discover{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-amex{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-paypal{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-stripe{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bell-slash-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-bell-slash-o:before{content:"\f1f6"}

.la.la-trash:before{content:"\f2ed"}

.la.la-copyright{font-family:'Line Awesome Free';font-weight:400}

.la.la-eyedropper:before{content:"\f1fb"}

.la.la-area-chart:before{content:"\f1fe"}

.la.la-pie-chart:before{content:"\f200"}

.la.la-line-chart:before{content:"\f201"}

.la.la-lastfm{font-family:'Line Awesome Brands';font-weight:400}

.la.la-lastfm-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ioxhost{font-family:'Line Awesome Brands';font-weight:400}

.la.la-angellist{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc{font-family:'Line Awesome Free';font-weight:400}

.la.la-cc:before{content:"\f20a"}

.la.la-ils:before{content:"\f20b"}

.la.la-shekel:before{content:"\f20b"}

.la.la-sheqel:before{content:"\f20b"}

.la.la-meanpath{font-family:'Line Awesome Brands';font-weight:400}

.la.la-meanpath:before{content:"\f2b4"}

.la.la-buysellads{font-family:'Line Awesome Brands';font-weight:400}

.la.la-connectdevelop{font-family:'Line Awesome Brands';font-weight:400}

.la.la-dashcube{font-family:'Line Awesome Brands';font-weight:400}

.la.la-forumbee{font-family:'Line Awesome Brands';font-weight:400}

.la.la-leanpub{font-family:'Line Awesome Brands';font-weight:400}

.la.la-sellsy{font-family:'Line Awesome Brands';font-weight:400}

.la.la-shirtsinbulk{font-family:'Line Awesome Brands';font-weight:400}

.la.la-simplybuilt{font-family:'Line Awesome Brands';font-weight:400}

.la.la-skyatlas{font-family:'Line Awesome Brands';font-weight:400}

.la.la-diamond{font-family:'Line Awesome Free';font-weight:400}

.la.la-diamond:before{content:"\f3a5"}

.la.la-intersex:before{content:"\f224"}

.la.la-facebook-official{font-family:'Line Awesome Brands';font-weight:400}

.la.la-facebook-official:before{content:"\f09a"}

.la.la-pinterest-p{font-family:'Line Awesome Brands';font-weight:400}

.la.la-whatsapp{font-family:'Line Awesome Brands';font-weight:400}

.la.la-hotel:before{content:"\f236"}

.la.la-viacoin{font-family:'Line Awesome Brands';font-weight:400}

.la.la-medium{font-family:'Line Awesome Brands';font-weight:400}

.la.la-y-combinator{font-family:'Line Awesome Brands';font-weight:400}

.la.la-yc{font-family:'Line Awesome Brands';font-weight:400}

.la.la-yc:before{content:"\f23b"}

.la.la-optin-monster{font-family:'Line Awesome Brands';font-weight:400}

.la.la-opencart{font-family:'Line Awesome Brands';font-weight:400}

.la.la-expeditedssl{font-family:'Line Awesome Brands';font-weight:400}

.la.la-battery-4:before{content:"\f240"}

.la.la-battery:before{content:"\f240"}

.la.la-battery-3:before{content:"\f241"}

.la.la-battery-2:before{content:"\f242"}

.la.la-battery-1:before{content:"\f243"}

.la.la-battery-0:before{content:"\f244"}

.la.la-object-group{font-family:'Line Awesome Free';font-weight:400}

.la.la-object-ungroup{font-family:'Line Awesome Free';font-weight:400}

.la.la-sticky-note-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-sticky-note-o:before{content:"\f249"}

.la.la-cc-jcb{font-family:'Line Awesome Brands';font-weight:400}

.la.la-cc-diners-club{font-family:'Line Awesome Brands';font-weight:400}

.la.la-clone{font-family:'Line Awesome Free';font-weight:400}

.la.la-hourglass-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hourglass-o:before{content:"\f254"}

.la.la-hourglass-1:before{content:"\f251"}

.la.la-hourglass-2:before{content:"\f252"}

.la.la-hourglass-3:before{content:"\f253"}

.la.la-hand-rock-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-rock-o:before{content:"\f255"}

.la.la-hand-grab-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-grab-o:before{content:"\f255"}

.la.la-hand-paper-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-paper-o:before{content:"\f256"}

.la.la-hand-stop-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-stop-o:before{content:"\f256"}

.la.la-hand-scissors-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-scissors-o:before{content:"\f257"}

.la.la-hand-lizard-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-lizard-o:before{content:"\f258"}

.la.la-hand-spock-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-spock-o:before{content:"\f259"}

.la.la-hand-pointer-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-pointer-o:before{content:"\f25a"}

.la.la-hand-peace-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-hand-peace-o:before{content:"\f25b"}

.la.la-registered{font-family:'Line Awesome Free';font-weight:400}

.la.la-creative-commons{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gg{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gg-circle{font-family:'Line Awesome Brands';font-weight:400}

.la.la-tripadvisor{font-family:'Line Awesome Brands';font-weight:400}

.la.la-odnoklassniki{font-family:'Line Awesome Brands';font-weight:400}

.la.la-odnoklassniki-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-get-pocket{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wikipedia-w{font-family:'Line Awesome Brands';font-weight:400}

.la.la-safari{font-family:'Line Awesome Brands';font-weight:400}

.la.la-chrome{font-family:'Line Awesome Brands';font-weight:400}

.la.la-firefox{font-family:'Line Awesome Brands';font-weight:400}

.la.la-opera{font-family:'Line Awesome Brands';font-weight:400}

.la.la-internet-explorer{font-family:'Line Awesome Brands';font-weight:400}

.la.la-television:before{content:"\f26c"}

.la.la-contao{font-family:'Line Awesome Brands';font-weight:400}

.la.la-500px{font-family:'Line Awesome Brands';font-weight:400}

.la.la-amazon{font-family:'Line Awesome Brands';font-weight:400}

.la.la-calendar-plus-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-calendar-plus-o:before{content:"\f271"}

.la.la-calendar-minus-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-calendar-minus-o:before{content:"\f272"}

.la.la-calendar-times-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-calendar-times-o:before{content:"\f273"}

.la.la-calendar-check-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-calendar-check-o:before{content:"\f274"}

.la.la-map-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-map-o:before{content:"\f279"}

.la.la-commenting:before{content:"\f4ad"}

.la.la-commenting-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-commenting-o:before{content:"\f4ad"}

.la.la-houzz{font-family:'Line Awesome Brands';font-weight:400}

.la.la-vimeo{font-family:'Line Awesome Brands';font-weight:400}

.la.la-vimeo:before{content:"\f27d"}

.la.la-black-tie{font-family:'Line Awesome Brands';font-weight:400}

.la.la-fonticons{font-family:'Line Awesome Brands';font-weight:400}

.la.la-reddit-alien{font-family:'Line Awesome Brands';font-weight:400}

.la.la-edge{font-family:'Line Awesome Brands';font-weight:400}

.la.la-credit-card-alt:before{content:"\f09d"}

.la.la-codiepie{font-family:'Line Awesome Brands';font-weight:400}

.la.la-modx{font-family:'Line Awesome Brands';font-weight:400}

.la.la-fort-awesome{font-family:'Line Awesome Brands';font-weight:400}

.la.la-usb{font-family:'Line Awesome Brands';font-weight:400}

.la.la-product-hunt{font-family:'Line Awesome Brands';font-weight:400}

.la.la-mixcloud{font-family:'Line Awesome Brands';font-weight:400}

.la.la-scribd{font-family:'Line Awesome Brands';font-weight:400}

.la.la-pause-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-pause-circle-o:before{content:"\f28b"}

.la.la-stop-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-stop-circle-o:before{content:"\f28d"}

.la.la-bluetooth{font-family:'Line Awesome Brands';font-weight:400}

.la.la-bluetooth-b{font-family:'Line Awesome Brands';font-weight:400}

.la.la-gitlab{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wpbeginner{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wpforms{font-family:'Line Awesome Brands';font-weight:400}

.la.la-envira{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wheelchair-alt{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wheelchair-alt:before{content:"\f368"}

.la.la-question-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-question-circle-o:before{content:"\f059"}

.la.la-volume-control-phone:before{content:"\f2a0"}

.la.la-asl-interpreting:before{content:"\f2a3"}

.la.la-deafness:before{content:"\f2a4"}

.la.la-hard-of-hearing:before{content:"\f2a4"}

.la.la-glide{font-family:'Line Awesome Brands';font-weight:400}

.la.la-glide-g{font-family:'Line Awesome Brands';font-weight:400}

.la.la-signing:before{content:"\f2a7"}

.la.la-viadeo{font-family:'Line Awesome Brands';font-weight:400}

.la.la-viadeo-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-snapchat{font-family:'Line Awesome Brands';font-weight:400}

.la.la-snapchat-ghost{font-family:'Line Awesome Brands';font-weight:400}

.la.la-snapchat-square{font-family:'Line Awesome Brands';font-weight:400}

.la.la-pied-piper{font-family:'Line Awesome Brands';font-weight:400}

.la.la-first-order{font-family:'Line Awesome Brands';font-weight:400}

.la.la-yoast{font-family:'Line Awesome Brands';font-weight:400}

.la.la-themeisle{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-plus-official{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-plus-official:before{content:"\f2b3"}

.la.la-google-plus-circle{font-family:'Line Awesome Brands';font-weight:400}

.la.la-google-plus-circle:before{content:"\f2b3"}

.la.la-font-awesome{font-family:'Line Awesome Brands';font-weight:400}

.la.la-fa{font-family:'Line Awesome Brands';font-weight:400}

.la.la-fa:before{content:"\f2b4"}

.la.la-handshake-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-handshake-o:before{content:"\f2b5"}

.la.la-envelope-open-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-envelope-open-o:before{content:"\f2b6"}

.la.la-linode{font-family:'Line Awesome Brands';font-weight:400}

.la.la-address-book-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-address-book-o:before{content:"\f2b9"}

.la.la-vcard:before{content:"\f2bb"}

.la.la-address-card-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-address-card-o:before{content:"\f2bb"}

.la.la-vcard-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-vcard-o:before{content:"\f2bb"}

.la.la-user-circle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-user-circle-o:before{content:"\f2bd"}

.la.la-user-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-user-o:before{content:"\f007"}

.la.la-id-badge{font-family:'Line Awesome Free';font-weight:400}

.la.la-drivers-license:before{content:"\f2c2"}

.la.la-id-card-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-id-card-o:before{content:"\f2c2"}

.la.la-drivers-license-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-drivers-license-o:before{content:"\f2c2"}

.la.la-quora{font-family:'Line Awesome Brands';font-weight:400}

.la.la-free-code-camp{font-family:'Line Awesome Brands';font-weight:400}

.la.la-telegram{font-family:'Line Awesome Brands';font-weight:400}

.la.la-thermometer-4:before{content:"\f2c7"}

.la.la-thermometer:before{content:"\f2c7"}

.la.la-thermometer-3:before{content:"\f2c8"}

.la.la-thermometer-2:before{content:"\f2c9"}

.la.la-thermometer-1:before{content:"\f2ca"}

.la.la-thermometer-0:before{content:"\f2cb"}

.la.la-bathtub:before{content:"\f2cd"}

.la.la-s15:before{content:"\f2cd"}

.la.la-window-maximize{font-family:'Line Awesome Free';font-weight:400}

.la.la-window-restore{font-family:'Line Awesome Free';font-weight:400}

.la.la-times-rectangle:before{content:"\f410"}

.la.la-window-close-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-window-close-o:before{content:"\f410"}

.la.la-times-rectangle-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-times-rectangle-o:before{content:"\f410"}

.la.la-bandcamp{font-family:'Line Awesome Brands';font-weight:400}

.la.la-grav{font-family:'Line Awesome Brands';font-weight:400}

.la.la-etsy{font-family:'Line Awesome Brands';font-weight:400}

.la.la-imdb{font-family:'Line Awesome Brands';font-weight:400}

.la.la-ravelry{font-family:'Line Awesome Brands';font-weight:400}

.la.la-eercast{font-family:'Line Awesome Brands';font-weight:400}

.la.la-eercast:before{content:"\f2da"}

.la.la-snowflake-o{font-family:'Line Awesome Free';font-weight:400}

.la.la-snowflake-o:before{content:"\f2dc"}

.la.la-superpowers{font-family:'Line Awesome Brands';font-weight:400}

.la.la-wpexplorer{font-family:'Line Awesome Brands';font-weight:400}

.la.la-spotify{font-family:'Line Awesome Brands';font-weight:400}

/* Using a url */

@font-face{font-family:avasta;src:url('avasta.58cec1a297e4815e.eot');src:url('avasta.58cec1a297e4815e.eot') format('embedded-opentype'),url('avasta.ab041d358992285b.woff2') format('woff2'),url('avasta.4158faa6dc812a2e.woff') format('woff'),url('avasta.c72239725ae33cd1.ttf') format('truetype'),url('avasta.8e4f4521b2e24902.svg') format('svg');font-weight:400;font-style:normal}

.icon{display:inline-block;font:normal normal normal 1em/1 avasta;speak:none;text-transform:none;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}

.icon-sm{font-size:.8em}

.icon-lg{font-size:1.2em}

.icon-16{font-size:16px}

.icon-32{font-size:32px}

.icon-bg-circle,.icon-bg-square{padding:.35em;background-color:#eee}

.icon-bg-circle{border-radius:50%}

.icon-ul{padding-left:0;list-style-type:none}

.icon-ul>li{display:flex;align-items:flex-start;line-height:1.4}

.icon-ul>li>.icon{margin-right:.4em;line-height:inherit}

.icon-is-spinning{animation:icon-spin 2s infinite linear}

@keyframes icon-spin{0%{transform:rotate(0)}100%{transform:rotate(360deg)}}

.icon-rotate-90{transform:rotate(90deg)}

.icon-rotate-180{transform:rotate(180deg)}

.icon-rotate-270{transform:rotate(270deg)}

.icon-flip-y{transform:scale(-1,1)}

.icon-flip-x{transform:scale(1,-1)}

.icon-cloud-download-95::before{content:"\ea02"}

.icon-home-minimal::before{content:"\ea03"}

.icon-single-04::before{content:"\ea04"}

.icon-users-mm::before{content:"\ea05"}

.icon-webpage::before{content:"\ea06"}

.icon-layout-25::before{content:"\ea07"}

.icon-analytics::before{content:"\ea08"}

.icon-chart-pie-36::before{content:"\ea09"}

.icon-chart-bar-33::before{content:"\ea0a"}

.icon-single-copy-06::before{content:"\ea0b"}

.icon-home::before{content:"\ea0c"}

.icon-single-content-03::before{content:"\ea0d"}

.icon-bell-53::before{content:"\ea0e"}

.icon-email-84::before{content:"\ea0f"}

.icon-send::before{content:"\ea10"}

.icon-at-sign::before{content:"\ea11"}

.icon-attach-87::before{content:"\ea12"}

.icon-edit-72::before{content:"\ea13"}

.icon-tail-right::before{content:"\ea14"}

.icon-minimal-right::before{content:"\ea15"}

.icon-tail-left::before{content:"\ea16"}

.icon-minimal-left::before{content:"\ea17"}

.icon-tail-up::before{content:"\ea18"}

.icon-minimal-up::before{content:"\ea19"}

.icon-minimal-down::before{content:"\ea1a"}

.icon-tail-down::before{content:"\ea1b"}

.icon-settings-gear-64::before{content:"\ea1c"}

.icon-settings::before{content:"\ea1d"}

.icon-menu-dots::before{content:"\ea1e"}

.icon-menu-left::before{content:"\ea1f"}

.icon-funnel-40::before{content:"\ea20"}

.icon-filter::before{content:"\ea21"}

.icon-preferences-circle::before{content:"\ea22"}

.icon-check-2::before{content:"\ea23"}

.icon-cart-simple::before{content:"\ea24"}

.icon-cart-9::before{content:"\ea25"}

.icon-card-update::before{content:"\ea26"}

.icon-basket::before{content:"\ea27"}

.icon-check-circle-07::before{content:"\ea28"}

.icon-simple-remove::before{content:"\ea29"}

.icon-circle-remove::before{content:"\ea2a"}

.icon-alert-circle-exc::before{content:"\ea2b"}

.icon-bug::before{content:"\ea2c"}

.icon-share-66::before{content:"\ea2d"}

.icon-time-3::before{content:"\ea2e"}

.icon-time::before{content:"\ea2f"}

.icon-coffee::before{content:"\ea30"}

.icon-smile::before{content:"\ea31"}

.icon-sad::before{content:"\ea32"}

.icon-broken-heart::before{content:"\ea33"}

.icon-heart-2::before{content:"\ea34"}

.icon-pin-3::before{content:"\ea35"}

.icon-marker-3::before{content:"\ea36"}

.icon-globe-2::before{content:"\ea37"}

.icon-world-2::before{content:"\ea38"}

.icon-phone-2::before{content:"\ea39"}

.icon-check-square-11::before{content:"\ea3a"}

.icon-wallet-90::before{content:"\ea3b"}

.icon-credit-card::before{content:"\ea3c"}

.icon-payment::before{content:"\ea3d"}

.icon-tag::before{content:"\ea3e"}

.icon-tag-cut::before{content:"\ea3f"}

.icon-tag-content::before{content:"\ea40"}

.icon-flag-diagonal-33::before{content:"\ea41"}

.icon-triangle-right-17::before{content:"\ea47"}

.icon-puzzle-10::before{content:"\ea48"}

.icon-triangle-right-17-2::before{content:"\ea49"}

.icon-btn-play::before{content:"\ea4a"}

.icon-btn-play-2::before{content:"\ea4b"}

.icon-menu-34::before{content:"\ea4c"}

.icon-menu-left-2::before{content:"\ea4d"}

.icon-heart-2-2::before{content:"\ea4e"}

.icon-single-04-2::before{content:"\ea4f"}

.icon-users-mm-2::before{content:"\ea50"}

.icon-l-settings::before{content:"\ea51"}

.icon-book-open-2::before{content:"\ea52"}

.icon-layers-3::before{content:"\ea53"}

.icon-logo-fb-simple::before{content:"\ea55"}

.icon-logo-twitter::before{content:"\ea56"}

.icon-google::before{content:"\ea57"}

.icon-logo-pinterest::before{content:"\ea58"}

.icon-logo-instagram::before{content:"\ea59"}

.icon-logo-dribbble::before{content:"\ea5a"}

.icon-tablet-mobile::before{content:"\ea5b"}

.icon-house-search-engine::before{content:"\ea5c"}

.icon-house-pricing::before{content:"\ea5d"}

.icon-pulse-chart::before{content:"\ea5e"}

.icon-plug::before{content:"\ea5f"}

.icon-app-store::before{content:"\ea60"}

.icon-power-level::before{content:"\ea61"}

.icon-window-add::before{content:"\ea62"}

.icon-form::before{content:"\ea63"}

.icon-folder-15::before{content:"\ea64"}

.icon-lock::before{content:"\ea65"}

.icon-unlocked::before{content:"\ea66"}

.icon-e-reader::before{content:"\ea67"}

.icon-layout-grid::before{content:"\ea68"}

.icon-single-copies::before{content:"\ea69"}

/* Using a url */

/* Using a url */

/* api doc
@import url("./assets/css/api_css.css");
@import url("./assets/css/theme.bundle.css"); */

.div_scroll_my {
  overflow-y: auto;
  height: calc(100vh - 10rem);
  padding-left: 0 !important;
}

.header_top1 a {
  text-decoration: none;
}

.loader{
  width: 20px;
  height: 20px;
  border-radius: 100%;
  position: relative;
  margin: 0 auto;
  left: 10px;

  top: 9px;
}

/* LOADER 1 */

.loader-1:before, .loader-1:after{
  content: "";
  position: absolute;
  top: -10px;
  left: -10px;
  width: 100%;
  height: 100%;
  border-radius: 100%;
  border: 3px solid transparent;
  border-top-color: #3498db;
}

.loader-1:before{
  z-index: 100;
  animation: spin 1s infinite;
}

.loader-1:after{
  border: 3px solid white;
}

@keyframes spin{
  0%{
    transform: rotate(0deg);
  }

  100%{
    transform: rotate(360deg);
  }
}

/*!*******************************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/bootstrap/dist/css/bootstrap.min.css ***!
  \*******************************************************************************************************************************************************************************************************************************************/
@charset "UTF-8";
/*!
 * Bootstrap  v5.3.7 (https://getbootstrap.com/)
 * Copyright 2011-2025 The Bootstrap Authors
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
:root,[data-bs-theme=light]{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#052c65;--bs-secondary-text-emphasis:#2b2f32;--bs-success-text-emphasis:#0a3622;--bs-info-text-emphasis:#055160;--bs-warning-text-emphasis:#664d03;--bs-danger-text-emphasis:#58151c;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#cfe2ff;--bs-secondary-bg-subtle:#e2e3e5;--bs-success-bg-subtle:#d1e7dd;--bs-info-bg-subtle:#cff4fc;--bs-warning-bg-subtle:#fff3cd;--bs-danger-bg-subtle:#f8d7da;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#9ec5fe;--bs-secondary-border-subtle:#c4c8cb;--bs-success-border-subtle:#a3cfbb;--bs-info-border-subtle:#9eeaf9;--bs-warning-border-subtle:#ffe69c;--bs-danger-border-subtle:#f1aeb5;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-color-rgb:33,37,41;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb:33,37,41;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb:33,37,41;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:inherit;--bs-link-color:#0d6efd;--bs-link-color-rgb:13,110,253;--bs-link-decoration:underline;--bs-link-hover-color:#0a58ca;--bs-link-hover-color-rgb:10,88,202;--bs-code-color:#d63384;--bs-highlight-color:#212529;--bs-highlight-bg:#fff3cd;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(13, 110, 253, 0.25);--bs-form-valid-color:#198754;--bs-form-valid-border-color:#198754;--bs-form-invalid-color:#dc3545;--bs-form-invalid-border-color:#dc3545}
[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#6ea8fe;--bs-secondary-text-emphasis:#a7acb1;--bs-success-text-emphasis:#75b798;--bs-info-text-emphasis:#6edff6;--bs-warning-text-emphasis:#ffda6a;--bs-danger-text-emphasis:#ea868f;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#031633;--bs-secondary-bg-subtle:#161719;--bs-success-bg-subtle:#051b11;--bs-info-bg-subtle:#032830;--bs-warning-bg-subtle:#332701;--bs-danger-bg-subtle:#2c0b0e;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#084298;--bs-secondary-border-subtle:#41464b;--bs-success-border-subtle:#0f5132;--bs-info-border-subtle:#087990;--bs-warning-border-subtle:#997404;--bs-danger-border-subtle:#842029;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#6ea8fe;--bs-link-hover-color:#8bb9fe;--bs-link-color-rgb:110,168,254;--bs-link-hover-color-rgb:139,185,254;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#664d03;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#75b798;--bs-form-valid-border-color:#75b798;--bs-form-invalid-color:#ea868f;--bs-form-invalid-border-color:#ea868f}
*,::after,::before{box-sizing:border-box}
@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}
body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}
hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}
.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}
.h1,h1{font-size:calc(1.375rem + 1.5vw)}
@media (min-width:1200px){.h1,h1{font-size:2.5rem}}
.h2,h2{font-size:calc(1.325rem + .9vw)}
@media (min-width:1200px){.h2,h2{font-size:2rem}}
.h3,h3{font-size:calc(1.3rem + .6vw)}
@media (min-width:1200px){.h3,h3{font-size:1.75rem}}
.h4,h4{font-size:calc(1.275rem + .3vw)}
@media (min-width:1200px){.h4,h4{font-size:1.5rem}}
.h5,h5{font-size:1.25rem}
.h6,h6{font-size:1rem}
p{margin-top:0;margin-bottom:1rem}
abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}
address{margin-bottom:1rem;font-style:normal;line-height:inherit}
ol,ul{padding-left:2rem}
dl,ol,ul{margin-top:0;margin-bottom:1rem}
ol ol,ol ul,ul ol,ul ul{margin-bottom:0}
dt{font-weight:700}
dd{margin-bottom:.5rem;margin-left:0}
blockquote{margin:0 0 1rem}
b,strong{font-weight:bolder}
.small,small{font-size:.875em}
.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}
sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}
sub{bottom:-.25em}
sup{top:-.5em}
a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}
a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}
a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}
code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}
pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}
pre code{font-size:inherit;color:inherit;word-break:normal}
code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}
a>code{color:inherit}
kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}
kbd kbd{padding:0;font-size:1em}
figure{margin:0 0 1rem}
img,svg{vertical-align:middle}
table{caption-side:bottom;border-collapse:collapse}
caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}
th{text-align:inherit;text-align:-webkit-match-parent}
tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}
label{display:inline-block}
button{border-radius:0}
button:focus:not(:focus-visible){outline:0}
button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}
button,select{text-transform:none}
[role=button]{cursor:pointer}
select{word-wrap:normal}
select:disabled{opacity:1}
[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}
[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}
[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}
::-moz-focus-inner{padding:0;border-style:none}
textarea{resize:vertical}
fieldset{min-width:0;padding:0;margin:0;border:0}
legend{float:left;width:100%;padding:0;margin-bottom:.5rem;line-height:inherit;font-size:calc(1.275rem + .3vw)}
@media (min-width:1200px){legend{font-size:1.5rem}}
legend+*{clear:left}
::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}
::-webkit-inner-spin-button{height:auto}
[type=search]{-webkit-appearance:textfield;outline-offset:-2px}
::-webkit-search-decoration{-webkit-appearance:none}
::-webkit-color-swatch-wrapper{padding:0}
::file-selector-button{font:inherit;-webkit-appearance:button}
output{display:inline-block}
iframe{border:0}
summary{display:list-item;cursor:pointer}
progress{vertical-align:baseline}
[hidden]{display:none!important}
.lead{font-size:1.25rem;font-weight:300}
.display-1{font-weight:300;line-height:1.2;font-size:calc(1.625rem + 4.5vw)}
@media (min-width:1200px){.display-1{font-size:5rem}}
.display-2{font-weight:300;line-height:1.2;font-size:calc(1.575rem + 3.9vw)}
@media (min-width:1200px){.display-2{font-size:4.5rem}}
.display-3{font-weight:300;line-height:1.2;font-size:calc(1.525rem + 3.3vw)}
@media (min-width:1200px){.display-3{font-size:4rem}}
.display-4{font-weight:300;line-height:1.2;font-size:calc(1.475rem + 2.7vw)}
@media (min-width:1200px){.display-4{font-size:3.5rem}}
.display-5{font-weight:300;line-height:1.2;font-size:calc(1.425rem + 2.1vw)}
@media (min-width:1200px){.display-5{font-size:3rem}}
.display-6{font-weight:300;line-height:1.2;font-size:calc(1.375rem + 1.5vw)}
@media (min-width:1200px){.display-6{font-size:2.5rem}}
.list-unstyled{padding-left:0;list-style:none}
.list-inline{padding-left:0;list-style:none}
.list-inline-item{display:inline-block}
.list-inline-item:not(:last-child){margin-right:.5rem}
.initialism{font-size:.875em;text-transform:uppercase}
.blockquote{margin-bottom:1rem;font-size:1.25rem}
.blockquote>:last-child{margin-bottom:0}
.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}
.blockquote-footer::before{content:"— "}
.img-fluid{max-width:100%;height:auto}
.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}
.figure{display:inline-block}
.figure-img{margin-bottom:.5rem;line-height:1}
.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}
.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}
@media (min-width:576px){.container,.container-sm{max-width:540px}}
@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}
@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}
@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}
@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}
:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}
.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}
.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}
.col{flex:1 0 0}
.row-cols-auto>*{flex:0 0 auto;width:auto}
.row-cols-1>*{flex:0 0 auto;width:100%}
.row-cols-2>*{flex:0 0 auto;width:50%}
.row-cols-3>*{flex:0 0 auto;width:33.33333333%}
.row-cols-4>*{flex:0 0 auto;width:25%}
.row-cols-5>*{flex:0 0 auto;width:20%}
.row-cols-6>*{flex:0 0 auto;width:16.66666667%}
.col-auto{flex:0 0 auto;width:auto}
.col-1{flex:0 0 auto;width:8.33333333%}
.col-2{flex:0 0 auto;width:16.66666667%}
.col-3{flex:0 0 auto;width:25%}
.col-4{flex:0 0 auto;width:33.33333333%}
.col-5{flex:0 0 auto;width:41.66666667%}
.col-6{flex:0 0 auto;width:50%}
.col-7{flex:0 0 auto;width:58.33333333%}
.col-8{flex:0 0 auto;width:66.66666667%}
.col-9{flex:0 0 auto;width:75%}
.col-10{flex:0 0 auto;width:83.33333333%}
.col-11{flex:0 0 auto;width:91.66666667%}
.col-12{flex:0 0 auto;width:100%}
.offset-1{margin-left:8.33333333%}
.offset-2{margin-left:16.66666667%}
.offset-3{margin-left:25%}
.offset-4{margin-left:33.33333333%}
.offset-5{margin-left:41.66666667%}
.offset-6{margin-left:50%}
.offset-7{margin-left:58.33333333%}
.offset-8{margin-left:66.66666667%}
.offset-9{margin-left:75%}
.offset-10{margin-left:83.33333333%}
.offset-11{margin-left:91.66666667%}
.g-0,.gx-0{--bs-gutter-x:0}
.g-0,.gy-0{--bs-gutter-y:0}
.g-1,.gx-1{--bs-gutter-x:0.25rem}
.g-1,.gy-1{--bs-gutter-y:0.25rem}
.g-2,.gx-2{--bs-gutter-x:0.5rem}
.g-2,.gy-2{--bs-gutter-y:0.5rem}
.g-3,.gx-3{--bs-gutter-x:1rem}
.g-3,.gy-3{--bs-gutter-y:1rem}
.g-4,.gx-4{--bs-gutter-x:1.5rem}
.g-4,.gy-4{--bs-gutter-y:1.5rem}
.g-5,.gx-5{--bs-gutter-x:3rem}
.g-5,.gy-5{--bs-gutter-y:3rem}
@media (min-width:576px){.col-sm{flex:1 0 0}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}
@media (min-width:768px){.col-md{flex:1 0 0}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}
@media (min-width:992px){.col-lg{flex:1 0 0}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}
@media (min-width:1200px){.col-xl{flex:1 0 0}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}
@media (min-width:1400px){.col-xxl{flex:1 0 0}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}
.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}
.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}
.table>tbody{vertical-align:inherit}
.table>thead{vertical-align:bottom}
.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}
.caption-top{caption-side:top}
.table-sm>:not(caption)>*>*{padding:.25rem .25rem}
.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}
.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}
.table-borderless>:not(caption)>*>*{border-bottom-width:0}
.table-borderless>:not(:first-child){border-top-width:0}
.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}
.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}
.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}
.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}
.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}
.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}
@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}
@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}
@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}
@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}
@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}
.form-label{margin-bottom:.5rem}
.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}
.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}
.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}
.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}
.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-control{transition:none}}
.form-control[type=file]{overflow:hidden}
.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}
.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}
.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}
.form-control::-webkit-datetime-edit{display:block;padding:0}
.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}
.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}
.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-control::file-selector-button{transition:none}}
.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}
.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}
.form-control-plaintext:focus{outline:0}
.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}
.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}
.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;margin-inline-end:.5rem}
.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}
.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;margin-inline-end:1rem}
textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}
textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}
textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}
.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}
.form-control-color:not(:disabled):not([readonly]){cursor:pointer}
.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}
.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}
.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}
.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}
.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-select{transition:none}}
.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}
.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}
.form-select:disabled{background-color:var(--bs-secondary-bg)}
.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}
.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}
.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}
[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}
.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}
.form-check .form-check-input{float:left;margin-left:-1.5em}
.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}
.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}
.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);print-color-adjust:exact}
.form-check-input[type=checkbox]{border-radius:.25em}
.form-check-input[type=radio]{border-radius:50%}
.form-check-input:active{filter:brightness(90%)}
.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}
.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}
.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}
.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}
.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}
.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}
.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}
.form-switch{padding-left:2.5em}
.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}
.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}
.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}
.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}
.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}
.form-check-inline{display:inline-block;margin-right:1rem}
.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}
.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}
[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}
.form-range{width:100%;height:1.5rem;padding:0;appearance:none;background-color:transparent}
.form-range:focus{outline:0}
.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}
.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}
.form-range::-moz-focus-outer{border:0}
.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}
.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}
.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}
.form-range::-moz-range-thumb{width:1rem;height:1rem;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}
.form-range::-moz-range-thumb:active{background-color:#b6d4fe}
.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}
.form-range:disabled{pointer-events:none}
.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}
.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}
.form-floating{position:relative}
.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}
.form-floating>label{position:absolute;top:0;left:0;z-index:2;max-width:100%;height:100%;padding:1rem .75rem;overflow:hidden;color:rgba(var(--bs-body-color-rgb),.65);text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}
@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}
.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}
.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}
.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}
.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}
.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem;padding-left:.75rem}
.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{transform:scale(.85) translateY(-.5rem) translateX(.15rem)}
.form-floating>.form-control:-webkit-autofill~label{transform:scale(.85) translateY(-.5rem) translateX(.15rem)}
.form-floating>textarea:focus~label::after,.form-floating>textarea:not(:placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}
.form-floating>textarea:disabled~label::after{background-color:var(--bs-secondary-bg)}
.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}
.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}
.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}
.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}
.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}
.input-group .btn{position:relative;z-index:2}
.input-group .btn:focus{z-index:5}
.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}
.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}
.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}
.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}
.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}
.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}
.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(-1 * var(--bs-border-width));border-top-left-radius:0;border-bottom-left-radius:0}
.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}
.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}
.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}
.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}
.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}
.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}
.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}
.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}
.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}
.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}
.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}
.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}
.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}
.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}
.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}
.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}
.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}
.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}
.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}
.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}
.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}
.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}
.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}
.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}
.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}
.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}
.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}
.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}
.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}
.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}
.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}
.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}
.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}
.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.btn{transition:none}}
.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}
.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}
.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}
.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}
.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}
.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}
.btn-check:checked:focus-visible+.btn{box-shadow:var(--bs-btn-focus-box-shadow)}
.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}
.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}
.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}
.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}
.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}
.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}
.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}
.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}
.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}
.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}
.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}
.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}
.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}
.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}
.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}
.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}
.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}
.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}
.btn-link:focus-visible{color:var(--bs-btn-color)}
.btn-link:hover{color:var(--bs-btn-hover-color)}
.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}
.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}
.fade{transition:opacity .15s linear}
@media (prefers-reduced-motion:reduce){.fade{transition:none}}
.fade:not(.show){opacity:0}
.collapse:not(.show){display:none}
.collapsing{height:0;overflow:hidden;transition:height .35s ease}
@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}
.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}
@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}
.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}
.dropdown-toggle{white-space:nowrap}
.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}
.dropdown-toggle:empty::after{margin-left:0}
.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}
.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}
.dropdown-menu-start{--bs-position:start}
.dropdown-menu-start[data-bs-popper]{right:auto;left:0}
.dropdown-menu-end{--bs-position:end}
.dropdown-menu-end[data-bs-popper]{right:0;left:auto}
@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}
@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}
@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}
@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}
@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}
.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}
.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}
.dropup .dropdown-toggle:empty::after{margin-left:0}
.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}
.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}
.dropend .dropdown-toggle:empty::after{margin-left:0}
.dropend .dropdown-toggle::after{vertical-align:0}
.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}
.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}
.dropstart .dropdown-toggle::after{display:none}
.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}
.dropstart .dropdown-toggle:empty::after{margin-left:0}
.dropstart .dropdown-toggle::before{vertical-align:0}
.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}
.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}
.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}
.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}
.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}
.dropdown-menu.show{display:block}
.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}
.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}
.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}
.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}
.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}
.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}
.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}
.btn-toolbar .input-group{width:auto}
.btn-group{border-radius:var(--bs-border-radius)}
.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(-1 * var(--bs-border-width))}
.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}
.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}
.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}
.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}
.dropstart .dropdown-toggle-split::before{margin-right:0}
.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}
.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}
.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}
.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}
.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(-1 * var(--bs-border-width))}
.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}
.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:nth-child(n+3),.btn-group-vertical>:not(.btn-check)+.btn{border-top-left-radius:0;border-top-right-radius:0}
.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}
.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}
.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}
.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}
.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}
.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}
.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}
.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}
.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}
.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}
.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}
.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}
.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}
.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}
.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}
.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}
.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}
.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}
.nav-justified .nav-item,.nav-justified>.nav-link{flex-grow:1;flex-basis:0;text-align:center}
.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}
.tab-content>.tab-pane{display:none}
.tab-content>.active{display:block}
.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}
.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}
.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}
.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}
.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}
.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}
.navbar-nav .dropdown-menu{position:static}
.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}
.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}
.navbar-collapse{flex-grow:1;flex-basis:100%;align-items:center}
.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}
@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}
.navbar-toggler:hover{text-decoration:none}
.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}
.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}
.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}
@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}
@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}
@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}
@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}
@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}
.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}
.navbar-expand .navbar-nav{flex-direction:row}
.navbar-expand .navbar-nav .dropdown-menu{position:absolute}
.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}
.navbar-expand .navbar-nav-scroll{overflow:visible}
.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}
.navbar-expand .navbar-toggler{display:none}
.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}
.navbar-expand .offcanvas .offcanvas-header{display:none}
.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}
.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}
[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}
.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}
.card>hr{margin-right:0;margin-left:0}
.card>.list-group{border-top:inherit;border-bottom:inherit}
.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}
.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}
.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}
.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}
.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}
.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}
.card-text:last-child{margin-bottom:0}
.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}
.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}
.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}
.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}
.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}
.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}
.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}
.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}
.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}
.card-img,.card-img-bottom,.card-img-top{width:100%}
.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}
.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}
.card-group>.card{margin-bottom:var(--bs-card-group-margin)}
@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child)>.card-header,.card-group>.card:not(:last-child)>.card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child)>.card-footer,.card-group>.card:not(:last-child)>.card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child)>.card-header,.card-group>.card:not(:first-child)>.card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child)>.card-footer,.card-group>.card:not(:first-child)>.card-img-bottom{border-bottom-left-radius:0}}
.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23212529' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='m2 5 6 6 6-6'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23052c65' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='m2 5 6 6 6-6'/%3e%3c/svg%3e");--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}
.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}
@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}
.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}
.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}
.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}
@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}
.accordion-button:hover{z-index:2}
.accordion-button:focus{z-index:3;outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}
.accordion-header{margin-bottom:0}
.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}
.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}
.accordion-item:first-of-type>.accordion-header .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}
.accordion-item:not(:first-of-type){border-top:0}
.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}
.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}
.accordion-item:last-of-type>.accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}
.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}
.accordion-flush>.accordion-item{border-right:0;border-left:0;border-radius:0}
.accordion-flush>.accordion-item:first-child{border-top:0}
.accordion-flush>.accordion-item:last-child{border-bottom:0}
.accordion-flush>.accordion-item>.accordion-collapse,.accordion-flush>.accordion-item>.accordion-header .accordion-button,.accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed{border-radius:0}
[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708'/%3e%3c/svg%3e")}
.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}
.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}
.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}
.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}
.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}
.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}
@media (prefers-reduced-motion:reduce){.page-link{transition:none}}
.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}
.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}
.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}
.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}
.page-item:not(:first-child) .page-link{margin-left:calc(-1 * var(--bs-border-width))}
.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}
.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}
.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}
.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}
.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}
.badge:empty{display:none}
.btn .badge{position:relative;top:-1px}
.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}
.alert-heading{color:inherit}
.alert-link{font-weight:700;color:var(--bs-alert-link-color)}
.alert-dismissible{padding-right:3rem}
.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}
.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}
.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}
.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}
.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}
.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}
.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}
.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}
.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}
@keyframes progress-bar-stripes{0%{background-position-x:var(--bs-progress-height)}}
.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}
.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}
@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}
.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}
.progress-stacked>.progress{overflow:visible}
.progress-stacked>.progress>.progress-bar{width:100%}
.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}
@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}
.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}
.list-group-numbered{list-style-type:none;counter-reset:section}
.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}
.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}
.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}
.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}
.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}
.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}
.list-group-item+.list-group-item{border-top-width:0}
.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}
.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}
.list-group-item-action:not(.active):focus,.list-group-item-action:not(.active):hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}
.list-group-item-action:not(.active):active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}
.list-group-horizontal{flex-direction:row}
.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}
.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}
.list-group-horizontal>.list-group-item.active{margin-top:0}
.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}
.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}
@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}
@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}
@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}
@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}
@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}
.list-group-flush{border-radius:0}
.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}
.list-group-flush>.list-group-item:last-child{border-bottom-width:0}
.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}
.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}
.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}
.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}
.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}
.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}
.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}
.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}
.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;filter:var(--bs-btn-close-filter);border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}
.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}
.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}
.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}
.btn-close-white{--bs-btn-close-filter:invert(1) grayscale(100%) brightness(200%)}
:root,[data-bs-theme=light]{--bs-btn-close-filter: }
[data-bs-theme=dark]{--bs-btn-close-filter:invert(1) grayscale(100%) brightness(200%)}
.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}
.toast.showing{opacity:0}
.toast:not(.show){display:none}
.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:max-content;max-width:100%;pointer-events:none}
.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}
.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}
.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}
.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}
.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color:var(--bs-body-color);--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}
.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}
.modal.fade .modal-dialog{transform:translate(0,-50px);transition:transform .3s ease-out}
@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}
.modal.show .modal-dialog{transform:none}
.modal.modal-static .modal-dialog{transform:scale(1.02)}
.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}
.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}
.modal-dialog-scrollable .modal-body{overflow-y:auto}
.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}
.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}
.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}
.modal-backdrop.fade{opacity:0}
.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}
.modal-header{display:flex;flex-shrink:0;align-items:center;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}
.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin-top:calc(-.5 * var(--bs-modal-header-padding-y));margin-right:calc(-.5 * var(--bs-modal-header-padding-x));margin-bottom:calc(-.5 * var(--bs-modal-header-padding-y));margin-left:auto}
.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}
.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}
.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}
.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}
@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}
@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}
@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}
.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}
.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}
.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}
.modal-fullscreen .modal-body{overflow-y:auto}
@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}
@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}
@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}
@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}
@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}
.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}
.tooltip.show{opacity:var(--bs-tooltip-opacity)}
.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}
.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}
.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}
.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}
.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}
.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}
.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}
.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}
.popover-header:empty{display:none}
.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}
.carousel{position:relative}
.carousel.pointer-event{touch-action:pan-y}
.carousel-inner{position:relative;width:100%;overflow:hidden}
.carousel-inner::after{display:block;clear:both;content:""}
.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;backface-visibility:hidden;transition:transform .6s ease-in-out}
@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}
.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}
.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}
.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}
.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}
.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}
.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}
@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}
.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;filter:var(--bs-carousel-control-icon-filter);border:0;opacity:.5;transition:opacity .15s ease}
@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}
.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}
.carousel-control-prev{left:0}
.carousel-control-next{right:0}
.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}
.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0'/%3e%3c/svg%3e")}
.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708'/%3e%3c/svg%3e")}
.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}
.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:var(--bs-carousel-indicator-active-bg);background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}
@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}
.carousel-indicators .active{opacity:1}
.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:var(--bs-carousel-caption-color);text-align:center}
.carousel-dark{--bs-carousel-indicator-active-bg:#000;--bs-carousel-caption-color:#000;--bs-carousel-control-icon-filter:invert(1) grayscale(100)}
:root,[data-bs-theme=light]{--bs-carousel-indicator-active-bg:#fff;--bs-carousel-caption-color:#fff;--bs-carousel-control-icon-filter: }
[data-bs-theme=dark]{--bs-carousel-indicator-active-bg:#000;--bs-carousel-caption-color:#000;--bs-carousel-control-icon-filter:invert(1) grayscale(100)}
.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}
@keyframes spinner-border{to{transform:rotate(360deg)}}
.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}
.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}
@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}
.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}
.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}
@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}
.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}
@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}
@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}
@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}
@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}
@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}
@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}
@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}
@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}
@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}
@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}
@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}
@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}
@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}
@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}
@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}
@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}
@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}
@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}
@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}
@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}
.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}
@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}
.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}
.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}
.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}
.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}
.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}
.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}
.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}
.offcanvas-backdrop.fade{opacity:0}
.offcanvas-backdrop.show{opacity:.5}
.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}
.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y));margin-left:auto}
.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}
.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}
.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}
.placeholder.btn::before{display:inline-block;content:""}
.placeholder-xs{min-height:.6em}
.placeholder-sm{min-height:.8em}
.placeholder-lg{min-height:1.2em}
.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}
@keyframes placeholder-glow{50%{opacity:.2}}
.placeholder-wave{mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}
@keyframes placeholder-wave{100%{mask-position:-200% 0%}}
.clearfix::after{display:block;clear:both;content:""}
.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}
.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}
.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}
.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}
.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}
.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}
.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}
.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}
.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}
.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}
.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}
.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}
.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}
.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}
.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}
.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}
.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}
.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}
.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}
.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}
.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}
.icon-link{display:inline-flex;gap:.375rem;align-items:center;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;backface-visibility:hidden}
.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}
@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}
.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}
.ratio{position:relative;width:100%}
.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}
.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}
.ratio-1x1{--bs-aspect-ratio:100%}
.ratio-4x3{--bs-aspect-ratio:75%}
.ratio-16x9{--bs-aspect-ratio:56.25%}
.ratio-21x9{--bs-aspect-ratio:42.8571428571%}
.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}
.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}
.sticky-top{position:sticky;top:0;z-index:1020}
.sticky-bottom{position:sticky;bottom:0;z-index:1020}
@media (min-width:576px){.sticky-sm-top{position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:sticky;bottom:0;z-index:1020}}
@media (min-width:768px){.sticky-md-top{position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:sticky;bottom:0;z-index:1020}}
@media (min-width:992px){.sticky-lg-top{position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:sticky;bottom:0;z-index:1020}}
@media (min-width:1200px){.sticky-xl-top{position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:sticky;bottom:0;z-index:1020}}
@media (min-width:1400px){.sticky-xxl-top{position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:sticky;bottom:0;z-index:1020}}
.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}
.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}
.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}
.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}
.visually-hidden *,.visually-hidden-focusable:not(:focus):not(:focus-within) *{overflow:hidden!important}
.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}
.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}
.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}
.align-baseline{vertical-align:baseline!important}
.align-top{vertical-align:top!important}
.align-middle{vertical-align:middle!important}
.align-bottom{vertical-align:bottom!important}
.align-text-bottom{vertical-align:text-bottom!important}
.align-text-top{vertical-align:text-top!important}
.float-start{float:left!important}
.float-end{float:right!important}
.float-none{float:none!important}
.object-fit-contain{object-fit:contain!important}
.object-fit-cover{object-fit:cover!important}
.object-fit-fill{object-fit:fill!important}
.object-fit-scale{object-fit:scale-down!important}
.object-fit-none{object-fit:none!important}
.opacity-0{opacity:0!important}
.opacity-25{opacity:.25!important}
.opacity-50{opacity:.5!important}
.opacity-75{opacity:.75!important}
.opacity-100{opacity:1!important}
.overflow-auto{overflow:auto!important}
.overflow-hidden{overflow:hidden!important}
.overflow-visible{overflow:visible!important}
.overflow-scroll{overflow:scroll!important}
.overflow-x-auto{overflow-x:auto!important}
.overflow-x-hidden{overflow-x:hidden!important}
.overflow-x-visible{overflow-x:visible!important}
.overflow-x-scroll{overflow-x:scroll!important}
.overflow-y-auto{overflow-y:auto!important}
.overflow-y-hidden{overflow-y:hidden!important}
.overflow-y-visible{overflow-y:visible!important}
.overflow-y-scroll{overflow-y:scroll!important}
.d-inline{display:inline!important}
.d-inline-block{display:inline-block!important}
.d-block{display:block!important}
.d-grid{display:grid!important}
.d-inline-grid{display:inline-grid!important}
.d-table{display:table!important}
.d-table-row{display:table-row!important}
.d-table-cell{display:table-cell!important}
.d-flex{display:flex!important}
.d-inline-flex{display:inline-flex!important}
.d-none{display:none!important}
.shadow{box-shadow:var(--bs-box-shadow)!important}
.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}
.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}
.shadow-none{box-shadow:none!important}
.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}
.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}
.position-static{position:static!important}
.position-relative{position:relative!important}
.position-absolute{position:absolute!important}
.position-fixed{position:fixed!important}
.position-sticky{position:sticky!important}
.top-0{top:0!important}
.top-50{top:50%!important}
.top-100{top:100%!important}
.bottom-0{bottom:0!important}
.bottom-50{bottom:50%!important}
.bottom-100{bottom:100%!important}
.start-0{left:0!important}
.start-50{left:50%!important}
.start-100{left:100%!important}
.end-0{right:0!important}
.end-50{right:50%!important}
.end-100{right:100%!important}
.translate-middle{transform:translate(-50%,-50%)!important}
.translate-middle-x{transform:translateX(-50%)!important}
.translate-middle-y{transform:translateY(-50%)!important}
.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}
.border-0{border:0!important}
.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}
.border-top-0{border-top:0!important}
.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}
.border-end-0{border-right:0!important}
.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}
.border-bottom-0{border-bottom:0!important}
.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}
.border-start-0{border-left:0!important}
.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}
.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}
.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}
.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}
.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}
.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}
.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}
.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}
.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}
.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}
.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}
.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}
.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}
.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}
.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}
.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}
.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}
.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}
.border-1{border-width:1px!important}
.border-2{border-width:2px!important}
.border-3{border-width:3px!important}
.border-4{border-width:4px!important}
.border-5{border-width:5px!important}
.border-opacity-10{--bs-border-opacity:0.1}
.border-opacity-25{--bs-border-opacity:0.25}
.border-opacity-50{--bs-border-opacity:0.5}
.border-opacity-75{--bs-border-opacity:0.75}
.border-opacity-100{--bs-border-opacity:1}
.w-25{width:25%!important}
.w-50{width:50%!important}
.w-75{width:75%!important}
.w-100{width:100%!important}
.w-auto{width:auto!important}
.mw-100{max-width:100%!important}
.vw-100{width:100vw!important}
.min-vw-100{min-width:100vw!important}
.h-25{height:25%!important}
.h-50{height:50%!important}
.h-75{height:75%!important}
.h-100{height:100%!important}
.h-auto{height:auto!important}
.mh-100{max-height:100%!important}
.vh-100{height:100vh!important}
.min-vh-100{min-height:100vh!important}
.flex-fill{flex:1 1 auto!important}
.flex-row{flex-direction:row!important}
.flex-column{flex-direction:column!important}
.flex-row-reverse{flex-direction:row-reverse!important}
.flex-column-reverse{flex-direction:column-reverse!important}
.flex-grow-0{flex-grow:0!important}
.flex-grow-1{flex-grow:1!important}
.flex-shrink-0{flex-shrink:0!important}
.flex-shrink-1{flex-shrink:1!important}
.flex-wrap{flex-wrap:wrap!important}
.flex-nowrap{flex-wrap:nowrap!important}
.flex-wrap-reverse{flex-wrap:wrap-reverse!important}
.justify-content-start{justify-content:flex-start!important}
.justify-content-end{justify-content:flex-end!important}
.justify-content-center{justify-content:center!important}
.justify-content-between{justify-content:space-between!important}
.justify-content-around{justify-content:space-around!important}
.justify-content-evenly{justify-content:space-evenly!important}
.align-items-start{align-items:flex-start!important}
.align-items-end{align-items:flex-end!important}
.align-items-center{align-items:center!important}
.align-items-baseline{align-items:baseline!important}
.align-items-stretch{align-items:stretch!important}
.align-content-start{align-content:flex-start!important}
.align-content-end{align-content:flex-end!important}
.align-content-center{align-content:center!important}
.align-content-between{align-content:space-between!important}
.align-content-around{align-content:space-around!important}
.align-content-stretch{align-content:stretch!important}
.align-self-auto{align-self:auto!important}
.align-self-start{align-self:flex-start!important}
.align-self-end{align-self:flex-end!important}
.align-self-center{align-self:center!important}
.align-self-baseline{align-self:baseline!important}
.align-self-stretch{align-self:stretch!important}
.order-first{order:-1!important}
.order-0{order:0!important}
.order-1{order:1!important}
.order-2{order:2!important}
.order-3{order:3!important}
.order-4{order:4!important}
.order-5{order:5!important}
.order-last{order:6!important}
.m-0{margin:0!important}
.m-1{margin:.25rem!important}
.m-2{margin:.5rem!important}
.m-3{margin:1rem!important}
.m-4{margin:1.5rem!important}
.m-5{margin:3rem!important}
.m-auto{margin:auto!important}
.mx-0{margin-right:0!important;margin-left:0!important}
.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}
.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}
.mx-3{margin-right:1rem!important;margin-left:1rem!important}
.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}
.mx-5{margin-right:3rem!important;margin-left:3rem!important}
.mx-auto{margin-right:auto!important;margin-left:auto!important}
.my-0{margin-top:0!important;margin-bottom:0!important}
.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}
.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}
.my-3{margin-top:1rem!important;margin-bottom:1rem!important}
.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}
.my-5{margin-top:3rem!important;margin-bottom:3rem!important}
.my-auto{margin-top:auto!important;margin-bottom:auto!important}
.mt-0{margin-top:0!important}
.mt-1{margin-top:.25rem!important}
.mt-2{margin-top:.5rem!important}
.mt-3{margin-top:1rem!important}
.mt-4{margin-top:1.5rem!important}
.mt-5{margin-top:3rem!important}
.mt-auto{margin-top:auto!important}
.me-0{margin-right:0!important}
.me-1{margin-right:.25rem!important}
.me-2{margin-right:.5rem!important}
.me-3{margin-right:1rem!important}
.me-4{margin-right:1.5rem!important}
.me-5{margin-right:3rem!important}
.me-auto{margin-right:auto!important}
.mb-0{margin-bottom:0!important}
.mb-1{margin-bottom:.25rem!important}
.mb-2{margin-bottom:.5rem!important}
.mb-3{margin-bottom:1rem!important}
.mb-4{margin-bottom:1.5rem!important}
.mb-5{margin-bottom:3rem!important}
.mb-auto{margin-bottom:auto!important}
.ms-0{margin-left:0!important}
.ms-1{margin-left:.25rem!important}
.ms-2{margin-left:.5rem!important}
.ms-3{margin-left:1rem!important}
.ms-4{margin-left:1.5rem!important}
.ms-5{margin-left:3rem!important}
.ms-auto{margin-left:auto!important}
.p-0{padding:0!important}
.p-1{padding:.25rem!important}
.p-2{padding:.5rem!important}
.p-3{padding:1rem!important}
.p-4{padding:1.5rem!important}
.p-5{padding:3rem!important}
.px-0{padding-right:0!important;padding-left:0!important}
.px-1{padding-right:.25rem!important;padding-left:.25rem!important}
.px-2{padding-right:.5rem!important;padding-left:.5rem!important}
.px-3{padding-right:1rem!important;padding-left:1rem!important}
.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}
.px-5{padding-right:3rem!important;padding-left:3rem!important}
.py-0{padding-top:0!important;padding-bottom:0!important}
.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}
.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}
.py-3{padding-top:1rem!important;padding-bottom:1rem!important}
.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}
.py-5{padding-top:3rem!important;padding-bottom:3rem!important}
.pt-0{padding-top:0!important}
.pt-1{padding-top:.25rem!important}
.pt-2{padding-top:.5rem!important}
.pt-3{padding-top:1rem!important}
.pt-4{padding-top:1.5rem!important}
.pt-5{padding-top:3rem!important}
.pe-0{padding-right:0!important}
.pe-1{padding-right:.25rem!important}
.pe-2{padding-right:.5rem!important}
.pe-3{padding-right:1rem!important}
.pe-4{padding-right:1.5rem!important}
.pe-5{padding-right:3rem!important}
.pb-0{padding-bottom:0!important}
.pb-1{padding-bottom:.25rem!important}
.pb-2{padding-bottom:.5rem!important}
.pb-3{padding-bottom:1rem!important}
.pb-4{padding-bottom:1.5rem!important}
.pb-5{padding-bottom:3rem!important}
.ps-0{padding-left:0!important}
.ps-1{padding-left:.25rem!important}
.ps-2{padding-left:.5rem!important}
.ps-3{padding-left:1rem!important}
.ps-4{padding-left:1.5rem!important}
.ps-5{padding-left:3rem!important}
.gap-0{gap:0!important}
.gap-1{gap:.25rem!important}
.gap-2{gap:.5rem!important}
.gap-3{gap:1rem!important}
.gap-4{gap:1.5rem!important}
.gap-5{gap:3rem!important}
.row-gap-0{row-gap:0!important}
.row-gap-1{row-gap:.25rem!important}
.row-gap-2{row-gap:.5rem!important}
.row-gap-3{row-gap:1rem!important}
.row-gap-4{row-gap:1.5rem!important}
.row-gap-5{row-gap:3rem!important}
.column-gap-0{column-gap:0!important}
.column-gap-1{column-gap:.25rem!important}
.column-gap-2{column-gap:.5rem!important}
.column-gap-3{column-gap:1rem!important}
.column-gap-4{column-gap:1.5rem!important}
.column-gap-5{column-gap:3rem!important}
.font-monospace{font-family:var(--bs-font-monospace)!important}
.fs-1{font-size:calc(1.375rem + 1.5vw)!important}
.fs-2{font-size:calc(1.325rem + .9vw)!important}
.fs-3{font-size:calc(1.3rem + .6vw)!important}
.fs-4{font-size:calc(1.275rem + .3vw)!important}
.fs-5{font-size:1.25rem!important}
.fs-6{font-size:1rem!important}
.fst-italic{font-style:italic!important}
.fst-normal{font-style:normal!important}
.fw-lighter{font-weight:lighter!important}
.fw-light{font-weight:300!important}
.fw-normal{font-weight:400!important}
.fw-medium{font-weight:500!important}
.fw-semibold{font-weight:600!important}
.fw-bold{font-weight:700!important}
.fw-bolder{font-weight:bolder!important}
.lh-1{line-height:1!important}
.lh-sm{line-height:1.25!important}
.lh-base{line-height:1.5!important}
.lh-lg{line-height:2!important}
.text-start{text-align:left!important}
.text-end{text-align:right!important}
.text-center{text-align:center!important}
.text-decoration-none{text-decoration:none!important}
.text-decoration-underline{text-decoration:underline!important}
.text-decoration-line-through{text-decoration:line-through!important}
.text-lowercase{text-transform:lowercase!important}
.text-uppercase{text-transform:uppercase!important}
.text-capitalize{text-transform:capitalize!important}
.text-wrap{white-space:normal!important}
.text-nowrap{white-space:nowrap!important}
.text-break{word-wrap:break-word!important;word-break:break-word!important}
.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}
.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}
.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}
.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}
.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}
.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}
.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}
.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}
.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}
.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}
.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}
.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}
.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}
.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}
.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}
.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}
.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}
.text-reset{--bs-text-opacity:1;color:inherit!important}
.text-opacity-25{--bs-text-opacity:0.25}
.text-opacity-50{--bs-text-opacity:0.5}
.text-opacity-75{--bs-text-opacity:0.75}
.text-opacity-100{--bs-text-opacity:1}
.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}
.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}
.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}
.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}
.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}
.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}
.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}
.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}
.link-opacity-10{--bs-link-opacity:0.1}
.link-opacity-10-hover:hover{--bs-link-opacity:0.1}
.link-opacity-25{--bs-link-opacity:0.25}
.link-opacity-25-hover:hover{--bs-link-opacity:0.25}
.link-opacity-50{--bs-link-opacity:0.5}
.link-opacity-50-hover:hover{--bs-link-opacity:0.5}
.link-opacity-75{--bs-link-opacity:0.75}
.link-opacity-75-hover:hover{--bs-link-opacity:0.75}
.link-opacity-100{--bs-link-opacity:1}
.link-opacity-100-hover:hover{--bs-link-opacity:1}
.link-offset-1{text-underline-offset:0.125em!important}
.link-offset-1-hover:hover{text-underline-offset:0.125em!important}
.link-offset-2{text-underline-offset:0.25em!important}
.link-offset-2-hover:hover{text-underline-offset:0.25em!important}
.link-offset-3{text-underline-offset:0.375em!important}
.link-offset-3-hover:hover{text-underline-offset:0.375em!important}
.link-underline-primary{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-secondary{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-success{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-info{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-warning{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-danger{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-light{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}
.link-underline-dark{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}
.link-underline{--bs-link-underline-opacity:1;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}
.link-underline-opacity-0{--bs-link-underline-opacity:0}
.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}
.link-underline-opacity-10{--bs-link-underline-opacity:0.1}
.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}
.link-underline-opacity-25{--bs-link-underline-opacity:0.25}
.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}
.link-underline-opacity-50{--bs-link-underline-opacity:0.5}
.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}
.link-underline-opacity-75{--bs-link-underline-opacity:0.75}
.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}
.link-underline-opacity-100{--bs-link-underline-opacity:1}
.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}
.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}
.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}
.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}
.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}
.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}
.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}
.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}
.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}
.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}
.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}
.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}
.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}
.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}
.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}
.bg-opacity-10{--bs-bg-opacity:0.1}
.bg-opacity-25{--bs-bg-opacity:0.25}
.bg-opacity-50{--bs-bg-opacity:0.5}
.bg-opacity-75{--bs-bg-opacity:0.75}
.bg-opacity-100{--bs-bg-opacity:1}
.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}
.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}
.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}
.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}
.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}
.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}
.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}
.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}
.bg-gradient{background-image:var(--bs-gradient)!important}
.user-select-all{-webkit-user-select:all!important;user-select:all!important}
.user-select-auto{-webkit-user-select:auto!important;user-select:auto!important}
.user-select-none{-webkit-user-select:none!important;user-select:none!important}
.pe-none{pointer-events:none!important}
.pe-auto{pointer-events:auto!important}
.rounded{border-radius:var(--bs-border-radius)!important}
.rounded-0{border-radius:0!important}
.rounded-1{border-radius:var(--bs-border-radius-sm)!important}
.rounded-2{border-radius:var(--bs-border-radius)!important}
.rounded-3{border-radius:var(--bs-border-radius-lg)!important}
.rounded-4{border-radius:var(--bs-border-radius-xl)!important}
.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}
.rounded-circle{border-radius:50%!important}
.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}
.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}
.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}
.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}
.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}
.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}
.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}
.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}
.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}
.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}
.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}
.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}
.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}
.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}
.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}
.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}
.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}
.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}
.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}
.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}
.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}
.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}
.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}
.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}
.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}
.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}
.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}
.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}
.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}
.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}
.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}
.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}
.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}
.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}
.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}
.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}
.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}
.visible{visibility:visible!important}
.invisible{visibility:hidden!important}
.z-n1{z-index:-1!important}
.z-0{z-index:0!important}
.z-1{z-index:1!important}
.z-2{z-index:2!important}
.z-3{z-index:3!important}
@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{object-fit:contain!important}.object-fit-sm-cover{object-fit:cover!important}.object-fit-sm-fill{object-fit:fill!important}.object-fit-sm-scale{object-fit:scale-down!important}.object-fit-sm-none{object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{column-gap:0!important}.column-gap-sm-1{column-gap:.25rem!important}.column-gap-sm-2{column-gap:.5rem!important}.column-gap-sm-3{column-gap:1rem!important}.column-gap-sm-4{column-gap:1.5rem!important}.column-gap-sm-5{column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}
@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{object-fit:contain!important}.object-fit-md-cover{object-fit:cover!important}.object-fit-md-fill{object-fit:fill!important}.object-fit-md-scale{object-fit:scale-down!important}.object-fit-md-none{object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{column-gap:0!important}.column-gap-md-1{column-gap:.25rem!important}.column-gap-md-2{column-gap:.5rem!important}.column-gap-md-3{column-gap:1rem!important}.column-gap-md-4{column-gap:1.5rem!important}.column-gap-md-5{column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}
@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{object-fit:contain!important}.object-fit-lg-cover{object-fit:cover!important}.object-fit-lg-fill{object-fit:fill!important}.object-fit-lg-scale{object-fit:scale-down!important}.object-fit-lg-none{object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{column-gap:0!important}.column-gap-lg-1{column-gap:.25rem!important}.column-gap-lg-2{column-gap:.5rem!important}.column-gap-lg-3{column-gap:1rem!important}.column-gap-lg-4{column-gap:1.5rem!important}.column-gap-lg-5{column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}
@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{object-fit:contain!important}.object-fit-xl-cover{object-fit:cover!important}.object-fit-xl-fill{object-fit:fill!important}.object-fit-xl-scale{object-fit:scale-down!important}.object-fit-xl-none{object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{column-gap:0!important}.column-gap-xl-1{column-gap:.25rem!important}.column-gap-xl-2{column-gap:.5rem!important}.column-gap-xl-3{column-gap:1rem!important}.column-gap-xl-4{column-gap:1.5rem!important}.column-gap-xl-5{column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}
@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{object-fit:contain!important}.object-fit-xxl-cover{object-fit:cover!important}.object-fit-xxl-fill{object-fit:fill!important}.object-fit-xxl-scale{object-fit:scale-down!important}.object-fit-xxl-none{object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{column-gap:0!important}.column-gap-xxl-1{column-gap:.25rem!important}.column-gap-xxl-2{column-gap:.5rem!important}.column-gap-xxl-3{column-gap:1rem!important}.column-gap-xxl-4{column-gap:1.5rem!important}.column-gap-xxl-5{column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}
@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}
@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}
/*!****************************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/font-awesome/css/font-awesome.css ***!
  \****************************************************************************************************************************************************************************************************************************************/
/*!
 *  Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome
 *  License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
 */
/* FONT PATH
 * -------------------------- */
@font-face {
  font-family: 'FontAwesome';
  src: url('fontawesome-webfont.2b13baa7dd4f54c9.eot?v=4.7.0');
  src: url('fontawesome-webfont.2b13baa7dd4f54c9.eot?#iefix&v=4.7.0') format('embedded-opentype'), url('fontawesome-webfont.e9955780856cf8aa.woff2?v=4.7.0') format('woff2'), url('fontawesome-webfont.cf011583fb81df9f.woff?v=4.7.0') format('woff'), url('fontawesome-webfont.8a7cb27d142e3e19.ttf?v=4.7.0') format('truetype'), url('fontawesome-webfont.da909aa098b0ee2d.svg?v=4.7.0#fontawesomeregular') format('svg');
  font-weight: normal;
  font-style: normal;
}
.fa {
  display: inline-block;
  font: normal normal normal 14px/1 FontAwesome;
  font-size: inherit;
  text-rendering: auto;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}
/* makes the font 33% larger relative to the icon container */
.fa-lg {
  font-size: 1.33333333em;
  line-height: 0.75em;
  vertical-align: -15%;
}
.fa-2x {
  font-size: 2em;
}
.fa-3x {
  font-size: 3em;
}
.fa-4x {
  font-size: 4em;
}
.fa-5x {
  font-size: 5em;
}
.fa-fw {
  width: 1.28571429em;
  text-align: center;
}
.fa-ul {
  padding-left: 0;
  margin-left: 2.14285714em;
  list-style-type: none;
}
.fa-ul > li {
  position: relative;
}
.fa-li {
  position: absolute;
  left: -2.14285714em;
  width: 2.14285714em;
  top: 0.14285714em;
  text-align: center;
}
.fa-li.fa-lg {
  left: -1.85714286em;
}
.fa-border {
  padding: .2em .25em .15em;
  border: solid 0.08em #eeeeee;
  border-radius: .1em;
}
.fa-pull-left {
  float: left;
}
.fa-pull-right {
  float: right;
}
.fa.fa-pull-left {
  margin-right: .3em;
}
.fa.fa-pull-right {
  margin-left: .3em;
}
/* Deprecated as of 4.4.0 */
.pull-right {
  float: right;
}
.pull-left {
  float: left;
}
.fa.pull-left {
  margin-right: .3em;
}
.fa.pull-right {
  margin-left: .3em;
}
.fa-spin {
  animation: fa-spin 2s infinite linear;
}
.fa-pulse {
  animation: fa-spin 1s infinite steps(8);
}
@keyframes fa-spin {
  0% {
    transform: rotate(0deg);
  }
  100% {
    transform: rotate(359deg);
  }
}
.fa-rotate-90 {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";
  transform: rotate(90deg);
}
.fa-rotate-180 {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";
  transform: rotate(180deg);
}
.fa-rotate-270 {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";
  transform: rotate(270deg);
}
.fa-flip-horizontal {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";
  transform: scale(-1, 1);
}
.fa-flip-vertical {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";
  transform: scale(1, -1);
}
:root .fa-rotate-90,
:root .fa-rotate-180,
:root .fa-rotate-270,
:root .fa-flip-horizontal,
:root .fa-flip-vertical {
  filter: none;
}
.fa-stack {
  position: relative;
  display: inline-block;
  width: 2em;
  height: 2em;
  line-height: 2em;
  vertical-align: middle;
}
.fa-stack-1x,
.fa-stack-2x {
  position: absolute;
  left: 0;
  width: 100%;
  text-align: center;
}
.fa-stack-1x {
  line-height: inherit;
}
.fa-stack-2x {
  font-size: 2em;
}
.fa-inverse {
  color: #ffffff;
}
/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
   readers do not read off random characters that represent icons */
.fa-glass:before {
  content: "\f000";
}
.fa-music:before {
  content: "\f001";
}
.fa-search:before {
  content: "\f002";
}
.fa-envelope-o:before {
  content: "\f003";
}
.fa-heart:before {
  content: "\f004";
}
.fa-star:before {
  content: "\f005";
}
.fa-star-o:before {
  content: "\f006";
}
.fa-user:before {
  content: "\f007";
}
.fa-film:before {
  content: "\f008";
}
.fa-th-large:before {
  content: "\f009";
}
.fa-th:before {
  content: "\f00a";
}
.fa-th-list:before {
  content: "\f00b";
}
.fa-check:before {
  content: "\f00c";
}
.fa-remove:before,
.fa-close:before,
.fa-times:before {
  content: "\f00d";
}
.fa-search-plus:before {
  content: "\f00e";
}
.fa-search-minus:before {
  content: "\f010";
}
.fa-power-off:before {
  content: "\f011";
}
.fa-signal:before {
  content: "\f012";
}
.fa-gear:before,
.fa-cog:before {
  content: "\f013";
}
.fa-trash-o:before {
  content: "\f014";
}
.fa-home:before {
  content: "\f015";
}
.fa-file-o:before {
  content: "\f016";
}
.fa-clock-o:before {
  content: "\f017";
}
.fa-road:before {
  content: "\f018";
}
.fa-download:before {
  content: "\f019";
}
.fa-arrow-circle-o-down:before {
  content: "\f01a";
}
.fa-arrow-circle-o-up:before {
  content: "\f01b";
}
.fa-inbox:before {
  content: "\f01c";
}
.fa-play-circle-o:before {
  content: "\f01d";
}
.fa-rotate-right:before,
.fa-repeat:before {
  content: "\f01e";
}
.fa-refresh:before {
  content: "\f021";
}
.fa-list-alt:before {
  content: "\f022";
}
.fa-lock:before {
  content: "\f023";
}
.fa-flag:before {
  content: "\f024";
}
.fa-headphones:before {
  content: "\f025";
}
.fa-volume-off:before {
  content: "\f026";
}
.fa-volume-down:before {
  content: "\f027";
}
.fa-volume-up:before {
  content: "\f028";
}
.fa-qrcode:before {
  content: "\f029";
}
.fa-barcode:before {
  content: "\f02a";
}
.fa-tag:before {
  content: "\f02b";
}
.fa-tags:before {
  content: "\f02c";
}
.fa-book:before {
  content: "\f02d";
}
.fa-bookmark:before {
  content: "\f02e";
}
.fa-print:before {
  content: "\f02f";
}
.fa-camera:before {
  content: "\f030";
}
.fa-font:before {
  content: "\f031";
}
.fa-bold:before {
  content: "\f032";
}
.fa-italic:before {
  content: "\f033";
}
.fa-text-height:before {
  content: "\f034";
}
.fa-text-width:before {
  content: "\f035";
}
.fa-align-left:before {
  content: "\f036";
}
.fa-align-center:before {
  content: "\f037";
}
.fa-align-right:before {
  content: "\f038";
}
.fa-align-justify:before {
  content: "\f039";
}
.fa-list:before {
  content: "\f03a";
}
.fa-dedent:before,
.fa-outdent:before {
  content: "\f03b";
}
.fa-indent:before {
  content: "\f03c";
}
.fa-video-camera:before {
  content: "\f03d";
}
.fa-photo:before,
.fa-image:before,
.fa-picture-o:before {
  content: "\f03e";
}
.fa-pencil:before {
  content: "\f040";
}
.fa-map-marker:before {
  content: "\f041";
}
.fa-adjust:before {
  content: "\f042";
}
.fa-tint:before {
  content: "\f043";
}
.fa-edit:before,
.fa-pencil-square-o:before {
  content: "\f044";
}
.fa-share-square-o:before {
  content: "\f045";
}
.fa-check-square-o:before {
  content: "\f046";
}
.fa-arrows:before {
  content: "\f047";
}
.fa-step-backward:before {
  content: "\f048";
}
.fa-fast-backward:before {
  content: "\f049";
}
.fa-backward:before {
  content: "\f04a";
}
.fa-play:before {
  content: "\f04b";
}
.fa-pause:before {
  content: "\f04c";
}
.fa-stop:before {
  content: "\f04d";
}
.fa-forward:before {
  content: "\f04e";
}
.fa-fast-forward:before {
  content: "\f050";
}
.fa-step-forward:before {
  content: "\f051";
}
.fa-eject:before {
  content: "\f052";
}
.fa-chevron-left:before {
  content: "\f053";
}
.fa-chevron-right:before {
  content: "\f054";
}
.fa-plus-circle:before {
  content: "\f055";
}
.fa-minus-circle:before {
  content: "\f056";
}
.fa-times-circle:before {
  content: "\f057";
}
.fa-check-circle:before {
  content: "\f058";
}
.fa-question-circle:before {
  content: "\f059";
}
.fa-info-circle:before {
  content: "\f05a";
}
.fa-crosshairs:before {
  content: "\f05b";
}
.fa-times-circle-o:before {
  content: "\f05c";
}
.fa-check-circle-o:before {
  content: "\f05d";
}
.fa-ban:before {
  content: "\f05e";
}
.fa-arrow-left:before {
  content: "\f060";
}
.fa-arrow-right:before {
  content: "\f061";
}
.fa-arrow-up:before {
  content: "\f062";
}
.fa-arrow-down:before {
  content: "\f063";
}
.fa-mail-forward:before,
.fa-share:before {
  content: "\f064";
}
.fa-expand:before {
  content: "\f065";
}
.fa-compress:before {
  content: "\f066";
}
.fa-plus:before {
  content: "\f067";
}
.fa-minus:before {
  content: "\f068";
}
.fa-asterisk:before {
  content: "\f069";
}
.fa-exclamation-circle:before {
  content: "\f06a";
}
.fa-gift:before {
  content: "\f06b";
}
.fa-leaf:before {
  content: "\f06c";
}
.fa-fire:before {
  content: "\f06d";
}
.fa-eye:before {
  content: "\f06e";
}
.fa-eye-slash:before {
  content: "\f070";
}
.fa-warning:before,
.fa-exclamation-triangle:before {
  content: "\f071";
}
.fa-plane:before {
  content: "\f072";
}
.fa-calendar:before {
  content: "\f073";
}
.fa-random:before {
  content: "\f074";
}
.fa-comment:before {
  content: "\f075";
}
.fa-magnet:before {
  content: "\f076";
}
.fa-chevron-up:before {
  content: "\f077";
}
.fa-chevron-down:before {
  content: "\f078";
}
.fa-retweet:before {
  content: "\f079";
}
.fa-shopping-cart:before {
  content: "\f07a";
}
.fa-folder:before {
  content: "\f07b";
}
.fa-folder-open:before {
  content: "\f07c";
}
.fa-arrows-v:before {
  content: "\f07d";
}
.fa-arrows-h:before {
  content: "\f07e";
}
.fa-bar-chart-o:before,
.fa-bar-chart:before {
  content: "\f080";
}
.fa-twitter-square:before {
  content: "\f081";
}
.fa-facebook-square:before {
  content: "\f082";
}
.fa-camera-retro:before {
  content: "\f083";
}
.fa-key:before {
  content: "\f084";
}
.fa-gears:before,
.fa-cogs:before {
  content: "\f085";
}
.fa-comments:before {
  content: "\f086";
}
.fa-thumbs-o-up:before {
  content: "\f087";
}
.fa-thumbs-o-down:before {
  content: "\f088";
}
.fa-star-half:before {
  content: "\f089";
}
.fa-heart-o:before {
  content: "\f08a";
}
.fa-sign-out:before {
  content: "\f08b";
}
.fa-linkedin-square:before {
  content: "\f08c";
}
.fa-thumb-tack:before {
  content: "\f08d";
}
.fa-external-link:before {
  content: "\f08e";
}
.fa-sign-in:before {
  content: "\f090";
}
.fa-trophy:before {
  content: "\f091";
}
.fa-github-square:before {
  content: "\f092";
}
.fa-upload:before {
  content: "\f093";
}
.fa-lemon-o:before {
  content: "\f094";
}
.fa-phone:before {
  content: "\f095";
}
.fa-square-o:before {
  content: "\f096";
}
.fa-bookmark-o:before {
  content: "\f097";
}
.fa-phone-square:before {
  content: "\f098";
}
.fa-twitter:before {
  content: "\f099";
}
.fa-facebook-f:before,
.fa-facebook:before {
  content: "\f09a";
}
.fa-github:before {
  content: "\f09b";
}
.fa-unlock:before {
  content: "\f09c";
}
.fa-credit-card:before {
  content: "\f09d";
}
.fa-feed:before,
.fa-rss:before {
  content: "\f09e";
}
.fa-hdd-o:before {
  content: "\f0a0";
}
.fa-bullhorn:before {
  content: "\f0a1";
}
.fa-bell:before {
  content: "\f0f3";
}
.fa-certificate:before {
  content: "\f0a3";
}
.fa-hand-o-right:before {
  content: "\f0a4";
}
.fa-hand-o-left:before {
  content: "\f0a5";
}
.fa-hand-o-up:before {
  content: "\f0a6";
}
.fa-hand-o-down:before {
  content: "\f0a7";
}
.fa-arrow-circle-left:before {
  content: "\f0a8";
}
.fa-arrow-circle-right:before {
  content: "\f0a9";
}
.fa-arrow-circle-up:before {
  content: "\f0aa";
}
.fa-arrow-circle-down:before {
  content: "\f0ab";
}
.fa-globe:before {
  content: "\f0ac";
}
.fa-wrench:before {
  content: "\f0ad";
}
.fa-tasks:before {
  content: "\f0ae";
}
.fa-filter:before {
  content: "\f0b0";
}
.fa-briefcase:before {
  content: "\f0b1";
}
.fa-arrows-alt:before {
  content: "\f0b2";
}
.fa-group:before,
.fa-users:before {
  content: "\f0c0";
}
.fa-chain:before,
.fa-link:before {
  content: "\f0c1";
}
.fa-cloud:before {
  content: "\f0c2";
}
.fa-flask:before {
  content: "\f0c3";
}
.fa-cut:before,
.fa-scissors:before {
  content: "\f0c4";
}
.fa-copy:before,
.fa-files-o:before {
  content: "\f0c5";
}
.fa-paperclip:before {
  content: "\f0c6";
}
.fa-save:before,
.fa-floppy-o:before {
  content: "\f0c7";
}
.fa-square:before {
  content: "\f0c8";
}
.fa-navicon:before,
.fa-reorder:before,
.fa-bars:before {
  content: "\f0c9";
}
.fa-list-ul:before {
  content: "\f0ca";
}
.fa-list-ol:before {
  content: "\f0cb";
}
.fa-strikethrough:before {
  content: "\f0cc";
}
.fa-underline:before {
  content: "\f0cd";
}
.fa-table:before {
  content: "\f0ce";
}
.fa-magic:before {
  content: "\f0d0";
}
.fa-truck:before {
  content: "\f0d1";
}
.fa-pinterest:before {
  content: "\f0d2";
}
.fa-pinterest-square:before {
  content: "\f0d3";
}
.fa-google-plus-square:before {
  content: "\f0d4";
}
.fa-google-plus:before {
  content: "\f0d5";
}
.fa-money:before {
  content: "\f0d6";
}
.fa-caret-down:before {
  content: "\f0d7";
}
.fa-caret-up:before {
  content: "\f0d8";
}
.fa-caret-left:before {
  content: "\f0d9";
}
.fa-caret-right:before {
  content: "\f0da";
}
.fa-columns:before {
  content: "\f0db";
}
.fa-unsorted:before,
.fa-sort:before {
  content: "\f0dc";
}
.fa-sort-down:before,
.fa-sort-desc:before {
  content: "\f0dd";
}
.fa-sort-up:before,
.fa-sort-asc:before {
  content: "\f0de";
}
.fa-envelope:before {
  content: "\f0e0";
}
.fa-linkedin:before {
  content: "\f0e1";
}
.fa-rotate-left:before,
.fa-undo:before {
  content: "\f0e2";
}
.fa-legal:before,
.fa-gavel:before {
  content: "\f0e3";
}
.fa-dashboard:before,
.fa-tachometer:before {
  content: "\f0e4";
}
.fa-comment-o:before {
  content: "\f0e5";
}
.fa-comments-o:before {
  content: "\f0e6";
}
.fa-flash:before,
.fa-bolt:before {
  content: "\f0e7";
}
.fa-sitemap:before {
  content: "\f0e8";
}
.fa-umbrella:before {
  content: "\f0e9";
}
.fa-paste:before,
.fa-clipboard:before {
  content: "\f0ea";
}
.fa-lightbulb-o:before {
  content: "\f0eb";
}
.fa-exchange:before {
  content: "\f0ec";
}
.fa-cloud-download:before {
  content: "\f0ed";
}
.fa-cloud-upload:before {
  content: "\f0ee";
}
.fa-user-md:before {
  content: "\f0f0";
}
.fa-stethoscope:before {
  content: "\f0f1";
}
.fa-suitcase:before {
  content: "\f0f2";
}
.fa-bell-o:before {
  content: "\f0a2";
}
.fa-coffee:before {
  content: "\f0f4";
}
.fa-cutlery:before {
  content: "\f0f5";
}
.fa-file-text-o:before {
  content: "\f0f6";
}
.fa-building-o:before {
  content: "\f0f7";
}
.fa-hospital-o:before {
  content: "\f0f8";
}
.fa-ambulance:before {
  content: "\f0f9";
}
.fa-medkit:before {
  content: "\f0fa";
}
.fa-fighter-jet:before {
  content: "\f0fb";
}
.fa-beer:before {
  content: "\f0fc";
}
.fa-h-square:before {
  content: "\f0fd";
}
.fa-plus-square:before {
  content: "\f0fe";
}
.fa-angle-double-left:before {
  content: "\f100";
}
.fa-angle-double-right:before {
  content: "\f101";
}
.fa-angle-double-up:before {
  content: "\f102";
}
.fa-angle-double-down:before {
  content: "\f103";
}
.fa-angle-left:before {
  content: "\f104";
}
.fa-angle-right:before {
  content: "\f105";
}
.fa-angle-up:before {
  content: "\f106";
}
.fa-angle-down:before {
  content: "\f107";
}
.fa-desktop:before {
  content: "\f108";
}
.fa-laptop:before {
  content: "\f109";
}
.fa-tablet:before {
  content: "\f10a";
}
.fa-mobile-phone:before,
.fa-mobile:before {
  content: "\f10b";
}
.fa-circle-o:before {
  content: "\f10c";
}
.fa-quote-left:before {
  content: "\f10d";
}
.fa-quote-right:before {
  content: "\f10e";
}
.fa-spinner:before {
  content: "\f110";
}
.fa-circle:before {
  content: "\f111";
}
.fa-mail-reply:before,
.fa-reply:before {
  content: "\f112";
}
.fa-github-alt:before {
  content: "\f113";
}
.fa-folder-o:before {
  content: "\f114";
}
.fa-folder-open-o:before {
  content: "\f115";
}
.fa-smile-o:before {
  content: "\f118";
}
.fa-frown-o:before {
  content: "\f119";
}
.fa-meh-o:before {
  content: "\f11a";
}
.fa-gamepad:before {
  content: "\f11b";
}
.fa-keyboard-o:before {
  content: "\f11c";
}
.fa-flag-o:before {
  content: "\f11d";
}
.fa-flag-checkered:before {
  content: "\f11e";
}
.fa-terminal:before {
  content: "\f120";
}
.fa-code:before {
  content: "\f121";
}
.fa-mail-reply-all:before,
.fa-reply-all:before {
  content: "\f122";
}
.fa-star-half-empty:before,
.fa-star-half-full:before,
.fa-star-half-o:before {
  content: "\f123";
}
.fa-location-arrow:before {
  content: "\f124";
}
.fa-crop:before {
  content: "\f125";
}
.fa-code-fork:before {
  content: "\f126";
}
.fa-unlink:before,
.fa-chain-broken:before {
  content: "\f127";
}
.fa-question:before {
  content: "\f128";
}
.fa-info:before {
  content: "\f129";
}
.fa-exclamation:before {
  content: "\f12a";
}
.fa-superscript:before {
  content: "\f12b";
}
.fa-subscript:before {
  content: "\f12c";
}
.fa-eraser:before {
  content: "\f12d";
}
.fa-puzzle-piece:before {
  content: "\f12e";
}
.fa-microphone:before {
  content: "\f130";
}
.fa-microphone-slash:before {
  content: "\f131";
}
.fa-shield:before {
  content: "\f132";
}
.fa-calendar-o:before {
  content: "\f133";
}
.fa-fire-extinguisher:before {
  content: "\f134";
}
.fa-rocket:before {
  content: "\f135";
}
.fa-maxcdn:before {
  content: "\f136";
}
.fa-chevron-circle-left:before {
  content: "\f137";
}
.fa-chevron-circle-right:before {
  content: "\f138";
}
.fa-chevron-circle-up:before {
  content: "\f139";
}
.fa-chevron-circle-down:before {
  content: "\f13a";
}
.fa-html5:before {
  content: "\f13b";
}
.fa-css3:before {
  content: "\f13c";
}
.fa-anchor:before {
  content: "\f13d";
}
.fa-unlock-alt:before {
  content: "\f13e";
}
.fa-bullseye:before {
  content: "\f140";
}
.fa-ellipsis-h:before {
  content: "\f141";
}
.fa-ellipsis-v:before {
  content: "\f142";
}
.fa-rss-square:before {
  content: "\f143";
}
.fa-play-circle:before {
  content: "\f144";
}
.fa-ticket:before {
  content: "\f145";
}
.fa-minus-square:before {
  content: "\f146";
}
.fa-minus-square-o:before {
  content: "\f147";
}
.fa-level-up:before {
  content: "\f148";
}
.fa-level-down:before {
  content: "\f149";
}
.fa-check-square:before {
  content: "\f14a";
}
.fa-pencil-square:before {
  content: "\f14b";
}
.fa-external-link-square:before {
  content: "\f14c";
}
.fa-share-square:before {
  content: "\f14d";
}
.fa-compass:before {
  content: "\f14e";
}
.fa-toggle-down:before,
.fa-caret-square-o-down:before {
  content: "\f150";
}
.fa-toggle-up:before,
.fa-caret-square-o-up:before {
  content: "\f151";
}
.fa-toggle-right:before,
.fa-caret-square-o-right:before {
  content: "\f152";
}
.fa-euro:before,
.fa-eur:before {
  content: "\f153";
}
.fa-gbp:before {
  content: "\f154";
}
.fa-dollar:before,
.fa-usd:before {
  content: "\f155";
}
.fa-rupee:before,
.fa-inr:before {
  content: "\f156";
}
.fa-cny:before,
.fa-rmb:before,
.fa-yen:before,
.fa-jpy:before {
  content: "\f157";
}
.fa-ruble:before,
.fa-rouble:before,
.fa-rub:before {
  content: "\f158";
}
.fa-won:before,
.fa-krw:before {
  content: "\f159";
}
.fa-bitcoin:before,
.fa-btc:before {
  content: "\f15a";
}
.fa-file:before {
  content: "\f15b";
}
.fa-file-text:before {
  content: "\f15c";
}
.fa-sort-alpha-asc:before {
  content: "\f15d";
}
.fa-sort-alpha-desc:before {
  content: "\f15e";
}
.fa-sort-amount-asc:before {
  content: "\f160";
}
.fa-sort-amount-desc:before {
  content: "\f161";
}
.fa-sort-numeric-asc:before {
  content: "\f162";
}
.fa-sort-numeric-desc:before {
  content: "\f163";
}
.fa-thumbs-up:before {
  content: "\f164";
}
.fa-thumbs-down:before {
  content: "\f165";
}
.fa-youtube-square:before {
  content: "\f166";
}
.fa-youtube:before {
  content: "\f167";
}
.fa-xing:before {
  content: "\f168";
}
.fa-xing-square:before {
  content: "\f169";
}
.fa-youtube-play:before {
  content: "\f16a";
}
.fa-dropbox:before {
  content: "\f16b";
}
.fa-stack-overflow:before {
  content: "\f16c";
}
.fa-instagram:before {
  content: "\f16d";
}
.fa-flickr:before {
  content: "\f16e";
}
.fa-adn:before {
  content: "\f170";
}
.fa-bitbucket:before {
  content: "\f171";
}
.fa-bitbucket-square:before {
  content: "\f172";
}
.fa-tumblr:before {
  content: "\f173";
}
.fa-tumblr-square:before {
  content: "\f174";
}
.fa-long-arrow-down:before {
  content: "\f175";
}
.fa-long-arrow-up:before {
  content: "\f176";
}
.fa-long-arrow-left:before {
  content: "\f177";
}
.fa-long-arrow-right:before {
  content: "\f178";
}
.fa-apple:before {
  content: "\f179";
}
.fa-windows:before {
  content: "\f17a";
}
.fa-android:before {
  content: "\f17b";
}
.fa-linux:before {
  content: "\f17c";
}
.fa-dribbble:before {
  content: "\f17d";
}
.fa-skype:before {
  content: "\f17e";
}
.fa-foursquare:before {
  content: "\f180";
}
.fa-trello:before {
  content: "\f181";
}
.fa-female:before {
  content: "\f182";
}
.fa-male:before {
  content: "\f183";
}
.fa-gittip:before,
.fa-gratipay:before {
  content: "\f184";
}
.fa-sun-o:before {
  content: "\f185";
}
.fa-moon-o:before {
  content: "\f186";
}
.fa-archive:before {
  content: "\f187";
}
.fa-bug:before {
  content: "\f188";
}
.fa-vk:before {
  content: "\f189";
}
.fa-weibo:before {
  content: "\f18a";
}
.fa-renren:before {
  content: "\f18b";
}
.fa-pagelines:before {
  content: "\f18c";
}
.fa-stack-exchange:before {
  content: "\f18d";
}
.fa-arrow-circle-o-right:before {
  content: "\f18e";
}
.fa-arrow-circle-o-left:before {
  content: "\f190";
}
.fa-toggle-left:before,
.fa-caret-square-o-left:before {
  content: "\f191";
}
.fa-dot-circle-o:before {
  content: "\f192";
}
.fa-wheelchair:before {
  content: "\f193";
}
.fa-vimeo-square:before {
  content: "\f194";
}
.fa-turkish-lira:before,
.fa-try:before {
  content: "\f195";
}
.fa-plus-square-o:before {
  content: "\f196";
}
.fa-space-shuttle:before {
  content: "\f197";
}
.fa-slack:before {
  content: "\f198";
}
.fa-envelope-square:before {
  content: "\f199";
}
.fa-wordpress:before {
  content: "\f19a";
}
.fa-openid:before {
  content: "\f19b";
}
.fa-institution:before,
.fa-bank:before,
.fa-university:before {
  content: "\f19c";
}
.fa-mortar-board:before,
.fa-graduation-cap:before {
  content: "\f19d";
}
.fa-yahoo:before {
  content: "\f19e";
}
.fa-google:before {
  content: "\f1a0";
}
.fa-reddit:before {
  content: "\f1a1";
}
.fa-reddit-square:before {
  content: "\f1a2";
}
.fa-stumbleupon-circle:before {
  content: "\f1a3";
}
.fa-stumbleupon:before {
  content: "\f1a4";
}
.fa-delicious:before {
  content: "\f1a5";
}
.fa-digg:before {
  content: "\f1a6";
}
.fa-pied-piper-pp:before {
  content: "\f1a7";
}
.fa-pied-piper-alt:before {
  content: "\f1a8";
}
.fa-drupal:before {
  content: "\f1a9";
}
.fa-joomla:before {
  content: "\f1aa";
}
.fa-language:before {
  content: "\f1ab";
}
.fa-fax:before {
  content: "\f1ac";
}
.fa-building:before {
  content: "\f1ad";
}
.fa-child:before {
  content: "\f1ae";
}
.fa-paw:before {
  content: "\f1b0";
}
.fa-spoon:before {
  content: "\f1b1";
}
.fa-cube:before {
  content: "\f1b2";
}
.fa-cubes:before {
  content: "\f1b3";
}
.fa-behance:before {
  content: "\f1b4";
}
.fa-behance-square:before {
  content: "\f1b5";
}
.fa-steam:before {
  content: "\f1b6";
}
.fa-steam-square:before {
  content: "\f1b7";
}
.fa-recycle:before {
  content: "\f1b8";
}
.fa-automobile:before,
.fa-car:before {
  content: "\f1b9";
}
.fa-cab:before,
.fa-taxi:before {
  content: "\f1ba";
}
.fa-tree:before {
  content: "\f1bb";
}
.fa-spotify:before {
  content: "\f1bc";
}
.fa-deviantart:before {
  content: "\f1bd";
}
.fa-soundcloud:before {
  content: "\f1be";
}
.fa-database:before {
  content: "\f1c0";
}
.fa-file-pdf-o:before {
  content: "\f1c1";
}
.fa-file-word-o:before {
  content: "\f1c2";
}
.fa-file-excel-o:before {
  content: "\f1c3";
}
.fa-file-powerpoint-o:before {
  content: "\f1c4";
}
.fa-file-photo-o:before,
.fa-file-picture-o:before,
.fa-file-image-o:before {
  content: "\f1c5";
}
.fa-file-zip-o:before,
.fa-file-archive-o:before {
  content: "\f1c6";
}
.fa-file-sound-o:before,
.fa-file-audio-o:before {
  content: "\f1c7";
}
.fa-file-movie-o:before,
.fa-file-video-o:before {
  content: "\f1c8";
}
.fa-file-code-o:before {
  content: "\f1c9";
}
.fa-vine:before {
  content: "\f1ca";
}
.fa-codepen:before {
  content: "\f1cb";
}
.fa-jsfiddle:before {
  content: "\f1cc";
}
.fa-life-bouy:before,
.fa-life-buoy:before,
.fa-life-saver:before,
.fa-support:before,
.fa-life-ring:before {
  content: "\f1cd";
}
.fa-circle-o-notch:before {
  content: "\f1ce";
}
.fa-ra:before,
.fa-resistance:before,
.fa-rebel:before {
  content: "\f1d0";
}
.fa-ge:before,
.fa-empire:before {
  content: "\f1d1";
}
.fa-git-square:before {
  content: "\f1d2";
}
.fa-git:before {
  content: "\f1d3";
}
.fa-y-combinator-square:before,
.fa-yc-square:before,
.fa-hacker-news:before {
  content: "\f1d4";
}
.fa-tencent-weibo:before {
  content: "\f1d5";
}
.fa-qq:before {
  content: "\f1d6";
}
.fa-wechat:before,
.fa-weixin:before {
  content: "\f1d7";
}
.fa-send:before,
.fa-paper-plane:before {
  content: "\f1d8";
}
.fa-send-o:before,
.fa-paper-plane-o:before {
  content: "\f1d9";
}
.fa-history:before {
  content: "\f1da";
}
.fa-circle-thin:before {
  content: "\f1db";
}
.fa-header:before {
  content: "\f1dc";
}
.fa-paragraph:before {
  content: "\f1dd";
}
.fa-sliders:before {
  content: "\f1de";
}
.fa-share-alt:before {
  content: "\f1e0";
}
.fa-share-alt-square:before {
  content: "\f1e1";
}
.fa-bomb:before {
  content: "\f1e2";
}
.fa-soccer-ball-o:before,
.fa-futbol-o:before {
  content: "\f1e3";
}
.fa-tty:before {
  content: "\f1e4";
}
.fa-binoculars:before {
  content: "\f1e5";
}
.fa-plug:before {
  content: "\f1e6";
}
.fa-slideshare:before {
  content: "\f1e7";
}
.fa-twitch:before {
  content: "\f1e8";
}
.fa-yelp:before {
  content: "\f1e9";
}
.fa-newspaper-o:before {
  content: "\f1ea";
}
.fa-wifi:before {
  content: "\f1eb";
}
.fa-calculator:before {
  content: "\f1ec";
}
.fa-paypal:before {
  content: "\f1ed";
}
.fa-google-wallet:before {
  content: "\f1ee";
}
.fa-cc-visa:before {
  content: "\f1f0";
}
.fa-cc-mastercard:before {
  content: "\f1f1";
}
.fa-cc-discover:before {
  content: "\f1f2";
}
.fa-cc-amex:before {
  content: "\f1f3";
}
.fa-cc-paypal:before {
  content: "\f1f4";
}
.fa-cc-stripe:before {
  content: "\f1f5";
}
.fa-bell-slash:before {
  content: "\f1f6";
}
.fa-bell-slash-o:before {
  content: "\f1f7";
}
.fa-trash:before {
  content: "\f1f8";
}
.fa-copyright:before {
  content: "\f1f9";
}
.fa-at:before {
  content: "\f1fa";
}
.fa-eyedropper:before {
  content: "\f1fb";
}
.fa-paint-brush:before {
  content: "\f1fc";
}
.fa-birthday-cake:before {
  content: "\f1fd";
}
.fa-area-chart:before {
  content: "\f1fe";
}
.fa-pie-chart:before {
  content: "\f200";
}
.fa-line-chart:before {
  content: "\f201";
}
.fa-lastfm:before {
  content: "\f202";
}
.fa-lastfm-square:before {
  content: "\f203";
}
.fa-toggle-off:before {
  content: "\f204";
}
.fa-toggle-on:before {
  content: "\f205";
}
.fa-bicycle:before {
  content: "\f206";
}
.fa-bus:before {
  content: "\f207";
}
.fa-ioxhost:before {
  content: "\f208";
}
.fa-angellist:before {
  content: "\f209";
}
.fa-cc:before {
  content: "\f20a";
}
.fa-shekel:before,
.fa-sheqel:before,
.fa-ils:before {
  content: "\f20b";
}
.fa-meanpath:before {
  content: "\f20c";
}
.fa-buysellads:before {
  content: "\f20d";
}
.fa-connectdevelop:before {
  content: "\f20e";
}
.fa-dashcube:before {
  content: "\f210";
}
.fa-forumbee:before {
  content: "\f211";
}
.fa-leanpub:before {
  content: "\f212";
}
.fa-sellsy:before {
  content: "\f213";
}
.fa-shirtsinbulk:before {
  content: "\f214";
}
.fa-simplybuilt:before {
  content: "\f215";
}
.fa-skyatlas:before {
  content: "\f216";
}
.fa-cart-plus:before {
  content: "\f217";
}
.fa-cart-arrow-down:before {
  content: "\f218";
}
.fa-diamond:before {
  content: "\f219";
}
.fa-ship:before {
  content: "\f21a";
}
.fa-user-secret:before {
  content: "\f21b";
}
.fa-motorcycle:before {
  content: "\f21c";
}
.fa-street-view:before {
  content: "\f21d";
}
.fa-heartbeat:before {
  content: "\f21e";
}
.fa-venus:before {
  content: "\f221";
}
.fa-mars:before {
  content: "\f222";
}
.fa-mercury:before {
  content: "\f223";
}
.fa-intersex:before,
.fa-transgender:before {
  content: "\f224";
}
.fa-transgender-alt:before {
  content: "\f225";
}
.fa-venus-double:before {
  content: "\f226";
}
.fa-mars-double:before {
  content: "\f227";
}
.fa-venus-mars:before {
  content: "\f228";
}
.fa-mars-stroke:before {
  content: "\f229";
}
.fa-mars-stroke-v:before {
  content: "\f22a";
}
.fa-mars-stroke-h:before {
  content: "\f22b";
}
.fa-neuter:before {
  content: "\f22c";
}
.fa-genderless:before {
  content: "\f22d";
}
.fa-facebook-official:before {
  content: "\f230";
}
.fa-pinterest-p:before {
  content: "\f231";
}
.fa-whatsapp:before {
  content: "\f232";
}
.fa-server:before {
  content: "\f233";
}
.fa-user-plus:before {
  content: "\f234";
}
.fa-user-times:before {
  content: "\f235";
}
.fa-hotel:before,
.fa-bed:before {
  content: "\f236";
}
.fa-viacoin:before {
  content: "\f237";
}
.fa-train:before {
  content: "\f238";
}
.fa-subway:before {
  content: "\f239";
}
.fa-medium:before {
  content: "\f23a";
}
.fa-yc:before,
.fa-y-combinator:before {
  content: "\f23b";
}
.fa-optin-monster:before {
  content: "\f23c";
}
.fa-opencart:before {
  content: "\f23d";
}
.fa-expeditedssl:before {
  content: "\f23e";
}
.fa-battery-4:before,
.fa-battery:before,
.fa-battery-full:before {
  content: "\f240";
}
.fa-battery-3:before,
.fa-battery-three-quarters:before {
  content: "\f241";
}
.fa-battery-2:before,
.fa-battery-half:before {
  content: "\f242";
}
.fa-battery-1:before,
.fa-battery-quarter:before {
  content: "\f243";
}
.fa-battery-0:before,
.fa-battery-empty:before {
  content: "\f244";
}
.fa-mouse-pointer:before {
  content: "\f245";
}
.fa-i-cursor:before {
  content: "\f246";
}
.fa-object-group:before {
  content: "\f247";
}
.fa-object-ungroup:before {
  content: "\f248";
}
.fa-sticky-note:before {
  content: "\f249";
}
.fa-sticky-note-o:before {
  content: "\f24a";
}
.fa-cc-jcb:before {
  content: "\f24b";
}
.fa-cc-diners-club:before {
  content: "\f24c";
}
.fa-clone:before {
  content: "\f24d";
}
.fa-balance-scale:before {
  content: "\f24e";
}
.fa-hourglass-o:before {
  content: "\f250";
}
.fa-hourglass-1:before,
.fa-hourglass-start:before {
  content: "\f251";
}
.fa-hourglass-2:before,
.fa-hourglass-half:before {
  content: "\f252";
}
.fa-hourglass-3:before,
.fa-hourglass-end:before {
  content: "\f253";
}
.fa-hourglass:before {
  content: "\f254";
}
.fa-hand-grab-o:before,
.fa-hand-rock-o:before {
  content: "\f255";
}
.fa-hand-stop-o:before,
.fa-hand-paper-o:before {
  content: "\f256";
}
.fa-hand-scissors-o:before {
  content: "\f257";
}
.fa-hand-lizard-o:before {
  content: "\f258";
}
.fa-hand-spock-o:before {
  content: "\f259";
}
.fa-hand-pointer-o:before {
  content: "\f25a";
}
.fa-hand-peace-o:before {
  content: "\f25b";
}
.fa-trademark:before {
  content: "\f25c";
}
.fa-registered:before {
  content: "\f25d";
}
.fa-creative-commons:before {
  content: "\f25e";
}
.fa-gg:before {
  content: "\f260";
}
.fa-gg-circle:before {
  content: "\f261";
}
.fa-tripadvisor:before {
  content: "\f262";
}
.fa-odnoklassniki:before {
  content: "\f263";
}
.fa-odnoklassniki-square:before {
  content: "\f264";
}
.fa-get-pocket:before {
  content: "\f265";
}
.fa-wikipedia-w:before {
  content: "\f266";
}
.fa-safari:before {
  content: "\f267";
}
.fa-chrome:before {
  content: "\f268";
}
.fa-firefox:before {
  content: "\f269";
}
.fa-opera:before {
  content: "\f26a";
}
.fa-internet-explorer:before {
  content: "\f26b";
}
.fa-tv:before,
.fa-television:before {
  content: "\f26c";
}
.fa-contao:before {
  content: "\f26d";
}
.fa-500px:before {
  content: "\f26e";
}
.fa-amazon:before {
  content: "\f270";
}
.fa-calendar-plus-o:before {
  content: "\f271";
}
.fa-calendar-minus-o:before {
  content: "\f272";
}
.fa-calendar-times-o:before {
  content: "\f273";
}
.fa-calendar-check-o:before {
  content: "\f274";
}
.fa-industry:before {
  content: "\f275";
}
.fa-map-pin:before {
  content: "\f276";
}
.fa-map-signs:before {
  content: "\f277";
}
.fa-map-o:before {
  content: "\f278";
}
.fa-map:before {
  content: "\f279";
}
.fa-commenting:before {
  content: "\f27a";
}
.fa-commenting-o:before {
  content: "\f27b";
}
.fa-houzz:before {
  content: "\f27c";
}
.fa-vimeo:before {
  content: "\f27d";
}
.fa-black-tie:before {
  content: "\f27e";
}
.fa-fonticons:before {
  content: "\f280";
}
.fa-reddit-alien:before {
  content: "\f281";
}
.fa-edge:before {
  content: "\f282";
}
.fa-credit-card-alt:before {
  content: "\f283";
}
.fa-codiepie:before {
  content: "\f284";
}
.fa-modx:before {
  content: "\f285";
}
.fa-fort-awesome:before {
  content: "\f286";
}
.fa-usb:before {
  content: "\f287";
}
.fa-product-hunt:before {
  content: "\f288";
}
.fa-mixcloud:before {
  content: "\f289";
}
.fa-scribd:before {
  content: "\f28a";
}
.fa-pause-circle:before {
  content: "\f28b";
}
.fa-pause-circle-o:before {
  content: "\f28c";
}
.fa-stop-circle:before {
  content: "\f28d";
}
.fa-stop-circle-o:before {
  content: "\f28e";
}
.fa-shopping-bag:before {
  content: "\f290";
}
.fa-shopping-basket:before {
  content: "\f291";
}
.fa-hashtag:before {
  content: "\f292";
}
.fa-bluetooth:before {
  content: "\f293";
}
.fa-bluetooth-b:before {
  content: "\f294";
}
.fa-percent:before {
  content: "\f295";
}
.fa-gitlab:before {
  content: "\f296";
}
.fa-wpbeginner:before {
  content: "\f297";
}
.fa-wpforms:before {
  content: "\f298";
}
.fa-envira:before {
  content: "\f299";
}
.fa-universal-access:before {
  content: "\f29a";
}
.fa-wheelchair-alt:before {
  content: "\f29b";
}
.fa-question-circle-o:before {
  content: "\f29c";
}
.fa-blind:before {
  content: "\f29d";
}
.fa-audio-description:before {
  content: "\f29e";
}
.fa-volume-control-phone:before {
  content: "\f2a0";
}
.fa-braille:before {
  content: "\f2a1";
}
.fa-assistive-listening-systems:before {
  content: "\f2a2";
}
.fa-asl-interpreting:before,
.fa-american-sign-language-interpreting:before {
  content: "\f2a3";
}
.fa-deafness:before,
.fa-hard-of-hearing:before,
.fa-deaf:before {
  content: "\f2a4";
}
.fa-glide:before {
  content: "\f2a5";
}
.fa-glide-g:before {
  content: "\f2a6";
}
.fa-signing:before,
.fa-sign-language:before {
  content: "\f2a7";
}
.fa-low-vision:before {
  content: "\f2a8";
}
.fa-viadeo:before {
  content: "\f2a9";
}
.fa-viadeo-square:before {
  content: "\f2aa";
}
.fa-snapchat:before {
  content: "\f2ab";
}
.fa-snapchat-ghost:before {
  content: "\f2ac";
}
.fa-snapchat-square:before {
  content: "\f2ad";
}
.fa-pied-piper:before {
  content: "\f2ae";
}
.fa-first-order:before {
  content: "\f2b0";
}
.fa-yoast:before {
  content: "\f2b1";
}
.fa-themeisle:before {
  content: "\f2b2";
}
.fa-google-plus-circle:before,
.fa-google-plus-official:before {
  content: "\f2b3";
}
.fa-fa:before,
.fa-font-awesome:before {
  content: "\f2b4";
}
.fa-handshake-o:before {
  content: "\f2b5";
}
.fa-envelope-open:before {
  content: "\f2b6";
}
.fa-envelope-open-o:before {
  content: "\f2b7";
}
.fa-linode:before {
  content: "\f2b8";
}
.fa-address-book:before {
  content: "\f2b9";
}
.fa-address-book-o:before {
  content: "\f2ba";
}
.fa-vcard:before,
.fa-address-card:before {
  content: "\f2bb";
}
.fa-vcard-o:before,
.fa-address-card-o:before {
  content: "\f2bc";
}
.fa-user-circle:before {
  content: "\f2bd";
}
.fa-user-circle-o:before {
  content: "\f2be";
}
.fa-user-o:before {
  content: "\f2c0";
}
.fa-id-badge:before {
  content: "\f2c1";
}
.fa-drivers-license:before,
.fa-id-card:before {
  content: "\f2c2";
}
.fa-drivers-license-o:before,
.fa-id-card-o:before {
  content: "\f2c3";
}
.fa-quora:before {
  content: "\f2c4";
}
.fa-free-code-camp:before {
  content: "\f2c5";
}
.fa-telegram:before {
  content: "\f2c6";
}
.fa-thermometer-4:before,
.fa-thermometer:before,
.fa-thermometer-full:before {
  content: "\f2c7";
}
.fa-thermometer-3:before,
.fa-thermometer-three-quarters:before {
  content: "\f2c8";
}
.fa-thermometer-2:before,
.fa-thermometer-half:before {
  content: "\f2c9";
}
.fa-thermometer-1:before,
.fa-thermometer-quarter:before {
  content: "\f2ca";
}
.fa-thermometer-0:before,
.fa-thermometer-empty:before {
  content: "\f2cb";
}
.fa-shower:before {
  content: "\f2cc";
}
.fa-bathtub:before,
.fa-s15:before,
.fa-bath:before {
  content: "\f2cd";
}
.fa-podcast:before {
  content: "\f2ce";
}
.fa-window-maximize:before {
  content: "\f2d0";
}
.fa-window-minimize:before {
  content: "\f2d1";
}
.fa-window-restore:before {
  content: "\f2d2";
}
.fa-times-rectangle:before,
.fa-window-close:before {
  content: "\f2d3";
}
.fa-times-rectangle-o:before,
.fa-window-close-o:before {
  content: "\f2d4";
}
.fa-bandcamp:before {
  content: "\f2d5";
}
.fa-grav:before {
  content: "\f2d6";
}
.fa-etsy:before {
  content: "\f2d7";
}
.fa-imdb:before {
  content: "\f2d8";
}
.fa-ravelry:before {
  content: "\f2d9";
}
.fa-eercast:before {
  content: "\f2da";
}
.fa-microchip:before {
  content: "\f2db";
}
.fa-snowflake-o:before {
  content: "\f2dc";
}
.fa-superpowers:before {
  content: "\f2dd";
}
.fa-wpexplorer:before {
  content: "\f2de";
}
.fa-meetup:before {
  content: "\f2e0";
}
.sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  margin: -1px;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  border: 0;
}
.sr-only-focusable:active,
.sr-only-focusable:focus {
  position: static;
  width: auto;
  height: auto;
  margin: 0;
  overflow: visible;
  clip: auto;
}

/*!*************************************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/ngx-bootstrap/datepicker/bs-datepicker.css ***!
  \*************************************************************************************************************************************************************************************************************************************************/
/* .bs-datepicker */
.bs-datepicker {
  display: flex;
  align-items: stretch;
  flex-flow: row wrap;
  background: #fff;
  box-shadow: 0 0 10px 0 #aaa;
  position: relative;
  z-index: 1;
  /* button */
  /* .bs-datepicker-head */
  /* .bs-datepicker-body */
  /* .current-timedate */
  /* .bs-datepicker-multiple */
  /* .bs-datepicker-btns */
  /*.bs-datepicker-custom-range */
  /* .bs-datepicker-predefined-btns */
  /* .bs-datepicker-buttons */
}
.bs-datepicker:after {
  clear: both;
  content: "";
  display: block;
}
.bs-datepicker bs-day-picker {
  float: left;
}
.bs-datepicker button:hover,
.bs-datepicker button:focus,
.bs-datepicker button:active,
.bs-datepicker input:hover,
.bs-datepicker input:focus,
.bs-datepicker input:active, .bs-datepicker-btns button:hover, .bs-datepicker-btns button:focus, .bs-datepicker-btns button:active, .bs-datepicker-predefined-btns button:active, .bs-datepicker-predefined-btns button:focus {
  outline: none;
}
.bs-datepicker-head {
  min-width: 270px;
  height: 50px;
  padding: 10px;
  border-radius: 3px 3px 0 0;
  text-align: justify;
  /* .bs-datepicker-head button */
}
.bs-datepicker-head:after {
  content: "";
  display: inline-block;
  vertical-align: top;
  width: 100%;
}
.bs-datepicker-head button {
  display: inline-block;
  vertical-align: top;
  padding: 0;
  height: 30px;
  line-height: 30px;
  border: 0;
  background: transparent;
  text-align: center;
  cursor: pointer;
  color: #fff;
  transition: 0.3s;
}
.bs-datepicker-head button[disabled], .bs-datepicker-head button[disabled]:hover, .bs-datepicker-head button[disabled]:active {
  background: rgba(221, 221, 221, 0.3);
  color: #f5f5f5;
  cursor: not-allowed;
}
.bs-datepicker-head button.previous span {
  transform: translate(-1px, -1px);
}
.bs-datepicker-head button.next span {
  transform: translate(1px, -1px);
}
.bs-datepicker-head button.next, .bs-datepicker-head button.previous {
  border-radius: 50%;
  width: 30px;
  height: 30px;
}
.bs-datepicker-head button.next span, .bs-datepicker-head button.previous span {
  font-size: 28px;
  line-height: 1;
  display: inline-block;
  position: relative;
  height: 100%;
  width: 100%;
  border-radius: 50%;
}
.bs-datepicker-head button.current {
  border-radius: 15px;
  max-width: 155px;
  padding: 0 13px;
}
.bs-datepicker-head button:hover {
  background-color: rgba(0, 0, 0, 0.1);
}
.bs-datepicker-head button:active {
  background-color: rgba(0, 0, 0, 0.2);
}
.bs-datepicker-body {
  padding: 10px;
  border-radius: 0 0 3px 3px;
  min-height: 232px;
  min-width: 278px;
  border: 1px solid #e9edf0;
  /* .bs-datepicker-body table */
}
.bs-datepicker-body .days.weeks {
  position: relative;
  z-index: 1;
}
.bs-datepicker-body table {
  width: 100%;
  border-collapse: separate;
  border-spacing: 0;
  /* .bs-datepicker-body table.days */
  /* .bs-datepicker-body table.weeks */
}
.bs-datepicker-body table th {
  font-size: 13px;
  color: #9aaec1;
  font-weight: 400;
  text-align: center;
}
.bs-datepicker-body table td {
  color: #54708b;
  text-align: center;
  position: relative;
  padding: 0;
  /* todo: check first :not(.disabled) usage */
}
.bs-datepicker-body table td span {
  display: block;
  margin: 0 auto;
  font-size: 13px;
  border-radius: 50%;
  /*z-index: 1;*/
  -moz-user-select: none;
  -webkit-user-select: none;
  -ms-user-select: none;
}
.bs-datepicker-body table td:not(.disabled):not(.week) span:not(.disabled):not(.is-other-month) {
  cursor: pointer;
}
.bs-datepicker-body table td.is-highlighted:not(.disabled):not(.selected) span,
.bs-datepicker-body table td span.is-highlighted:not(.disabled):not(.selected) {
  background-color: #e9edf0;
  transition: 0s;
}
.bs-datepicker-body table td.is-active-other-month:not(.disabled):not(.selected) span,
.bs-datepicker-body table td span.is-active-other-month:not(.disabled):not(.selected) {
  background-color: #e9edf0;
  transition: 0s;
  cursor: pointer;
}
.bs-datepicker-body table td span.disabled, .bs-datepicker-body table td.disabled span {
  color: #9aaec1;
}
.bs-datepicker-body table td span.selected, .bs-datepicker-body table td.selected span {
  color: #fff;
}
.bs-datepicker-body table td span.is-other-month, .bs-datepicker-body table td.is-other-month span {
  color: rgba(0, 0, 0, 0.25);
}
.bs-datepicker-body table td.active {
  position: relative;
}
.bs-datepicker-body table td.active.select-start:before {
  left: 35%;
}
.bs-datepicker-body table td.active.select-end:before {
  left: -85%;
}
.bs-datepicker-body table td span.active.select-start:after,
.bs-datepicker-body table td span.active.select-end:after, .bs-datepicker-body table td.active.select-start span:after, .bs-datepicker-body table td.active.select-end span:after {
  content: "";
  display: block;
  position: absolute;
  z-index: -1;
  width: 100%;
  height: 100%;
  transition: 0.3s;
  top: 0;
  border-radius: 50%;
}
.bs-datepicker-body table td:before,
.bs-datepicker-body table td span:before {
  content: "";
  display: block;
  position: absolute;
  z-index: -1;
  top: 6px;
  bottom: 6px;
  left: -3px;
  right: -2px;
  box-sizing: content-box;
  background: transparent;
}
.bs-datepicker-body table td.active.select-start + td.active:before {
  left: -20%;
}
.bs-datepicker-body table td:last-child.active:before {
  border-radius: 0 3px 3px 0;
  width: 125%;
  left: -25%;
}
.bs-datepicker-body table td span[class*=select-], .bs-datepicker-body table td[class*=select-] span {
  border-radius: 50%;
  color: #fff;
}
.bs-datepicker-body table.days td.active:not(.select-start):before, .bs-datepicker-body table.days td.in-range:not(.select-start):before,
.bs-datepicker-body table.days span.active:not(.select-start):before,
.bs-datepicker-body table.days span.in-range:not(.select-start):before {
  background: #e9edf0;
}
.bs-datepicker-body table.days span {
  width: 32px;
  height: 32px;
  line-height: 32px;
}
.bs-datepicker-body table.days span.select-start {
  z-index: 2;
}
.bs-datepicker-body table.days span.is-highlighted.in-range:before {
  right: 3px;
  left: 0;
}
.bs-datepicker-body table.days span.in-range.select-end:before {
  right: 4px;
  left: 0;
}
.bs-datepicker-body table.days td.select-start + td.select-end:before, .bs-datepicker-body table.days td.select-start + td.is-highlighted:before, .bs-datepicker-body table.days td.active + td.is-highlighted:before, .bs-datepicker-body table.days td.active + td.select-end:before, .bs-datepicker-body table.days td.in-range + td.is-highlighted:before, .bs-datepicker-body table.days td.in-range + td.select-end:before {
  background: #e9edf0;
  width: 100%;
}
.bs-datepicker-body table.weeks tr td:nth-child(2).active:before {
  border-radius: 3px 0 0 3px;
  left: 0;
  width: 100%;
}
.bs-datepicker-body table:not(.weeks) tr td:first-child:before {
  border-radius: 3px 0 0 3px;
}
.bs-datepicker-body table.years td span {
  width: 46px;
  height: 46px;
  line-height: 45px;
  margin: 0 auto;
}
.bs-datepicker-body table.years tr:not(:last-child) td span {
  margin-bottom: 8px;
}
.bs-datepicker-body table.months td {
  height: 52px;
}
.bs-datepicker-body table.months td span {
  padding: 6px;
  border-radius: 15px;
}
.bs-datepicker .current-timedate {
  color: #54708b;
  font-size: 15px;
  text-align: center;
  height: 30px;
  line-height: 30px;
  border-radius: 20px;
  border: 1px solid #e9edf0;
  margin-bottom: 10px;
  cursor: pointer;
  text-transform: uppercase;
  -moz-user-select: none;
  -webkit-user-select: none;
  -ms-user-select: none;
}
.bs-datepicker .current-timedate span:not(:empty):before {
  content: "";
  width: 15px;
  height: 16px;
  display: inline-block;
  margin-right: 4px;
  vertical-align: text-bottom;
  background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA8AAAAQCAYAAADJViUEAAABMklEQVQoU9VTwW3CQBCcOUgBtEBKSAukAnBKME+wFCAlYIhk8sQlxFABtJAScAsuAPBEewYcxCP8ouxrPDsza61uiVN1o6RNHD4htSCmq49RfO71BvMJqBBkITRf1kmUW49nQRC9h1I5AZlBClaL8aP1fKgOOxCx8aSLs+Q19eZuNO8QmPqJRtDFguy7OAcDbJPs+/BKVPDIPrvD2ZJgWAmVe7O0rI0Vqs1seyWUXpuJoppYCa5L+U++NpNPkr5OE2oMdARsb3gykJT5ydZcL8Z9Ww60nxg2LhjON9li9OwXZzo+xLbp3nC2s9CL2RrueGyVrgwNm8HpsCzZ9EEW6kqXlo1GQe03FzP/7W8Hl0dBtu7Bf7zt6mIwvX1RvzDCm7+q3mAW0Dl/GPdUCeXrZLT9BrDrGkm4qlPvAAAAAElFTkSuQmCC);
}
.bs-datepicker-multiple {
  border-radius: 4px 0 0 4px;
}
.bs-datepicker-multiple + .bs-datepicker-multiple {
  margin-left: 10px;
}
.bs-datepicker-multiple .bs-datepicker {
  box-shadow: none;
  position: relative;
}
.bs-datepicker-multiple .bs-datepicker:not(:last-child) {
  padding-right: 10px;
}
.bs-datepicker-multiple .bs-datepicker + .bs-datepicker:after {
  content: "";
  display: block;
  width: 14px;
  height: 10px;
  background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA8AAAAKCAYAAABrGwT5AAAA1ElEQVQoU42RsQrCUAxF77VuDu7O4oMWW//BURBBpZvgKk4uIrjoqKOTf+DopIO4uYggtFTfw3+pkQqCW1/G5J7kJiFy4m5MxUlxAzgIPHX+lzMPzupRYlYgxiR7vqsOP8YKzsTx0yxFMCUZ+q7aZzlr+OvgoWcAFyAHgat2jLWu48252DdqAihDJGSSJNUUxYmQjs3+hPQBlAh2rG2LCOPnaw3IiGDX99TRCs7ASJsNhUOA7d/LcuHvRG22FIZvsNXw1MX6VZExCilOQKEfeLXr/10+aC9Ho7arh7oAAAAASUVORK5CYII=);
  position: absolute;
  top: 25px;
  left: -8px;
}
.bs-datepicker-multiple .bs-datepicker .left {
  float: left;
}
.bs-datepicker-multiple .bs-datepicker .right {
  float: right;
}
.bs-datepicker-container {
  padding: 15px;
}
.bs-datepicker .bs-media-container {
  display: flex;
}
@media (max-width: 768px) {
  .bs-datepicker .bs-media-container {
    flex-direction: column;
  }
}
.bs-datepicker .bs-timepicker-in-datepicker-container {
  display: flex;
  justify-content: space-around;
}
.bs-datepicker-custom-range {
  padding: 15px;
  background: #eee;
}
.bs-datepicker-predefined-btns button {
  width: 100%;
  display: block;
  height: 30px;
  background-color: #9aaec1;
  border-radius: 4px;
  color: #fff;
  border: 0;
  margin-bottom: 10px;
  padding: 0 18px;
  text-align: left;
  transition: 0.3s;
}
.bs-datepicker-predefined-btns button:hover {
  background-color: #54708b;
}
.bs-datepicker-buttons {
  display: flex;
  flex-flow: row wrap;
  justify-content: flex-end;
  padding-top: 10px;
  border-top: 1px solid #e9edf0;
}
.bs-datepicker-buttons .btn-default {
  margin-left: 10px;
}
.bs-datepicker-buttons .btn-today-wrapper {
  display: flex;
  flex-flow: row wrap;
}
.bs-datepicker-buttons .clear-right,
.bs-datepicker-buttons .today-right {
  flex-grow: 0;
}
.bs-datepicker-buttons .clear-left,
.bs-datepicker-buttons .today-left {
  flex-grow: 1;
}
.bs-datepicker-buttons .clear-center,
.bs-datepicker-buttons .today-center {
  flex-grow: 0.5;
}
/* .bs-timepicker */
.bs-timepicker-container {
  padding: 10px 0;
}
.bs-timepicker-label {
  color: #54708b;
  margin-bottom: 10px;
}
.bs-timepicker-controls {
  display: inline-block;
  vertical-align: top;
  margin-right: 10px;
}
.bs-timepicker-controls button {
  width: 20px;
  height: 20px;
  border-radius: 50%;
  border: 0;
  background-color: #e9edf0;
  color: #54708b;
  font-size: 16px;
  font-weight: 700;
  vertical-align: middle;
  line-height: 0;
  padding: 0;
  transition: 0.3s;
}
.bs-timepicker-controls button:hover {
  background-color: #d5dadd;
}
.bs-timepicker-controls input {
  width: 35px;
  height: 25px;
  border-radius: 13px;
  text-align: center;
  border: 1px solid #e9edf0;
}
.bs-timepicker .switch-time-format {
  text-transform: uppercase;
  min-width: 54px;
  height: 25px;
  border-radius: 20px;
  border: 1px solid #e9edf0;
  background: #fff;
  color: #54708b;
  font-size: 13px;
}
.bs-timepicker .switch-time-format img {
  vertical-align: initial;
  margin-left: 4px;
}
bs-datepicker-container,
bs-daterangepicker-container {
  z-index: 1080;
}
/* screen size < 1024px */
@media (max-width: 768px) {
  .bs-datepicker {
    width: min-content;
    justify-content: center;
  }
  .bs-datepicker-multiple {
    display: flex;
  }
  .bs-datepicker-multiple + .bs-datepicker-multiple {
    margin-top: 10px;
    margin-left: 0;
  }
}
/* theming */
.theme-default .bs-datepicker-head {
  background-color: #777;
}
.theme-default .btn-today-wrapper .btn-success, .theme-default .btn-clear-wrapper .btn-success {
  background-color: #777;
  border-color: #777;
}
.theme-default .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active:focus, .theme-default .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active:focus {
  box-shadow: none;
}
.theme-default .btn-today-wrapper .btn-success:focus, .theme-default .btn-clear-wrapper .btn-success:focus {
  box-shadow: none;
}
.theme-default .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active, .theme-default .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active {
  background-color: #616161;
  border-color: #616161;
}
.theme-default .btn-today-wrapper .btn-success:hover, .theme-default .btn-clear-wrapper .btn-success:hover {
  background-color: #6F6E6E;
  border-color: #6F6E6E;
}
.theme-default .bs-datepicker-predefined-btns button.selected {
  background-color: #777;
}
.theme-default .bs-datepicker-body table td span.selected, .theme-default .bs-datepicker-body table td.selected span,
.theme-default .bs-datepicker-body table td span[class*=select-]:after, .theme-default .bs-datepicker-body table td[class*=select-] span:after {
  background-color: #777;
}
.theme-default .bs-datepicker-body table td.week span {
  color: #777;
}
.theme-default .bs-datepicker-body table td.active-week span:hover {
  cursor: pointer;
  background-color: #777;
  color: #fff;
  opacity: 0.5;
  transition: 0s;
}
.theme-green .bs-datepicker-head {
  background-color: #5cb85c;
}
.theme-green .btn-today-wrapper .btn-success, .theme-green .btn-clear-wrapper .btn-success {
  background-color: #5cb85c;
  border-color: #5cb85c;
}
.theme-green .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active:focus, .theme-green .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active:focus {
  box-shadow: none;
}
.theme-green .btn-today-wrapper .btn-success:focus, .theme-green .btn-clear-wrapper .btn-success:focus {
  box-shadow: none;
}
.theme-green .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active, .theme-green .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active {
  background-color: #1e7e34;
  border-color: #1e7e34;
}
.theme-green .btn-today-wrapper .btn-success:hover, .theme-green .btn-clear-wrapper .btn-success:hover {
  background-color: #218838;
  border-color: #218838;
}
.theme-green .bs-datepicker-predefined-btns button.selected {
  background-color: #5cb85c;
}
.theme-green .bs-datepicker-body table td span.selected, .theme-green .bs-datepicker-body table td.selected span,
.theme-green .bs-datepicker-body table td span[class*=select-]:after, .theme-green .bs-datepicker-body table td[class*=select-] span:after {
  background-color: #5cb85c;
}
.theme-green .bs-datepicker-body table td.week span {
  color: #5cb85c;
}
.theme-green .bs-datepicker-body table td.active-week span:hover {
  cursor: pointer;
  background-color: #5cb85c;
  color: #fff;
  opacity: 0.5;
  transition: 0s;
}
.theme-blue .bs-datepicker-head {
  background-color: #5bc0de;
}
.theme-blue .btn-today-wrapper .btn-success, .theme-blue .btn-clear-wrapper .btn-success {
  background-color: #5bc0de;
  border-color: #5bc0de;
}
.theme-blue .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active:focus, .theme-blue .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active:focus {
  box-shadow: none;
}
.theme-blue .btn-today-wrapper .btn-success:focus, .theme-blue .btn-clear-wrapper .btn-success:focus {
  box-shadow: none;
}
.theme-blue .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active, .theme-blue .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active {
  background-color: #2AA8CD;
  border-color: #2AA8CD;
}
.theme-blue .btn-today-wrapper .btn-success:hover, .theme-blue .btn-clear-wrapper .btn-success:hover {
  background-color: #3AB3D7;
  border-color: #3AB3D7;
}
.theme-blue .bs-datepicker-predefined-btns button.selected {
  background-color: #5bc0de;
}
.theme-blue .bs-datepicker-body table td span.selected, .theme-blue .bs-datepicker-body table td.selected span,
.theme-blue .bs-datepicker-body table td span[class*=select-]:after, .theme-blue .bs-datepicker-body table td[class*=select-] span:after {
  background-color: #5bc0de;
}
.theme-blue .bs-datepicker-body table td.week span {
  color: #5bc0de;
}
.theme-blue .bs-datepicker-body table td.active-week span:hover {
  cursor: pointer;
  background-color: #5bc0de;
  color: #fff;
  opacity: 0.5;
  transition: 0s;
}
.theme-dark-blue .bs-datepicker-head {
  background-color: #337ab7;
}
.theme-dark-blue .btn-today-wrapper .btn-success, .theme-dark-blue .btn-clear-wrapper .btn-success {
  background-color: #337ab7;
  border-color: #337ab7;
}
.theme-dark-blue .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active:focus, .theme-dark-blue .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active:focus {
  box-shadow: none;
}
.theme-dark-blue .btn-today-wrapper .btn-success:focus, .theme-dark-blue .btn-clear-wrapper .btn-success:focus {
  box-shadow: none;
}
.theme-dark-blue .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active, .theme-dark-blue .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active {
  background-color: #266498;
  border-color: #266498;
}
.theme-dark-blue .btn-today-wrapper .btn-success:hover, .theme-dark-blue .btn-clear-wrapper .btn-success:hover {
  background-color: #2C6FA9;
  border-color: #2C6FA9;
}
.theme-dark-blue .bs-datepicker-predefined-btns button.selected {
  background-color: #337ab7;
}
.theme-dark-blue .bs-datepicker-body table td span.selected, .theme-dark-blue .bs-datepicker-body table td.selected span,
.theme-dark-blue .bs-datepicker-body table td span[class*=select-]:after, .theme-dark-blue .bs-datepicker-body table td[class*=select-] span:after {
  background-color: #337ab7;
}
.theme-dark-blue .bs-datepicker-body table td.week span {
  color: #337ab7;
}
.theme-dark-blue .bs-datepicker-body table td.active-week span:hover {
  cursor: pointer;
  background-color: #337ab7;
  color: #fff;
  opacity: 0.5;
  transition: 0s;
}
.theme-red .bs-datepicker-head {
  background-color: #d9534f;
}
.theme-red .btn-today-wrapper .btn-success, .theme-red .btn-clear-wrapper .btn-success {
  background-color: #d9534f;
  border-color: #d9534f;
}
.theme-red .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active:focus, .theme-red .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active:focus {
  box-shadow: none;
}
.theme-red .btn-today-wrapper .btn-success:focus, .theme-red .btn-clear-wrapper .btn-success:focus {
  box-shadow: none;
}
.theme-red .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active, .theme-red .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active {
  background-color: #D23531;
  border-color: #D23531;
}
.theme-red .btn-today-wrapper .btn-success:hover, .theme-red .btn-clear-wrapper .btn-success:hover {
  background-color: #E33732;
  border-color: #E33732;
}
.theme-red .bs-datepicker-predefined-btns button.selected {
  background-color: #d9534f;
}
.theme-red .bs-datepicker-body table td span.selected, .theme-red .bs-datepicker-body table td.selected span,
.theme-red .bs-datepicker-body table td span[class*=select-]:after, .theme-red .bs-datepicker-body table td[class*=select-] span:after {
  background-color: #d9534f;
}
.theme-red .bs-datepicker-body table td.week span {
  color: #d9534f;
}
.theme-red .bs-datepicker-body table td.active-week span:hover {
  cursor: pointer;
  background-color: #d9534f;
  color: #fff;
  opacity: 0.5;
  transition: 0s;
}
.theme-orange .bs-datepicker-head {
  background-color: #f0ad4e;
}
.theme-orange .btn-today-wrapper .btn-success, .theme-orange .btn-clear-wrapper .btn-success {
  background-color: #f0ad4e;
  border-color: #f0ad4e;
}
.theme-orange .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active:focus, .theme-orange .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active:focus {
  box-shadow: none;
}
.theme-orange .btn-today-wrapper .btn-success:focus, .theme-orange .btn-clear-wrapper .btn-success:focus {
  box-shadow: none;
}
.theme-orange .btn-today-wrapper .btn-success:not(:disabled):not(.disabled):active, .theme-orange .btn-clear-wrapper .btn-success:not(:disabled):not(.disabled):active {
  background-color: #ED9C29;
  border-color: #ED9C29;
}
.theme-orange .btn-today-wrapper .btn-success:hover, .theme-orange .btn-clear-wrapper .btn-success:hover {
  background-color: #FFAC35;
  border-color: #FFAC35;
}
.theme-orange .bs-datepicker-predefined-btns button.selected {
  background-color: #f0ad4e;
}
.theme-orange .bs-datepicker-body table td span.selected, .theme-orange .bs-datepicker-body table td.selected span,
.theme-orange .bs-datepicker-body table td span[class*=select-]:after, .theme-orange .bs-datepicker-body table td[class*=select-] span:after {
  background-color: #f0ad4e;
}
.theme-orange .bs-datepicker-body table td.week span {
  color: #f0ad4e;
}
.theme-orange .bs-datepicker-body table td.active-week span:hover {
  cursor: pointer;
  background-color: #f0ad4e;
  color: #fff;
  opacity: 0.5;
  transition: 0s;
}

/*!**************************************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/perfect-scrollbar/css/perfect-scrollbar.css ***!
  \**************************************************************************************************************************************************************************************************************************************************/
/*
 * Container style
 */
.ps {
  overflow: hidden !important;
  overflow-anchor: none;
  -ms-overflow-style: none;
  touch-action: auto;
  -ms-touch-action: auto;
}
/*
 * Scrollbar rail styles
 */
.ps__rail-x {
  display: none;
  opacity: 0;
  transition: background-color .2s linear, opacity .2s linear;
  -webkit-transition: background-color .2s linear, opacity .2s linear;
  height: 15px;
  /* there must be 'bottom' or 'top' for ps__rail-x */
  bottom: 0px;
  /* please don't change 'position' */
  position: absolute;
}
.ps__rail-y {
  display: none;
  opacity: 0;
  transition: background-color .2s linear, opacity .2s linear;
  -webkit-transition: background-color .2s linear, opacity .2s linear;
  width: 15px;
  /* there must be 'right' or 'left' for ps__rail-y */
  right: 0;
  /* please don't change 'position' */
  position: absolute;
}
.ps--active-x > .ps__rail-x,
.ps--active-y > .ps__rail-y {
  display: block;
  background-color: transparent;
}
.ps:hover > .ps__rail-x,
.ps:hover > .ps__rail-y,
.ps--focus > .ps__rail-x,
.ps--focus > .ps__rail-y,
.ps--scrolling-x > .ps__rail-x,
.ps--scrolling-y > .ps__rail-y {
  opacity: 0.6;
}
.ps .ps__rail-x:hover,
.ps .ps__rail-y:hover,
.ps .ps__rail-x:focus,
.ps .ps__rail-y:focus,
.ps .ps__rail-x.ps--clicking,
.ps .ps__rail-y.ps--clicking {
  background-color: #eee;
  opacity: 0.9;
}
/*
 * Scrollbar thumb styles
 */
.ps__thumb-x {
  background-color: #aaa;
  border-radius: 6px;
  transition: background-color .2s linear, height .2s ease-in-out;
  -webkit-transition: background-color .2s linear, height .2s ease-in-out;
  height: 6px;
  /* there must be 'bottom' for ps__thumb-x */
  bottom: 2px;
  /* please don't change 'position' */
  position: absolute;
}
.ps__thumb-y {
  background-color: #aaa;
  border-radius: 6px;
  transition: background-color .2s linear, width .2s ease-in-out;
  -webkit-transition: background-color .2s linear, width .2s ease-in-out;
  width: 6px;
  /* there must be 'right' for ps__thumb-y */
  right: 2px;
  /* please don't change 'position' */
  position: absolute;
}
.ps__rail-x:hover > .ps__thumb-x,
.ps__rail-x:focus > .ps__thumb-x,
.ps__rail-x.ps--clicking .ps__thumb-x {
  background-color: #999;
  height: 11px;
}
.ps__rail-y:hover > .ps__thumb-y,
.ps__rail-y:focus > .ps__thumb-y,
.ps__rail-y.ps--clicking .ps__thumb-y {
  background-color: #999;
  width: 11px;
}
/* MS supports */
@supports (-ms-overflow-style: none) {
  .ps {
    overflow: auto !important;
  }
}
@media screen and (-ms-high-contrast: active), (-ms-high-contrast: none) {
  .ps {
    overflow: auto !important;
  }
}

/*!****************************************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/owl.carousel/dist/assets/owl.carousel.min.css ***!
  \****************************************************************************************************************************************************************************************************************************************************/
/**
 * Owl Carousel v2.3.4
 * Copyright 2013-2018 David Deutsch
 * Licensed under: SEE LICENSE IN https://github.com/OwlCarousel2/OwlCarousel2/blob/master/LICENSE
 */
.owl-carousel,.owl-carousel .owl-item{-webkit-tap-highlight-color:transparent;position:relative}
.owl-carousel{display:none;width:100%;z-index:1}
.owl-carousel .owl-stage{position:relative;touch-action:manipulation;-moz-backface-visibility:hidden}
.owl-carousel .owl-stage:after{content:".";display:block;clear:both;visibility:hidden;line-height:0;height:0}
.owl-carousel .owl-stage-outer{position:relative;overflow:hidden;-webkit-transform:translate3d(0,0,0)}
.owl-carousel .owl-item,.owl-carousel .owl-wrapper{-webkit-backface-visibility:hidden;-moz-backface-visibility:hidden;-ms-backface-visibility:hidden;-webkit-transform:translate3d(0,0,0);-moz-transform:translate3d(0,0,0);-ms-transform:translate3d(0,0,0)}
.owl-carousel .owl-item{min-height:1px;float:left;-webkit-backface-visibility:hidden;-webkit-touch-callout:none}
.owl-carousel .owl-item img{display:block;width:100%}
.owl-carousel .owl-dots.disabled,.owl-carousel .owl-nav.disabled{display:none}
.no-js .owl-carousel,.owl-carousel.owl-loaded{display:block}
.owl-carousel .owl-dot,.owl-carousel .owl-nav .owl-next,.owl-carousel .owl-nav .owl-prev{cursor:pointer;-webkit-user-select:none;user-select:none}
.owl-carousel .owl-nav button.owl-next,.owl-carousel .owl-nav button.owl-prev,.owl-carousel button.owl-dot{background:0 0;color:inherit;border:none;padding:0!important;font:inherit}
.owl-carousel.owl-loading{opacity:0;display:block}
.owl-carousel.owl-hidden{opacity:0}
.owl-carousel.owl-refresh .owl-item{visibility:hidden}
.owl-carousel.owl-drag .owl-item{touch-action:pan-y;-webkit-user-select:none;user-select:none}
.owl-carousel.owl-grab{cursor:move;cursor:grab}
.owl-carousel.owl-rtl{direction:rtl}
.owl-carousel.owl-rtl .owl-item{float:right}
.owl-carousel .animated{animation-duration:1s;animation-fill-mode:both}
.owl-carousel .owl-animated-in{z-index:0}
.owl-carousel .owl-animated-out{z-index:1}
.owl-carousel .fadeOut{animation-name:fadeOut}
@keyframes fadeOut{0%{opacity:1}100%{opacity:0}}
.owl-height{transition:height .5s ease-in-out}
.owl-carousel .owl-item .owl-lazy{opacity:0;transition:opacity .4s ease}
.owl-carousel .owl-item .owl-lazy:not([src]),.owl-carousel .owl-item .owl-lazy[src^=""]{max-height:0}
.owl-carousel .owl-item img.owl-lazy{transform-style:preserve-3d}
.owl-carousel .owl-video-wrapper{position:relative;height:100%;background:#000}
.owl-carousel .owl-video-play-icon{position:absolute;height:80px;width:80px;left:50%;top:50%;margin-left:-40px;margin-top:-40px;background:url('owl.video.play.e3b436436832b027.png') no-repeat;cursor:pointer;z-index:1;-webkit-backface-visibility:hidden;transition:transform .1s ease}
.owl-carousel .owl-video-play-icon:hover{transform:scale(1.3,1.3)}
.owl-carousel .owl-video-playing .owl-video-play-icon,.owl-carousel .owl-video-playing .owl-video-tn{display:none}
.owl-carousel .owl-video-tn{opacity:0;height:100%;background-position:center center;background-repeat:no-repeat;background-size:contain;transition:opacity .4s ease}
.owl-carousel .owl-video-frame{position:relative;z-index:1;height:100%;width:100%}
/*!*****************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/jqvmap/dist/jqvmap.css ***!
  \*****************************************************************************************************************************************************************************************************************************/
.jqvmap-label
{
	position: absolute;
	display: none;
	border-radius: 3px;
	background: #292929;
	color: white;
	font-family: sans-serif, Verdana;
	font-size: smaller;
	padding: 3px;
  pointer-events:none;
}
.jqvmap-pin {
  pointer-events:none;
}
.jqvmap-zoomin, .jqvmap-zoomout
{
	position: absolute;
	left: 10px;
	border-radius: 3px;
	background: #000000;
	padding: 3px;
	color: white;
	width: 10px;
	height: 10px;
	cursor: pointer;
	line-height: 10px;
	text-align: center;
}
.jqvmap-zoomin
{
	top: 10px;
}
.jqvmap-zoomout
{
	top: 30px;
}
.jqvmap-region
{
  cursor: pointer;
}
.jqvmap-ajax_response
{
  width: 100%;
  height: 500px;
}

/*!***************************************************************************************************************************************************************************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[1]!./node_modules/postcss-loader/dist/cjs.js??ruleSet[1].rules[4].rules[0].oneOf[0].use[2]!./node_modules/material-design-iconic-font/dist/css/material-design-iconic-font.css ***!
  \***************************************************************************************************************************************************************************************************************************************************************************/
/*!
 *  Material Design Iconic Font by Sergey Kupletsky (@zavoloklom) - http://zavoloklom.github.io/material-design-iconic-font/
 *  License - http://zavoloklom.github.io/material-design-iconic-font/license (Font: SIL OFL 1.1, CSS: MIT License)
 */
@font-face {
  font-family: 'Material-Design-Iconic-Font';
  src: url('Material-Design-Iconic-Font.ab076669ebbd2b69.woff2?v=2.2.0') format('woff2'), url('Material-Design-Iconic-Font.0a121b5a1bde855d.woff?v=2.2.0') format('woff'), url('Material-Design-Iconic-Font.ca2a27dacadba6c4.ttf?v=2.2.0') format('truetype');
  font-weight: normal;
  font-style: normal;
}
.zmdi {
  display: inline-block;
  font: normal normal normal 14px/1 'Material-Design-Iconic-Font';
  font-size: inherit;
  text-rendering: auto;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}
.zmdi-hc-lg {
  font-size: 1.33333333em;
  line-height: 0.75em;
  vertical-align: -15%;
}
.zmdi-hc-2x {
  font-size: 2em;
}
.zmdi-hc-3x {
  font-size: 3em;
}
.zmdi-hc-4x {
  font-size: 4em;
}
.zmdi-hc-5x {
  font-size: 5em;
}
.zmdi-hc-fw {
  width: 1.28571429em;
  text-align: center;
}
.zmdi-hc-ul {
  padding-left: 0;
  margin-left: 2.14285714em;
  list-style-type: none;
}
.zmdi-hc-ul > li {
  position: relative;
}
.zmdi-hc-li {
  position: absolute;
  left: -2.14285714em;
  width: 2.14285714em;
  top: 0.14285714em;
  text-align: center;
}
.zmdi-hc-li.zmdi-hc-lg {
  left: -1.85714286em;
}
.zmdi-hc-border {
  padding: .1em .25em;
  border: solid 0.1em #9e9e9e;
  border-radius: 2px;
}
.zmdi-hc-border-circle {
  padding: .1em .25em;
  border: solid 0.1em #9e9e9e;
  border-radius: 50%;
}
.zmdi.pull-left {
  float: left;
  margin-right: .15em;
}
.zmdi.pull-right {
  float: right;
  margin-left: .15em;
}
.zmdi-hc-spin {
  animation: zmdi-spin 1.5s infinite linear;
}
.zmdi-hc-spin-reverse {
  animation: zmdi-spin-reverse 1.5s infinite linear;
}
@keyframes zmdi-spin {
  0% {
    transform: rotate(0deg);
  }
  100% {
    transform: rotate(359deg);
  }
}
@keyframes zmdi-spin-reverse {
  0% {
    transform: rotate(0deg);
  }
  100% {
    transform: rotate(-359deg);
  }
}
.zmdi-hc-rotate-90 {
  transform: rotate(90deg);
}
.zmdi-hc-rotate-180 {
  transform: rotate(180deg);
}
.zmdi-hc-rotate-270 {
  transform: rotate(270deg);
}
.zmdi-hc-flip-horizontal {
  transform: scale(-1, 1);
}
.zmdi-hc-flip-vertical {
  transform: scale(1, -1);
}
.zmdi-hc-stack {
  position: relative;
  display: inline-block;
  width: 2em;
  height: 2em;
  line-height: 2em;
  vertical-align: middle;
}
.zmdi-hc-stack-1x,
.zmdi-hc-stack-2x {
  position: absolute;
  left: 0;
  width: 100%;
  text-align: center;
}
.zmdi-hc-stack-1x {
  line-height: inherit;
}
.zmdi-hc-stack-2x {
  font-size: 2em;
}
.zmdi-hc-inverse {
  color: #ffffff;
}
/* Material Design Iconic Font uses the Unicode Private Use Area (PUA) to ensure screen
   readers do not read off random characters that represent icons */
.zmdi-3d-rotation:before {
  content: '\f101';
}
.zmdi-airplane-off:before {
  content: '\f102';
}
.zmdi-airplane:before {
  content: '\f103';
}
.zmdi-album:before {
  content: '\f104';
}
.zmdi-archive:before {
  content: '\f105';
}
.zmdi-assignment-account:before {
  content: '\f106';
}
.zmdi-assignment-alert:before {
  content: '\f107';
}
.zmdi-assignment-check:before {
  content: '\f108';
}
.zmdi-assignment-o:before {
  content: '\f109';
}
.zmdi-assignment-return:before {
  content: '\f10a';
}
.zmdi-assignment-returned:before {
  content: '\f10b';
}
.zmdi-assignment:before {
  content: '\f10c';
}
.zmdi-attachment-alt:before {
  content: '\f10d';
}
.zmdi-attachment:before {
  content: '\f10e';
}
.zmdi-audio:before {
  content: '\f10f';
}
.zmdi-badge-check:before {
  content: '\f110';
}
.zmdi-balance-wallet:before {
  content: '\f111';
}
.zmdi-balance:before {
  content: '\f112';
}
.zmdi-battery-alert:before {
  content: '\f113';
}
.zmdi-battery-flash:before {
  content: '\f114';
}
.zmdi-battery-unknown:before {
  content: '\f115';
}
.zmdi-battery:before {
  content: '\f116';
}
.zmdi-bike:before {
  content: '\f117';
}
.zmdi-block-alt:before {
  content: '\f118';
}
.zmdi-block:before {
  content: '\f119';
}
.zmdi-boat:before {
  content: '\f11a';
}
.zmdi-book-image:before {
  content: '\f11b';
}
.zmdi-book:before {
  content: '\f11c';
}
.zmdi-bookmark-outline:before {
  content: '\f11d';
}
.zmdi-bookmark:before {
  content: '\f11e';
}
.zmdi-brush:before {
  content: '\f11f';
}
.zmdi-bug:before {
  content: '\f120';
}
.zmdi-bus:before {
  content: '\f121';
}
.zmdi-cake:before {
  content: '\f122';
}
.zmdi-car-taxi:before {
  content: '\f123';
}
.zmdi-car-wash:before {
  content: '\f124';
}
.zmdi-car:before {
  content: '\f125';
}
.zmdi-card-giftcard:before {
  content: '\f126';
}
.zmdi-card-membership:before {
  content: '\f127';
}
.zmdi-card-travel:before {
  content: '\f128';
}
.zmdi-card:before {
  content: '\f129';
}
.zmdi-case-check:before {
  content: '\f12a';
}
.zmdi-case-download:before {
  content: '\f12b';
}
.zmdi-case-play:before {
  content: '\f12c';
}
.zmdi-case:before {
  content: '\f12d';
}
.zmdi-cast-connected:before {
  content: '\f12e';
}
.zmdi-cast:before {
  content: '\f12f';
}
.zmdi-chart-donut:before {
  content: '\f130';
}
.zmdi-chart:before {
  content: '\f131';
}
.zmdi-city-alt:before {
  content: '\f132';
}
.zmdi-city:before {
  content: '\f133';
}
.zmdi-close-circle-o:before {
  content: '\f134';
}
.zmdi-close-circle:before {
  content: '\f135';
}
.zmdi-close:before {
  content: '\f136';
}
.zmdi-cocktail:before {
  content: '\f137';
}
.zmdi-code-setting:before {
  content: '\f138';
}
.zmdi-code-smartphone:before {
  content: '\f139';
}
.zmdi-code:before {
  content: '\f13a';
}
.zmdi-coffee:before {
  content: '\f13b';
}
.zmdi-collection-bookmark:before {
  content: '\f13c';
}
.zmdi-collection-case-play:before {
  content: '\f13d';
}
.zmdi-collection-folder-image:before {
  content: '\f13e';
}
.zmdi-collection-image-o:before {
  content: '\f13f';
}
.zmdi-collection-image:before {
  content: '\f140';
}
.zmdi-collection-item-1:before {
  content: '\f141';
}
.zmdi-collection-item-2:before {
  content: '\f142';
}
.zmdi-collection-item-3:before {
  content: '\f143';
}
.zmdi-collection-item-4:before {
  content: '\f144';
}
.zmdi-collection-item-5:before {
  content: '\f145';
}
.zmdi-collection-item-6:before {
  content: '\f146';
}
.zmdi-collection-item-7:before {
  content: '\f147';
}
.zmdi-collection-item-8:before {
  content: '\f148';
}
.zmdi-collection-item-9-plus:before {
  content: '\f149';
}
.zmdi-collection-item-9:before {
  content: '\f14a';
}
.zmdi-collection-item:before {
  content: '\f14b';
}
.zmdi-collection-music:before {
  content: '\f14c';
}
.zmdi-collection-pdf:before {
  content: '\f14d';
}
.zmdi-collection-plus:before {
  content: '\f14e';
}
.zmdi-collection-speaker:before {
  content: '\f14f';
}
.zmdi-collection-text:before {
  content: '\f150';
}
.zmdi-collection-video:before {
  content: '\f151';
}
.zmdi-compass:before {
  content: '\f152';
}
.zmdi-cutlery:before {
  content: '\f153';
}
.zmdi-delete:before {
  content: '\f154';
}
.zmdi-dialpad:before {
  content: '\f155';
}
.zmdi-dns:before {
  content: '\f156';
}
.zmdi-drink:before {
  content: '\f157';
}
.zmdi-edit:before {
  content: '\f158';
}
.zmdi-email-open:before {
  content: '\f159';
}
.zmdi-email:before {
  content: '\f15a';
}
.zmdi-eye-off:before {
  content: '\f15b';
}
.zmdi-eye:before {
  content: '\f15c';
}
.zmdi-eyedropper:before {
  content: '\f15d';
}
.zmdi-favorite-outline:before {
  content: '\f15e';
}
.zmdi-favorite:before {
  content: '\f15f';
}
.zmdi-filter-list:before {
  content: '\f160';
}
.zmdi-fire:before {
  content: '\f161';
}
.zmdi-flag:before {
  content: '\f162';
}
.zmdi-flare:before {
  content: '\f163';
}
.zmdi-flash-auto:before {
  content: '\f164';
}
.zmdi-flash-off:before {
  content: '\f165';
}
.zmdi-flash:before {
  content: '\f166';
}
.zmdi-flip:before {
  content: '\f167';
}
.zmdi-flower-alt:before {
  content: '\f168';
}
.zmdi-flower:before {
  content: '\f169';
}
.zmdi-font:before {
  content: '\f16a';
}
.zmdi-fullscreen-alt:before {
  content: '\f16b';
}
.zmdi-fullscreen-exit:before {
  content: '\f16c';
}
.zmdi-fullscreen:before {
  content: '\f16d';
}
.zmdi-functions:before {
  content: '\f16e';
}
.zmdi-gas-station:before {
  content: '\f16f';
}
.zmdi-gesture:before {
  content: '\f170';
}
.zmdi-globe-alt:before {
  content: '\f171';
}
.zmdi-globe-lock:before {
  content: '\f172';
}
.zmdi-globe:before {
  content: '\f173';
}
.zmdi-graduation-cap:before {
  content: '\f174';
}
.zmdi-home:before {
  content: '\f175';
}
.zmdi-hospital-alt:before {
  content: '\f176';
}
.zmdi-hospital:before {
  content: '\f177';
}
.zmdi-hotel:before {
  content: '\f178';
}
.zmdi-hourglass-alt:before {
  content: '\f179';
}
.zmdi-hourglass-outline:before {
  content: '\f17a';
}
.zmdi-hourglass:before {
  content: '\f17b';
}
.zmdi-http:before {
  content: '\f17c';
}
.zmdi-image-alt:before {
  content: '\f17d';
}
.zmdi-image-o:before {
  content: '\f17e';
}
.zmdi-image:before {
  content: '\f17f';
}
.zmdi-inbox:before {
  content: '\f180';
}
.zmdi-invert-colors-off:before {
  content: '\f181';
}
.zmdi-invert-colors:before {
  content: '\f182';
}
.zmdi-key:before {
  content: '\f183';
}
.zmdi-label-alt-outline:before {
  content: '\f184';
}
.zmdi-label-alt:before {
  content: '\f185';
}
.zmdi-label-heart:before {
  content: '\f186';
}
.zmdi-label:before {
  content: '\f187';
}
.zmdi-labels:before {
  content: '\f188';
}
.zmdi-lamp:before {
  content: '\f189';
}
.zmdi-landscape:before {
  content: '\f18a';
}
.zmdi-layers-off:before {
  content: '\f18b';
}
.zmdi-layers:before {
  content: '\f18c';
}
.zmdi-library:before {
  content: '\f18d';
}
.zmdi-link:before {
  content: '\f18e';
}
.zmdi-lock-open:before {
  content: '\f18f';
}
.zmdi-lock-outline:before {
  content: '\f190';
}
.zmdi-lock:before {
  content: '\f191';
}
.zmdi-mail-reply-all:before {
  content: '\f192';
}
.zmdi-mail-reply:before {
  content: '\f193';
}
.zmdi-mail-send:before {
  content: '\f194';
}
.zmdi-mall:before {
  content: '\f195';
}
.zmdi-map:before {
  content: '\f196';
}
.zmdi-menu:before {
  content: '\f197';
}
.zmdi-money-box:before {
  content: '\f198';
}
.zmdi-money-off:before {
  content: '\f199';
}
.zmdi-money:before {
  content: '\f19a';
}
.zmdi-more-vert:before {
  content: '\f19b';
}
.zmdi-more:before {
  content: '\f19c';
}
.zmdi-movie-alt:before {
  content: '\f19d';
}
.zmdi-movie:before {
  content: '\f19e';
}
.zmdi-nature-people:before {
  content: '\f19f';
}
.zmdi-nature:before {
  content: '\f1a0';
}
.zmdi-navigation:before {
  content: '\f1a1';
}
.zmdi-open-in-browser:before {
  content: '\f1a2';
}
.zmdi-open-in-new:before {
  content: '\f1a3';
}
.zmdi-palette:before {
  content: '\f1a4';
}
.zmdi-parking:before {
  content: '\f1a5';
}
.zmdi-pin-account:before {
  content: '\f1a6';
}
.zmdi-pin-assistant:before {
  content: '\f1a7';
}
.zmdi-pin-drop:before {
  content: '\f1a8';
}
.zmdi-pin-help:before {
  content: '\f1a9';
}
.zmdi-pin-off:before {
  content: '\f1aa';
}
.zmdi-pin:before {
  content: '\f1ab';
}
.zmdi-pizza:before {
  content: '\f1ac';
}
.zmdi-plaster:before {
  content: '\f1ad';
}
.zmdi-power-setting:before {
  content: '\f1ae';
}
.zmdi-power:before {
  content: '\f1af';
}
.zmdi-print:before {
  content: '\f1b0';
}
.zmdi-puzzle-piece:before {
  content: '\f1b1';
}
.zmdi-quote:before {
  content: '\f1b2';
}
.zmdi-railway:before {
  content: '\f1b3';
}
.zmdi-receipt:before {
  content: '\f1b4';
}
.zmdi-refresh-alt:before {
  content: '\f1b5';
}
.zmdi-refresh-sync-alert:before {
  content: '\f1b6';
}
.zmdi-refresh-sync-off:before {
  content: '\f1b7';
}
.zmdi-refresh-sync:before {
  content: '\f1b8';
}
.zmdi-refresh:before {
  content: '\f1b9';
}
.zmdi-roller:before {
  content: '\f1ba';
}
.zmdi-ruler:before {
  content: '\f1bb';
}
.zmdi-scissors:before {
  content: '\f1bc';
}
.zmdi-screen-rotation-lock:before {
  content: '\f1bd';
}
.zmdi-screen-rotation:before {
  content: '\f1be';
}
.zmdi-search-for:before {
  content: '\f1bf';
}
.zmdi-search-in-file:before {
  content: '\f1c0';
}
.zmdi-search-in-page:before {
  content: '\f1c1';
}
.zmdi-search-replace:before {
  content: '\f1c2';
}
.zmdi-search:before {
  content: '\f1c3';
}
.zmdi-seat:before {
  content: '\f1c4';
}
.zmdi-settings-square:before {
  content: '\f1c5';
}
.zmdi-settings:before {
  content: '\f1c6';
}
.zmdi-shield-check:before {
  content: '\f1c7';
}
.zmdi-shield-security:before {
  content: '\f1c8';
}
.zmdi-shopping-basket:before {
  content: '\f1c9';
}
.zmdi-shopping-cart-plus:before {
  content: '\f1ca';
}
.zmdi-shopping-cart:before {
  content: '\f1cb';
}
.zmdi-sign-in:before {
  content: '\f1cc';
}
.zmdi-sort-amount-asc:before {
  content: '\f1cd';
}
.zmdi-sort-amount-desc:before {
  content: '\f1ce';
}
.zmdi-sort-asc:before {
  content: '\f1cf';
}
.zmdi-sort-desc:before {
  content: '\f1d0';
}
.zmdi-spellcheck:before {
  content: '\f1d1';
}
.zmdi-storage:before {
  content: '\f1d2';
}
.zmdi-store-24:before {
  content: '\f1d3';
}
.zmdi-store:before {
  content: '\f1d4';
}
.zmdi-subway:before {
  content: '\f1d5';
}
.zmdi-sun:before {
  content: '\f1d6';
}
.zmdi-tab-unselected:before {
  content: '\f1d7';
}
.zmdi-tab:before {
  content: '\f1d8';
}
.zmdi-tag-close:before {
  content: '\f1d9';
}
.zmdi-tag-more:before {
  content: '\f1da';
}
.zmdi-tag:before {
  content: '\f1db';
}
.zmdi-thumb-down:before {
  content: '\f1dc';
}
.zmdi-thumb-up-down:before {
  content: '\f1dd';
}
.zmdi-thumb-up:before {
  content: '\f1de';
}
.zmdi-ticket-star:before {
  content: '\f1df';
}
.zmdi-toll:before {
  content: '\f1e0';
}
.zmdi-toys:before {
  content: '\f1e1';
}
.zmdi-traffic:before {
  content: '\f1e2';
}
.zmdi-translate:before {
  content: '\f1e3';
}
.zmdi-triangle-down:before {
  content: '\f1e4';
}
.zmdi-triangle-up:before {
  content: '\f1e5';
}
.zmdi-truck:before {
  content: '\f1e6';
}
.zmdi-turning-sign:before {
  content: '\f1e7';
}
.zmdi-wallpaper:before {
  content: '\f1e8';
}
.zmdi-washing-machine:before {
  content: '\f1e9';
}
.zmdi-window-maximize:before {
  content: '\f1ea';
}
.zmdi-window-minimize:before {
  content: '\f1eb';
}
.zmdi-window-restore:before {
  content: '\f1ec';
}
.zmdi-wrench:before {
  content: '\f1ed';
}
.zmdi-zoom-in:before {
  content: '\f1ee';
}
.zmdi-zoom-out:before {
  content: '\f1ef';
}
.zmdi-alert-circle-o:before {
  content: '\f1f0';
}
.zmdi-alert-circle:before {
  content: '\f1f1';
}
.zmdi-alert-octagon:before {
  content: '\f1f2';
}
.zmdi-alert-polygon:before {
  content: '\f1f3';
}
.zmdi-alert-triangle:before {
  content: '\f1f4';
}
.zmdi-help-outline:before {
  content: '\f1f5';
}
.zmdi-help:before {
  content: '\f1f6';
}
.zmdi-info-outline:before {
  content: '\f1f7';
}
.zmdi-info:before {
  content: '\f1f8';
}
.zmdi-notifications-active:before {
  content: '\f1f9';
}
.zmdi-notifications-add:before {
  content: '\f1fa';
}
.zmdi-notifications-none:before {
  content: '\f1fb';
}
.zmdi-notifications-off:before {
  content: '\f1fc';
}
.zmdi-notifications-paused:before {
  content: '\f1fd';
}
.zmdi-notifications:before {
  content: '\f1fe';
}
.zmdi-account-add:before {
  content: '\f1ff';
}
.zmdi-account-box-mail:before {
  content: '\f200';
}
.zmdi-account-box-o:before {
  content: '\f201';
}
.zmdi-account-box-phone:before {
  content: '\f202';
}
.zmdi-account-box:before {
  content: '\f203';
}
.zmdi-account-calendar:before {
  content: '\f204';
}
.zmdi-account-circle:before {
  content: '\f205';
}
.zmdi-account-o:before {
  content: '\f206';
}
.zmdi-account:before {
  content: '\f207';
}
.zmdi-accounts-add:before {
  content: '\f208';
}
.zmdi-accounts-alt:before {
  content: '\f209';
}
.zmdi-accounts-list-alt:before {
  content: '\f20a';
}
.zmdi-accounts-list:before {
  content: '\f20b';
}
.zmdi-accounts-outline:before {
  content: '\f20c';
}
.zmdi-accounts:before {
  content: '\f20d';
}
.zmdi-face:before {
  content: '\f20e';
}
.zmdi-female:before {
  content: '\f20f';
}
.zmdi-male-alt:before {
  content: '\f210';
}
.zmdi-male-female:before {
  content: '\f211';
}
.zmdi-male:before {
  content: '\f212';
}
.zmdi-mood-bad:before {
  content: '\f213';
}
.zmdi-mood:before {
  content: '\f214';
}
.zmdi-run:before {
  content: '\f215';
}
.zmdi-walk:before {
  content: '\f216';
}
.zmdi-cloud-box:before {
  content: '\f217';
}
.zmdi-cloud-circle:before {
  content: '\f218';
}
.zmdi-cloud-done:before {
  content: '\f219';
}
.zmdi-cloud-download:before {
  content: '\f21a';
}
.zmdi-cloud-off:before {
  content: '\f21b';
}
.zmdi-cloud-outline-alt:before {
  content: '\f21c';
}
.zmdi-cloud-outline:before {
  content: '\f21d';
}
.zmdi-cloud-upload:before {
  content: '\f21e';
}
.zmdi-cloud:before {
  content: '\f21f';
}
.zmdi-download:before {
  content: '\f220';
}
.zmdi-file-plus:before {
  content: '\f221';
}
.zmdi-file-text:before {
  content: '\f222';
}
.zmdi-file:before {
  content: '\f223';
}
.zmdi-folder-outline:before {
  content: '\f224';
}
.zmdi-folder-person:before {
  content: '\f225';
}
.zmdi-folder-star-alt:before {
  content: '\f226';
}
.zmdi-folder-star:before {
  content: '\f227';
}
.zmdi-folder:before {
  content: '\f228';
}
.zmdi-gif:before {
  content: '\f229';
}
.zmdi-upload:before {
  content: '\f22a';
}
.zmdi-border-all:before {
  content: '\f22b';
}
.zmdi-border-bottom:before {
  content: '\f22c';
}
.zmdi-border-clear:before {
  content: '\f22d';
}
.zmdi-border-color:before {
  content: '\f22e';
}
.zmdi-border-horizontal:before {
  content: '\f22f';
}
.zmdi-border-inner:before {
  content: '\f230';
}
.zmdi-border-left:before {
  content: '\f231';
}
.zmdi-border-outer:before {
  content: '\f232';
}
.zmdi-border-right:before {
  content: '\f233';
}
.zmdi-border-style:before {
  content: '\f234';
}
.zmdi-border-top:before {
  content: '\f235';
}
.zmdi-border-vertical:before {
  content: '\f236';
}
.zmdi-copy:before {
  content: '\f237';
}
.zmdi-crop:before {
  content: '\f238';
}
.zmdi-format-align-center:before {
  content: '\f239';
}
.zmdi-format-align-justify:before {
  content: '\f23a';
}
.zmdi-format-align-left:before {
  content: '\f23b';
}
.zmdi-format-align-right:before {
  content: '\f23c';
}
.zmdi-format-bold:before {
  content: '\f23d';
}
.zmdi-format-clear-all:before {
  content: '\f23e';
}
.zmdi-format-clear:before {
  content: '\f23f';
}
.zmdi-format-color-fill:before {
  content: '\f240';
}
.zmdi-format-color-reset:before {
  content: '\f241';
}
.zmdi-format-color-text:before {
  content: '\f242';
}
.zmdi-format-indent-decrease:before {
  content: '\f243';
}
.zmdi-format-indent-increase:before {
  content: '\f244';
}
.zmdi-format-italic:before {
  content: '\f245';
}
.zmdi-format-line-spacing:before {
  content: '\f246';
}
.zmdi-format-list-bulleted:before {
  content: '\f247';
}
.zmdi-format-list-numbered:before {
  content: '\f248';
}
.zmdi-format-ltr:before {
  content: '\f249';
}
.zmdi-format-rtl:before {
  content: '\f24a';
}
.zmdi-format-size:before {
  content: '\f24b';
}
.zmdi-format-strikethrough-s:before {
  content: '\f24c';
}
.zmdi-format-strikethrough:before {
  content: '\f24d';
}
.zmdi-format-subject:before {
  content: '\f24e';
}
.zmdi-format-underlined:before {
  content: '\f24f';
}
.zmdi-format-valign-bottom:before {
  content: '\f250';
}
.zmdi-format-valign-center:before {
  content: '\f251';
}
.zmdi-format-valign-top:before {
  content: '\f252';
}
.zmdi-redo:before {
  content: '\f253';
}
.zmdi-select-all:before {
  content: '\f254';
}
.zmdi-space-bar:before {
  content: '\f255';
}
.zmdi-text-format:before {
  content: '\f256';
}
.zmdi-transform:before {
  content: '\f257';
}
.zmdi-undo:before {
  content: '\f258';
}
.zmdi-wrap-text:before {
  content: '\f259';
}
.zmdi-comment-alert:before {
  content: '\f25a';
}
.zmdi-comment-alt-text:before {
  content: '\f25b';
}
.zmdi-comment-alt:before {
  content: '\f25c';
}
.zmdi-comment-edit:before {
  content: '\f25d';
}
.zmdi-comment-image:before {
  content: '\f25e';
}
.zmdi-comment-list:before {
  content: '\f25f';
}
.zmdi-comment-more:before {
  content: '\f260';
}
.zmdi-comment-outline:before {
  content: '\f261';
}
.zmdi-comment-text-alt:before {
  content: '\f262';
}
.zmdi-comment-text:before {
  content: '\f263';
}
.zmdi-comment-video:before {
  content: '\f264';
}
.zmdi-comment:before {
  content: '\f265';
}
.zmdi-comments:before {
  content: '\f266';
}
.zmdi-check-all:before {
  content: '\f267';
}
.zmdi-check-circle-u:before {
  content: '\f268';
}
.zmdi-check-circle:before {
  content: '\f269';
}
.zmdi-check-square:before {
  content: '\f26a';
}
.zmdi-check:before {
  content: '\f26b';
}
.zmdi-circle-o:before {
  content: '\f26c';
}
.zmdi-circle:before {
  content: '\f26d';
}
.zmdi-dot-circle-alt:before {
  content: '\f26e';
}
.zmdi-dot-circle:before {
  content: '\f26f';
}
.zmdi-minus-circle-outline:before {
  content: '\f270';
}
.zmdi-minus-circle:before {
  content: '\f271';
}
.zmdi-minus-square:before {
  content: '\f272';
}
.zmdi-minus:before {
  content: '\f273';
}
.zmdi-plus-circle-o-duplicate:before {
  content: '\f274';
}
.zmdi-plus-circle-o:before {
  content: '\f275';
}
.zmdi-plus-circle:before {
  content: '\f276';
}
.zmdi-plus-square:before {
  content: '\f277';
}
.zmdi-plus:before {
  content: '\f278';
}
.zmdi-square-o:before {
  content: '\f279';
}
.zmdi-star-circle:before {
  content: '\f27a';
}
.zmdi-star-half:before {
  content: '\f27b';
}
.zmdi-star-outline:before {
  content: '\f27c';
}
.zmdi-star:before {
  content: '\f27d';
}
.zmdi-bluetooth-connected:before {
  content: '\f27e';
}
.zmdi-bluetooth-off:before {
  content: '\f27f';
}
.zmdi-bluetooth-search:before {
  content: '\f280';
}
.zmdi-bluetooth-setting:before {
  content: '\f281';
}
.zmdi-bluetooth:before {
  content: '\f282';
}
.zmdi-camera-add:before {
  content: '\f283';
}
.zmdi-camera-alt:before {
  content: '\f284';
}
.zmdi-camera-bw:before {
  content: '\f285';
}
.zmdi-camera-front:before {
  content: '\f286';
}
.zmdi-camera-mic:before {
  content: '\f287';
}
.zmdi-camera-party-mode:before {
  content: '\f288';
}
.zmdi-camera-rear:before {
  content: '\f289';
}
.zmdi-camera-roll:before {
  content: '\f28a';
}
.zmdi-camera-switch:before {
  content: '\f28b';
}
.zmdi-camera:before {
  content: '\f28c';
}
.zmdi-card-alert:before {
  content: '\f28d';
}
.zmdi-card-off:before {
  content: '\f28e';
}
.zmdi-card-sd:before {
  content: '\f28f';
}
.zmdi-card-sim:before {
  content: '\f290';
}
.zmdi-desktop-mac:before {
  content: '\f291';
}
.zmdi-desktop-windows:before {
  content: '\f292';
}
.zmdi-device-hub:before {
  content: '\f293';
}
.zmdi-devices-off:before {
  content: '\f294';
}
.zmdi-devices:before {
  content: '\f295';
}
.zmdi-dock:before {
  content: '\f296';
}
.zmdi-floppy:before {
  content: '\f297';
}
.zmdi-gamepad:before {
  content: '\f298';
}
.zmdi-gps-dot:before {
  content: '\f299';
}
.zmdi-gps-off:before {
  content: '\f29a';
}
.zmdi-gps:before {
  content: '\f29b';
}
.zmdi-headset-mic:before {
  content: '\f29c';
}
.zmdi-headset:before {
  content: '\f29d';
}
.zmdi-input-antenna:before {
  content: '\f29e';
}
.zmdi-input-composite:before {
  content: '\f29f';
}
.zmdi-input-hdmi:before {
  content: '\f2a0';
}
.zmdi-input-power:before {
  content: '\f2a1';
}
.zmdi-input-svideo:before {
  content: '\f2a2';
}
.zmdi-keyboard-hide:before {
  content: '\f2a3';
}
.zmdi-keyboard:before {
  content: '\f2a4';
}
.zmdi-laptop-chromebook:before {
  content: '\f2a5';
}
.zmdi-laptop-mac:before {
  content: '\f2a6';
}
.zmdi-laptop:before {
  content: '\f2a7';
}
.zmdi-mic-off:before {
  content: '\f2a8';
}
.zmdi-mic-outline:before {
  content: '\f2a9';
}
.zmdi-mic-setting:before {
  content: '\f2aa';
}
.zmdi-mic:before {
  content: '\f2ab';
}
.zmdi-mouse:before {
  content: '\f2ac';
}
.zmdi-network-alert:before {
  content: '\f2ad';
}
.zmdi-network-locked:before {
  content: '\f2ae';
}
.zmdi-network-off:before {
  content: '\f2af';
}
.zmdi-network-outline:before {
  content: '\f2b0';
}
.zmdi-network-setting:before {
  content: '\f2b1';
}
.zmdi-network:before {
  content: '\f2b2';
}
.zmdi-phone-bluetooth:before {
  content: '\f2b3';
}
.zmdi-phone-end:before {
  content: '\f2b4';
}
.zmdi-phone-forwarded:before {
  content: '\f2b5';
}
.zmdi-phone-in-talk:before {
  content: '\f2b6';
}
.zmdi-phone-locked:before {
  content: '\f2b7';
}
.zmdi-phone-missed:before {
  content: '\f2b8';
}
.zmdi-phone-msg:before {
  content: '\f2b9';
}
.zmdi-phone-paused:before {
  content: '\f2ba';
}
.zmdi-phone-ring:before {
  content: '\f2bb';
}
.zmdi-phone-setting:before {
  content: '\f2bc';
}
.zmdi-phone-sip:before {
  content: '\f2bd';
}
.zmdi-phone:before {
  content: '\f2be';
}
.zmdi-portable-wifi-changes:before {
  content: '\f2bf';
}
.zmdi-portable-wifi-off:before {
  content: '\f2c0';
}
.zmdi-portable-wifi:before {
  content: '\f2c1';
}
.zmdi-radio:before {
  content: '\f2c2';
}
.zmdi-reader:before {
  content: '\f2c3';
}
.zmdi-remote-control-alt:before {
  content: '\f2c4';
}
.zmdi-remote-control:before {
  content: '\f2c5';
}
.zmdi-router:before {
  content: '\f2c6';
}
.zmdi-scanner:before {
  content: '\f2c7';
}
.zmdi-smartphone-android:before {
  content: '\f2c8';
}
.zmdi-smartphone-download:before {
  content: '\f2c9';
}
.zmdi-smartphone-erase:before {
  content: '\f2ca';
}
.zmdi-smartphone-info:before {
  content: '\f2cb';
}
.zmdi-smartphone-iphone:before {
  content: '\f2cc';
}
.zmdi-smartphone-landscape-lock:before {
  content: '\f2cd';
}
.zmdi-smartphone-landscape:before {
  content: '\f2ce';
}
.zmdi-smartphone-lock:before {
  content: '\f2cf';
}
.zmdi-smartphone-portrait-lock:before {
  content: '\f2d0';
}
.zmdi-smartphone-ring:before {
  content: '\f2d1';
}
.zmdi-smartphone-setting:before {
  content: '\f2d2';
}
.zmdi-smartphone-setup:before {
  content: '\f2d3';
}
.zmdi-smartphone:before {
  content: '\f2d4';
}
.zmdi-speaker:before {
  content: '\f2d5';
}
.zmdi-tablet-android:before {
  content: '\f2d6';
}
.zmdi-tablet-mac:before {
  content: '\f2d7';
}
.zmdi-tablet:before {
  content: '\f2d8';
}
.zmdi-tv-alt-play:before {
  content: '\f2d9';
}
.zmdi-tv-list:before {
  content: '\f2da';
}
.zmdi-tv-play:before {
  content: '\f2db';
}
.zmdi-tv:before {
  content: '\f2dc';
}
.zmdi-usb:before {
  content: '\f2dd';
}
.zmdi-videocam-off:before {
  content: '\f2de';
}
.zmdi-videocam-switch:before {
  content: '\f2df';
}
.zmdi-videocam:before {
  content: '\f2e0';
}
.zmdi-watch:before {
  content: '\f2e1';
}
.zmdi-wifi-alt-2:before {
  content: '\f2e2';
}
.zmdi-wifi-alt:before {
  content: '\f2e3';
}
.zmdi-wifi-info:before {
  content: '\f2e4';
}
.zmdi-wifi-lock:before {
  content: '\f2e5';
}
.zmdi-wifi-off:before {
  content: '\f2e6';
}
.zmdi-wifi-outline:before {
  content: '\f2e7';
}
.zmdi-wifi:before {
  content: '\f2e8';
}
.zmdi-arrow-left-bottom:before {
  content: '\f2e9';
}
.zmdi-arrow-left:before {
  content: '\f2ea';
}
.zmdi-arrow-merge:before {
  content: '\f2eb';
}
.zmdi-arrow-missed:before {
  content: '\f2ec';
}
.zmdi-arrow-right-top:before {
  content: '\f2ed';
}
.zmdi-arrow-right:before {
  content: '\f2ee';
}
.zmdi-arrow-split:before {
  content: '\f2ef';
}
.zmdi-arrows:before {
  content: '\f2f0';
}
.zmdi-caret-down-circle:before {
  content: '\f2f1';
}
.zmdi-caret-down:before {
  content: '\f2f2';
}
.zmdi-caret-left-circle:before {
  content: '\f2f3';
}
.zmdi-caret-left:before {
  content: '\f2f4';
}
.zmdi-caret-right-circle:before {
  content: '\f2f5';
}
.zmdi-caret-right:before {
  content: '\f2f6';
}
.zmdi-caret-up-circle:before {
  content: '\f2f7';
}
.zmdi-caret-up:before {
  content: '\f2f8';
}
.zmdi-chevron-down:before {
  content: '\f2f9';
}
.zmdi-chevron-left:before {
  content: '\f2fa';
}
.zmdi-chevron-right:before {
  content: '\f2fb';
}
.zmdi-chevron-up:before {
  content: '\f2fc';
}
.zmdi-forward:before {
  content: '\f2fd';
}
.zmdi-long-arrow-down:before {
  content: '\f2fe';
}
.zmdi-long-arrow-left:before {
  content: '\f2ff';
}
.zmdi-long-arrow-return:before {
  content: '\f300';
}
.zmdi-long-arrow-right:before {
  content: '\f301';
}
.zmdi-long-arrow-tab:before {
  content: '\f302';
}
.zmdi-long-arrow-up:before {
  content: '\f303';
}
.zmdi-rotate-ccw:before {
  content: '\f304';
}
.zmdi-rotate-cw:before {
  content: '\f305';
}
.zmdi-rotate-left:before {
  content: '\f306';
}
.zmdi-rotate-right:before {
  content: '\f307';
}
.zmdi-square-down:before {
  content: '\f308';
}
.zmdi-square-right:before {
  content: '\f309';
}
.zmdi-swap-alt:before {
  content: '\f30a';
}
.zmdi-swap-vertical-circle:before {
  content: '\f30b';
}
.zmdi-swap-vertical:before {
  content: '\f30c';
}
.zmdi-swap:before {
  content: '\f30d';
}
.zmdi-trending-down:before {
  content: '\f30e';
}
.zmdi-trending-flat:before {
  content: '\f30f';
}
.zmdi-trending-up:before {
  content: '\f310';
}
.zmdi-unfold-less:before {
  content: '\f311';
}
.zmdi-unfold-more:before {
  content: '\f312';
}
.zmdi-apps:before {
  content: '\f313';
}
.zmdi-grid-off:before {
  content: '\f314';
}
.zmdi-grid:before {
  content: '\f315';
}
.zmdi-view-agenda:before {
  content: '\f316';
}
.zmdi-view-array:before {
  content: '\f317';
}
.zmdi-view-carousel:before {
  content: '\f318';
}
.zmdi-view-column:before {
  content: '\f319';
}
.zmdi-view-comfy:before {
  content: '\f31a';
}
.zmdi-view-compact:before {
  content: '\f31b';
}
.zmdi-view-dashboard:before {
  content: '\f31c';
}
.zmdi-view-day:before {
  content: '\f31d';
}
.zmdi-view-headline:before {
  content: '\f31e';
}
.zmdi-view-list-alt:before {
  content: '\f31f';
}
.zmdi-view-list:before {
  content: '\f320';
}
.zmdi-view-module:before {
  content: '\f321';
}
.zmdi-view-quilt:before {
  content: '\f322';
}
.zmdi-view-stream:before {
  content: '\f323';
}
.zmdi-view-subtitles:before {
  content: '\f324';
}
.zmdi-view-toc:before {
  content: '\f325';
}
.zmdi-view-web:before {
  content: '\f326';
}
.zmdi-view-week:before {
  content: '\f327';
}
.zmdi-widgets:before {
  content: '\f328';
}
.zmdi-alarm-check:before {
  content: '\f329';
}
.zmdi-alarm-off:before {
  content: '\f32a';
}
.zmdi-alarm-plus:before {
  content: '\f32b';
}
.zmdi-alarm-snooze:before {
  content: '\f32c';
}
.zmdi-alarm:before {
  content: '\f32d';
}
.zmdi-calendar-alt:before {
  content: '\f32e';
}
.zmdi-calendar-check:before {
  content: '\f32f';
}
.zmdi-calendar-close:before {
  content: '\f330';
}
.zmdi-calendar-note:before {
  content: '\f331';
}
.zmdi-calendar:before {
  content: '\f332';
}
.zmdi-time-countdown:before {
  content: '\f333';
}
.zmdi-time-interval:before {
  content: '\f334';
}
.zmdi-time-restore-setting:before {
  content: '\f335';
}
.zmdi-time-restore:before {
  content: '\f336';
}
.zmdi-time:before {
  content: '\f337';
}
.zmdi-timer-off:before {
  content: '\f338';
}
.zmdi-timer:before {
  content: '\f339';
}
.zmdi-android-alt:before {
  content: '\f33a';
}
.zmdi-android:before {
  content: '\f33b';
}
.zmdi-apple:before {
  content: '\f33c';
}
.zmdi-behance:before {
  content: '\f33d';
}
.zmdi-codepen:before {
  content: '\f33e';
}
.zmdi-dribbble:before {
  content: '\f33f';
}
.zmdi-dropbox:before {
  content: '\f340';
}
.zmdi-evernote:before {
  content: '\f341';
}
.zmdi-facebook-box:before {
  content: '\f342';
}
.zmdi-facebook:before {
  content: '\f343';
}
.zmdi-github-box:before {
  content: '\f344';
}
.zmdi-github:before {
  content: '\f345';
}
.zmdi-google-drive:before {
  content: '\f346';
}
.zmdi-google-earth:before {
  content: '\f347';
}
.zmdi-google-glass:before {
  content: '\f348';
}
.zmdi-google-maps:before {
  content: '\f349';
}
.zmdi-google-pages:before {
  content: '\f34a';
}
.zmdi-google-play:before {
  content: '\f34b';
}
.zmdi-google-plus-box:before {
  content: '\f34c';
}
.zmdi-google-plus:before {
  content: '\f34d';
}
.zmdi-google:before {
  content: '\f34e';
}
.zmdi-instagram:before {
  content: '\f34f';
}
.zmdi-language-css3:before {
  content: '\f350';
}
.zmdi-language-html5:before {
  content: '\f351';
}
.zmdi-language-javascript:before {
  content: '\f352';
}
.zmdi-language-python-alt:before {
  content: '\f353';
}
.zmdi-language-python:before {
  content: '\f354';
}
.zmdi-lastfm:before {
  content: '\f355';
}
.zmdi-linkedin-box:before {
  content: '\f356';
}
.zmdi-paypal:before {
  content: '\f357';
}
.zmdi-pinterest-box:before {
  content: '\f358';
}
.zmdi-pocket:before {
  content: '\f359';
}
.zmdi-polymer:before {
  content: '\f35a';
}
.zmdi-share:before {
  content: '\f35b';
}
.zmdi-stackoverflow:before {
  content: '\f35c';
}
.zmdi-steam-square:before {
  content: '\f35d';
}
.zmdi-steam:before {
  content: '\f35e';
}
.zmdi-twitter-box:before {
  content: '\f35f';
}
.zmdi-twitter:before {
  content: '\f360';
}
.zmdi-vk:before {
  content: '\f361';
}
.zmdi-wikipedia:before {
  content: '\f362';
}
.zmdi-windows:before {
  content: '\f363';
}
.zmdi-aspect-ratio-alt:before {
  content: '\f364';
}
.zmdi-aspect-ratio:before {
  content: '\f365';
}
.zmdi-blur-circular:before {
  content: '\f366';
}
.zmdi-blur-linear:before {
  content: '\f367';
}
.zmdi-blur-off:before {
  content: '\f368';
}
.zmdi-blur:before {
  content: '\f369';
}
.zmdi-brightness-2:before {
  content: '\f36a';
}
.zmdi-brightness-3:before {
  content: '\f36b';
}
.zmdi-brightness-4:before {
  content: '\f36c';
}
.zmdi-brightness-5:before {
  content: '\f36d';
}
.zmdi-brightness-6:before {
  content: '\f36e';
}
.zmdi-brightness-7:before {
  content: '\f36f';
}
.zmdi-brightness-auto:before {
  content: '\f370';
}
.zmdi-brightness-setting:before {
  content: '\f371';
}
.zmdi-broken-image:before {
  content: '\f372';
}
.zmdi-center-focus-strong:before {
  content: '\f373';
}
.zmdi-center-focus-weak:before {
  content: '\f374';
}
.zmdi-compare:before {
  content: '\f375';
}
.zmdi-crop-16-9:before {
  content: '\f376';
}
.zmdi-crop-3-2:before {
  content: '\f377';
}
.zmdi-crop-5-4:before {
  content: '\f378';
}
.zmdi-crop-7-5:before {
  content: '\f379';
}
.zmdi-crop-din:before {
  content: '\f37a';
}
.zmdi-crop-free:before {
  content: '\f37b';
}
.zmdi-crop-landscape:before {
  content: '\f37c';
}
.zmdi-crop-portrait:before {
  content: '\f37d';
}
.zmdi-crop-square:before {
  content: '\f37e';
}
.zmdi-exposure-alt:before {
  content: '\f37f';
}
.zmdi-exposure:before {
  content: '\f380';
}
.zmdi-filter-b-and-w:before {
  content: '\f381';
}
.zmdi-filter-center-focus:before {
  content: '\f382';
}
.zmdi-filter-frames:before {
  content: '\f383';
}
.zmdi-filter-tilt-shift:before {
  content: '\f384';
}
.zmdi-gradient:before {
  content: '\f385';
}
.zmdi-grain:before {
  content: '\f386';
}
.zmdi-graphic-eq:before {
  content: '\f387';
}
.zmdi-hdr-off:before {
  content: '\f388';
}
.zmdi-hdr-strong:before {
  content: '\f389';
}
.zmdi-hdr-weak:before {
  content: '\f38a';
}
.zmdi-hdr:before {
  content: '\f38b';
}
.zmdi-iridescent:before {
  content: '\f38c';
}
.zmdi-leak-off:before {
  content: '\f38d';
}
.zmdi-leak:before {
  content: '\f38e';
}
.zmdi-looks:before {
  content: '\f38f';
}
.zmdi-loupe:before {
  content: '\f390';
}
.zmdi-panorama-horizontal:before {
  content: '\f391';
}
.zmdi-panorama-vertical:before {
  content: '\f392';
}
.zmdi-panorama-wide-angle:before {
  content: '\f393';
}
.zmdi-photo-size-select-large:before {
  content: '\f394';
}
.zmdi-photo-size-select-small:before {
  content: '\f395';
}
.zmdi-picture-in-picture:before {
  content: '\f396';
}
.zmdi-slideshow:before {
  content: '\f397';
}
.zmdi-texture:before {
  content: '\f398';
}
.zmdi-tonality:before {
  content: '\f399';
}
.zmdi-vignette:before {
  content: '\f39a';
}
.zmdi-wb-auto:before {
  content: '\f39b';
}
.zmdi-eject-alt:before {
  content: '\f39c';
}
.zmdi-eject:before {
  content: '\f39d';
}
.zmdi-equalizer:before {
  content: '\f39e';
}
.zmdi-fast-forward:before {
  content: '\f39f';
}
.zmdi-fast-rewind:before {
  content: '\f3a0';
}
.zmdi-forward-10:before {
  content: '\f3a1';
}
.zmdi-forward-30:before {
  content: '\f3a2';
}
.zmdi-forward-5:before {
  content: '\f3a3';
}
.zmdi-hearing:before {
  content: '\f3a4';
}
.zmdi-pause-circle-outline:before {
  content: '\f3a5';
}
.zmdi-pause-circle:before {
  content: '\f3a6';
}
.zmdi-pause:before {
  content: '\f3a7';
}
.zmdi-play-circle-outline:before {
  content: '\f3a8';
}
.zmdi-play-circle:before {
  content: '\f3a9';
}
.zmdi-play:before {
  content: '\f3aa';
}
.zmdi-playlist-audio:before {
  content: '\f3ab';
}
.zmdi-playlist-plus:before {
  content: '\f3ac';
}
.zmdi-repeat-one:before {
  content: '\f3ad';
}
.zmdi-repeat:before {
  content: '\f3ae';
}
.zmdi-replay-10:before {
  content: '\f3af';
}
.zmdi-replay-30:before {
  content: '\f3b0';
}
.zmdi-replay-5:before {
  content: '\f3b1';
}
.zmdi-replay:before {
  content: '\f3b2';
}
.zmdi-shuffle:before {
  content: '\f3b3';
}
.zmdi-skip-next:before {
  content: '\f3b4';
}
.zmdi-skip-previous:before {
  content: '\f3b5';
}
.zmdi-stop:before {
  content: '\f3b6';
}
.zmdi-surround-sound:before {
  content: '\f3b7';
}
.zmdi-tune:before {
  content: '\f3b8';
}
.zmdi-volume-down:before {
  content: '\f3b9';
}
.zmdi-volume-mute:before {
  content: '\f3ba';
}
.zmdi-volume-off:before {
  content: '\f3bb';
}
.zmdi-volume-up:before {
  content: '\f3bc';
}
.zmdi-n-1-square:before {
  content: '\f3bd';
}
.zmdi-n-2-square:before {
  content: '\f3be';
}
.zmdi-n-3-square:before {
  content: '\f3bf';
}
.zmdi-n-4-square:before {
  content: '\f3c0';
}
.zmdi-n-5-square:before {
  content: '\f3c1';
}
.zmdi-n-6-square:before {
  content: '\f3c2';
}
.zmdi-neg-1:before {
  content: '\f3c3';
}
.zmdi-neg-2:before {
  content: '\f3c4';
}
.zmdi-plus-1:before {
  content: '\f3c5';
}
.zmdi-plus-2:before {
  content: '\f3c6';
}
.zmdi-sec-10:before {
  content: '\f3c7';
}
.zmdi-sec-3:before {
  content: '\f3c8';
}
.zmdi-zero:before {
  content: '\f3c9';
}
.zmdi-airline-seat-flat-angled:before {
  content: '\f3ca';
}
.zmdi-airline-seat-flat:before {
  content: '\f3cb';
}
.zmdi-airline-seat-individual-suite:before {
  content: '\f3cc';
}
.zmdi-airline-seat-legroom-extra:before {
  content: '\f3cd';
}
.zmdi-airline-seat-legroom-normal:before {
  content: '\f3ce';
}
.zmdi-airline-seat-legroom-reduced:before {
  content: '\f3cf';
}
.zmdi-airline-seat-recline-extra:before {
  content: '\f3d0';
}
.zmdi-airline-seat-recline-normal:before {
  content: '\f3d1';
}
.zmdi-airplay:before {
  content: '\f3d2';
}
.zmdi-closed-caption:before {
  content: '\f3d3';
}
.zmdi-confirmation-number:before {
  content: '\f3d4';
}
.zmdi-developer-board:before {
  content: '\f3d5';
}
.zmdi-disc-full:before {
  content: '\f3d6';
}
.zmdi-explicit:before {
  content: '\f3d7';
}
.zmdi-flight-land:before {
  content: '\f3d8';
}
.zmdi-flight-takeoff:before {
  content: '\f3d9';
}
.zmdi-flip-to-back:before {
  content: '\f3da';
}
.zmdi-flip-to-front:before {
  content: '\f3db';
}
.zmdi-group-work:before {
  content: '\f3dc';
}
.zmdi-hd:before {
  content: '\f3dd';
}
.zmdi-hq:before {
  content: '\f3de';
}
.zmdi-markunread-mailbox:before {
  content: '\f3df';
}
.zmdi-memory:before {
  content: '\f3e0';
}
.zmdi-nfc:before {
  content: '\f3e1';
}
.zmdi-play-for-work:before {
  content: '\f3e2';
}
.zmdi-power-input:before {
  content: '\f3e3';
}
.zmdi-present-to-all:before {
  content: '\f3e4';
}
.zmdi-satellite:before {
  content: '\f3e5';
}
.zmdi-tap-and-play:before {
  content: '\f3e6';
}
.zmdi-vibration:before {
  content: '\f3e7';
}
.zmdi-voicemail:before {
  content: '\f3e8';
}
.zmdi-group:before {
  content: '\f3e9';
}
.zmdi-rss:before {
  content: '\f3ea';
}
.zmdi-shape:before {
  content: '\f3eb';
}
.zmdi-spinner:before {
  content: '\f3ec';
}
.zmdi-ungroup:before {
  content: '\f3ed';
}
.zmdi-500px:before {
  content: '\f3ee';
}
.zmdi-8tracks:before {
  content: '\f3ef';
}
.zmdi-amazon:before {
  content: '\f3f0';
}
.zmdi-blogger:before {
  content: '\f3f1';
}
.zmdi-delicious:before {
  content: '\f3f2';
}
.zmdi-disqus:before {
  content: '\f3f3';
}
.zmdi-flattr:before {
  content: '\f3f4';
}
.zmdi-flickr:before {
  content: '\f3f5';
}
.zmdi-github-alt:before {
  content: '\f3f6';
}
.zmdi-google-old:before {
  content: '\f3f7';
}
.zmdi-linkedin:before {
  content: '\f3f8';
}
.zmdi-odnoklassniki:before {
  content: '\f3f9';
}
.zmdi-outlook:before {
  content: '\f3fa';
}
.zmdi-paypal-alt:before {
  content: '\f3fb';
}
.zmdi-pinterest:before {
  content: '\f3fc';
}
.zmdi-playstation:before {
  content: '\f3fd';
}
.zmdi-reddit:before {
  content: '\f3fe';
}
.zmdi-skype:before {
  content: '\f3ff';
}
.zmdi-slideshare:before {
  content: '\f400';
}
.zmdi-soundcloud:before {
  content: '\f401';
}
.zmdi-tumblr:before {
  content: '\f402';
}
.zmdi-twitch:before {
  content: '\f403';
}
.zmdi-vimeo:before {
  content: '\f404';
}
.zmdi-whatsapp:before {
  content: '\f405';
}
.zmdi-xbox:before {
  content: '\f406';
}
.zmdi-yahoo:before {
  content: '\f407';
}
.zmdi-youtube-play:before {
  content: '\f408';
}
.zmdi-youtube:before {
  content: '\f409';
}
.zmdi-3d-rotation:before {
  content: '\f101';
}
.zmdi-airplane-off:before {
  content: '\f102';
}
.zmdi-airplane:before {
  content: '\f103';
}
.zmdi-album:before {
  content: '\f104';
}
.zmdi-archive:before {
  content: '\f105';
}
.zmdi-assignment-account:before {
  content: '\f106';
}
.zmdi-assignment-alert:before {
  content: '\f107';
}
.zmdi-assignment-check:before {
  content: '\f108';
}
.zmdi-assignment-o:before {
  content: '\f109';
}
.zmdi-assignment-return:before {
  content: '\f10a';
}
.zmdi-assignment-returned:before {
  content: '\f10b';
}
.zmdi-assignment:before {
  content: '\f10c';
}
.zmdi-attachment-alt:before {
  content: '\f10d';
}
.zmdi-attachment:before {
  content: '\f10e';
}
.zmdi-audio:before {
  content: '\f10f';
}
.zmdi-badge-check:before {
  content: '\f110';
}
.zmdi-balance-wallet:before {
  content: '\f111';
}
.zmdi-balance:before {
  content: '\f112';
}
.zmdi-battery-alert:before {
  content: '\f113';
}
.zmdi-battery-flash:before {
  content: '\f114';
}
.zmdi-battery-unknown:before {
  content: '\f115';
}
.zmdi-battery:before {
  content: '\f116';
}
.zmdi-bike:before {
  content: '\f117';
}
.zmdi-block-alt:before {
  content: '\f118';
}
.zmdi-block:before {
  content: '\f119';
}
.zmdi-boat:before {
  content: '\f11a';
}
.zmdi-book-image:before {
  content: '\f11b';
}
.zmdi-book:before {
  content: '\f11c';
}
.zmdi-bookmark-outline:before {
  content: '\f11d';
}
.zmdi-bookmark:before {
  content: '\f11e';
}
.zmdi-brush:before {
  content: '\f11f';
}
.zmdi-bug:before {
  content: '\f120';
}
.zmdi-bus:before {
  content: '\f121';
}
.zmdi-cake:before {
  content: '\f122';
}
.zmdi-car-taxi:before {
  content: '\f123';
}
.zmdi-car-wash:before {
  content: '\f124';
}
.zmdi-car:before {
  content: '\f125';
}
.zmdi-card-giftcard:before {
  content: '\f126';
}
.zmdi-card-membership:before {
  content: '\f127';
}
.zmdi-card-travel:before {
  content: '\f128';
}
.zmdi-card:before {
  content: '\f129';
}
.zmdi-case-check:before {
  content: '\f12a';
}
.zmdi-case-download:before {
  content: '\f12b';
}
.zmdi-case-play:before {
  content: '\f12c';
}
.zmdi-case:before {
  content: '\f12d';
}
.zmdi-cast-connected:before {
  content: '\f12e';
}
.zmdi-cast:before {
  content: '\f12f';
}
.zmdi-chart-donut:before {
  content: '\f130';
}
.zmdi-chart:before {
  content: '\f131';
}
.zmdi-city-alt:before {
  content: '\f132';
}
.zmdi-city:before {
  content: '\f133';
}
.zmdi-close-circle-o:before {
  content: '\f134';
}
.zmdi-close-circle:before {
  content: '\f135';
}
.zmdi-close:before {
  content: '\f136';
}
.zmdi-cocktail:before {
  content: '\f137';
}
.zmdi-code-setting:before {
  content: '\f138';
}
.zmdi-code-smartphone:before {
  content: '\f139';
}
.zmdi-code:before {
  content: '\f13a';
}
.zmdi-coffee:before {
  content: '\f13b';
}
.zmdi-collection-bookmark:before {
  content: '\f13c';
}
.zmdi-collection-case-play:before {
  content: '\f13d';
}
.zmdi-collection-folder-image:before {
  content: '\f13e';
}
.zmdi-collection-image-o:before {
  content: '\f13f';
}
.zmdi-collection-image:before {
  content: '\f140';
}
.zmdi-collection-item-1:before {
  content: '\f141';
}
.zmdi-collection-item-2:before {
  content: '\f142';
}
.zmdi-collection-item-3:before {
  content: '\f143';
}
.zmdi-collection-item-4:before {
  content: '\f144';
}
.zmdi-collection-item-5:before {
  content: '\f145';
}
.zmdi-collection-item-6:before {
  content: '\f146';
}
.zmdi-collection-item-7:before {
  content: '\f147';
}
.zmdi-collection-item-8:before {
  content: '\f148';
}
.zmdi-collection-item-9-plus:before {
  content: '\f149';
}
.zmdi-collection-item-9:before {
  content: '\f14a';
}
.zmdi-collection-item:before {
  content: '\f14b';
}
.zmdi-collection-music:before {
  content: '\f14c';
}
.zmdi-collection-pdf:before {
  content: '\f14d';
}
.zmdi-collection-plus:before {
  content: '\f14e';
}
.zmdi-collection-speaker:before {
  content: '\f14f';
}
.zmdi-collection-text:before {
  content: '\f150';
}
.zmdi-collection-video:before {
  content: '\f151';
}
.zmdi-compass:before {
  content: '\f152';
}
.zmdi-cutlery:before {
  content: '\f153';
}
.zmdi-delete:before {
  content: '\f154';
}
.zmdi-dialpad:before {
  content: '\f155';
}
.zmdi-dns:before {
  content: '\f156';
}
.zmdi-drink:before {
  content: '\f157';
}
.zmdi-edit:before {
  content: '\f158';
}
.zmdi-email-open:before {
  content: '\f159';
}
.zmdi-email:before {
  content: '\f15a';
}
.zmdi-eye-off:before {
  content: '\f15b';
}
.zmdi-eye:before {
  content: '\f15c';
}
.zmdi-eyedropper:before {
  content: '\f15d';
}
.zmdi-favorite-outline:before {
  content: '\f15e';
}
.zmdi-favorite:before {
  content: '\f15f';
}
.zmdi-filter-list:before {
  content: '\f160';
}
.zmdi-fire:before {
  content: '\f161';
}
.zmdi-flag:before {
  content: '\f162';
}
.zmdi-flare:before {
  content: '\f163';
}
.zmdi-flash-auto:before {
  content: '\f164';
}
.zmdi-flash-off:before {
  content: '\f165';
}
.zmdi-flash:before {
  content: '\f166';
}
.zmdi-flip:before {
  content: '\f167';
}
.zmdi-flower-alt:before {
  content: '\f168';
}
.zmdi-flower:before {
  content: '\f169';
}
.zmdi-font:before {
  content: '\f16a';
}
.zmdi-fullscreen-alt:before {
  content: '\f16b';
}
.zmdi-fullscreen-exit:before {
  content: '\f16c';
}
.zmdi-fullscreen:before {
  content: '\f16d';
}
.zmdi-functions:before {
  content: '\f16e';
}
.zmdi-gas-station:before {
  content: '\f16f';
}
.zmdi-gesture:before {
  content: '\f170';
}
.zmdi-globe-alt:before {
  content: '\f171';
}
.zmdi-globe-lock:before {
  content: '\f172';
}
.zmdi-globe:before {
  content: '\f173';
}
.zmdi-graduation-cap:before {
  content: '\f174';
}
.zmdi-home:before {
  content: '\f175';
}
.zmdi-hospital-alt:before {
  content: '\f176';
}
.zmdi-hospital:before {
  content: '\f177';
}
.zmdi-hotel:before {
  content: '\f178';
}
.zmdi-hourglass-alt:before {
  content: '\f179';
}
.zmdi-hourglass-outline:before {
  content: '\f17a';
}
.zmdi-hourglass:before {
  content: '\f17b';
}
.zmdi-http:before {
  content: '\f17c';
}
.zmdi-image-alt:before {
  content: '\f17d';
}
.zmdi-image-o:before {
  content: '\f17e';
}
.zmdi-image:before {
  content: '\f17f';
}
.zmdi-inbox:before {
  content: '\f180';
}
.zmdi-invert-colors-off:before {
  content: '\f181';
}
.zmdi-invert-colors:before {
  content: '\f182';
}
.zmdi-key:before {
  content: '\f183';
}
.zmdi-label-alt-outline:before {
  content: '\f184';
}
.zmdi-label-alt:before {
  content: '\f185';
}
.zmdi-label-heart:before {
  content: '\f186';
}
.zmdi-label:before {
  content: '\f187';
}
.zmdi-labels:before {
  content: '\f188';
}
.zmdi-lamp:before {
  content: '\f189';
}
.zmdi-landscape:before {
  content: '\f18a';
}
.zmdi-layers-off:before {
  content: '\f18b';
}
.zmdi-layers:before {
  content: '\f18c';
}
.zmdi-library:before {
  content: '\f18d';
}
.zmdi-link:before {
  content: '\f18e';
}
.zmdi-lock-open:before {
  content: '\f18f';
}
.zmdi-lock-outline:before {
  content: '\f190';
}
.zmdi-lock:before {
  content: '\f191';
}
.zmdi-mail-reply-all:before {
  content: '\f192';
}
.zmdi-mail-reply:before {
  content: '\f193';
}
.zmdi-mail-send:before {
  content: '\f194';
}
.zmdi-mall:before {
  content: '\f195';
}
.zmdi-map:before {
  content: '\f196';
}
.zmdi-menu:before {
  content: '\f197';
}
.zmdi-money-box:before {
  content: '\f198';
}
.zmdi-money-off:before {
  content: '\f199';
}
.zmdi-money:before {
  content: '\f19a';
}
.zmdi-more-vert:before {
  content: '\f19b';
}
.zmdi-more:before {
  content: '\f19c';
}
.zmdi-movie-alt:before {
  content: '\f19d';
}
.zmdi-movie:before {
  content: '\f19e';
}
.zmdi-nature-people:before {
  content: '\f19f';
}
.zmdi-nature:before {
  content: '\f1a0';
}
.zmdi-navigation:before {
  content: '\f1a1';
}
.zmdi-open-in-browser:before {
  content: '\f1a2';
}
.zmdi-open-in-new:before {
  content: '\f1a3';
}
.zmdi-palette:before {
  content: '\f1a4';
}
.zmdi-parking:before {
  content: '\f1a5';
}
.zmdi-pin-account:before {
  content: '\f1a6';
}
.zmdi-pin-assistant:before {
  content: '\f1a7';
}
.zmdi-pin-drop:before {
  content: '\f1a8';
}
.zmdi-pin-help:before {
  content: '\f1a9';
}
.zmdi-pin-off:before {
  content: '\f1aa';
}
.zmdi-pin:before {
  content: '\f1ab';
}
.zmdi-pizza:before {
  content: '\f1ac';
}
.zmdi-plaster:before {
  content: '\f1ad';
}
.zmdi-power-setting:before {
  content: '\f1ae';
}
.zmdi-power:before {
  content: '\f1af';
}
.zmdi-print:before {
  content: '\f1b0';
}
.zmdi-puzzle-piece:before {
  content: '\f1b1';
}
.zmdi-quote:before {
  content: '\f1b2';
}
.zmdi-railway:before {
  content: '\f1b3';
}
.zmdi-receipt:before {
  content: '\f1b4';
}
.zmdi-refresh-alt:before {
  content: '\f1b5';
}
.zmdi-refresh-sync-alert:before {
  content: '\f1b6';
}
.zmdi-refresh-sync-off:before {
  content: '\f1b7';
}
.zmdi-refresh-sync:before {
  content: '\f1b8';
}
.zmdi-refresh:before {
  content: '\f1b9';
}
.zmdi-roller:before {
  content: '\f1ba';
}
.zmdi-ruler:before {
  content: '\f1bb';
}
.zmdi-scissors:before {
  content: '\f1bc';
}
.zmdi-screen-rotation-lock:before {
  content: '\f1bd';
}
.zmdi-screen-rotation:before {
  content: '\f1be';
}
.zmdi-search-for:before {
  content: '\f1bf';
}
.zmdi-search-in-file:before {
  content: '\f1c0';
}
.zmdi-search-in-page:before {
  content: '\f1c1';
}
.zmdi-search-replace:before {
  content: '\f1c2';
}
.zmdi-search:before {
  content: '\f1c3';
}
.zmdi-seat:before {
  content: '\f1c4';
}
.zmdi-settings-square:before {
  content: '\f1c5';
}
.zmdi-settings:before {
  content: '\f1c6';
}
.zmdi-shield-check:before {
  content: '\f1c7';
}
.zmdi-shield-security:before {
  content: '\f1c8';
}
.zmdi-shopping-basket:before {
  content: '\f1c9';
}
.zmdi-shopping-cart-plus:before {
  content: '\f1ca';
}
.zmdi-shopping-cart:before {
  content: '\f1cb';
}
.zmdi-sign-in:before {
  content: '\f1cc';
}
.zmdi-sort-amount-asc:before {
  content: '\f1cd';
}
.zmdi-sort-amount-desc:before {
  content: '\f1ce';
}
.zmdi-sort-asc:before {
  content: '\f1cf';
}
.zmdi-sort-desc:before {
  content: '\f1d0';
}
.zmdi-spellcheck:before {
  content: '\f1d1';
}
.zmdi-storage:before {
  content: '\f1d2';
}
.zmdi-store-24:before {
  content: '\f1d3';
}
.zmdi-store:before {
  content: '\f1d4';
}
.zmdi-subway:before {
  content: '\f1d5';
}
.zmdi-sun:before {
  content: '\f1d6';
}
.zmdi-tab-unselected:before {
  content: '\f1d7';
}
.zmdi-tab:before {
  content: '\f1d8';
}
.zmdi-tag-close:before {
  content: '\f1d9';
}
.zmdi-tag-more:before {
  content: '\f1da';
}
.zmdi-tag:before {
  content: '\f1db';
}
.zmdi-thumb-down:before {
  content: '\f1dc';
}
.zmdi-thumb-up-down:before {
  content: '\f1dd';
}
.zmdi-thumb-up:before {
  content: '\f1de';
}
.zmdi-ticket-star:before {
  content: '\f1df';
}
.zmdi-toll:before {
  content: '\f1e0';
}
.zmdi-toys:before {
  content: '\f1e1';
}
.zmdi-traffic:before {
  content: '\f1e2';
}
.zmdi-translate:before {
  content: '\f1e3';
}
.zmdi-triangle-down:before {
  content: '\f1e4';
}
.zmdi-triangle-up:before {
  content: '\f1e5';
}
.zmdi-truck:before {
  content: '\f1e6';
}
.zmdi-turning-sign:before {
  content: '\f1e7';
}
.zmdi-wallpaper:before {
  content: '\f1e8';
}
.zmdi-washing-machine:before {
  content: '\f1e9';
}
.zmdi-window-maximize:before {
  content: '\f1ea';
}
.zmdi-window-minimize:before {
  content: '\f1eb';
}
.zmdi-window-restore:before {
  content: '\f1ec';
}
.zmdi-wrench:before {
  content: '\f1ed';
}
.zmdi-zoom-in:before {
  content: '\f1ee';
}
.zmdi-zoom-out:before {
  content: '\f1ef';
}
.zmdi-alert-circle-o:before {
  content: '\f1f0';
}
.zmdi-alert-circle:before {
  content: '\f1f1';
}
.zmdi-alert-octagon:before {
  content: '\f1f2';
}
.zmdi-alert-polygon:before {
  content: '\f1f3';
}
.zmdi-alert-triangle:before {
  content: '\f1f4';
}
.zmdi-help-outline:before {
  content: '\f1f5';
}
.zmdi-help:before {
  content: '\f1f6';
}
.zmdi-info-outline:before {
  content: '\f1f7';
}
.zmdi-info:before {
  content: '\f1f8';
}
.zmdi-notifications-active:before {
  content: '\f1f9';
}
.zmdi-notifications-add:before {
  content: '\f1fa';
}
.zmdi-notifications-none:before {
  content: '\f1fb';
}
.zmdi-notifications-off:before {
  content: '\f1fc';
}
.zmdi-notifications-paused:before {
  content: '\f1fd';
}
.zmdi-notifications:before {
  content: '\f1fe';
}
.zmdi-account-add:before {
  content: '\f1ff';
}
.zmdi-account-box-mail:before {
  content: '\f200';
}
.zmdi-account-box-o:before {
  content: '\f201';
}
.zmdi-account-box-phone:before {
  content: '\f202';
}
.zmdi-account-box:before {
  content: '\f203';
}
.zmdi-account-calendar:before {
  content: '\f204';
}
.zmdi-account-circle:before {
  content: '\f205';
}
.zmdi-account-o:before {
  content: '\f206';
}
.zmdi-account:before {
  content: '\f207';
}
.zmdi-accounts-add:before {
  content: '\f208';
}
.zmdi-accounts-alt:before {
  content: '\f209';
}
.zmdi-accounts-list-alt:before {
  content: '\f20a';
}
.zmdi-accounts-list:before {
  content: '\f20b';
}
.zmdi-accounts-outline:before {
  content: '\f20c';
}
.zmdi-accounts:before {
  content: '\f20d';
}
.zmdi-face:before {
  content: '\f20e';
}
.zmdi-female:before {
  content: '\f20f';
}
.zmdi-male-alt:before {
  content: '\f210';
}
.zmdi-male-female:before {
  content: '\f211';
}
.zmdi-male:before {
  content: '\f212';
}
.zmdi-mood-bad:before {
  content: '\f213';
}
.zmdi-mood:before {
  content: '\f214';
}
.zmdi-run:before {
  content: '\f215';
}
.zmdi-walk:before {
  content: '\f216';
}
.zmdi-cloud-box:before {
  content: '\f217';
}
.zmdi-cloud-circle:before {
  content: '\f218';
}
.zmdi-cloud-done:before {
  content: '\f219';
}
.zmdi-cloud-download:before {
  content: '\f21a';
}
.zmdi-cloud-off:before {
  content: '\f21b';
}
.zmdi-cloud-outline-alt:before {
  content: '\f21c';
}
.zmdi-cloud-outline:before {
  content: '\f21d';
}
.zmdi-cloud-upload:before {
  content: '\f21e';
}
.zmdi-cloud:before {
  content: '\f21f';
}
.zmdi-download:before {
  content: '\f220';
}
.zmdi-file-plus:before {
  content: '\f221';
}
.zmdi-file-text:before {
  content: '\f222';
}
.zmdi-file:before {
  content: '\f223';
}
.zmdi-folder-outline:before {
  content: '\f224';
}
.zmdi-folder-person:before {
  content: '\f225';
}
.zmdi-folder-star-alt:before {
  content: '\f226';
}
.zmdi-folder-star:before {
  content: '\f227';
}
.zmdi-folder:before {
  content: '\f228';
}
.zmdi-gif:before {
  content: '\f229';
}
.zmdi-upload:before {
  content: '\f22a';
}
.zmdi-border-all:before {
  content: '\f22b';
}
.zmdi-border-bottom:before {
  content: '\f22c';
}
.zmdi-border-clear:before {
  content: '\f22d';
}
.zmdi-border-color:before {
  content: '\f22e';
}
.zmdi-border-horizontal:before {
  content: '\f22f';
}
.zmdi-border-inner:before {
  content: '\f230';
}
.zmdi-border-left:before {
  content: '\f231';
}
.zmdi-border-outer:before {
  content: '\f232';
}
.zmdi-border-right:before {
  content: '\f233';
}
.zmdi-border-style:before {
  content: '\f234';
}
.zmdi-border-top:before {
  content: '\f235';
}
.zmdi-border-vertical:before {
  content: '\f236';
}
.zmdi-copy:before {
  content: '\f237';
}
.zmdi-crop:before {
  content: '\f238';
}
.zmdi-format-align-center:before {
  content: '\f239';
}
.zmdi-format-align-justify:before {
  content: '\f23a';
}
.zmdi-format-align-left:before {
  content: '\f23b';
}
.zmdi-format-align-right:before {
  content: '\f23c';
}
.zmdi-format-bold:before {
  content: '\f23d';
}
.zmdi-format-clear-all:before {
  content: '\f23e';
}
.zmdi-format-clear:before {
  content: '\f23f';
}
.zmdi-format-color-fill:before {
  content: '\f240';
}
.zmdi-format-color-reset:before {
  content: '\f241';
}
.zmdi-format-color-text:before {
  content: '\f242';
}
.zmdi-format-indent-decrease:before {
  content: '\f243';
}
.zmdi-format-indent-increase:before {
  content: '\f244';
}
.zmdi-format-italic:before {
  content: '\f245';
}
.zmdi-format-line-spacing:before {
  content: '\f246';
}
.zmdi-format-list-bulleted:before {
  content: '\f247';
}
.zmdi-format-list-numbered:before {
  content: '\f248';
}
.zmdi-format-ltr:before {
  content: '\f249';
}
.zmdi-format-rtl:before {
  content: '\f24a';
}
.zmdi-format-size:before {
  content: '\f24b';
}
.zmdi-format-strikethrough-s:before {
  content: '\f24c';
}
.zmdi-format-strikethrough:before {
  content: '\f24d';
}
.zmdi-format-subject:before {
  content: '\f24e';
}
.zmdi-format-underlined:before {
  content: '\f24f';
}
.zmdi-format-valign-bottom:before {
  content: '\f250';
}
.zmdi-format-valign-center:before {
  content: '\f251';
}
.zmdi-format-valign-top:before {
  content: '\f252';
}
.zmdi-redo:before {
  content: '\f253';
}
.zmdi-select-all:before {
  content: '\f254';
}
.zmdi-space-bar:before {
  content: '\f255';
}
.zmdi-text-format:before {
  content: '\f256';
}
.zmdi-transform:before {
  content: '\f257';
}
.zmdi-undo:before {
  content: '\f258';
}
.zmdi-wrap-text:before {
  content: '\f259';
}
.zmdi-comment-alert:before {
  content: '\f25a';
}
.zmdi-comment-alt-text:before {
  content: '\f25b';
}
.zmdi-comment-alt:before {
  content: '\f25c';
}
.zmdi-comment-edit:before {
  content: '\f25d';
}
.zmdi-comment-image:before {
  content: '\f25e';
}
.zmdi-comment-list:before {
  content: '\f25f';
}
.zmdi-comment-more:before {
  content: '\f260';
}
.zmdi-comment-outline:before {
  content: '\f261';
}
.zmdi-comment-text-alt:before {
  content: '\f262';
}
.zmdi-comment-text:before {
  content: '\f263';
}
.zmdi-comment-video:before {
  content: '\f264';
}
.zmdi-comment:before {
  content: '\f265';
}
.zmdi-comments:before {
  content: '\f266';
}
.zmdi-check-all:before {
  content: '\f267';
}
.zmdi-check-circle-u:before {
  content: '\f268';
}
.zmdi-check-circle:before {
  content: '\f269';
}
.zmdi-check-square:before {
  content: '\f26a';
}
.zmdi-check:before {
  content: '\f26b';
}
.zmdi-circle-o:before {
  content: '\f26c';
}
.zmdi-circle:before {
  content: '\f26d';
}
.zmdi-dot-circle-alt:before {
  content: '\f26e';
}
.zmdi-dot-circle:before {
  content: '\f26f';
}
.zmdi-minus-circle-outline:before {
  content: '\f270';
}
.zmdi-minus-circle:before {
  content: '\f271';
}
.zmdi-minus-square:before {
  content: '\f272';
}
.zmdi-minus:before {
  content: '\f273';
}
.zmdi-plus-circle-o-duplicate:before {
  content: '\f274';
}
.zmdi-plus-circle-o:before {
  content: '\f275';
}
.zmdi-plus-circle:before {
  content: '\f276';
}
.zmdi-plus-square:before {
  content: '\f277';
}
.zmdi-plus:before {
  content: '\f278';
}
.zmdi-square-o:before {
  content: '\f279';
}
.zmdi-star-circle:before {
  content: '\f27a';
}
.zmdi-star-half:before {
  content: '\f27b';
}
.zmdi-star-outline:before {
  content: '\f27c';
}
.zmdi-star:before {
  content: '\f27d';
}
.zmdi-bluetooth-connected:before {
  content: '\f27e';
}
.zmdi-bluetooth-off:before {
  content: '\f27f';
}
.zmdi-bluetooth-search:before {
  content: '\f280';
}
.zmdi-bluetooth-setting:before {
  content: '\f281';
}
.zmdi-bluetooth:before {
  content: '\f282';
}
.zmdi-camera-add:before {
  content: '\f283';
}
.zmdi-camera-alt:before {
  content: '\f284';
}
.zmdi-camera-bw:before {
  content: '\f285';
}
.zmdi-camera-front:before {
  content: '\f286';
}
.zmdi-camera-mic:before {
  content: '\f287';
}
.zmdi-camera-party-mode:before {
  content: '\f288';
}
.zmdi-camera-rear:before {
  content: '\f289';
}
.zmdi-camera-roll:before {
  content: '\f28a';
}
.zmdi-camera-switch:before {
  content: '\f28b';
}
.zmdi-camera:before {
  content: '\f28c';
}
.zmdi-card-alert:before {
  content: '\f28d';
}
.zmdi-card-off:before {
  content: '\f28e';
}
.zmdi-card-sd:before {
  content: '\f28f';
}
.zmdi-card-sim:before {
  content: '\f290';
}
.zmdi-desktop-mac:before {
  content: '\f291';
}
.zmdi-desktop-windows:before {
  content: '\f292';
}
.zmdi-device-hub:before {
  content: '\f293';
}
.zmdi-devices-off:before {
  content: '\f294';
}
.zmdi-devices:before {
  content: '\f295';
}
.zmdi-dock:before {
  content: '\f296';
}
.zmdi-floppy:before {
  content: '\f297';
}
.zmdi-gamepad:before {
  content: '\f298';
}
.zmdi-gps-dot:before {
  content: '\f299';
}
.zmdi-gps-off:before {
  content: '\f29a';
}
.zmdi-gps:before {
  content: '\f29b';
}
.zmdi-headset-mic:before {
  content: '\f29c';
}
.zmdi-headset:before {
  content: '\f29d';
}
.zmdi-input-antenna:before {
  content: '\f29e';
}
.zmdi-input-composite:before {
  content: '\f29f';
}
.zmdi-input-hdmi:before {
  content: '\f2a0';
}
.zmdi-input-power:before {
  content: '\f2a1';
}
.zmdi-input-svideo:before {
  content: '\f2a2';
}
.zmdi-keyboard-hide:before {
  content: '\f2a3';
}
.zmdi-keyboard:before {
  content: '\f2a4';
}
.zmdi-laptop-chromebook:before {
  content: '\f2a5';
}
.zmdi-laptop-mac:before {
  content: '\f2a6';
}
.zmdi-laptop:before {
  content: '\f2a7';
}
.zmdi-mic-off:before {
  content: '\f2a8';
}
.zmdi-mic-outline:before {
  content: '\f2a9';
}
.zmdi-mic-setting:before {
  content: '\f2aa';
}
.zmdi-mic:before {
  content: '\f2ab';
}
.zmdi-mouse:before {
  content: '\f2ac';
}
.zmdi-network-alert:before {
  content: '\f2ad';
}
.zmdi-network-locked:before {
  content: '\f2ae';
}
.zmdi-network-off:before {
  content: '\f2af';
}
.zmdi-network-outline:before {
  content: '\f2b0';
}
.zmdi-network-setting:before {
  content: '\f2b1';
}
.zmdi-network:before {
  content: '\f2b2';
}
.zmdi-phone-bluetooth:before {
  content: '\f2b3';
}
.zmdi-phone-end:before {
  content: '\f2b4';
}
.zmdi-phone-forwarded:before {
  content: '\f2b5';
}
.zmdi-phone-in-talk:before {
  content: '\f2b6';
}
.zmdi-phone-locked:before {
  content: '\f2b7';
}
.zmdi-phone-missed:before {
  content: '\f2b8';
}
.zmdi-phone-msg:before {
  content: '\f2b9';
}
.zmdi-phone-paused:before {
  content: '\f2ba';
}
.zmdi-phone-ring:before {
  content: '\f2bb';
}
.zmdi-phone-setting:before {
  content: '\f2bc';
}
.zmdi-phone-sip:before {
  content: '\f2bd';
}
.zmdi-phone:before {
  content: '\f2be';
}
.zmdi-portable-wifi-changes:before {
  content: '\f2bf';
}
.zmdi-portable-wifi-off:before {
  content: '\f2c0';
}
.zmdi-portable-wifi:before {
  content: '\f2c1';
}
.zmdi-radio:before {
  content: '\f2c2';
}
.zmdi-reader:before {
  content: '\f2c3';
}
.zmdi-remote-control-alt:before {
  content: '\f2c4';
}
.zmdi-remote-control:before {
  content: '\f2c5';
}
.zmdi-router:before {
  content: '\f2c6';
}
.zmdi-scanner:before {
  content: '\f2c7';
}
.zmdi-smartphone-android:before {
  content: '\f2c8';
}
.zmdi-smartphone-download:before {
  content: '\f2c9';
}
.zmdi-smartphone-erase:before {
  content: '\f2ca';
}
.zmdi-smartphone-info:before {
  content: '\f2cb';
}
.zmdi-smartphone-iphone:before {
  content: '\f2cc';
}
.zmdi-smartphone-landscape-lock:before {
  content: '\f2cd';
}
.zmdi-smartphone-landscape:before {
  content: '\f2ce';
}
.zmdi-smartphone-lock:before {
  content: '\f2cf';
}
.zmdi-smartphone-portrait-lock:before {
  content: '\f2d0';
}
.zmdi-smartphone-ring:before {
  content: '\f2d1';
}
.zmdi-smartphone-setting:before {
  content: '\f2d2';
}
.zmdi-smartphone-setup:before {
  content: '\f2d3';
}
.zmdi-smartphone:before {
  content: '\f2d4';
}
.zmdi-speaker:before {
  content: '\f2d5';
}
.zmdi-tablet-android:before {
  content: '\f2d6';
}
.zmdi-tablet-mac:before {
  content: '\f2d7';
}
.zmdi-tablet:before {
  content: '\f2d8';
}
.zmdi-tv-alt-play:before {
  content: '\f2d9';
}
.zmdi-tv-list:before {
  content: '\f2da';
}
.zmdi-tv-play:before {
  content: '\f2db';
}
.zmdi-tv:before {
  content: '\f2dc';
}
.zmdi-usb:before {
  content: '\f2dd';
}
.zmdi-videocam-off:before {
  content: '\f2de';
}
.zmdi-videocam-switch:before {
  content: '\f2df';
}
.zmdi-videocam:before {
  content: '\f2e0';
}
.zmdi-watch:before {
  content: '\f2e1';
}
.zmdi-wifi-alt-2:before {
  content: '\f2e2';
}
.zmdi-wifi-alt:before {
  content: '\f2e3';
}
.zmdi-wifi-info:before {
  content: '\f2e4';
}
.zmdi-wifi-lock:before {
  content: '\f2e5';
}
.zmdi-wifi-off:before {
  content: '\f2e6';
}
.zmdi-wifi-outline:before {
  content: '\f2e7';
}
.zmdi-wifi:before {
  content: '\f2e8';
}
.zmdi-arrow-left-bottom:before {
  content: '\f2e9';
}
.zmdi-arrow-left:before {
  content: '\f2ea';
}
.zmdi-arrow-merge:before {
  content: '\f2eb';
}
.zmdi-arrow-missed:before {
  content: '\f2ec';
}
.zmdi-arrow-right-top:before {
  content: '\f2ed';
}
.zmdi-arrow-right:before {
  content: '\f2ee';
}
.zmdi-arrow-split:before {
  content: '\f2ef';
}
.zmdi-arrows:before {
  content: '\f2f0';
}
.zmdi-caret-down-circle:before {
  content: '\f2f1';
}
.zmdi-caret-down:before {
  content: '\f2f2';
}
.zmdi-caret-left-circle:before {
  content: '\f2f3';
}
.zmdi-caret-left:before {
  content: '\f2f4';
}
.zmdi-caret-right-circle:before {
  content: '\f2f5';
}
.zmdi-caret-right:before {
  content: '\f2f6';
}
.zmdi-caret-up-circle:before {
  content: '\f2f7';
}
.zmdi-caret-up:before {
  content: '\f2f8';
}
.zmdi-chevron-down:before {
  content: '\f2f9';
}
.zmdi-chevron-left:before {
  content: '\f2fa';
}
.zmdi-chevron-right:before {
  content: '\f2fb';
}
.zmdi-chevron-up:before {
  content: '\f2fc';
}
.zmdi-forward:before {
  content: '\f2fd';
}
.zmdi-long-arrow-down:before {
  content: '\f2fe';
}
.zmdi-long-arrow-left:before {
  content: '\f2ff';
}
.zmdi-long-arrow-return:before {
  content: '\f300';
}
.zmdi-long-arrow-right:before {
  content: '\f301';
}
.zmdi-long-arrow-tab:before {
  content: '\f302';
}
.zmdi-long-arrow-up:before {
  content: '\f303';
}
.zmdi-rotate-ccw:before {
  content: '\f304';
}
.zmdi-rotate-cw:before {
  content: '\f305';
}
.zmdi-rotate-left:before {
  content: '\f306';
}
.zmdi-rotate-right:before {
  content: '\f307';
}
.zmdi-square-down:before {
  content: '\f308';
}
.zmdi-square-right:before {
  content: '\f309';
}
.zmdi-swap-alt:before {
  content: '\f30a';
}
.zmdi-swap-vertical-circle:before {
  content: '\f30b';
}
.zmdi-swap-vertical:before {
  content: '\f30c';
}
.zmdi-swap:before {
  content: '\f30d';
}
.zmdi-trending-down:before {
  content: '\f30e';
}
.zmdi-trending-flat:before {
  content: '\f30f';
}
.zmdi-trending-up:before {
  content: '\f310';
}
.zmdi-unfold-less:before {
  content: '\f311';
}
.zmdi-unfold-more:before {
  content: '\f312';
}
.zmdi-apps:before {
  content: '\f313';
}
.zmdi-grid-off:before {
  content: '\f314';
}
.zmdi-grid:before {
  content: '\f315';
}
.zmdi-view-agenda:before {
  content: '\f316';
}
.zmdi-view-array:before {
  content: '\f317';
}
.zmdi-view-carousel:before {
  content: '\f318';
}
.zmdi-view-column:before {
  content: '\f319';
}
.zmdi-view-comfy:before {
  content: '\f31a';
}
.zmdi-view-compact:before {
  content: '\f31b';
}
.zmdi-view-dashboard:before {
  content: '\f31c';
}
.zmdi-view-day:before {
  content: '\f31d';
}
.zmdi-view-headline:before {
  content: '\f31e';
}
.zmdi-view-list-alt:before {
  content: '\f31f';
}
.zmdi-view-list:before {
  content: '\f320';
}
.zmdi-view-module:before {
  content: '\f321';
}
.zmdi-view-quilt:before {
  content: '\f322';
}
.zmdi-view-stream:before {
  content: '\f323';
}
.zmdi-view-subtitles:before {
  content: '\f324';
}
.zmdi-view-toc:before {
  content: '\f325';
}
.zmdi-view-web:before {
  content: '\f326';
}
.zmdi-view-week:before {
  content: '\f327';
}
.zmdi-widgets:before {
  content: '\f328';
}
.zmdi-alarm-check:before {
  content: '\f329';
}
.zmdi-alarm-off:before {
  content: '\f32a';
}
.zmdi-alarm-plus:before {
  content: '\f32b';
}
.zmdi-alarm-snooze:before {
  content: '\f32c';
}
.zmdi-alarm:before {
  content: '\f32d';
}
.zmdi-calendar-alt:before {
  content: '\f32e';
}
.zmdi-calendar-check:before {
  content: '\f32f';
}
.zmdi-calendar-close:before {
  content: '\f330';
}
.zmdi-calendar-note:before {
  content: '\f331';
}
.zmdi-calendar:before {
  content: '\f332';
}
.zmdi-time-countdown:before {
  content: '\f333';
}
.zmdi-time-interval:before {
  content: '\f334';
}
.zmdi-time-restore-setting:before {
  content: '\f335';
}
.zmdi-time-restore:before {
  content: '\f336';
}
.zmdi-time:before {
  content: '\f337';
}
.zmdi-timer-off:before {
  content: '\f338';
}
.zmdi-timer:before {
  content: '\f339';
}
.zmdi-android-alt:before {
  content: '\f33a';
}
.zmdi-android:before {
  content: '\f33b';
}
.zmdi-apple:before {
  content: '\f33c';
}
.zmdi-behance:before {
  content: '\f33d';
}
.zmdi-codepen:before {
  content: '\f33e';
}
.zmdi-dribbble:before {
  content: '\f33f';
}
.zmdi-dropbox:before {
  content: '\f340';
}
.zmdi-evernote:before {
  content: '\f341';
}
.zmdi-facebook-box:before {
  content: '\f342';
}
.zmdi-facebook:before {
  content: '\f343';
}
.zmdi-github-box:before {
  content: '\f344';
}
.zmdi-github:before {
  content: '\f345';
}
.zmdi-google-drive:before {
  content: '\f346';
}
.zmdi-google-earth:before {
  content: '\f347';
}
.zmdi-google-glass:before {
  content: '\f348';
}
.zmdi-google-maps:before {
  content: '\f349';
}
.zmdi-google-pages:before {
  content: '\f34a';
}
.zmdi-google-play:before {
  content: '\f34b';
}
.zmdi-google-plus-box:before {
  content: '\f34c';
}
.zmdi-google-plus:before {
  content: '\f34d';
}
.zmdi-google:before {
  content: '\f34e';
}
.zmdi-instagram:before {
  content: '\f34f';
}
.zmdi-language-css3:before {
  content: '\f350';
}
.zmdi-language-html5:before {
  content: '\f351';
}
.zmdi-language-javascript:before {
  content: '\f352';
}
.zmdi-language-python-alt:before {
  content: '\f353';
}
.zmdi-language-python:before {
  content: '\f354';
}
.zmdi-lastfm:before {
  content: '\f355';
}
.zmdi-linkedin-box:before {
  content: '\f356';
}
.zmdi-paypal:before {
  content: '\f357';
}
.zmdi-pinterest-box:before {
  content: '\f358';
}
.zmdi-pocket:before {
  content: '\f359';
}
.zmdi-polymer:before {
  content: '\f35a';
}
.zmdi-share:before {
  content: '\f35b';
}
.zmdi-stackoverflow:before {
  content: '\f35c';
}
.zmdi-steam-square:before {
  content: '\f35d';
}
.zmdi-steam:before {
  content: '\f35e';
}
.zmdi-twitter-box:before {
  content: '\f35f';
}
.zmdi-twitter:before {
  content: '\f360';
}
.zmdi-vk:before {
  content: '\f361';
}
.zmdi-wikipedia:before {
  content: '\f362';
}
.zmdi-windows:before {
  content: '\f363';
}
.zmdi-aspect-ratio-alt:before {
  content: '\f364';
}
.zmdi-aspect-ratio:before {
  content: '\f365';
}
.zmdi-blur-circular:before {
  content: '\f366';
}
.zmdi-blur-linear:before {
  content: '\f367';
}
.zmdi-blur-off:before {
  content: '\f368';
}
.zmdi-blur:before {
  content: '\f369';
}
.zmdi-brightness-2:before {
  content: '\f36a';
}
.zmdi-brightness-3:before {
  content: '\f36b';
}
.zmdi-brightness-4:before {
  content: '\f36c';
}
.zmdi-brightness-5:before {
  content: '\f36d';
}
.zmdi-brightness-6:before {
  content: '\f36e';
}
.zmdi-brightness-7:before {
  content: '\f36f';
}
.zmdi-brightness-auto:before {
  content: '\f370';
}
.zmdi-brightness-setting:before {
  content: '\f371';
}
.zmdi-broken-image:before {
  content: '\f372';
}
.zmdi-center-focus-strong:before {
  content: '\f373';
}
.zmdi-center-focus-weak:before {
  content: '\f374';
}
.zmdi-compare:before {
  content: '\f375';
}
.zmdi-crop-16-9:before {
  content: '\f376';
}
.zmdi-crop-3-2:before {
  content: '\f377';
}
.zmdi-crop-5-4:before {
  content: '\f378';
}
.zmdi-crop-7-5:before {
  content: '\f379';
}
.zmdi-crop-din:before {
  content: '\f37a';
}
.zmdi-crop-free:before {
  content: '\f37b';
}
.zmdi-crop-landscape:before {
  content: '\f37c';
}
.zmdi-crop-portrait:before {
  content: '\f37d';
}
.zmdi-crop-square:before {
  content: '\f37e';
}
.zmdi-exposure-alt:before {
  content: '\f37f';
}
.zmdi-exposure:before {
  content: '\f380';
}
.zmdi-filter-b-and-w:before {
  content: '\f381';
}
.zmdi-filter-center-focus:before {
  content: '\f382';
}
.zmdi-filter-frames:before {
  content: '\f383';
}
.zmdi-filter-tilt-shift:before {
  content: '\f384';
}
.zmdi-gradient:before {
  content: '\f385';
}
.zmdi-grain:before {
  content: '\f386';
}
.zmdi-graphic-eq:before {
  content: '\f387';
}
.zmdi-hdr-off:before {
  content: '\f388';
}
.zmdi-hdr-strong:before {
  content: '\f389';
}
.zmdi-hdr-weak:before {
  content: '\f38a';
}
.zmdi-hdr:before {
  content: '\f38b';
}
.zmdi-iridescent:before {
  content: '\f38c';
}
.zmdi-leak-off:before {
  content: '\f38d';
}
.zmdi-leak:before {
  content: '\f38e';
}
.zmdi-looks:before {
  content: '\f38f';
}
.zmdi-loupe:before {
  content: '\f390';
}
.zmdi-panorama-horizontal:before {
  content: '\f391';
}
.zmdi-panorama-vertical:before {
  content: '\f392';
}
.zmdi-panorama-wide-angle:before {
  content: '\f393';
}
.zmdi-photo-size-select-large:before {
  content: '\f394';
}
.zmdi-photo-size-select-small:before {
  content: '\f395';
}
.zmdi-picture-in-picture:before {
  content: '\f396';
}
.zmdi-slideshow:before {
  content: '\f397';
}
.zmdi-texture:before {
  content: '\f398';
}
.zmdi-tonality:before {
  content: '\f399';
}
.zmdi-vignette:before {
  content: '\f39a';
}
.zmdi-wb-auto:before {
  content: '\f39b';
}
.zmdi-eject-alt:before {
  content: '\f39c';
}
.zmdi-eject:before {
  content: '\f39d';
}
.zmdi-equalizer:before {
  content: '\f39e';
}
.zmdi-fast-forward:before {
  content: '\f39f';
}
.zmdi-fast-rewind:before {
  content: '\f3a0';
}
.zmdi-forward-10:before {
  content: '\f3a1';
}
.zmdi-forward-30:before {
  content: '\f3a2';
}
.zmdi-forward-5:before {
  content: '\f3a3';
}
.zmdi-hearing:before {
  content: '\f3a4';
}
.zmdi-pause-circle-outline:before {
  content: '\f3a5';
}
.zmdi-pause-circle:before {
  content: '\f3a6';
}
.zmdi-pause:before {
  content: '\f3a7';
}
.zmdi-play-circle-outline:before {
  content: '\f3a8';
}
.zmdi-play-circle:before {
  content: '\f3a9';
}
.zmdi-play:before {
  content: '\f3aa';
}
.zmdi-playlist-audio:before {
  content: '\f3ab';
}
.zmdi-playlist-plus:before {
  content: '\f3ac';
}
.zmdi-repeat-one:before {
  content: '\f3ad';
}
.zmdi-repeat:before {
  content: '\f3ae';
}
.zmdi-replay-10:before {
  content: '\f3af';
}
.zmdi-replay-30:before {
  content: '\f3b0';
}
.zmdi-replay-5:before {
  content: '\f3b1';
}
.zmdi-replay:before {
  content: '\f3b2';
}
.zmdi-shuffle:before {
  content: '\f3b3';
}
.zmdi-skip-next:before {
  content: '\f3b4';
}
.zmdi-skip-previous:before {
  content: '\f3b5';
}
.zmdi-stop:before {
  content: '\f3b6';
}
.zmdi-surround-sound:before {
  content: '\f3b7';
}
.zmdi-tune:before {
  content: '\f3b8';
}
.zmdi-volume-down:before {
  content: '\f3b9';
}
.zmdi-volume-mute:before {
  content: '\f3ba';
}
.zmdi-volume-off:before {
  content: '\f3bb';
}
.zmdi-volume-up:before {
  content: '\f3bc';
}
.zmdi-n-1-square:before {
  content: '\f3bd';
}
.zmdi-n-2-square:before {
  content: '\f3be';
}
.zmdi-n-3-square:before {
  content: '\f3bf';
}
.zmdi-n-4-square:before {
  content: '\f3c0';
}
.zmdi-n-5-square:before {
  content: '\f3c1';
}
.zmdi-n-6-square:before {
  content: '\f3c2';
}
.zmdi-neg-1:before {
  content: '\f3c3';
}
.zmdi-neg-2:before {
  content: '\f3c4';
}
.zmdi-plus-1:before {
  content: '\f3c5';
}
.zmdi-plus-2:before {
  content: '\f3c6';
}
.zmdi-sec-10:before {
  content: '\f3c7';
}
.zmdi-sec-3:before {
  content: '\f3c8';
}
.zmdi-zero:before {
  content: '\f3c9';
}
.zmdi-airline-seat-flat-angled:before {
  content: '\f3ca';
}
.zmdi-airline-seat-flat:before {
  content: '\f3cb';
}
.zmdi-airline-seat-individual-suite:before {
  content: '\f3cc';
}
.zmdi-airline-seat-legroom-extra:before {
  content: '\f3cd';
}
.zmdi-airline-seat-legroom-normal:before {
  content: '\f3ce';
}
.zmdi-airline-seat-legroom-reduced:before {
  content: '\f3cf';
}
.zmdi-airline-seat-recline-extra:before {
  content: '\f3d0';
}
.zmdi-airline-seat-recline-normal:before {
  content: '\f3d1';
}
.zmdi-airplay:before {
  content: '\f3d2';
}
.zmdi-closed-caption:before {
  content: '\f3d3';
}
.zmdi-confirmation-number:before {
  content: '\f3d4';
}
.zmdi-developer-board:before {
  content: '\f3d5';
}
.zmdi-disc-full:before {
  content: '\f3d6';
}
.zmdi-explicit:before {
  content: '\f3d7';
}
.zmdi-flight-land:before {
  content: '\f3d8';
}
.zmdi-flight-takeoff:before {
  content: '\f3d9';
}
.zmdi-flip-to-back:before {
  content: '\f3da';
}
.zmdi-flip-to-front:before {
  content: '\f3db';
}
.zmdi-group-work:before {
  content: '\f3dc';
}
.zmdi-hd:before {
  content: '\f3dd';
}
.zmdi-hq:before {
  content: '\f3de';
}
.zmdi-markunread-mailbox:before {
  content: '\f3df';
}
.zmdi-memory:before {
  content: '\f3e0';
}
.zmdi-nfc:before {
  content: '\f3e1';
}
.zmdi-play-for-work:before {
  content: '\f3e2';
}
.zmdi-power-input:before {
  content: '\f3e3';
}
.zmdi-present-to-all:before {
  content: '\f3e4';
}
.zmdi-satellite:before {
  content: '\f3e5';
}
.zmdi-tap-and-play:before {
  content: '\f3e6';
}
.zmdi-vibration:before {
  content: '\f3e7';
}
.zmdi-voicemail:before {
  content: '\f3e8';
}
.zmdi-group:before {
  content: '\f3e9';
}
.zmdi-rss:before {
  content: '\f3ea';
}
.zmdi-shape:before {
  content: '\f3eb';
}
.zmdi-spinner:before {
  content: '\f3ec';
}
.zmdi-ungroup:before {
  content: '\f3ed';
}
.zmdi-500px:before {
  content: '\f3ee';
}
.zmdi-8tracks:before {
  content: '\f3ef';
}
.zmdi-amazon:before {
  content: '\f3f0';
}
.zmdi-blogger:before {
  content: '\f3f1';
}
.zmdi-delicious:before {
  content: '\f3f2';
}
.zmdi-disqus:before {
  content: '\f3f3';
}
.zmdi-flattr:before {
  content: '\f3f4';
}
.zmdi-flickr:before {
  content: '\f3f5';
}
.zmdi-github-alt:before {
  content: '\f3f6';
}
.zmdi-google-old:before {
  content: '\f3f7';
}
.zmdi-linkedin:before {
  content: '\f3f8';
}
.zmdi-odnoklassniki:before {
  content: '\f3f9';
}
.zmdi-outlook:before {
  content: '\f3fa';
}
.zmdi-paypal-alt:before {
  content: '\f3fb';
}
.zmdi-pinterest:before {
  content: '\f3fc';
}
.zmdi-playstation:before {
  content: '\f3fd';
}
.zmdi-reddit:before {
  content: '\f3fe';
}
.zmdi-skype:before {
  content: '\f3ff';
}
.zmdi-slideshare:before {
  content: '\f400';
}
.zmdi-soundcloud:before {
  content: '\f401';
}
.zmdi-tumblr:before {
  content: '\f402';
}
.zmdi-twitch:before {
  content: '\f403';
}
.zmdi-vimeo:before {
  content: '\f404';
}
.zmdi-whatsapp:before {
  content: '\f405';
}
.zmdi-xbox:before {
  content: '\f406';
}
.zmdi-yahoo:before {
  content: '\f407';
}
.zmdi-youtube-play:before {
  content: '\f408';
}
.zmdi-youtube:before {
  content: '\f409';
}
.zmdi-import-export:before {
  content: '\f30c';
}
.zmdi-swap-vertical-:before {
  content: '\f30c';
}
.zmdi-airplanemode-inactive:before {
  content: '\f102';
}
.zmdi-airplanemode-active:before {
  content: '\f103';
}
.zmdi-rate-review:before {
  content: '\f103';
}
.zmdi-comment-sign:before {
  content: '\f25a';
}
.zmdi-network-warning:before {
  content: '\f2ad';
}
.zmdi-shopping-cart-add:before {
  content: '\f1ca';
}
.zmdi-file-add:before {
  content: '\f221';
}
.zmdi-network-wifi-scan:before {
  content: '\f2e4';
}
.zmdi-collection-add:before {
  content: '\f14e';
}
.zmdi-format-playlist-add:before {
  content: '\f3ac';
}
.zmdi-format-queue-music:before {
  content: '\f3ab';
}
.zmdi-plus-box:before {
  content: '\f277';
}
.zmdi-tag-backspace:before {
  content: '\f1d9';
}
.zmdi-alarm-add:before {
  content: '\f32b';
}
.zmdi-battery-charging:before {
  content: '\f114';
}
.zmdi-daydream-setting:before {
  content: '\f217';
}
.zmdi-more-horiz:before {
  content: '\f19c';
}
.zmdi-book-photo:before {
  content: '\f11b';
}
.zmdi-incandescent:before {
  content: '\f189';
}
.zmdi-wb-iridescent:before {
  content: '\f38c';
}
.zmdi-calendar-remove:before {
  content: '\f330';
}
.zmdi-refresh-sync-disabled:before {
  content: '\f1b7';
}
.zmdi-refresh-sync-problem:before {
  content: '\f1b6';
}
.zmdi-crop-original:before {
  content: '\f17e';
}
.zmdi-power-off:before {
  content: '\f1af';
}
.zmdi-power-off-setting:before {
  content: '\f1ae';
}
.zmdi-leak-remove:before {
  content: '\f38d';
}
.zmdi-star-border:before {
  content: '\f27c';
}
.zmdi-brightness-low:before {
  content: '\f36d';
}
.zmdi-brightness-medium:before {
  content: '\f36e';
}
.zmdi-brightness-high:before {
  content: '\f36f';
}
.zmdi-smartphone-portrait:before {
  content: '\f2d4';
}
.zmdi-live-tv:before {
  content: '\f2d9';
}
.zmdi-format-textdirection-l-to-r:before {
  content: '\f249';
}
.zmdi-format-textdirection-r-to-l:before {
  content: '\f24a';
}
.zmdi-arrow-back:before {
  content: '\f2ea';
}
.zmdi-arrow-forward:before {
  content: '\f2ee';
}
.zmdi-arrow-in:before {
  content: '\f2e9';
}
.zmdi-arrow-out:before {
  content: '\f2ed';
}
.zmdi-rotate-90-degrees-ccw:before {
  content: '\f304';
}
.zmdi-adb:before {
  content: '\f33a';
}
.zmdi-network-wifi:before {
  content: '\f2e8';
}
.zmdi-network-wifi-alt:before {
  content: '\f2e3';
}
.zmdi-network-wifi-lock:before {
  content: '\f2e5';
}
.zmdi-network-wifi-off:before {
  content: '\f2e6';
}
.zmdi-network-wifi-outline:before {
  content: '\f2e7';
}
.zmdi-network-wifi-info:before {
  content: '\f2e4';
}
.zmdi-layers-clear:before {
  content: '\f18b';
}
.zmdi-colorize:before {
  content: '\f15d';
}
.zmdi-format-paint:before {
  content: '\f1ba';
}
.zmdi-format-quote:before {
  content: '\f1b2';
}
.zmdi-camera-monochrome-photos:before {
  content: '\f285';
}
.zmdi-sort-by-alpha:before {
  content: '\f1cf';
}
.zmdi-folder-shared:before {
  content: '\f225';
}
.zmdi-folder-special:before {
  content: '\f226';
}
.zmdi-comment-dots:before {
  content: '\f260';
}
.zmdi-reorder:before {
  content: '\f31e';
}
.zmdi-dehaze:before {
  content: '\f197';
}
.zmdi-sort:before {
  content: '\f1ce';
}
.zmdi-pages:before {
  content: '\f34a';
}
.zmdi-stack-overflow:before {
  content: '\f35c';
}
.zmdi-calendar-account:before {
  content: '\f204';
}
.zmdi-paste:before {
  content: '\f109';
}
.zmdi-cut:before {
  content: '\f1bc';
}
.zmdi-save:before {
  content: '\f297';
}
.zmdi-smartphone-code:before {
  content: '\f139';
}
.zmdi-directions-bike:before {
  content: '\f117';
}
.zmdi-directions-boat:before {
  content: '\f11a';
}
.zmdi-directions-bus:before {
  content: '\f121';
}
.zmdi-directions-car:before {
  content: '\f125';
}
.zmdi-directions-railway:before {
  content: '\f1b3';
}
.zmdi-directions-run:before {
  content: '\f215';
}
.zmdi-directions-subway:before {
  content: '\f1d5';
}
.zmdi-directions-walk:before {
  content: '\f216';
}
.zmdi-local-hotel:before {
  content: '\f178';
}
.zmdi-local-activity:before {
  content: '\f1df';
}
.zmdi-local-play:before {
  content: '\f1df';
}
.zmdi-local-airport:before {
  content: '\f103';
}
.zmdi-local-atm:before {
  content: '\f198';
}
.zmdi-local-bar:before {
  content: '\f137';
}
.zmdi-local-cafe:before {
  content: '\f13b';
}
.zmdi-local-car-wash:before {
  content: '\f124';
}
.zmdi-local-convenience-store:before {
  content: '\f1d3';
}
.zmdi-local-dining:before {
  content: '\f153';
}
.zmdi-local-drink:before {
  content: '\f157';
}
.zmdi-local-florist:before {
  content: '\f168';
}
.zmdi-local-gas-station:before {
  content: '\f16f';
}
.zmdi-local-grocery-store:before {
  content: '\f1cb';
}
.zmdi-local-hospital:before {
  content: '\f177';
}
.zmdi-local-laundry-service:before {
  content: '\f1e9';
}
.zmdi-local-library:before {
  content: '\f18d';
}
.zmdi-local-mall:before {
  content: '\f195';
}
.zmdi-local-movies:before {
  content: '\f19d';
}
.zmdi-local-offer:before {
  content: '\f187';
}
.zmdi-local-parking:before {
  content: '\f1a5';
}
.zmdi-local-parking:before {
  content: '\f1a5';
}
.zmdi-local-pharmacy:before {
  content: '\f176';
}
.zmdi-local-phone:before {
  content: '\f2be';
}
.zmdi-local-pizza:before {
  content: '\f1ac';
}
.zmdi-local-post-office:before {
  content: '\f15a';
}
.zmdi-local-printshop:before {
  content: '\f1b0';
}
.zmdi-local-see:before {
  content: '\f28c';
}
.zmdi-local-shipping:before {
  content: '\f1e6';
}
.zmdi-local-store:before {
  content: '\f1d4';
}
.zmdi-local-taxi:before {
  content: '\f123';
}
.zmdi-local-wc:before {
  content: '\f211';
}
.zmdi-my-location:before {
  content: '\f299';
}
.zmdi-directions:before {
  content: '\f1e7';
}